Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2006-05-22 14:17:52 UTC |
---|
Update Date | 2022-03-07 02:49:15 UTC |
---|
HMDB ID | HMDB0002400 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Levuglandin D2 |
---|
Description | Levuglandin D2 is one of the products of a non-enzymatically rearrangement of prostaglandin H2 (PGH2) to this highly reactive gamma-keto aldehyde. PGH2 markedly accelerates the formation of dimers and higher oligomers of amyloid beta1-42. This evidence implicates cyclooxygenase activity in the pathogenesis of Alzheimer's disease, and is associated with the formation of levuglandin adducts of the peptide. Levuglandins (LGs) and their stereo and structural isomers are extraordinarily reactive γ-ketoaldehydes that are generated by rearrangements of prostanoid endoperoxide intermediates of polyene cyclooxygenation. Their rapid adduction with biological nucleophiles results, inter alia, in pathological modifications of proteins and DNA. It also complicates their detection. Cyclooxygenase-promoted lipid oxidation is a pivotal step in the biosynthesis of an array of physiologically active metabolites. COX fosters a highly regio and stereoselective cyclooxygenation of arachidonic acid (AA) to deliver a single, enantiomerically pure endoperoxide, PGH2, that is a branch point in the biosynthesis of numerous hormone-like mediators of cellular activities. Spontaneous rearrangements of PGH2 were known to generate prostaglandins (PG) PGD2 and PGE2. (PMID: 12358806 , 15752459 , 3317517 , 10224068 ). |
---|
Structure | CCCCC[C@H](O)\C=C\[C@H]([C@@H](C\C=C/CCCC(O)=O)C=O)C(C)=O InChI=1S/C20H32O5/c1-3-4-7-11-18(23)13-14-19(16(2)22)17(15-21)10-8-5-6-9-12-20(24)25/h5,8,13-15,17-19,23H,3-4,6-7,9-12H2,1-2H3,(H,24,25)/b8-5-,14-13+/t17-,18-,19-/m0/s1 |
---|
Synonyms | Value | Source |
---|
9,10-Seco-9,11-dioxo-15S-hydroxy-5Z,13E-prostadienoate | ChEBI | 9,10-Seco-9,11-dioxo-15S-hydroxy-5Z,13E-prostadienoic acid | ChEBI | LGD2 | ChEBI | Levuglandin D2 | MeSH |
|
---|
Chemical Formula | C20H32O5 |
---|
Average Molecular Weight | 352.4651 |
---|
Monoisotopic Molecular Weight | 352.224974134 |
---|
IUPAC Name | (5Z,8R,9R,10E,12S)-9-acetyl-8-formyl-12-hydroxyheptadeca-5,10-dienoic acid |
---|
Traditional Name | levuglandin D2 |
---|
CAS Registry Number | Not Available |
---|
SMILES | CCCCC[C@H](O)\C=C\[C@H]([C@@H](C\C=C/CCCC(O)=O)C=O)C(C)=O |
---|
InChI Identifier | InChI=1S/C20H32O5/c1-3-4-7-11-18(23)13-14-19(16(2)22)17(15-21)10-8-5-6-9-12-20(24)25/h5,8,13-15,17-19,23H,3-4,6-7,9-12H2,1-2H3,(H,24,25)/b8-5-,14-13+/t17-,18-,19-/m0/s1 |
---|
InChI Key | MLLWPVVMXGUOHD-QNUMDXCLSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Fatty Acyls |
---|
Sub Class | Fatty acids and conjugates |
---|
Direct Parent | Long-chain fatty acids |
---|
Alternative Parents | |
---|
Substituents | - Long-chain fatty acid
- Branched fatty acid
- Hydroxy fatty acid
- Unsaturated fatty acid
- Ketone
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Hydrocarbon derivative
- Alcohol
- Organic oxide
- Carbonyl group
- Organic oxygen compound
- Organooxygen compound
- Aldehyde
- Aliphatic acyclic compound
|
---|
Molecular Framework | Aliphatic acyclic compounds |
---|
External Descriptors | |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | | Show more...
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Levuglandin D2,1TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O)O[Si](C)(C)C | 2742.4 | Semi standard non polar | 33892256 | Levuglandin D2,1TMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2703.3 | Semi standard non polar | 33892256 | Levuglandin D2,1TMS,isomer #3 | CCCCC[C@H](O)/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O | 2780.2 | Semi standard non polar | 33892256 | Levuglandin D2,1TMS,isomer #4 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)[C@H](C=O)C/C=C\CCCC(=O)O | 2712.9 | Semi standard non polar | 33892256 | Levuglandin D2,1TMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O | 2777.7 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2700.9 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #2 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O)O[Si](C)(C)C | 2830.8 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #3 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O | 2727.1 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #4 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O)O[Si](C)(C)C | 2789.8 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #5 | CCCCC[C@H](O)/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2773.1 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #6 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2706.3 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2737.4 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #8 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C | 2958.9 | Semi standard non polar | 33892256 | Levuglandin D2,2TMS,isomer #9 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O | 2809.3 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2792.3 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2669.4 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2847.1 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2673.0 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2621.8 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C | 2827.5 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2744.8 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2600.5 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2934.9 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 2978.6 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 2569.3 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 3188.3 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #5 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O | 2805.2 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #5 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O | 2560.7 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #5 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O | 3189.2 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C | 2938.8 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C | 2653.0 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C | 3261.8 | Standard polar | 33892256 | Levuglandin D2,3TMS,isomer #7 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2775.0 | Semi standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #7 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2619.6 | Standard non polar | 33892256 | Levuglandin D2,3TMS,isomer #7 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 3298.9 | Standard polar | 33892256 | Levuglandin D2,4TMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 2924.1 | Semi standard non polar | 33892256 | Levuglandin D2,4TMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 2616.7 | Standard non polar | 33892256 | Levuglandin D2,4TMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C)=C(C)O[Si](C)(C)C)O[Si](C)(C)C | 2919.1 | Standard polar | 33892256 | Levuglandin D2,4TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2765.2 | Semi standard non polar | 33892256 | Levuglandin D2,4TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2621.2 | Standard non polar | 33892256 | Levuglandin D2,4TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)C(=CO[Si](C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C | 2900.0 | Standard polar | 33892256 | Levuglandin D2,1TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 2977.5 | Semi standard non polar | 33892256 | Levuglandin D2,1TBDMS,isomer #2 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 2956.1 | Semi standard non polar | 33892256 | Levuglandin D2,1TBDMS,isomer #3 | CCCCC[C@H](O)/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O | 3020.4 | Semi standard non polar | 33892256 | Levuglandin D2,1TBDMS,isomer #4 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)[C@H](C=O)C/C=C\CCCC(=O)O | 2949.3 | Semi standard non polar | 33892256 | Levuglandin D2,1TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O | 2985.6 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #1 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3211.3 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #2 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 3271.7 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O | 3192.2 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #4 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 3199.5 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #5 | CCCCC[C@H](O)/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3242.1 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #6 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3168.0 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #7 | CCCCC[C@H](O)/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3171.6 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #8 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C(C)(C)C | 3399.1 | Semi standard non polar | 33892256 | Levuglandin D2,2TBDMS,isomer #9 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O | 3238.1 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3482.7 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3183.3 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(=C(C)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3048.7 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3393.5 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3127.3 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[C@H](C=O)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3011.0 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3406.1 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3100.3 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #3 | CCCCC[C@@H](/C=C/[C@@H](C(C)=O)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3105.4 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3623.8 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3062.9 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #4 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3357.8 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #5 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O | 3454.3 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #5 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O | 3063.1 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #5 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O | 3333.4 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C | 3597.9 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C | 3152.0 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #6 | CCCCC[C@H](O)/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C | 3424.3 | Standard polar | 33892256 | Levuglandin D2,3TBDMS,isomer #7 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3451.7 | Semi standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #7 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3118.1 | Standard non polar | 33892256 | Levuglandin D2,3TBDMS,isomer #7 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCC)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3425.3 | Standard polar | 33892256 | Levuglandin D2,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3802.0 | Semi standard non polar | 33892256 | Levuglandin D2,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3267.5 | Standard non polar | 33892256 | Levuglandin D2,4TBDMS,isomer #1 | CCCCC[C@@H](/C=C/C(C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)=C(C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3174.8 | Standard polar | 33892256 | Levuglandin D2,4TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3637.7 | Semi standard non polar | 33892256 | Levuglandin D2,4TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3274.6 | Standard non polar | 33892256 | Levuglandin D2,4TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C | 3142.1 | Standard polar | 33892256 |
| Show more...
---|