Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2007-04-12 14:58:51 UTC
Update Date2021-10-13 04:47:35 UTC
HMDB IDHMDB0005826
Secondary Accession Numbers
  • HMDB05826
Metabolite Identification
Common NameGalactinol
DescriptionGalactinol belongs to the class of organic compounds known as O-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via an O-glycosidic bond. Galactinol is an extremely weak basic (essentially neutral) compound (based on its pKa). Galactinol is an intermediate in galactose metabolism. Galactinol is the fourth-to-last step in the synthesis of D-galactose and the third-to-last step in the synthesis of D-glucose and D-fructose. Galactinol is converted from UDP-galactose via the enzyme inositol 3-alpha-galactosyltransferase (EC 2.4.1.123). It is then converted into raffinose via the enzyme raffinose synthase (EC 2.4.1.82).
Structure
Data?1583255697
Synonyms
ValueSource
1-alpha-D-Galactosyl-myo-inositolChEBI
1-O-alpha-D-Galactosyl-D-myo-inositolChEBI
3-O-alpha-D-Galactosyl-1D-myo-inositolChEBI
O-alpha-D-Galactosyl-(1->3)-1D-myo-inositolChEBI
1-a-D-Galactosyl-myo-inositolGenerator
1-Α-D-galactosyl-myo-inositolGenerator
1-O-a-D-Galactosyl-D-myo-inositolGenerator
1-O-Α-D-galactosyl-D-myo-inositolGenerator
3-O-a-D-Galactosyl-1D-myo-inositolGenerator
3-O-Α-D-galactosyl-1D-myo-inositolGenerator
O-a-D-Galactosyl-(1->3)-1D-myo-inositolGenerator
O-Α-D-galactosyl-(1->3)-1D-myo-inositolGenerator
GalactinolChEBI
a-D-Galactosyl-(1->3)-1D-myo-inositolGenerator, HMDB
α-D-galactosyl-(1->3)-1D-myo-inositolGenerator, HMDB
3-O-alpha-D-Galactopyranosyl-D-myo-inositolHMDB
3-O-α-D-Galactopyranosyl-D-myo-inositolHMDB
Chemical FormulaC12H22O11
Average Molecular Weight342.2965
Monoisotopic Molecular Weight342.116211546
IUPAC Name(1S,2R,3R,4S,5S,6R)-6-{[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4,5-pentol
Traditional Name(1S,2R,3R,4S,5S,6R)-6-{[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4,5-pentol
CAS Registry Number3687-64-7
SMILES
[H][C@]1(O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O
InChI Identifier
InChI=1S/C12H22O11/c13-1-2-3(14)4(15)10(21)12(22-2)23-11-8(19)6(17)5(16)7(18)9(11)20/h2-21H,1H2/t2-,3+,4+,5-,6-,7+,8+,9+,10-,11-,12-/m1/s1
InChI KeyVCWMRQDBPZKXKG-DXNLKLAMSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentO-glycosyl compounds
Alternative Parents
Substituents
  • O-glycosyl compound
  • Cyclohexanol
  • Oxane
  • Monosaccharide
  • Cyclitol or derivatives
  • Cyclic alcohol
  • Secondary alcohol
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Physiological effect

Adverse health effect

Disposition

Source

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility1000000 mg/L @ 25 °C (est)The Good Scents Company Information System
LogPNot AvailableNot Available
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M-H]-Not Available164.586http://allccs.zhulab.cn/database/detail?ID=AllCCS00000401
Predicted Molecular Properties
PropertyValueSource
Water Solubility490 g/LALOGPS
logP-2.4ALOGPS
logP-5.6ChemAxon
logS0.16ALOGPS
pKa (Strongest Acidic)11.98ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area200.53 ŲChemAxon
Rotatable Bond Count3ChemAxon
Refractivity68.19 m³·mol⁻¹ChemAxon
Polarizability31.35 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+175.61930932474
DeepCCS[M-H]-173.69330932474
DeepCCS[M-2H]-207.24430932474
DeepCCS[M+Na]+181.51230932474
AllCCS[M+H]+178.732859911
AllCCS[M+H-H2O]+175.832859911
AllCCS[M+NH4]+181.432859911
AllCCS[M+Na]+182.232859911
AllCCS[M-H]-173.732859911
AllCCS[M+Na-2H]-173.032859911
AllCCS[M+HCOO]-172.532859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Galactinol[H][C@]1(O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O4343.0Standard polar33892256
Galactinol[H][C@]1(O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3276.7Standard non polar33892256
Galactinol[H][C@]1(O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3188.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Galactinol,1TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2838.5Semi standard non polar33892256
Galactinol,1TMS,isomer #2C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O2846.5Semi standard non polar33892256
Galactinol,1TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O2852.3Semi standard non polar33892256
Galactinol,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O2846.5Semi standard non polar33892256
Galactinol,1TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2838.5Semi standard non polar33892256
Galactinol,1TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2839.9Semi standard non polar33892256
Galactinol,1TMS,isomer #7C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O2845.0Semi standard non polar33892256
Galactinol,1TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O2849.1Semi standard non polar33892256
Galactinol,1TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O2845.0Semi standard non polar33892256
Galactinol,2TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2840.1Semi standard non polar33892256
Galactinol,2TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2833.2Semi standard non polar33892256
Galactinol,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2827.4Semi standard non polar33892256
Galactinol,2TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2840.2Semi standard non polar33892256
Galactinol,2TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O2837.4Semi standard non polar33892256
Galactinol,2TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2827.7Semi standard non polar33892256
Galactinol,2TMS,isomer #15C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O2836.9Semi standard non polar33892256
Galactinol,2TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O2842.8Semi standard non polar33892256
Galactinol,2TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2835.3Semi standard non polar33892256
Galactinol,2TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2845.4Semi standard non polar33892256
Galactinol,2TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O2847.3Semi standard non polar33892256
Galactinol,2TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2835.3Semi standard non polar33892256
Galactinol,2TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@@H]1O2841.4Semi standard non polar33892256
Galactinol,2TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O2849.4Semi standard non polar33892256
Galactinol,2TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2840.2Semi standard non polar33892256
Galactinol,2TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O2837.4Semi standard non polar33892256
Galactinol,2TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2827.7Semi standard non polar33892256
Galactinol,2TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2836.9Semi standard non polar33892256
Galactinol,2TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2840.1Semi standard non polar33892256
Galactinol,2TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2837.1Semi standard non polar33892256
Galactinol,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2827.7Semi standard non polar33892256
Galactinol,2TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2817.3Semi standard non polar33892256
Galactinol,2TMS,isomer #3C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2827.4Semi standard non polar33892256
Galactinol,2TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2830.0Semi standard non polar33892256
Galactinol,2TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2843.0Semi standard non polar33892256
Galactinol,2TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2840.5Semi standard non polar33892256
Galactinol,2TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2848.8Semi standard non polar33892256
Galactinol,2TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO2828.7Semi standard non polar33892256
Galactinol,2TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2840.5Semi standard non polar33892256
Galactinol,2TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C2836.1Semi standard non polar33892256
Galactinol,2TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2828.6Semi standard non polar33892256
Galactinol,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2837.1Semi standard non polar33892256
Galactinol,2TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2827.7Semi standard non polar33892256
Galactinol,2TMS,isomer #7C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2817.3Semi standard non polar33892256
Galactinol,2TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2830.0Semi standard non polar33892256
Galactinol,2TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O[Si](C)(C)C2842.8Semi standard non polar33892256
Galactinol,3TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2813.2Semi standard non polar33892256
Galactinol,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2806.0Semi standard non polar33892256
Galactinol,3TMS,isomer #11C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2830.6Semi standard non polar33892256
Galactinol,3TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2812.2Semi standard non polar33892256
Galactinol,3TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2828.3Semi standard non polar33892256
Galactinol,3TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2805.2Semi standard non polar33892256
Galactinol,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2797.5Semi standard non polar33892256
Galactinol,3TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2826.3Semi standard non polar33892256
Galactinol,3TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2809.8Semi standard non polar33892256
Galactinol,3TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2821.9Semi standard non polar33892256
Galactinol,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2810.1Semi standard non polar33892256
Galactinol,3TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O2807.0Semi standard non polar33892256
Galactinol,3TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2811.2Semi standard non polar33892256
Galactinol,3TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2794.3Semi standard non polar33892256
Galactinol,3TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2796.9Semi standard non polar33892256
Galactinol,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2813.8Semi standard non polar33892256
Galactinol,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2789.2Semi standard non polar33892256
Galactinol,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2824.5Semi standard non polar33892256
Galactinol,3TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2807.0Semi standard non polar33892256
Galactinol,3TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2812.8Semi standard non polar33892256
Galactinol,3TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2794.4Semi standard non polar33892256
Galactinol,3TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2809.6Semi standard non polar33892256
Galactinol,3TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2805.2Semi standard non polar33892256
Galactinol,3TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2815.2Semi standard non polar33892256
Galactinol,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2803.8Semi standard non polar33892256
Galactinol,3TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O[Si](C)(C)C2833.2Semi standard non polar33892256
Galactinol,3TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2817.8Semi standard non polar33892256
Galactinol,3TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2832.2Semi standard non polar33892256
Galactinol,3TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O2807.0Semi standard non polar33892256
Galactinol,3TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2792.2Semi standard non polar33892256
Galactinol,3TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2823.4Semi standard non polar33892256
Galactinol,3TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2815.3Semi standard non polar33892256
Galactinol,3TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2822.5Semi standard non polar33892256
Galactinol,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2810.8Semi standard non polar33892256
Galactinol,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2797.5Semi standard non polar33892256
Galactinol,3TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2826.3Semi standard non polar33892256
Galactinol,3TMS,isomer #42C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2809.8Semi standard non polar33892256
Galactinol,3TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2821.9Semi standard non polar33892256
Galactinol,3TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2812.8Semi standard non polar33892256
Galactinol,3TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2792.8Semi standard non polar33892256
Galactinol,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2821.2Semi standard non polar33892256
Galactinol,3TMS,isomer #47C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O2816.6Semi standard non polar33892256
Galactinol,3TMS,isomer #48C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O2824.8Semi standard non polar33892256
Galactinol,3TMS,isomer #49C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O2808.1Semi standard non polar33892256
Galactinol,3TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2819.9Semi standard non polar33892256
Galactinol,3TMS,isomer #50C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2813.2Semi standard non polar33892256
Galactinol,3TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2803.8Semi standard non polar33892256
Galactinol,3TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O2833.2Semi standard non polar33892256
Galactinol,3TMS,isomer #53C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@H]1O2817.8Semi standard non polar33892256
Galactinol,3TMS,isomer #54C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O2832.2Semi standard non polar33892256
Galactinol,3TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2806.0Semi standard non polar33892256
Galactinol,3TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2830.6Semi standard non polar33892256
Galactinol,3TMS,isomer #57C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2812.2Semi standard non polar33892256
Galactinol,3TMS,isomer #58C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2828.3Semi standard non polar33892256
Galactinol,3TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2826.1Semi standard non polar33892256
Galactinol,3TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2796.5Semi standard non polar33892256
Galactinol,3TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2800.4Semi standard non polar33892256
Galactinol,3TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2833.7Semi standard non polar33892256
Galactinol,3TMS,isomer #62C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2832.2Semi standard non polar33892256
Galactinol,3TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)O[C@@H]1CO2843.4Semi standard non polar33892256
Galactinol,3TMS,isomer #64C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C2830.1Semi standard non polar33892256
Galactinol,3TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2810.8Semi standard non polar33892256
Galactinol,3TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2812.8Semi standard non polar33892256
Galactinol,3TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2792.8Semi standard non polar33892256
Galactinol,3TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2821.2Semi standard non polar33892256
Galactinol,3TMS,isomer #69C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2816.6Semi standard non polar33892256
Galactinol,3TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2813.5Semi standard non polar33892256
Galactinol,3TMS,isomer #70C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2824.8Semi standard non polar33892256
Galactinol,3TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2819.9Semi standard non polar33892256
Galactinol,3TMS,isomer #72C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2796.5Semi standard non polar33892256
Galactinol,3TMS,isomer #73C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C2808.1Semi standard non polar33892256
Galactinol,3TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2813.5Semi standard non polar33892256
Galactinol,3TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2813.8Semi standard non polar33892256
Galactinol,3TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2789.2Semi standard non polar33892256
Galactinol,3TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2824.5Semi standard non polar33892256
Galactinol,3TMS,isomer #78C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2807.0Semi standard non polar33892256
Galactinol,3TMS,isomer #79C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2812.8Semi standard non polar33892256
Galactinol,3TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H]1O2815.2Semi standard non polar33892256
Galactinol,3TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O2794.4Semi standard non polar33892256
Galactinol,3TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2796.9Semi standard non polar33892256
Galactinol,3TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2819.1Semi standard non polar33892256
Galactinol,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2802.7Semi standard non polar33892256
Galactinol,3TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO2810.0Semi standard non polar33892256
Galactinol,3TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2814.2Semi standard non polar33892256
Galactinol,4TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2761.4Semi standard non polar33892256
Galactinol,4TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O2767.6Semi standard non polar33892256
Galactinol,4TMS,isomer #100C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O2782.8Semi standard non polar33892256
Galactinol,4TMS,isomer #101C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H]1O2759.5Semi standard non polar33892256
Galactinol,4TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2717.2Semi standard non polar33892256
Galactinol,4TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2702.8Semi standard non polar33892256
Galactinol,4TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2720.1Semi standard non polar33892256
Galactinol,4TMS,isomer #105C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2771.1Semi standard non polar33892256
Galactinol,4TMS,isomer #106C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2776.4Semi standard non polar33892256
Galactinol,4TMS,isomer #107C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2751.5Semi standard non polar33892256
Galactinol,4TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2709.4Semi standard non polar33892256
Galactinol,4TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2737.9Semi standard non polar33892256
Galactinol,4TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2750.6Semi standard non polar33892256
Galactinol,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2717.9Semi standard non polar33892256
Galactinol,4TMS,isomer #111C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)O[C@@H]1CO2755.8Semi standard non polar33892256
Galactinol,4TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2707.8Semi standard non polar33892256
Galactinol,4TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2687.7Semi standard non polar33892256
Galactinol,4TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2712.9Semi standard non polar33892256
Galactinol,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2696.4Semi standard non polar33892256
Galactinol,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2728.6Semi standard non polar33892256
Galactinol,4TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2707.1Semi standard non polar33892256
Galactinol,4TMS,isomer #118C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2744.6Semi standard non polar33892256
Galactinol,4TMS,isomer #119C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2739.4Semi standard non polar33892256
Galactinol,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2700.1Semi standard non polar33892256
Galactinol,4TMS,isomer #120C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2753.2Semi standard non polar33892256
Galactinol,4TMS,isomer #121C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2726.7Semi standard non polar33892256
Galactinol,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2693.1Semi standard non polar33892256
Galactinol,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2714.2Semi standard non polar33892256
Galactinol,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2705.5Semi standard non polar33892256
Galactinol,4TMS,isomer #125C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2722.6Semi standard non polar33892256
Galactinol,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2718.1Semi standard non polar33892256
Galactinol,4TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2767.3Semi standard non polar33892256
Galactinol,4TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2742.6Semi standard non polar33892256
Galactinol,4TMS,isomer #15C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2739.1Semi standard non polar33892256
Galactinol,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2707.8Semi standard non polar33892256
Galactinol,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2687.7Semi standard non polar33892256
Galactinol,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2712.9Semi standard non polar33892256
Galactinol,4TMS,isomer #19C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2744.6Semi standard non polar33892256
Galactinol,4TMS,isomer #2C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O2759.0Semi standard non polar33892256
Galactinol,4TMS,isomer #20C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2753.2Semi standard non polar33892256
Galactinol,4TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2726.7Semi standard non polar33892256
Galactinol,4TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2759.0Semi standard non polar33892256
Galactinol,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2722.0Semi standard non polar33892256
Galactinol,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H]1O2790.9Semi standard non polar33892256
Galactinol,4TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H]1O2780.7Semi standard non polar33892256
Galactinol,4TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2786.6Semi standard non polar33892256
Galactinol,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2716.5Semi standard non polar33892256
Galactinol,4TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2779.4Semi standard non polar33892256
Galactinol,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2763.0Semi standard non polar33892256
Galactinol,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2710.3Semi standard non polar33892256
Galactinol,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2754.0Semi standard non polar33892256
Galactinol,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2717.2Semi standard non polar33892256
Galactinol,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2702.8Semi standard non polar33892256
Galactinol,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2720.1Semi standard non polar33892256
Galactinol,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2771.1Semi standard non polar33892256
Galactinol,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2776.4Semi standard non polar33892256
Galactinol,4TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2751.5Semi standard non polar33892256
Galactinol,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2700.1Semi standard non polar33892256
Galactinol,4TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2767.3Semi standard non polar33892256
Galactinol,4TMS,isomer #39C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2742.6Semi standard non polar33892256
Galactinol,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2776.1Semi standard non polar33892256
Galactinol,4TMS,isomer #40C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2739.1Semi standard non polar33892256
Galactinol,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2712.1Semi standard non polar33892256
Galactinol,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2702.6Semi standard non polar33892256
Galactinol,4TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2715.3Semi standard non polar33892256
Galactinol,4TMS,isomer #44C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2765.4Semi standard non polar33892256
Galactinol,4TMS,isomer #45C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2770.1Semi standard non polar33892256
Galactinol,4TMS,isomer #46C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C2745.7Semi standard non polar33892256
Galactinol,4TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2681.5Semi standard non polar33892256
Galactinol,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2683.9Semi standard non polar33892256
Galactinol,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2709.3Semi standard non polar33892256
Galactinol,4TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2751.9Semi standard non polar33892256
Galactinol,4TMS,isomer #50C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2738.5Semi standard non polar33892256
Galactinol,4TMS,isomer #51C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2724.4Semi standard non polar33892256
Galactinol,4TMS,isomer #52C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2707.6Semi standard non polar33892256
Galactinol,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2693.1Semi standard non polar33892256
Galactinol,4TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2714.2Semi standard non polar33892256
Galactinol,4TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2705.5Semi standard non polar33892256
Galactinol,4TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO2722.6Semi standard non polar33892256
Galactinol,4TMS,isomer #57C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2761.4Semi standard non polar33892256
Galactinol,4TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2707.8Semi standard non polar33892256
Galactinol,4TMS,isomer #59C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2776.8Semi standard non polar33892256
Galactinol,4TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2767.0Semi standard non polar33892256
Galactinol,4TMS,isomer #60C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O2768.8Semi standard non polar33892256
Galactinol,4TMS,isomer #61C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2771.3Semi standard non polar33892256
Galactinol,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2722.0Semi standard non polar33892256
Galactinol,4TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2790.9Semi standard non polar33892256
Galactinol,4TMS,isomer #64C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2780.7Semi standard non polar33892256
Galactinol,4TMS,isomer #65C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2786.6Semi standard non polar33892256
Galactinol,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2724.7Semi standard non polar33892256
Galactinol,4TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2711.5Semi standard non polar33892256
Galactinol,4TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2726.2Semi standard non polar33892256
Galactinol,4TMS,isomer #69C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2775.0Semi standard non polar33892256
Galactinol,4TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2708.1Semi standard non polar33892256
Galactinol,4TMS,isomer #70C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2782.8Semi standard non polar33892256
Galactinol,4TMS,isomer #71C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C2759.5Semi standard non polar33892256
Galactinol,4TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2708.1Semi standard non polar33892256
Galactinol,4TMS,isomer #73C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O2775.9Semi standard non polar33892256
Galactinol,4TMS,isomer #74C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2768.0Semi standard non polar33892256
Galactinol,4TMS,isomer #75C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2767.6Semi standard non polar33892256
Galactinol,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2730.2Semi standard non polar33892256
Galactinol,4TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2725.3Semi standard non polar33892256
Galactinol,4TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2737.1Semi standard non polar33892256
Galactinol,4TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2781.3Semi standard non polar33892256
Galactinol,4TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O2775.9Semi standard non polar33892256
Galactinol,4TMS,isomer #80C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2779.2Semi standard non polar33892256
Galactinol,4TMS,isomer #81C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2767.4Semi standard non polar33892256
Galactinol,4TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2712.1Semi standard non polar33892256
Galactinol,4TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2702.6Semi standard non polar33892256
Galactinol,4TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2715.3Semi standard non polar33892256
Galactinol,4TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2765.4Semi standard non polar33892256
Galactinol,4TMS,isomer #86C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2770.1Semi standard non polar33892256
Galactinol,4TMS,isomer #87C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2745.7Semi standard non polar33892256
Galactinol,4TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2696.4Semi standard non polar33892256
Galactinol,4TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2728.6Semi standard non polar33892256
Galactinol,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2768.0Semi standard non polar33892256
Galactinol,4TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2707.1Semi standard non polar33892256
Galactinol,4TMS,isomer #91C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2739.4Semi standard non polar33892256
Galactinol,4TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2710.3Semi standard non polar33892256
Galactinol,4TMS,isomer #93C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2776.1Semi standard non polar33892256
Galactinol,4TMS,isomer #94C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2751.9Semi standard non polar33892256
Galactinol,4TMS,isomer #95C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2767.0Semi standard non polar33892256
Galactinol,4TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2724.7Semi standard non polar33892256
Galactinol,4TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2711.5Semi standard non polar33892256
Galactinol,4TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2726.2Semi standard non polar33892256
Galactinol,4TMS,isomer #99C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@H]1O2775.0Semi standard non polar33892256
Galactinol,5TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2742.9Semi standard non polar33892256
Galactinol,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2693.2Semi standard non polar33892256
Galactinol,5TMS,isomer #100C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2733.7Semi standard non polar33892256
Galactinol,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2676.9Semi standard non polar33892256
Galactinol,5TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2685.6Semi standard non polar33892256
Galactinol,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2688.6Semi standard non polar33892256
Galactinol,5TMS,isomer #104C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2717.3Semi standard non polar33892256
Galactinol,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2703.0Semi standard non polar33892256
Galactinol,5TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2693.2Semi standard non polar33892256
Galactinol,5TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2692.3Semi standard non polar33892256
Galactinol,5TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2703.1Semi standard non polar33892256
Galactinol,5TMS,isomer #109C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2735.9Semi standard non polar33892256
Galactinol,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2692.3Semi standard non polar33892256
Galactinol,5TMS,isomer #110C[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2715.2Semi standard non polar33892256
Galactinol,5TMS,isomer #111C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2716.9Semi standard non polar33892256
Galactinol,5TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2688.1Semi standard non polar33892256
Galactinol,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2690.5Semi standard non polar33892256
Galactinol,5TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2699.9Semi standard non polar33892256
Galactinol,5TMS,isomer #115C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2728.0Semi standard non polar33892256
Galactinol,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2677.0Semi standard non polar33892256
Galactinol,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2686.7Semi standard non polar33892256
Galactinol,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2691.9Semi standard non polar33892256
Galactinol,5TMS,isomer #119C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2717.1Semi standard non polar33892256
Galactinol,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2703.1Semi standard non polar33892256
Galactinol,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2702.4Semi standard non polar33892256
Galactinol,5TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2685.8Semi standard non polar33892256
Galactinol,5TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2689.3Semi standard non polar33892256
Galactinol,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2704.2Semi standard non polar33892256
Galactinol,5TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2703.0Semi standard non polar33892256
Galactinol,5TMS,isomer #125C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2712.0Semi standard non polar33892256
Galactinol,5TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2701.1Semi standard non polar33892256
Galactinol,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2735.9Semi standard non polar33892256
Galactinol,5TMS,isomer #14C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2715.2Semi standard non polar33892256
Galactinol,5TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2716.9Semi standard non polar33892256
Galactinol,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2700.1Semi standard non polar33892256
Galactinol,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2683.7Semi standard non polar33892256
Galactinol,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2695.4Semi standard non polar33892256
Galactinol,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2692.9Semi standard non polar33892256
Galactinol,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2722.3Semi standard non polar33892256
Galactinol,5TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O2727.2Semi standard non polar33892256
Galactinol,5TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O2707.5Semi standard non polar33892256
Galactinol,5TMS,isomer #22C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2721.7Semi standard non polar33892256
Galactinol,5TMS,isomer #23C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2723.9Semi standard non polar33892256
Galactinol,5TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O2713.2Semi standard non polar33892256
Galactinol,5TMS,isomer #25C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2706.2Semi standard non polar33892256
Galactinol,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2667.9Semi standard non polar33892256
Galactinol,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2678.4Semi standard non polar33892256
Galactinol,5TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2687.2Semi standard non polar33892256
Galactinol,5TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2717.4Semi standard non polar33892256
Galactinol,5TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2746.2Semi standard non polar33892256
Galactinol,5TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2686.8Semi standard non polar33892256
Galactinol,5TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2694.8Semi standard non polar33892256
Galactinol,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2685.8Semi standard non polar33892256
Galactinol,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2689.3Semi standard non polar33892256
Galactinol,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2704.2Semi standard non polar33892256
Galactinol,5TMS,isomer #35C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2712.0Semi standard non polar33892256
Galactinol,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2706.3Semi standard non polar33892256
Galactinol,5TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2725.9Semi standard non polar33892256
Galactinol,5TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2728.8Semi standard non polar33892256
Galactinol,5TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2709.1Semi standard non polar33892256
Galactinol,5TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2748.4Semi standard non polar33892256
Galactinol,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2691.2Semi standard non polar33892256
Galactinol,5TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2700.5Semi standard non polar33892256
Galactinol,5TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2696.3Semi standard non polar33892256
Galactinol,5TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H]1O2739.1Semi standard non polar33892256
Galactinol,5TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2716.7Semi standard non polar33892256
Galactinol,5TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2723.6Semi standard non polar33892256
Galactinol,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2667.6Semi standard non polar33892256
Galactinol,5TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2693.0Semi standard non polar33892256
Galactinol,5TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2689.3Semi standard non polar33892256
Galactinol,5TMS,isomer #49C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2720.8Semi standard non polar33892256
Galactinol,5TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2736.1Semi standard non polar33892256
Galactinol,5TMS,isomer #50C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2694.4Semi standard non polar33892256
Galactinol,5TMS,isomer #51C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2698.4Semi standard non polar33892256
Galactinol,5TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2677.0Semi standard non polar33892256
Galactinol,5TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2686.7Semi standard non polar33892256
Galactinol,5TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2691.9Semi standard non polar33892256
Galactinol,5TMS,isomer #55C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2717.1Semi standard non polar33892256
Galactinol,5TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2667.9Semi standard non polar33892256
Galactinol,5TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2678.4Semi standard non polar33892256
Galactinol,5TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2687.2Semi standard non polar33892256
Galactinol,5TMS,isomer #59C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2717.4Semi standard non polar33892256
Galactinol,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2706.3Semi standard non polar33892256
Galactinol,5TMS,isomer #60C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2686.8Semi standard non polar33892256
Galactinol,5TMS,isomer #61C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2694.8Semi standard non polar33892256
Galactinol,5TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2676.9Semi standard non polar33892256
Galactinol,5TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2685.6Semi standard non polar33892256
Galactinol,5TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2688.6Semi standard non polar33892256
Galactinol,5TMS,isomer #65C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2717.3Semi standard non polar33892256
Galactinol,5TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2662.2Semi standard non polar33892256
Galactinol,5TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2664.3Semi standard non polar33892256
Galactinol,5TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2688.0Semi standard non polar33892256
Galactinol,5TMS,isomer #69C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2696.3Semi standard non polar33892256
Galactinol,5TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2725.9Semi standard non polar33892256
Galactinol,5TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2701.1Semi standard non polar33892256
Galactinol,5TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O2722.3Semi standard non polar33892256
Galactinol,5TMS,isomer #72C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C2746.2Semi standard non polar33892256
Galactinol,5TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2748.4Semi standard non polar33892256
Galactinol,5TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2736.1Semi standard non polar33892256
Galactinol,5TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2690.6Semi standard non polar33892256
Galactinol,5TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2697.7Semi standard non polar33892256
Galactinol,5TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2696.4Semi standard non polar33892256
Galactinol,5TMS,isomer #78C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2732.9Semi standard non polar33892256
Galactinol,5TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2712.6Semi standard non polar33892256
Galactinol,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2728.8Semi standard non polar33892256
Galactinol,5TMS,isomer #80C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C2721.2Semi standard non polar33892256
Galactinol,5TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2691.2Semi standard non polar33892256
Galactinol,5TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2700.5Semi standard non polar33892256
Galactinol,5TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2696.3Semi standard non polar33892256
Galactinol,5TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2739.1Semi standard non polar33892256
Galactinol,5TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2716.7Semi standard non polar33892256
Galactinol,5TMS,isomer #86C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2723.6Semi standard non polar33892256
Galactinol,5TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2688.1Semi standard non polar33892256
Galactinol,5TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2690.5Semi standard non polar33892256
Galactinol,5TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2699.9Semi standard non polar33892256
Galactinol,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2709.1Semi standard non polar33892256
Galactinol,5TMS,isomer #90C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2728.0Semi standard non polar33892256
Galactinol,5TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2683.7Semi standard non polar33892256
Galactinol,5TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2695.4Semi standard non polar33892256
Galactinol,5TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2692.9Semi standard non polar33892256
Galactinol,5TMS,isomer #94C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2727.2Semi standard non polar33892256
Galactinol,5TMS,isomer #95C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2707.5Semi standard non polar33892256
Galactinol,5TMS,isomer #96C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2713.2Semi standard non polar33892256
Galactinol,5TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2694.8Semi standard non polar33892256
Galactinol,5TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2712.2Semi standard non polar33892256
Galactinol,5TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2704.8Semi standard non polar33892256
Galactinol,6TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O2756.8Semi standard non polar33892256
Galactinol,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.4Semi standard non polar33892256
Galactinol,6TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2697.5Semi standard non polar33892256
Galactinol,6TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2711.8Semi standard non polar33892256
Galactinol,6TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2718.8Semi standard non polar33892256
Galactinol,6TMS,isomer #14C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2751.9Semi standard non polar33892256
Galactinol,6TMS,isomer #15C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2712.2Semi standard non polar33892256
Galactinol,6TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2728.4Semi standard non polar33892256
Galactinol,6TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2719.0Semi standard non polar33892256
Galactinol,6TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2710.2Semi standard non polar33892256
Galactinol,6TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2737.3Semi standard non polar33892256
Galactinol,6TMS,isomer #2C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2775.6Semi standard non polar33892256
Galactinol,6TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2759.0Semi standard non polar33892256
Galactinol,6TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2695.3Semi standard non polar33892256
Galactinol,6TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2707.6Semi standard non polar33892256
Galactinol,6TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2714.9Semi standard non polar33892256
Galactinol,6TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2707.2Semi standard non polar33892256
Galactinol,6TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2705.6Semi standard non polar33892256
Galactinol,6TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2722.5Semi standard non polar33892256
Galactinol,6TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2747.9Semi standard non polar33892256
Galactinol,6TMS,isomer #28C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2749.7Semi standard non polar33892256
Galactinol,6TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2708.5Semi standard non polar33892256
Galactinol,6TMS,isomer #3C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O2771.2Semi standard non polar33892256
Galactinol,6TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2725.6Semi standard non polar33892256
Galactinol,6TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2688.6Semi standard non polar33892256
Galactinol,6TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2683.6Semi standard non polar33892256
Galactinol,6TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2714.0Semi standard non polar33892256
Galactinol,6TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2729.8Semi standard non polar33892256
Galactinol,6TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2729.6Semi standard non polar33892256
Galactinol,6TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2697.5Semi standard non polar33892256
Galactinol,6TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2711.8Semi standard non polar33892256
Galactinol,6TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2718.8Semi standard non polar33892256
Galactinol,6TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2751.9Semi standard non polar33892256
Galactinol,6TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2749.8Semi standard non polar33892256
Galactinol,6TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2712.2Semi standard non polar33892256
Galactinol,6TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2728.0Semi standard non polar33892256
Galactinol,6TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2709.7Semi standard non polar33892256
Galactinol,6TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2708.5Semi standard non polar33892256
Galactinol,6TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2725.8Semi standard non polar33892256
Galactinol,6TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2750.0Semi standard non polar33892256
Galactinol,6TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2688.1Semi standard non polar33892256
Galactinol,6TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2690.3Semi standard non polar33892256
Galactinol,6TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2710.0Semi standard non polar33892256
Galactinol,6TMS,isomer #49C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2728.9Semi standard non polar33892256
Galactinol,6TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2728.3Semi standard non polar33892256
Galactinol,6TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2713.6Semi standard non polar33892256
Galactinol,6TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2688.6Semi standard non polar33892256
Galactinol,6TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2683.6Semi standard non polar33892256
Galactinol,6TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2714.0Semi standard non polar33892256
Galactinol,6TMS,isomer #54C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2729.8Semi standard non polar33892256
Galactinol,6TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2717.4Semi standard non polar33892256
Galactinol,6TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2703.7Semi standard non polar33892256
Galactinol,6TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2728.3Semi standard non polar33892256
Galactinol,6TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2734.0Semi standard non polar33892256
Galactinol,6TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2742.7Semi standard non polar33892256
Galactinol,6TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2734.0Semi standard non polar33892256
Galactinol,6TMS,isomer #60C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C2774.7Semi standard non polar33892256
Galactinol,6TMS,isomer #61C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2742.9Semi standard non polar33892256
Galactinol,6TMS,isomer #62C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2758.4Semi standard non polar33892256
Galactinol,6TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2720.2Semi standard non polar33892256
Galactinol,6TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2714.0Semi standard non polar33892256
Galactinol,6TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2730.7Semi standard non polar33892256
Galactinol,6TMS,isomer #66C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2758.8Semi standard non polar33892256
Galactinol,6TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2709.7Semi standard non polar33892256
Galactinol,6TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2708.5Semi standard non polar33892256
Galactinol,6TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2725.8Semi standard non polar33892256
Galactinol,6TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2742.7Semi standard non polar33892256
Galactinol,6TMS,isomer #70C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2750.0Semi standard non polar33892256
Galactinol,6TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2729.7Semi standard non polar33892256
Galactinol,6TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2707.2Semi standard non polar33892256
Galactinol,6TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2705.6Semi standard non polar33892256
Galactinol,6TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2722.5Semi standard non polar33892256
Galactinol,6TMS,isomer #75C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2747.9Semi standard non polar33892256
Galactinol,6TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2727.0Semi standard non polar33892256
Galactinol,6TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2717.4Semi standard non polar33892256
Galactinol,6TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2719.0Semi standard non polar33892256
Galactinol,6TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2710.2Semi standard non polar33892256
Galactinol,6TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2774.7Semi standard non polar33892256
Galactinol,6TMS,isomer #80C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2737.3Semi standard non polar33892256
Galactinol,6TMS,isomer #81C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2759.0Semi standard non polar33892256
Galactinol,6TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2729.7Semi standard non polar33892256
Galactinol,6TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2713.6Semi standard non polar33892256
Galactinol,6TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2729.6Semi standard non polar33892256
Galactinol,6TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2742.9Semi standard non polar33892256
Galactinol,7TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2736.6Semi standard non polar33892256
Galactinol,7TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2770.5Semi standard non polar33892256
Galactinol,7TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2721.9Semi standard non polar33892256
Galactinol,7TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2729.6Semi standard non polar33892256
Galactinol,7TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2746.2Semi standard non polar33892256
Galactinol,7TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2749.4Semi standard non polar33892256
Galactinol,7TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2742.5Semi standard non polar33892256
Galactinol,7TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2716.2Semi standard non polar33892256
Galactinol,7TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2724.1Semi standard non polar33892256
Galactinol,7TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2742.9Semi standard non polar33892256
Galactinol,7TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2734.2Semi standard non polar33892256
Galactinol,7TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O2748.6Semi standard non polar33892256
Galactinol,7TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2740.3Semi standard non polar33892256
Galactinol,7TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2722.3Semi standard non polar33892256
Galactinol,7TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2721.9Semi standard non polar33892256
Galactinol,7TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2729.6Semi standard non polar33892256
Galactinol,7TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2746.2Semi standard non polar33892256
Galactinol,7TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO2749.4Semi standard non polar33892256
Galactinol,7TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2735.1Semi standard non polar33892256
Galactinol,7TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2720.5Semi standard non polar33892256
Galactinol,7TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2722.3Semi standard non polar33892256
Galactinol,7TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2741.3Semi standard non polar33892256
Galactinol,7TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2758.2Semi standard non polar33892256
Galactinol,7TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2746.0Semi standard non polar33892256
Galactinol,7TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2763.9Semi standard non polar33892256
Galactinol,7TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO2770.5Semi standard non polar33892256
Galactinol,7TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2746.5Semi standard non polar33892256
Galactinol,7TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2735.1Semi standard non polar33892256
Galactinol,7TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2734.2Semi standard non polar33892256
Galactinol,7TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2742.5Semi standard non polar33892256
Galactinol,7TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2784.6Semi standard non polar33892256
Galactinol,7TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.8Semi standard non polar33892256
Galactinol,7TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.2Semi standard non polar33892256
Galactinol,7TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O2741.3Semi standard non polar33892256
Galactinol,7TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2746.0Semi standard non polar33892256
Galactinol,7TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2763.9Semi standard non polar33892256
Galactinol,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3063.8Semi standard non polar33892256
Galactinol,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O3079.3Semi standard non polar33892256
Galactinol,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O3098.4Semi standard non polar33892256
Galactinol,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O3079.3Semi standard non polar33892256
Galactinol,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3063.8Semi standard non polar33892256
Galactinol,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3083.9Semi standard non polar33892256
Galactinol,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3070.0Semi standard non polar33892256
Galactinol,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O3069.1Semi standard non polar33892256
Galactinol,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O3071.8Semi standard non polar33892256
Galactinol,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3304.9Semi standard non polar33892256
Galactinol,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3312.5Semi standard non polar33892256
Galactinol,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3314.6Semi standard non polar33892256
Galactinol,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3291.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O3310.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3307.9Semi standard non polar33892256
Galactinol,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O3316.4Semi standard non polar33892256
Galactinol,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O3318.8Semi standard non polar33892256
Galactinol,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3318.0Semi standard non polar33892256
Galactinol,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3310.7Semi standard non polar33892256
Galactinol,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O3329.0Semi standard non polar33892256
Galactinol,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3318.0Semi standard non polar33892256
Galactinol,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@@H]1O3330.2Semi standard non polar33892256
Galactinol,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O3340.7Semi standard non polar33892256
Galactinol,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3291.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O3310.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3307.9Semi standard non polar33892256
Galactinol,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3316.4Semi standard non polar33892256
Galactinol,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3304.9Semi standard non polar33892256
Galactinol,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3281.3Semi standard non polar33892256
Galactinol,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3300.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3292.6Semi standard non polar33892256
Galactinol,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3314.6Semi standard non polar33892256
Galactinol,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3300.0Semi standard non polar33892256
Galactinol,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3294.7Semi standard non polar33892256
Galactinol,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3287.7Semi standard non polar33892256
Galactinol,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3295.5Semi standard non polar33892256
Galactinol,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3284.5Semi standard non polar33892256
Galactinol,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3292.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3298.5Semi standard non polar33892256
Galactinol,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3292.2Semi standard non polar33892256
Galactinol,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3281.3Semi standard non polar33892256
Galactinol,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3300.1Semi standard non polar33892256
Galactinol,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3292.6Semi standard non polar33892256
Galactinol,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3300.0Semi standard non polar33892256
Galactinol,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3318.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3496.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3472.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3501.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3504.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3507.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3483.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3474.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3501.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3504.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3505.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3452.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O3487.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3469.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3474.4Semi standard non polar33892256
Galactinol,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3475.5Semi standard non polar33892256
Galactinol,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3469.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3460.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3471.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3468.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3462.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3472.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3490.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3483.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3489.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3475.5Semi standard non polar33892256
Galactinol,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3498.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3501.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3505.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O3487.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3485.4Semi standard non polar33892256
Galactinol,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3505.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3511.4Semi standard non polar33892256
Galactinol,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3513.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3464.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3474.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3501.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3504.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3505.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3484.5Semi standard non polar33892256
Galactinol,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3482.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3481.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H]1O3484.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O3484.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O3492.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3482.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3496.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3475.5Semi standard non polar33892256
Galactinol,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O3498.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@H]1O3501.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3505.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3472.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3501.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3504.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3507.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3506.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3483.4Semi standard non polar33892256
Galactinol,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3498.8Semi standard non polar33892256
Galactinol,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3501.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3501.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)O[C@@H]1CO3502.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3511.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3464.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3484.5Semi standard non polar33892256
Galactinol,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3482.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3481.6Semi standard non polar33892256
Galactinol,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3484.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3487.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@@H]1CO3484.1Semi standard non polar33892256
Galactinol,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3482.9Semi standard non polar33892256
Galactinol,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3483.4Semi standard non polar33892256
Galactinol,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3492.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3487.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3469.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3460.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3471.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #78CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3468.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3462.2Semi standard non polar33892256
Galactinol,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3489.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1O3472.0Semi standard non polar33892256
Galactinol,3TBDMS,isomer #81CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3466.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #82CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3469.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #83CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3472.7Semi standard non polar33892256
Galactinol,3TBDMS,isomer #84CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3469.3Semi standard non polar33892256
Galactinol,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3488.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3620.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O3631.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3621.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3625.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3609.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3609.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3607.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3618.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #106CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3619.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #107CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3624.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #108CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3619.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #109CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3621.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3612.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #110CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3619.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #111CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O)O[C@@H]1CO3623.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #112CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3597.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #113CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3592.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #114CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3593.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #115CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3604.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #116CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3608.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #117CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3608.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #118CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3597.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #119CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@@H]1CO3612.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3585.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #120CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3597.8Semi standard non polar33892256
Galactinol,4TBDMS,isomer #121CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3603.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #122CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3590.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #123CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3593.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #124CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3596.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #125CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3596.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #126CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3623.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3611.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3621.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3614.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3597.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3592.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3593.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3597.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3616.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3597.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3603.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3616.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3590.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3627.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3630.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3630.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3594.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3633.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3635.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3598.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3637.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3609.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3609.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3607.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3618.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3619.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3624.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3585.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3611.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3621.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3621.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3614.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3612.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3613.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3610.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3620.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3622.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3625.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3588.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3585.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3583.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3630.8Semi standard non polar33892256
Galactinol,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3591.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3591.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3595.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3590.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3593.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3596.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3596.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C3620.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3599.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3629.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3627.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O3632.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3633.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3590.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3627.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3630.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3630.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3613.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3610.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3608.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3619.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3592.8Semi standard non polar33892256
Galactinol,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@@H]1CO3621.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3625.6Semi standard non polar33892256
Galactinol,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3592.8Semi standard non polar33892256
Galactinol,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O3628.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3632.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3631.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3625.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3620.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3619.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3637.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H]1O3628.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3637.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3644.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3612.1Semi standard non polar33892256
Galactinol,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3613.2Semi standard non polar33892256
Galactinol,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3610.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3620.9Semi standard non polar33892256
Galactinol,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3622.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3625.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3604.7Semi standard non polar33892256
Galactinol,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3608.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3632.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3608.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@@H]1CO3612.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #92CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3598.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #93CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3621.0Semi standard non polar33892256
Galactinol,4TBDMS,isomer #94CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3630.8Semi standard non polar33892256
Galactinol,4TBDMS,isomer #95CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3627.3Semi standard non polar33892256
Galactinol,4TBDMS,isomer #96CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3613.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #97CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3610.5Semi standard non polar33892256
Galactinol,4TBDMS,isomer #98CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3608.4Semi standard non polar33892256
Galactinol,4TBDMS,isomer #99CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@H]1O3619.2Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_4_11) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_22) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_23) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_25) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_26) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_31) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_5_56) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_11) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_16) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_21) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_28) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_29) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_31) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_32) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_36) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_51) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_6_52) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_1) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_6) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_11) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_12) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_16) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_17) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_21) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Galactinol GC-MS (TMS_7_22) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol LC-ESI-QTOF 32V, negative-QTOFsplash10-0h4x-7904000000-ccaf9f6687f64152ff232020-07-21HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 8V, negative-QTOFsplash10-0006-0109000000-8102050f464d000d36392020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 11V, negative-QTOFsplash10-0006-2609000000-e6624e0c1ee1a4dd5d1e2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 13V, negative-QTOFsplash10-002o-5904000000-4283a4fb4f8cf4f19d742020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 15V, negative-QTOFsplash10-0m0l-7901000000-d5688e9378c34693bb5d2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 20V, negative-QTOFsplash10-0m50-9700000000-f5df8546e5822b05f22d2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 25V, negative-QTOFsplash10-0c09-9400000000-21b8d5b25d2288b756652020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 30V, negative-QTOFsplash10-0abi-9200000000-e11f19704a4d0757d5c62020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 34V, negative-QTOFsplash10-0abi-9100000000-5df2f732d48fdb0b6b2e2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 39V, negative-QTOFsplash10-0abi-9000000000-98cab41297cfda142a652020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 43V, negative-QTOFsplash10-0a4r-9000000000-6d734010a85dbe389e5b2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol n/a 23V, negative-QTOFsplash10-03fr-1900000000-0e5e88acb391a53626332020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol n/a 23V, negative-QTOFsplash10-000j-9000000000-e7a410e700b0b77a74d12020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol n/a 23V, negative-QTOFsplash10-03di-1900000000-26f1961e559148ee12512020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 8V, negative-QTOFsplash10-00di-0309000000-e9fad444fae1c29237812020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 10V, negative-QTOFsplash10-00di-2809000000-f280939ea0cf3a8ee6c82020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 13V, negative-QTOFsplash10-0229-3904000000-a75f976ae237644aa4af2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 15V, negative-QTOFsplash10-0hbl-4902000000-28dd3b4eef1ceda8406d2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 19V, negative-QTOFsplash10-0gy9-7900000000-53a7af36249547a16c8f2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 23V, negative-QTOFsplash10-01w0-9600000000-063adbe73325b0d1127d2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 28V, negative-QTOFsplash10-0079-9300000000-5e0caa1781996476badf2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 32V, negative-QTOFsplash10-0079-9100000000-088bc383196e264f0b402020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 36V, negative-QTOFsplash10-0079-9100000000-864f9dcdd41cfca6c0a32020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 41V, negative-QTOFsplash10-059i-9000000000-eee622d63c038573c29d2020-07-22HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Galactinol Orbitrap 48V, negative-QTOFsplash10-05g0-9000000000-c55d0d4a53f1ba6842d12020-07-22HMDB team, MONAView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB001147
KNApSAcK IDC00001162
Chemspider ID19402461
KEGG Compound IDC01235
BioCyc IDCPD-458
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound381832774
PDB IDNot Available
ChEBI ID17505
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDrw1812041
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available

Enzymes

General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
GLA
Uniprot ID:
P06280
Molecular weight:
Not Available
Reactions
Galactinol + Water → myo-Inositol + beta-D-Galactosedetails