Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2006-08-13 05:44:14 UTC
Update Date2021-09-14 15:47:10 UTC
HMDB IDHMDB0003841
Secondary Accession Numbers
  • HMDB03841
Metabolite Identification
Common Name5-Amino-6-(5'-phosphoribitylamino)uracil
Description5-Amino-6-(5'-phosphoribitylamino)uracil belongs to the class of organic compounds known as monosaccharide phosphates. These are monosaccharides comprising a phosphated group linked to the carbohydrate unit. 5-Amino-6-(5'-phosphoribitylamino)uracil is an extremely weak basic (essentially neutral) compound (based on its pKa). 5-Amino-6-(5'-phosphoribitylamino)uracil has been detected, but not quantified in, several different foods, such as sapodilla, kumquats, sacred lotus, Persian limes, and Cascade huckleberries. This could make 5-amino-6-(5'-phosphoribitylamino)uracil a potential biomarker for the consumption of these foods. 5-Amino-6-(5'-phosphoribitylamino)uracil is an intermediate in riboflavin metabolism. 5-Amino-6-(5'-phosphoribitylamino)uracil is the third to last step in the synthesis of 7-hydroxy-6-methyl-8-ribityl lumazine and is converted from 5-amino-6-(5'-phosphoribosylamino)uracil via the enzyme 5-amino-6-(5-phosphoribosylamino)uracil reductase (EC 1.1.1.193). It is then converted into 4-(1-D-ribitylamino)-5-amino-2,6-dihydroxypyrimidine via a hydrolase enzyme (EC 3.1.3.- ).
Structure
Data?1583854706
Synonyms
ValueSource
5-Amino-2,6-dioxy-4-(5'-phospho-D-ribitylamino)pyrimidineChEBI
5-Amino-2,6-dioxy-4-(5'-phosphoribitylamino)pyrimidineChEBI
5-Amino-6-(5-phosphoribitylamino)uracilChEBI
5-Amino-6-(5-phospho-D-ribitylamino)uracilKegg
5-Amino-2,6-dioxy-4-(5’-phospho-D-ribitylamino)pyrimidineHMDB
5-Amino-6-(5'-phospho-D-ribitylamino)uracilHMDB
5-Amino-6-(5’-phospho-D-ribitylamino)uracilHMDB
5-Amino-6-(5’-phosphoribitylamino)uracilHMDB
5-Amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione-5'-phosphateHMDB
5-Amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione-5’-phosphateHMDB
5-Amino-6-(5'-phosphoribitylamino)uracilChEBI
Chemical FormulaC9H17N4O9P
Average Molecular Weight356.2264
Monoisotopic Molecular Weight356.073314674
IUPAC Name{[(2R,3S,4S)-5-[(5-amino-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl]oxy}phosphonic acid
Traditional Name[(2R,3S,4S)-5-[(5-amino-2,6-dioxo-1,3-dihydropyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl]oxyphosphonic acid
CAS Registry Number71491-01-5
SMILES
NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)NC(=O)NC1=O
InChI Identifier
InChI=1S/C9H17N4O9P/c10-5-7(12-9(18)13-8(5)17)11-1-3(14)6(16)4(15)2-22-23(19,20)21/h3-4,6,14-16H,1-2,10H2,(H2,19,20,21)(H3,11,12,13,17,18)/t3-,4+,6-/m0/s1
InChI KeyRQRINYISXYAZKL-RPDRRWSUSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as monosaccharide phosphates. These are monosaccharides comprising a phosphated group linked to the carbohydrate unit.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentMonosaccharide phosphates
Alternative Parents
Substituents
  • Monosaccharide phosphate
  • Aminopyrimidine
  • Monoalkyl phosphate
  • Pyrimidone
  • Secondary aliphatic/aromatic amine
  • Hydropyrimidine
  • Organic phosphoric acid derivative
  • Phosphoric acid ester
  • Pyrimidine
  • Alkyl phosphate
  • Heteroaromatic compound
  • Vinylogous amide
  • Lactam
  • Urea
  • Secondary alcohol
  • Organoheterocyclic compound
  • Polyol
  • Azacycle
  • Secondary amine
  • Primary amine
  • Organonitrogen compound
  • Hydrocarbon derivative
  • Organic oxide
  • Alcohol
  • Organopnictogen compound
  • Amine
  • Organic nitrogen compound
  • Aromatic heteromonocyclic compound
Molecular FrameworkAromatic heteromonocyclic compounds
External Descriptors
Ontology
Disposition

Source

Route of exposure

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility2.89 g/LALOGPS
logP10(-2.5) g/LALOGPS
logP10(-4.5) g/LChemAxon
logS10(-2.1) g/LALOGPS
pKa (Strongest Acidic)1.49ChemAxon
pKa (Strongest Basic)-2.7ChemAxon
Physiological Charge-2ChemAxon
Hydrogen Acceptor Count10ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area223.7 ŲChemAxon
Rotatable Bond Count8ChemAxon
Refractivity82.36 m³·mol⁻¹ChemAxon
Polarizability30.06 ųChemAxon
Number of Rings1ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+176.03330932474
DeepCCS[M-H]-173.44730932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
5-Amino-6-(5'-phosphoribitylamino)uracilNC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)NC(=O)NC1=O3985.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracilNC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)NC(=O)NC1=O2814.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracilNC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)NC(=O)NC1=O3991.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3108.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #2C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O3096.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #3C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13133.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #4C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13283.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #5C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3267.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #6C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)[NH]C(=O)[NH]13138.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #7C[Si](C)(C)N1C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C(=O)[NH]C1=O3126.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TMS,isomer #8C[Si](C)(C)N1C(=O)[NH]C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C1=O3177.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O2992.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #10C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3127.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #11C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O2994.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #12C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3004.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #13C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O3071.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #14C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13135.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #15C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3163.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #16C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3030.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #17C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3035.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #18C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13110.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #19C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C3240.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #2C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3001.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #20C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3292.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #21C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3186.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #22C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3187.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #23C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13249.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #24C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O)[Si](C)(C)C3248.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #25C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3173.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #26C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O3187.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #27C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O3228.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #28C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3168.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #29C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13173.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #3C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3123.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #30C[Si](C)(C)N1C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C(=O)N([Si](C)(C)C)C1=O3183.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #4C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3128.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #5C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3020.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3038.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #7C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3098.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #8C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3010.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TMS,isomer #9C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3108.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2987.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3002.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3026.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #12C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3140.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3148.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3051.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #15C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3102.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #16C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3148.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3097.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3058.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O3120.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #2C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3066.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #20C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O3165.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #21C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3082.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #22C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3095.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3118.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #24C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3079.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #25C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3078.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #26C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2959.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #27C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2994.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #28C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3042.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #29C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3135.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #3C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3060.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #30C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3143.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #31C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3041.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #32C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3080.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #33C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3117.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #34C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O3114.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3033.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O3095.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O3151.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #38C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3061.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #39C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3055.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #4C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O2952.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #40C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3068.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #41C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13149.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #42C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3170.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #43C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3052.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #44C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3088.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #45C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13151.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #46C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13126.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #47C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3061.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #48C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3117.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3177.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3005.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #50C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3077.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #51C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3090.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #52C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3111.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #53C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3257.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #54C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3131.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #55C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3162.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #56C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)O[Si](C)(C)C3226.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #57C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13258.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3190.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #59C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3235.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3022.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3285.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #61C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3210.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #62C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3231.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #63C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3246.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #64C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13116.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #65C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O)[Si](C)(C)C3209.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #66C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O)[Si](C)(C)C3264.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #67C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3206.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3217.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #69C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3249.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #7C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3067.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #70C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3261.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3060.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TMS,isomer #9C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2957.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3072.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C2932.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5600.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3099.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C2968.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5453.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #100C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3199.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #100C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3167.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #100C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C5148.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #101C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3196.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #101C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3131.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #101C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C5144.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #102C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3243.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #102C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3112.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #102C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C5286.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #103C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3153.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #103C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3323.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #103C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C4547.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #104C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3247.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #104C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3363.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #104C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C4642.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #105C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13280.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #105C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13322.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #105C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]14680.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #106C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3227.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #106C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3336.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #106C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4894.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3250.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3260.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4846.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #108C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3309.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #108C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3246.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #108C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4904.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #109C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3278.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #109C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3174.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #109C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C5226.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3099.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3240.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4890.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #110C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3242.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #110C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3447.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #110C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C4867.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #111C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13228.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #111C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13399.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #111C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]14906.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #112C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O)[Si](C)(C)C3310.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #112C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O)[Si](C)(C)C3421.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #112C[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O)[Si](C)(C)C5045.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3279.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3383.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O5106.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3033.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3220.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5291.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O3117.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O3184.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)[NH]C1=O5279.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #14C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O3118.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #14C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O3134.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #14C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C)C1=O5249.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3072.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3139.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O5569.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3061.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3092.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O5567.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3083.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3050.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O5704.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #18C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3099.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #18C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2963.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #18C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5413.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3104.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3092.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O5199.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3060.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3108.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O5506.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #20C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3040.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #20C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3040.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #20C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5424.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3090.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3025.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5528.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #22C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3092.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #22C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C2989.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #22C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5492.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3093.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3254.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4942.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #24C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3032.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #24C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3231.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #24C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5342.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #25C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3113.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #25C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3196.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #25C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5336.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #26C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3118.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #26C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3143.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #26C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5299.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3074.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3147.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5612.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #28C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3064.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #28C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3101.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #28C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5608.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #29C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3078.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #29C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3066.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #29C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5746.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2978.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3053.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5711.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #30C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3155.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #30C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3137.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #30C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4993.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3083.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3064.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5246.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3133.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3052.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5346.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3128.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3018.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5311.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3157.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3266.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4643.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3096.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3224.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5042.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3191.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3192.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5025.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3208.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3139.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4985.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3142.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3140.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C5329.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3135.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3093.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C5324.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3044.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3020.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5817.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3182.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3076.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C5454.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3045.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3328.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4830.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #42C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3142.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #42C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3370.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #42C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4938.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3159.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3334.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O4977.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #44C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3116.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #44C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3353.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #44C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5207.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3141.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3269.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5165.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #46C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3194.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #46C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3246.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #46C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O5237.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3179.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3173.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O5514.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3120.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2943.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5402.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3129.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3075.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O5147.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3049.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C2984.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5784.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3043.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3036.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5396.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #51C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3099.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #51C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3007.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #51C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5514.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #52C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3111.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #52C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C2971.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #52C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5477.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #53C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3108.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #53C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3231.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #53C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4932.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3039.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3219.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5299.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #55C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3102.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #55C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3179.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #55C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5292.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #56C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3131.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #56C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3129.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #56C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5246.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3069.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3144.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5582.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #58C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3061.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #58C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3099.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #58C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5579.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3081.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3055.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5731.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3111.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2941.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5376.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3164.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3091.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4887.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3092.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3045.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5169.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3141.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3017.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5284.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #63C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3136.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #63C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2981.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #63C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5249.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3183.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3213.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C4579.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3107.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3189.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4953.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #66C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3181.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #66C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3146.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #66C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4931.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3198.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3095.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4880.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3127.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3120.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5254.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3120.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3074.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5249.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3119.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3073.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O5154.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3156.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3041.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5396.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3065.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3304.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O4759.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3148.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3326.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O4866.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O3163.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O3289.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O4909.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #74C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3112.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #74C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3321.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #74C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5113.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #75C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3127.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #75C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3243.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #75C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5070.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #76C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3173.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #76C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3209.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #76C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O5138.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3158.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3156.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O5440.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #78C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3166.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #78C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3131.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #78C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4976.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #79C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3081.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #79C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3070.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #79C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C5258.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3038.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3024.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5384.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #80C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3133.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #80C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C3055.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #80C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C5373.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #81C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13143.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #81C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]13024.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #81C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]15336.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #82C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13174.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #82C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13247.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #82C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]14677.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #83C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3096.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #83C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3212.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #83C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5046.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #84C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3185.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #84C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3183.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #84C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5026.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #85C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3223.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #85C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3135.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #85C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4975.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #86C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3129.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #86C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3139.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #86C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C5341.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #87C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3128.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #87C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3097.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #87C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C5335.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #88C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3176.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #88C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3077.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #88C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C5482.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #89C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3047.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #89C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3324.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #89C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C4863.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3103.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3003.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5488.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #90C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3148.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #90C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3356.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #90C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C4972.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #91C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13173.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #91C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13321.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #91C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]15013.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #92C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3113.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #92C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3339.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #92C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5217.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #93C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3141.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #93C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3263.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #93C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5172.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #94C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3190.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #94C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3238.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #94C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O5242.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #95C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3170.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #95C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3173.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #95C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C5525.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #96C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C3213.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #96C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C3289.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #96C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C4424.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #97C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3156.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #97C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3262.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #97C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4816.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #98C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3232.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #98C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3234.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #98C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4784.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #99C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3279.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #99C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3184.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TMS,isomer #99C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4732.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3134.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2907.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5305.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3119.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3107.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5409.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #100C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3204.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #100C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3333.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #100C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O4506.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #101C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3268.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #101C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O3331.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #101C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O4644.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #102C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3247.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #102C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3303.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #102C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4729.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13217.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]13210.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]14212.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #104C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3133.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #104C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3172.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #104C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4633.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #105C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3218.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #105C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3145.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #105C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4594.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #106C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3228.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #106C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3114.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #106C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4530.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #107C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3181.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #107C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3113.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #107C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C4988.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3181.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3082.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C4984.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #109C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3213.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #109C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3048.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #109C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C5122.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #11C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3115.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #11C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3071.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #11C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5408.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #110C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3134.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #110C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3259.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #110C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C4303.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #111C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3242.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #111C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3284.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #111C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C4398.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #112C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13253.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #112C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13254.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #112C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]14441.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3184.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3256.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #113C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4680.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #114C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3199.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #114C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3198.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #114C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4617.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #115C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3282.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #115C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3177.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #115C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4678.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #116C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3233.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #116C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3133.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #116C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C5036.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #117C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3210.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #117C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3388.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #117C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C4573.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #118C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3182.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #118C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3350.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #118C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C4611.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #119C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3261.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #119C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3357.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #119C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C4752.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #12C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3147.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #12C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3019.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #12C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5543.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #120C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3238.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #120C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3318.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #120C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4834.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #121C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3155.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #121C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3285.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #121C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C4096.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #122C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3275.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #122C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3318.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #122C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)O[Si](C)(C)C4182.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #123C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)O[Si](C)(C)C3284.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #123C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)O[Si](C)(C)C3285.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #123C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)O[Si](C)(C)C4224.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #124C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3246.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #124C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3280.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #124C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4462.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #125C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3259.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #125C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3226.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #125C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4397.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #126C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3343.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #126C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3205.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #126C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4453.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #127C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3288.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #127C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3150.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #127C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C4855.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #128C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3298.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #128C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3385.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #128C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C4322.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #129C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3278.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #129C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3342.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #129C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C4356.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3159.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3054.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4775.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #130C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3357.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #130C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3356.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #130C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C4482.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #131C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3318.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #131C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3311.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #131C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4560.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #132C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3362.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #132C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3451.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #132C[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C4688.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3087.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3005.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5057.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #15C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3164.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #15C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2977.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #15C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5159.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #16C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3157.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #16C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2951.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #16C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5123.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3194.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3175.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4331.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3128.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3139.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4789.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3211.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3104.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #19C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4753.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3142.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3047.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #2C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O5013.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #20C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3196.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #20C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3073.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #20C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4707.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #21C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3165.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #21C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3081.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #21C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5108.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #22C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3158.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #22C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3047.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #22C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5107.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3199.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3008.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #23C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C5235.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3098.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3264.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4438.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3185.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3291.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4539.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #26C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3183.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #26C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3272.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #26C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4595.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #27C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3149.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #27C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3269.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #27C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4869.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #28C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3151.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #28C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3209.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #28C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4814.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #29C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3235.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #29C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3175.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #29C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4883.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3076.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3003.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #3C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5275.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3203.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3129.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O5242.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3142.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3076.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4815.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3080.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3021.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5093.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3150.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3001.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5192.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3149.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2976.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #34C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5154.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3185.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3196.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4375.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3121.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3156.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4828.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3192.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3126.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #37C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4802.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #38C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3181.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #38C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3094.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #38C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4748.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3158.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3096.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5143.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3141.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C2972.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5378.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #40C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3154.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #40C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3062.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #40C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5139.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #41C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3186.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #41C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3030.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #41C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5267.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3092.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3274.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4485.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3179.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3307.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4598.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #44C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3176.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #44C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3286.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #44C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4645.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3146.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3279.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #45C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4921.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3150.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3220.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4859.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #47C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3229.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #47C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3191.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #47C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4937.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #48C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3200.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #48C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3142.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #48C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5279.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #49C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3203.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #49C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3228.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #49C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4184.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3138.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C2946.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5340.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #50C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3141.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #50C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3178.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #50C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4636.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #51C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3228.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #51C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3150.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #51C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4603.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #52C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3230.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #52C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3117.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #52C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4551.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #53C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3197.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #53C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3109.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #53C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4976.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #54C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3192.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #54C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3076.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #54C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4973.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #55C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3220.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #55C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3050.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #55C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5101.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #56C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3138.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #56C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3260.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #56C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4269.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3245.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3300.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4368.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #58C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3248.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #58C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3273.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #58C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4408.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3198.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3268.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4673.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3140.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3209.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #6C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4601.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #60C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3209.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #60C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3204.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #60C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4612.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #61C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3291.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #61C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3182.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #61C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4680.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3252.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3127.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C5026.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3216.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3393.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4536.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #64C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3187.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #64C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3350.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #64C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4574.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #65C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3262.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #65C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3370.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #65C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4718.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #66C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3246.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #66C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3326.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #66C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4824.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3175.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3048.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #67C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4748.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3088.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3012.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #68C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5069.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3169.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2977.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #69C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5183.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #7C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3083.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #7C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3174.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #7C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O5075.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3170.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2951.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #70C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5145.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3205.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3161.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4369.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #72C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3132.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #72C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3141.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #72C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4791.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #73C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3201.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #73C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3100.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #73C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4759.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #74C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3199.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #74C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3068.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #74C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4695.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3157.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3088.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5118.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3158.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3055.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5115.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3197.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3011.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #77C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5255.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #78C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3100.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #78C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3269.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #78C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4476.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #79C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3182.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #79C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3285.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #79C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4583.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3159.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3136.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O5052.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3185.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3259.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4636.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #81C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3146.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #81C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3266.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #81C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4882.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #82C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3153.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #82C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3213.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #82C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4821.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #83C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3222.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #83C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3174.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #83C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4891.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #84C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3198.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #84C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3135.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #84C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5253.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3228.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3172.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4121.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #86C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3139.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #86C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3151.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #86C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4544.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #87C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3232.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #87C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3108.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #87C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4503.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #88C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3233.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #88C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3075.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #88C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4441.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #89C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3187.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #89C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3094.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #89C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4901.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #9C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3147.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #9C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3104.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #9C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O5007.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #90C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3185.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #90C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3061.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #90C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4898.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3216.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3018.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C5039.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3157.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3237.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4207.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3253.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3251.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4299.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3266.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C3219.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C4344.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3198.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3236.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4586.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #96C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3216.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #96C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3177.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #96C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4522.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #97C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3286.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #97C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3141.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #97C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4579.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #98C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3244.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #98C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3115.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #98C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4955.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #99C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3235.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #99C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3374.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,5TMS,isomer #99C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O4466.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #1C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3191.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #1C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O3040.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #1C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)[NH]C1=O4654.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3208.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3032.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #10C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5003.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #100C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3253.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #100C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3215.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #100C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4279.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #101C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3271.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #101C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3174.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #101C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4201.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #102C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3342.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #102C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3162.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #102C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4249.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3295.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3115.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #103C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C4712.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #104C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3305.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #104C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3330.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #104C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C4080.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #105C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3287.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #105C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3296.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #105C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C4108.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #106C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3369.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #106C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3296.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #106C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C4224.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3324.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3258.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #107C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4324.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3346.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3415.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #108C[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C4383.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #109C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3340.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #109C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3342.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #109C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3925.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3256.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3006.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #11C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5126.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #110C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3321.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #110C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3308.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #110C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3949.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #111C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3406.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #111C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C3315.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #111C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)O[Si](C)(C)C4055.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #112C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3381.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #112C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3269.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #112C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4148.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #113C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3414.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #113C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3392.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #113C[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C4188.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #12C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3167.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #12C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3239.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #12C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4172.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #13C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3256.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #13C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3254.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #13C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4266.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #14C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3245.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #14C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3243.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #14C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4317.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #15C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3213.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #15C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3226.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #15C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4629.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #16C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3219.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #16C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3185.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #16C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4558.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #17C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3293.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #17C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3155.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #17C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4618.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #18C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3256.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #18C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3113.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #18C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C5084.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #19C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3239.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #19C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3157.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #19C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3926.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #2C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3143.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #2C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2981.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #2C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4990.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #20C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3166.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #20C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3115.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #20C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4414.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #21C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3256.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #21C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3093.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #21C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4358.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #22C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3246.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #22C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3074.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #22C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4303.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #23C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3222.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #23C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3064.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #23C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4798.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3226.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3035.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #24C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4796.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3265.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3006.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #25C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4920.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3200.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3202.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3973.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #27C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3299.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #27C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3226.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #27C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4055.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3304.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3208.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4100.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3245.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3199.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4398.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #3C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3208.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #3C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2961.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #3C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5092.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #30C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3260.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #30C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3154.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #30C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4326.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3343.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3133.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #31C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4379.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3295.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3097.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #32C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4814.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #33C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3273.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #33C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3343.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #33C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4171.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #34C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3250.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #34C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3311.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #34C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4207.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3327.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3307.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #35C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4331.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3302.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3273.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #36C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4463.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #37C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3230.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #37C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3180.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #37C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3962.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #38C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3153.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #38C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3130.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #38C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4447.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #39C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3237.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #39C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3116.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #39C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4402.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3211.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2937.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #4C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C5055.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #40C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3232.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #40C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3096.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #40C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4340.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3214.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3077.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #41C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4832.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3217.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3049.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4828.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3252.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3023.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #43C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4952.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3195.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3218.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4007.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3290.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3250.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4099.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #46C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3298.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #46C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3231.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #46C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4136.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #47C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3238.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #47C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3212.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #47C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4439.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #48C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3253.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #48C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3168.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #48C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4362.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3325.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3154.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #49C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4426.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3240.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3153.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #5C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4124.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #50C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3287.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #50C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3111.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #50C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4847.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #51C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3268.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #51C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3354.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #51C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4215.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #52C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3246.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #52C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3324.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #52C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4245.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #53C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3321.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #53C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3325.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #53C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4381.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3297.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3284.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #54C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4509.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #55C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3196.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #55C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3227.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #55C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3868.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #56C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3304.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #56C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3268.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #56C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3953.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3310.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3247.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #57C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3988.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3269.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3222.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4277.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3284.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3179.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #59C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4201.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #6C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3170.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #6C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3108.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #6C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4625.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3352.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3170.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #60C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4260.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #61C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3315.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #61C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3113.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #61C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4700.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3319.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3332.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #62C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4050.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3299.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3293.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #63C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4076.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #64C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3374.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #64C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3311.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #64C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C4198.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3341.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3264.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #65C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4317.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #66C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3358.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #66C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3414.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #66C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4350.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #67C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3257.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #67C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3137.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #67C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3944.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3164.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3115.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4402.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #69C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3261.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #69C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3085.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #69C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4348.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3241.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3086.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #7C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4575.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #70C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3254.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #70C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3065.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #70C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4276.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3216.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3066.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #71C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4811.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3223.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3038.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #72C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4808.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3266.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3003.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #73C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4941.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #74C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3199.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #74C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3206.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #74C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4005.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3296.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3213.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #75C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4089.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3308.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3188.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #76C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4130.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #77C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3238.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #77C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3194.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #77C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4407.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #78C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3258.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #78C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3154.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #78C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4330.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #79C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3330.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #79C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3127.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #79C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4381.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3230.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3070.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #8C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4519.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3286.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3100.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #80C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4824.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #81C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3273.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #81C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3346.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #81C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4208.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #82C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3251.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #82C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3316.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #82C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4242.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #83C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3319.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #83C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3299.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #83C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4369.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #84C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3299.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #84C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3270.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #84C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4475.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3203.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3212.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #85C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3816.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #86C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3312.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #86C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3220.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #86C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3891.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #87C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3330.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #87C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3194.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #87C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3930.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #88C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3264.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #88C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3200.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #88C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4194.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #89C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3286.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #89C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3159.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #89C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4118.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #9C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3209.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #9C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3063.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #9C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C5003.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #90C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3355.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #90C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3135.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #90C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4165.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3308.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3101.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #91C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4625.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3331.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3314.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #92C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3996.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3316.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3279.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #93C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4025.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3388.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3266.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #94C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C4137.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3341.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3243.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #95C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4237.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #96C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3370.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #96C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O3400.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #96C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O4292.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #97C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3189.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #97C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3228.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #97C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C3896.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #98C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3298.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #98C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3252.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #98C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C3974.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #99C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13314.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #99C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]13227.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,6TMS,isomer #99C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]14010.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3295.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3135.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #1C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3809.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3363.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3195.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #10C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3919.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #11C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3306.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #11C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3178.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #11C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4224.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3320.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3150.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #12C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4143.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3383.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3143.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #13C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4195.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3345.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3098.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #14C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4710.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3346.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3320.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #15C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3958.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3320.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3297.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #16C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3985.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3400.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3292.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #17C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4101.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3372.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3260.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #18C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4248.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #19C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3261.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #19C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3187.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #19C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3655.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #2C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3229.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #2C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O3095.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #2C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)[NH]C1=O4310.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #20C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3354.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #20C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3215.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #20C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3720.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3362.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3200.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #21C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3760.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #22C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3315.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #22C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3181.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #22C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4053.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #23C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3321.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #23C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3152.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #23C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3976.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #24C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3382.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #24C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3140.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #24C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4023.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #25C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3350.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #25C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3092.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #25C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4531.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3376.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3289.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #26C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3802.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3352.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3260.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #27C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3826.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3439.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3266.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #28C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3928.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3393.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3233.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #29C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4064.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #3C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3297.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #3C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3089.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #3C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4243.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3425.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O3377.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #30C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O)O4051.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3248.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3203.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #31C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3682.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3343.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3237.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #32C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3758.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3355.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3222.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #33C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3790.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #34C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3302.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #34C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3194.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #34C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4089.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3309.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3165.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #35C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4005.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3365.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3158.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #36C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4062.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #37C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3341.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #37C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3105.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #37C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4564.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3369.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3305.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #38C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3837.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3349.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3275.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #39C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3855.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #4C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3292.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #4C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3075.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #4C[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O4181.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3430.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3287.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #40C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3968.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #41C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3386.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #41C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3246.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #41C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4099.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3419.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3392.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #42C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4088.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #43C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3381.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #43C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3309.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #43C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3727.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3363.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3279.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #44C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3744.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3438.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3296.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #45C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3852.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3416.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3250.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #46C[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3979.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3450.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3361.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #47C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C3958.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3256.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3189.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #48C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3668.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #49C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3353.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #49C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3201.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #49C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3737.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #5C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3273.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #5C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3058.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #5C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4735.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3373.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3180.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #50C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3772.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #51C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3310.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #51C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O3177.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #51C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)[NH]C1=O4048.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #52C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3320.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #52C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3149.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #52C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(=O)N([Si](C)(C)C)C1=O3964.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #53C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3382.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #53C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3134.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #53C[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4010.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #54C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3343.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #54C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3095.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #54C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4544.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #55C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3371.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #55C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3290.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #55C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3832.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #56C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3351.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #56C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3262.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #56C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3855.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3432.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3253.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #57C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3957.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3386.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3231.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #58C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O4073.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3422.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C3379.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #59C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C4085.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #6C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3273.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #6C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3033.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #6C[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4734.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #60C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3388.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #60C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3295.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #60C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3680.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3371.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3265.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #61C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3701.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3453.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3258.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #62C[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3797.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #63C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3407.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #63C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3234.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #63C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3907.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3464.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3348.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #64C[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C3910.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #65C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3369.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #65C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3308.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #65C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[Si](C)(C)C3749.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #66C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3353.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #66C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3278.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #66C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)[NH]1)[Si](C)(C)C3769.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #67C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3432.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #67C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3281.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #67C[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C3869.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3397.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3245.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #68C[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(=O)N([Si](C)(C)C)C1=O3981.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #69C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3435.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #69C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3360.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #69C[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C3987.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #7C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3313.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #7C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3019.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #7C[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4856.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #70C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3474.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #70C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3365.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #70C[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C)[Si](C)(C)C)O[Si](C)(C)C3858.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3266.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3185.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #8C[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3802.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3357.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3210.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,7TMS,isomer #9C[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3876.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3363.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O3356.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13369.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13533.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3501.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)[NH]C(=O)[NH]13387.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)N1C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C(=O)[NH]C1=O3370.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)N1C(=O)[NH]C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C1=O3423.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3455.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3567.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3486.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3519.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O3553.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13610.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3569.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3482.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3519.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13548.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C(C)(C)C3712.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3451.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3723.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3627.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3659.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13690.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O)[Si](C)(C)C(C)(C)C3660.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3574.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3630.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3664.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3643.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13635.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3611.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)N1C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3605.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3556.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3476.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3533.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3548.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3476.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3619.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3677.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3727.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3711.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3832.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3836.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3761.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3825.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3828.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O3745.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3683.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3782.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3791.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3797.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3784.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3778.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3797.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3802.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3734.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3661.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3732.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3735.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3841.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)[NH]C1=O3720.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3850.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3763.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3811.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3837.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O3772.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3699.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3791.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3822.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3786.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3792.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3652.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3794.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]13844.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3842.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3758.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3816.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13835.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]13767.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3687.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3771.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3794.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3738.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3776.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C3773.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C3785.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3906.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3834.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3875.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)O[Si](C)(C)C(C)(C)C3897.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]13905.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3815.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3887.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3724.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3926.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3878.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C3886.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C3893.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]13757.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O)[Si](C)(C)C(C)(C)C3884.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O)[Si](C)(C)C(C)(C)C3889.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3831.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3837.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3890.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3777.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C3883.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3710.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3646.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3976.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3597.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5617.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3996.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3662.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5458.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4070.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3779.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5213.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4072.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3763.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5203.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4083.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3722.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5295.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C4003.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3951.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C4609.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4121.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3973.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4649.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14127.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13958.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14714.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #106CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4055.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #106CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3948.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #106CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4911.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #107CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4068.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #107CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3916.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #107CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4850.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #108CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4139.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #108CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3886.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #108CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4854.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #109CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4120.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #109CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3800.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #109CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C5234.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3943.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3901.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4838.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #110CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4104.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #110CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4068.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #110CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4818.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #111CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14060.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #111CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14062.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #111CC(C)(C)[Si](C)(C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14844.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #112CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O)[Si](C)(C)C(C)(C)C4154.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #112CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O)[Si](C)(C)C(C)(C)C4051.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #112CC(C)(C)[Si](C)(C)N(C1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O)[Si](C)(C)C(C)(C)C4917.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #113CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4101.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #113CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4024.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #113CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O5004.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3884.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3879.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5210.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4007.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3855.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5144.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3998.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3825.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O5117.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3977.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3814.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O5527.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3971.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3797.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O5521.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4001.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3750.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O5602.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3981.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3586.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5483.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4003.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3748.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5204.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3926.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3766.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5393.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3932.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3718.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5459.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3995.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3710.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5512.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3977.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3682.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5485.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3931.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3916.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C4874.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3870.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3893.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5244.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3996.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3873.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5187.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3983.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3840.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O5152.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3969.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3825.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5558.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3958.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3808.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5549.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3989.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3766.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5632.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3879.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3743.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5681.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4038.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3728.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5069.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3971.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3692.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5330.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4017.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3685.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5385.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4006.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3657.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5359.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4017.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3893.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4689.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3946.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3858.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5056.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4063.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3842.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4993.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4073.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3811.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4957.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4024.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3794.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5345.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4021.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3777.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5336.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3949.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3726.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5738.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4048.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3742.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5415.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3917.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3984.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4776.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4045.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4014.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4824.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O4030.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O4007.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)[C@H](O)COP(=O)(O)O4891.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3983.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3991.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5105.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3983.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3956.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O5043.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4072.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3924.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O5065.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O4059.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O3827.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)COP(=O)(O)O5446.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4018.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3566.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5470.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4031.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3730.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5159.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3920.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3700.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5713.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3943.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3712.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5437.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4005.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3695.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5499.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4005.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3663.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5472.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3962.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3892.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C4867.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3887.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3886.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5221.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3994.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3856.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5150.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4003.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3826.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O5111.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3977.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3821.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5536.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3976.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3806.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5529.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3990.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C3754.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C5619.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3998.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3566.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)[NH]1)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5452.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4068.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3690.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4982.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3963.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3675.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5267.7Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4018.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3655.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5332.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4030.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3624.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C5306.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4055.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3849.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4637.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3966.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3839.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4994.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4075.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3809.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4915.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4101.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3775.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4876.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4029.9Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3775.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5285.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4042.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3758.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5277.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4019.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3724.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5167.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4053.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3712.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5364.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3946.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3972.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4725.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4064.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3984.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4769.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O4067.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O3971.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[C@H](O)COP(=O)(O)O4840.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4009.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3970.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5041.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4022.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3941.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4982.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4085.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3898.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4989.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O4075.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O3813.1Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)O[C@@H]([C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O5388.8Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4038.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3730.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5055.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3972.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3700.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C5340.6Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3941.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3700.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H](CN(C1=C(N)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5431.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4008.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C3691.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C5404.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14010.2Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13664.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]15377.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]14039.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]13882.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]14714.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3940.6Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3856.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O5065.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4040.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3837.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4992.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4065.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3808.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4949.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4012.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3799.2Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C5354.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C4016.0Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C3783.5Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]1)[Si](C)(C)C(C)(C)C5344.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C4036.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C3744.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)CNC1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C5432.3Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3921.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C3985.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)[Si](C)(C)C(C)(C)C4802.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C4008.7Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C3689.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H](CNC1=C(N)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)COP(=O)(O)O[Si](C)(C)C(C)(C)C5483.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4042.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4008.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)N1[Si](C)(C)C(C)(C)C4852.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14033.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]13999.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)[NH]14917.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #92CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3973.3Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #92CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3984.7Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #92CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O5116.2Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #93CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3979.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #93CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3954.4Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #93CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O5054.5Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #94CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O4056.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #94CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O3922.8Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #94CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O5065.9Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #95CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4046.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #95CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3831.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #95CC(C)(C)[Si](C)(C)O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H](O)CN(C1=C(N)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C5455.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #96CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C(C)(C)C4080.5Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #96CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C(C)(C)C3858.6Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #96CC(C)(C)[Si](C)(C)OP(=O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CNC1=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)[NH]C(=O)[NH]1)O[Si](C)(C)C(C)(C)C4566.4Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #97CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4003.4Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #97CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O3833.3Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #97CC(C)(C)[Si](C)(C)NC1=C(N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C(=O)[NH]C1=O4918.1Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #98CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4082.8Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #98CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O3814.0Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #98CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C(=O)[NH]C1=O4841.0Standard polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #99CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4104.1Semi standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #99CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O3785.9Standard non polar33892256
5-Amino-6-(5'-phosphoribitylamino)uracil,4TBDMS,isomer #99CC(C)(C)[Si](C)(C)NC1=C(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[NH]C(=O)N([Si](C)(C)C(C)(C)C)C1=O4798.2Standard polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil GC-MS (Non-derivatized) - 70eV, Positivesplash10-000j-7932000000-f99b2e65ef6ba20ea0f82016-09-22Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 10V, Positive-QTOFsplash10-0a4i-0249000000-aad1afed0b055e36f1f22015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 20V, Positive-QTOFsplash10-052f-2932000000-8ce6cdef86c0d69042162015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 40V, Positive-QTOFsplash10-0a4l-9810000000-0889d500d98fdc4462822015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 10V, Negative-QTOFsplash10-03mi-6926000000-99084eeb27c449bf8caf2015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 20V, Negative-QTOFsplash10-004l-9100000000-7df2c276c4edd1cadab52015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 40V, Negative-QTOFsplash10-004i-9000000000-c2c18ea089d342debbaf2015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 10V, Positive-QTOFsplash10-0a4i-0039000000-29673935259424dca6642021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 20V, Positive-QTOFsplash10-052f-0490000000-f14bfba265a959aa7c3d2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 40V, Positive-QTOFsplash10-0006-6900000000-c2d4ad73928d0404741b2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 10V, Negative-QTOFsplash10-0a6r-8009000000-122c5a4319e344f1a64b2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 20V, Negative-QTOFsplash10-004i-9000000000-77766ee562ec0704b8792021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 5-Amino-6-(5'-phosphoribitylamino)uracil 40V, Negative-QTOFsplash10-004l-9100000000-4ea49ebd63ee36be8b962021-09-22Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB030559
KNApSAcK IDNot Available
Chemspider ID18921533
KEGG Compound IDC04454
BioCyc IDCPD-1086
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound18666812
PDB IDNot Available
ChEBI ID18247
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available

Enzymes

General function:
Involved in phosphohistidine phosphatase activity
Specific function:
Exhibits phosphohistidine phosphatase activity.
Gene Name:
PHPT1
Uniprot ID:
Q9NRX4
Molecular weight:
Not Available