Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2009-01-29 11:31:47 UTC
Update Date2021-09-14 14:59:05 UTC
HMDB IDHMDB0011596
Secondary Accession Numbers
  • HMDB11596
Metabolite Identification
Common NameQueuosine
DescriptionQueuosine is a modified nucleoside that is present in certain tRNAs in bacteria and eukaryotes. Originally identified in E. coli, queuosine was found to occupy the first anticodon position of tRNAs for histidine, aspartic acid, asparagine and tyrosine. The first anticodon position pairs with the third "wobble" position in codons, and queuosine improves accuracy of translation. Synthesis of queuosine begins with GTP. In bacteria, two classes of riboswitch are known to regulate genes that are involved in the synthesis or transport of pre-queuosine1, a precursor to queuosine: PreQ1-I riboswitches and PreQ1-II riboswitches (Wikipedia ).
Structure
Data?1582752927
Synonyms
ValueSource
(7-(((4,5-cis-Dihydroxy-2-cyclopenten-1-yl)amino)methyl)-7-deazaguanosine)HMDB
(Imidazol-4-yl)acetaldehydeHMDB
Chemical FormulaC17H23N5O7
Average Molecular Weight409.3938
Monoisotopic Molecular Weight409.159748115
IUPAC Name2-amino-7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-({[(1S,4S,5R)-4,5-dihydroxycyclopent-2-en-1-yl]amino}methyl)-1H,4H,7H-pyrrolo[2,3-d]pyrimidin-4-one
Traditional Name2-amino-7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-({[(1S,4S,5R)-4,5-dihydroxycyclopent-2-en-1-yl]amino}methyl)-1H-pyrrolo[2,3-d]pyrimidin-4-one
CAS Registry Number57072-36-3
SMILES
NC1=NC(=O)C2=C(N1)N(C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)C1O[C@H](CO)[C@@H](O)[C@H]1O
InChI Identifier
InChI=1S/C17H23N5O7/c18-17-20-14-10(15(28)21-17)6(3-19-7-1-2-8(24)11(7)25)4-22(14)16-13(27)12(26)9(5-23)29-16/h1-2,4,7-9,11-13,16,19,23-27H,3,5H2,(H3,18,20,21,28)/t7-,8-,9+,11+,12+,13+,16?/m0/s1
InChI KeyQQXQGKSPIMGUIZ-FSIZVHFJSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as pyrrolopyrimidine nucleosides and nucleotides. These are nucleoside derivatives containing a ribose derivative which is n-glycosylated to a pyrrolopyrimidine. Also called deazapurine nucleosides, they are analogs of purine nucleosides with the N atom of the purine being replaced by a C atom at position 7.
KingdomOrganic compounds
Super ClassNucleosides, nucleotides, and analogues
ClassPyrrolopyrimidine nucleosides and nucleotides
Sub ClassNot Available
Direct ParentPyrrolopyrimidine nucleosides and nucleotides
Alternative Parents
Substituents
  • Pyrrolopyrimidine ribonucleoside
  • Glycosyl compound
  • N-glycosyl compound
  • Pentose monosaccharide
  • Pyrrolopyrimidine
  • Pyrrolo[2,3-d]pyrimidine
  • Aminopyrimidine
  • Aralkylamine
  • Pyrimidone
  • Monosaccharide
  • Substituted pyrrole
  • Pyrimidine
  • Pyrrole
  • Vinylogous amide
  • Tetrahydrofuran
  • Heteroaromatic compound
  • Secondary alcohol
  • Secondary aliphatic amine
  • Oxacycle
  • Azacycle
  • Organoheterocyclic compound
  • Secondary amine
  • Primary alcohol
  • Hydrocarbon derivative
  • Organooxygen compound
  • Organonitrogen compound
  • Organic oxide
  • Organopnictogen compound
  • Organic oxygen compound
  • Primary amine
  • Amine
  • Organic nitrogen compound
  • Alcohol
  • Aromatic heteropolycyclic compound
Molecular FrameworkAromatic heteropolycyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Source

Route of exposure

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility7.96 g/LALOGPS
logP10(-1.8) g/LALOGPS
logP10(-2.8) g/LChemAxon
logS10(-1.7) g/LALOGPS
pKa (Strongest Acidic)9.06ChemAxon
pKa (Strongest Basic)7.21ChemAxon
Physiological Charge1ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area194.82 ŲChemAxon
Rotatable Bond Count5ChemAxon
Refractivity99.56 m³·mol⁻¹ChemAxon
Polarizability40.65 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+193.27331661259
DarkChem[M-H]-190.17931661259

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
QueuosineNC1=NC(=O)C2=C(N1)N(C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)C1O[C@H](CO)[C@@H](O)[C@H]1O4364.3Standard polar33892256
QueuosineNC1=NC(=O)C2=C(N1)N(C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)C1O[C@H](CO)[C@@H](O)[C@H]1O2348.1Standard non polar33892256
QueuosineNC1=NC(=O)C2=C(N1)N(C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)C1O[C@H](CO)[C@@H](O)[C@H]1O4259.3Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Queuosine,1TMS,isomer #1C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O3742.1Semi standard non polar33892256
Queuosine,1TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]23741.9Semi standard non polar33892256
Queuosine,1TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3728.2Semi standard non polar33892256
Queuosine,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3720.4Semi standard non polar33892256
Queuosine,1TMS,isomer #5C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O3721.7Semi standard non polar33892256
Queuosine,1TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3817.3Semi standard non polar33892256
Queuosine,1TMS,isomer #7C[Si](C)(C)N1C(N)=NC(=O)C2=C1N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3747.7Semi standard non polar33892256
Queuosine,1TMS,isomer #8C[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]2)[C@H]1C=C[C@H](O)[C@@H]1O3773.1Semi standard non polar33892256
Queuosine,2TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3612.8Semi standard non polar33892256
Queuosine,2TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)[NH]23640.7Semi standard non polar33892256
Queuosine,2TMS,isomer #11C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3724.0Semi standard non polar33892256
Queuosine,2TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C3679.8Semi standard non polar33892256
Queuosine,2TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C3707.3Semi standard non polar33892256
Queuosine,2TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3588.2Semi standard non polar33892256
Queuosine,2TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3571.5Semi standard non polar33892256
Queuosine,2TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3722.6Semi standard non polar33892256
Queuosine,2TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3677.7Semi standard non polar33892256
Queuosine,2TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3685.9Semi standard non polar33892256
Queuosine,2TMS,isomer #19C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3578.5Semi standard non polar33892256
Queuosine,2TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3623.2Semi standard non polar33892256
Queuosine,2TMS,isomer #20C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3703.3Semi standard non polar33892256
Queuosine,2TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3675.4Semi standard non polar33892256
Queuosine,2TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3692.6Semi standard non polar33892256
Queuosine,2TMS,isomer #23C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3699.0Semi standard non polar33892256
Queuosine,2TMS,isomer #24C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O3673.1Semi standard non polar33892256
Queuosine,2TMS,isomer #25C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O3685.3Semi standard non polar33892256
Queuosine,2TMS,isomer #26C[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3710.3Semi standard non polar33892256
Queuosine,2TMS,isomer #27C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3768.5Semi standard non polar33892256
Queuosine,2TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3756.4Semi standard non polar33892256
Queuosine,2TMS,isomer #29C[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C)[C@H]1C=C[C@H](O)[C@@H]1O3749.3Semi standard non polar33892256
Queuosine,2TMS,isomer #3C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O3622.2Semi standard non polar33892256
Queuosine,2TMS,isomer #4C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C3619.1Semi standard non polar33892256
Queuosine,2TMS,isomer #5C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3698.8Semi standard non polar33892256
Queuosine,2TMS,isomer #6C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O3681.1Semi standard non polar33892256
Queuosine,2TMS,isomer #7C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O3702.6Semi standard non polar33892256
Queuosine,2TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3635.7Semi standard non polar33892256
Queuosine,2TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3642.2Semi standard non polar33892256
Queuosine,3TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3516.4Semi standard non polar33892256
Queuosine,3TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3597.0Semi standard non polar33892256
Queuosine,3TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3611.7Semi standard non polar33892256
Queuosine,3TMS,isomer #12C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C3546.2Semi standard non polar33892256
Queuosine,3TMS,isomer #13C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3615.0Semi standard non polar33892256
Queuosine,3TMS,isomer #14C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O3598.4Semi standard non polar33892256
Queuosine,3TMS,isomer #15C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O3611.3Semi standard non polar33892256
Queuosine,3TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3630.4Semi standard non polar33892256
Queuosine,3TMS,isomer #17C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3609.0Semi standard non polar33892256
Queuosine,3TMS,isomer #18C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3625.4Semi standard non polar33892256
Queuosine,3TMS,isomer #19C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O3647.7Semi standard non polar33892256
Queuosine,3TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3483.9Semi standard non polar33892256
Queuosine,3TMS,isomer #20C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3684.6Semi standard non polar33892256
Queuosine,3TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3685.1Semi standard non polar33892256
Queuosine,3TMS,isomer #22C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3690.5Semi standard non polar33892256
Queuosine,3TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3509.3Semi standard non polar33892256
Queuosine,3TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3505.9Semi standard non polar33892256
Queuosine,3TMS,isomer #25C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3637.4Semi standard non polar33892256
Queuosine,3TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3583.3Semi standard non polar33892256
Queuosine,3TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3619.0Semi standard non polar33892256
Queuosine,3TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)[NH]23531.6Semi standard non polar33892256
Queuosine,3TMS,isomer #29C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3645.0Semi standard non polar33892256
Queuosine,3TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3479.9Semi standard non polar33892256
Queuosine,3TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3595.0Semi standard non polar33892256
Queuosine,3TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3632.1Semi standard non polar33892256
Queuosine,3TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3644.4Semi standard non polar33892256
Queuosine,3TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C3596.9Semi standard non polar33892256
Queuosine,3TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C3631.4Semi standard non polar33892256
Queuosine,3TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]23676.5Semi standard non polar33892256
Queuosine,3TMS,isomer #36C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3706.5Semi standard non polar33892256
Queuosine,3TMS,isomer #37C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3698.5Semi standard non polar33892256
Queuosine,3TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C)[Si](C)(C)C3699.0Semi standard non polar33892256
Queuosine,3TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3482.4Semi standard non polar33892256
Queuosine,3TMS,isomer #4C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3617.4Semi standard non polar33892256
Queuosine,3TMS,isomer #40C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3624.5Semi standard non polar33892256
Queuosine,3TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3580.8Semi standard non polar33892256
Queuosine,3TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3600.2Semi standard non polar33892256
Queuosine,3TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3602.4Semi standard non polar33892256
Queuosine,3TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3560.7Semi standard non polar33892256
Queuosine,3TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3588.2Semi standard non polar33892256
Queuosine,3TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3653.8Semi standard non polar33892256
Queuosine,3TMS,isomer #47C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3682.0Semi standard non polar33892256
Queuosine,3TMS,isomer #48C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3680.3Semi standard non polar33892256
Queuosine,3TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3680.3Semi standard non polar33892256
Queuosine,3TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3583.7Semi standard non polar33892256
Queuosine,3TMS,isomer #50C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3615.1Semi standard non polar33892256
Queuosine,3TMS,isomer #51C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3583.0Semi standard non polar33892256
Queuosine,3TMS,isomer #52C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3592.4Semi standard non polar33892256
Queuosine,3TMS,isomer #53C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3646.8Semi standard non polar33892256
Queuosine,3TMS,isomer #54C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3683.0Semi standard non polar33892256
Queuosine,3TMS,isomer #55C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3673.5Semi standard non polar33892256
Queuosine,3TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3682.4Semi standard non polar33892256
Queuosine,3TMS,isomer #57C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O3643.4Semi standard non polar33892256
Queuosine,3TMS,isomer #58C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3682.0Semi standard non polar33892256
Queuosine,3TMS,isomer #59C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3673.8Semi standard non polar33892256
Queuosine,3TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3607.9Semi standard non polar33892256
Queuosine,3TMS,isomer #60C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O3688.4Semi standard non polar33892256
Queuosine,3TMS,isomer #61C[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[C@H]1C=C[C@H](O)[C@@H]1O3694.8Semi standard non polar33892256
Queuosine,3TMS,isomer #62C[Si](C)(C)N(C1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C)[Si](C)(C)C3713.4Semi standard non polar33892256
Queuosine,3TMS,isomer #63C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3753.7Semi standard non polar33892256
Queuosine,3TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3540.1Semi standard non polar33892256
Queuosine,3TMS,isomer #8C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O3499.8Semi standard non polar33892256
Queuosine,3TMS,isomer #9C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3611.8Semi standard non polar33892256
Queuosine,4TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3472.2Semi standard non polar33892256
Queuosine,4TMS,isomer #10C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3547.2Semi standard non polar33892256
Queuosine,4TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3512.3Semi standard non polar33892256
Queuosine,4TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3539.8Semi standard non polar33892256
Queuosine,4TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3606.6Semi standard non polar33892256
Queuosine,4TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3617.1Semi standard non polar33892256
Queuosine,4TMS,isomer #15C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3637.9Semi standard non polar33892256
Queuosine,4TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3630.5Semi standard non polar33892256
Queuosine,4TMS,isomer #17C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C3485.0Semi standard non polar33892256
Queuosine,4TMS,isomer #18C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.8Semi standard non polar33892256
Queuosine,4TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3567.8Semi standard non polar33892256
Queuosine,4TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3463.3Semi standard non polar33892256
Queuosine,4TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3593.0Semi standard non polar33892256
Queuosine,4TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3566.5Semi standard non polar33892256
Queuosine,4TMS,isomer #22C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O3539.1Semi standard non polar33892256
Queuosine,4TMS,isomer #23C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O3555.5Semi standard non polar33892256
Queuosine,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3607.5Semi standard non polar33892256
Queuosine,4TMS,isomer #25C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3624.7Semi standard non polar33892256
Queuosine,4TMS,isomer #26C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3629.6Semi standard non polar33892256
Queuosine,4TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3637.0Semi standard non polar33892256
Queuosine,4TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3611.6Semi standard non polar33892256
Queuosine,4TMS,isomer #29C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3575.1Semi standard non polar33892256
Queuosine,4TMS,isomer #3C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3584.9Semi standard non polar33892256
Queuosine,4TMS,isomer #30C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3604.2Semi standard non polar33892256
Queuosine,4TMS,isomer #31C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O3614.1Semi standard non polar33892256
Queuosine,4TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3629.5Semi standard non polar33892256
Queuosine,4TMS,isomer #33C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3641.5Semi standard non polar33892256
Queuosine,4TMS,isomer #34C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3640.9Semi standard non polar33892256
Queuosine,4TMS,isomer #35C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C3626.3Semi standard non polar33892256
Queuosine,4TMS,isomer #36C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3662.0Semi standard non polar33892256
Queuosine,4TMS,isomer #37C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3659.8Semi standard non polar33892256
Queuosine,4TMS,isomer #38C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3663.1Semi standard non polar33892256
Queuosine,4TMS,isomer #39C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O3661.0Semi standard non polar33892256
Queuosine,4TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3546.2Semi standard non polar33892256
Queuosine,4TMS,isomer #40C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O3692.0Semi standard non polar33892256
Queuosine,4TMS,isomer #41C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3707.8Semi standard non polar33892256
Queuosine,4TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3443.5Semi standard non polar33892256
Queuosine,4TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3577.0Semi standard non polar33892256
Queuosine,4TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3520.7Semi standard non polar33892256
Queuosine,4TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3559.2Semi standard non polar33892256
Queuosine,4TMS,isomer #46C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3557.0Semi standard non polar33892256
Queuosine,4TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3511.7Semi standard non polar33892256
Queuosine,4TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3545.5Semi standard non polar33892256
Queuosine,4TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3619.4Semi standard non polar33892256
Queuosine,4TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3572.6Semi standard non polar33892256
Queuosine,4TMS,isomer #50C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3629.6Semi standard non polar33892256
Queuosine,4TMS,isomer #51C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3645.4Semi standard non polar33892256
Queuosine,4TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3629.2Semi standard non polar33892256
Queuosine,4TMS,isomer #53C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3585.2Semi standard non polar33892256
Queuosine,4TMS,isomer #54C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C3537.5Semi standard non polar33892256
Queuosine,4TMS,isomer #55C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C3575.4Semi standard non polar33892256
Queuosine,4TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3630.8Semi standard non polar33892256
Queuosine,4TMS,isomer #57C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3645.0Semi standard non polar33892256
Queuosine,4TMS,isomer #58C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3648.8Semi standard non polar33892256
Queuosine,4TMS,isomer #59C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3652.4Semi standard non polar33892256
Queuosine,4TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3439.1Semi standard non polar33892256
Queuosine,4TMS,isomer #60C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]23635.9Semi standard non polar33892256
Queuosine,4TMS,isomer #61C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3646.9Semi standard non polar33892256
Queuosine,4TMS,isomer #62C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3661.5Semi standard non polar33892256
Queuosine,4TMS,isomer #63C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C)[Si](C)(C)C3655.1Semi standard non polar33892256
Queuosine,4TMS,isomer #64C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[Si](C)(C)C3678.0Semi standard non polar33892256
Queuosine,4TMS,isomer #65C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C3708.4Semi standard non polar33892256
Queuosine,4TMS,isomer #66C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3722.7Semi standard non polar33892256
Queuosine,4TMS,isomer #67C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3576.8Semi standard non polar33892256
Queuosine,4TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3522.2Semi standard non polar33892256
Queuosine,4TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3544.8Semi standard non polar33892256
Queuosine,4TMS,isomer #7C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3569.8Semi standard non polar33892256
Queuosine,4TMS,isomer #70C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3604.5Semi standard non polar33892256
Queuosine,4TMS,isomer #71C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3623.3Semi standard non polar33892256
Queuosine,4TMS,isomer #72C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3628.7Semi standard non polar33892256
Queuosine,4TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3619.1Semi standard non polar33892256
Queuosine,4TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3584.3Semi standard non polar33892256
Queuosine,4TMS,isomer #75C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3601.5Semi standard non polar33892256
Queuosine,4TMS,isomer #76C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3608.9Semi standard non polar33892256
Queuosine,4TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3604.3Semi standard non polar33892256
Queuosine,4TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3657.8Semi standard non polar33892256
Queuosine,4TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3659.6Semi standard non polar33892256
Queuosine,4TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3526.8Semi standard non polar33892256
Queuosine,4TMS,isomer #80C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3688.3Semi standard non polar33892256
Queuosine,4TMS,isomer #81C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3599.3Semi standard non polar33892256
Queuosine,4TMS,isomer #82C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3618.2Semi standard non polar33892256
Queuosine,4TMS,isomer #83C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3621.8Semi standard non polar33892256
Queuosine,4TMS,isomer #84C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3617.2Semi standard non polar33892256
Queuosine,4TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3655.1Semi standard non polar33892256
Queuosine,4TMS,isomer #86C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3658.0Semi standard non polar33892256
Queuosine,4TMS,isomer #87C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3684.7Semi standard non polar33892256
Queuosine,4TMS,isomer #88C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O3660.2Semi standard non polar33892256
Queuosine,4TMS,isomer #89C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O3665.8Semi standard non polar33892256
Queuosine,4TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3551.6Semi standard non polar33892256
Queuosine,4TMS,isomer #90C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3691.0Semi standard non polar33892256
Queuosine,4TMS,isomer #91C[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C)[C@H]1C=C[C@H](O)[C@@H]1O3716.6Semi standard non polar33892256
Queuosine,5TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3468.9Semi standard non polar33892256
Queuosine,5TMS,isomer #10C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3642.2Semi standard non polar33892256
Queuosine,5TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O3633.5Semi standard non polar33892256
Queuosine,5TMS,isomer #12C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O3565.4Semi standard non polar33892256
Queuosine,5TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3518.8Semi standard non polar33892256
Queuosine,5TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3543.9Semi standard non polar33892256
Queuosine,5TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3594.3Semi standard non polar33892256
Queuosine,5TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3604.1Semi standard non polar33892256
Queuosine,5TMS,isomer #17C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3619.2Semi standard non polar33892256
Queuosine,5TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3610.6Semi standard non polar33892256
Queuosine,5TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3578.6Semi standard non polar33892256
Queuosine,5TMS,isomer #2C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3583.2Semi standard non polar33892256
Queuosine,5TMS,isomer #20C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3588.1Semi standard non polar33892256
Queuosine,5TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3603.0Semi standard non polar33892256
Queuosine,5TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3595.0Semi standard non polar33892256
Queuosine,5TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3636.3Semi standard non polar33892256
Queuosine,5TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3658.2Semi standard non polar33892256
Queuosine,5TMS,isomer #25C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3663.1Semi standard non polar33892256
Queuosine,5TMS,isomer #26C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3591.4Semi standard non polar33892256
Queuosine,5TMS,isomer #27C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3558.4Semi standard non polar33892256
Queuosine,5TMS,isomer #28C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3581.7Semi standard non polar33892256
Queuosine,5TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3625.1Semi standard non polar33892256
Queuosine,5TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3540.9Semi standard non polar33892256
Queuosine,5TMS,isomer #30C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3642.4Semi standard non polar33892256
Queuosine,5TMS,isomer #31C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3652.1Semi standard non polar33892256
Queuosine,5TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]1O3651.8Semi standard non polar33892256
Queuosine,5TMS,isomer #33C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O3597.8Semi standard non polar33892256
Queuosine,5TMS,isomer #34C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3616.0Semi standard non polar33892256
Queuosine,5TMS,isomer #35C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3622.3Semi standard non polar33892256
Queuosine,5TMS,isomer #36C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3621.6Semi standard non polar33892256
Queuosine,5TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3642.5Semi standard non polar33892256
Queuosine,5TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3657.7Semi standard non polar33892256
Queuosine,5TMS,isomer #39C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3663.4Semi standard non polar33892256
Queuosine,5TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3571.7Semi standard non polar33892256
Queuosine,5TMS,isomer #40C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C3633.5Semi standard non polar33892256
Queuosine,5TMS,isomer #41C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3653.5Semi standard non polar33892256
Queuosine,5TMS,isomer #42C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3663.5Semi standard non polar33892256
Queuosine,5TMS,isomer #43C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3667.8Semi standard non polar33892256
Queuosine,5TMS,isomer #44C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O3647.5Semi standard non polar33892256
Queuosine,5TMS,isomer #45C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O3671.1Semi standard non polar33892256
Queuosine,5TMS,isomer #46C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3679.5Semi standard non polar33892256
Queuosine,5TMS,isomer #47C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3673.4Semi standard non polar33892256
Queuosine,5TMS,isomer #48C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3692.1Semi standard non polar33892256
Queuosine,5TMS,isomer #49C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3707.1Semi standard non polar33892256
Queuosine,5TMS,isomer #5C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3565.7Semi standard non polar33892256
Queuosine,5TMS,isomer #50C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3720.0Semi standard non polar33892256
Queuosine,5TMS,isomer #51C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C3570.3Semi standard non polar33892256
Queuosine,5TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3516.0Semi standard non polar33892256
Queuosine,5TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3556.6Semi standard non polar33892256
Queuosine,5TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3607.7Semi standard non polar33892256
Queuosine,5TMS,isomer #55C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3613.6Semi standard non polar33892256
Queuosine,5TMS,isomer #56C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3634.4Semi standard non polar33892256
Queuosine,5TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3612.3Semi standard non polar33892256
Queuosine,5TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3592.4Semi standard non polar33892256
Queuosine,5TMS,isomer #59C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3600.3Semi standard non polar33892256
Queuosine,5TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3527.7Semi standard non polar33892256
Queuosine,5TMS,isomer #60C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3617.1Semi standard non polar33892256
Queuosine,5TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3598.4Semi standard non polar33892256
Queuosine,5TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3644.7Semi standard non polar33892256
Queuosine,5TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3675.7Semi standard non polar33892256
Queuosine,5TMS,isomer #64C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3672.6Semi standard non polar33892256
Queuosine,5TMS,isomer #65C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]23615.2Semi standard non polar33892256
Queuosine,5TMS,isomer #66C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3630.5Semi standard non polar33892256
Queuosine,5TMS,isomer #67C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3642.0Semi standard non polar33892256
Queuosine,5TMS,isomer #68C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C)[Si](C)(C)C3632.4Semi standard non polar33892256
Queuosine,5TMS,isomer #69C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3652.5Semi standard non polar33892256
Queuosine,5TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3558.0Semi standard non polar33892256
Queuosine,5TMS,isomer #70C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3681.8Semi standard non polar33892256
Queuosine,5TMS,isomer #71C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3680.4Semi standard non polar33892256
Queuosine,5TMS,isomer #72C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[Si](C)(C)C3658.3Semi standard non polar33892256
Queuosine,5TMS,isomer #73C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C3693.2Semi standard non polar33892256
Queuosine,5TMS,isomer #74C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3697.1Semi standard non polar33892256
Queuosine,5TMS,isomer #75C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C)[Si](C)(C)C3729.2Semi standard non polar33892256
Queuosine,5TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3598.3Semi standard non polar33892256
Queuosine,5TMS,isomer #77C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C3613.1Semi standard non polar33892256
Queuosine,5TMS,isomer #78C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C3618.1Semi standard non polar33892256
Queuosine,5TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3605.0Semi standard non polar33892256
Queuosine,5TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3601.1Semi standard non polar33892256
Queuosine,5TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3638.6Semi standard non polar33892256
Queuosine,5TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3647.9Semi standard non polar33892256
Queuosine,5TMS,isomer #82C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3655.9Semi standard non polar33892256
Queuosine,5TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3624.4Semi standard non polar33892256
Queuosine,5TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3628.8Semi standard non polar33892256
Queuosine,5TMS,isomer #85C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3634.9Semi standard non polar33892256
Queuosine,5TMS,isomer #86C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3699.4Semi standard non polar33892256
Queuosine,5TMS,isomer #87C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3639.2Semi standard non polar33892256
Queuosine,5TMS,isomer #88C[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3642.5Semi standard non polar33892256
Queuosine,5TMS,isomer #89C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3651.7Semi standard non polar33892256
Queuosine,5TMS,isomer #9C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3629.9Semi standard non polar33892256
Queuosine,5TMS,isomer #90C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3698.0Semi standard non polar33892256
Queuosine,5TMS,isomer #91C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O3705.0Semi standard non polar33892256
Queuosine,6TMS,isomer #1C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3604.5Semi standard non polar33892256
Queuosine,6TMS,isomer #1C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3237.7Standard non polar33892256
Queuosine,6TMS,isomer #1C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4494.1Standard polar33892256
Queuosine,6TMS,isomer #10C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3647.8Semi standard non polar33892256
Queuosine,6TMS,isomer #10C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3306.8Standard non polar33892256
Queuosine,6TMS,isomer #10C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C4516.7Standard polar33892256
Queuosine,6TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3640.9Semi standard non polar33892256
Queuosine,6TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3050.1Standard non polar33892256
Queuosine,6TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4908.9Standard polar33892256
Queuosine,6TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3672.7Semi standard non polar33892256
Queuosine,6TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3310.3Standard non polar33892256
Queuosine,6TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4537.8Standard polar33892256
Queuosine,6TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3688.5Semi standard non polar33892256
Queuosine,6TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3499.7Standard non polar33892256
Queuosine,6TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4529.6Standard polar33892256
Queuosine,6TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3696.4Semi standard non polar33892256
Queuosine,6TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3232.3Standard non polar33892256
Queuosine,6TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4681.6Standard polar33892256
Queuosine,6TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3608.8Semi standard non polar33892256
Queuosine,6TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3356.0Standard non polar33892256
Queuosine,6TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4709.0Standard polar33892256
Queuosine,6TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3622.3Semi standard non polar33892256
Queuosine,6TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3122.3Standard non polar33892256
Queuosine,6TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C4893.1Standard polar33892256
Queuosine,6TMS,isomer #17C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3639.3Semi standard non polar33892256
Queuosine,6TMS,isomer #17C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C3293.4Standard non polar33892256
Queuosine,6TMS,isomer #17C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)N1[Si](C)(C)C4829.8Standard polar33892256
Queuosine,6TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3633.0Semi standard non polar33892256
Queuosine,6TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3089.7Standard non polar33892256
Queuosine,6TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C5203.8Standard polar33892256
Queuosine,6TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3644.8Semi standard non polar33892256
Queuosine,6TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3325.8Standard non polar33892256
Queuosine,6TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4885.1Standard polar33892256
Queuosine,6TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3569.2Semi standard non polar33892256
Queuosine,6TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2979.5Standard non polar33892256
Queuosine,6TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4774.7Standard polar33892256
Queuosine,6TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3670.8Semi standard non polar33892256
Queuosine,6TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3486.9Standard non polar33892256
Queuosine,6TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4859.9Standard polar33892256
Queuosine,6TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3669.1Semi standard non polar33892256
Queuosine,6TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3256.3Standard non polar33892256
Queuosine,6TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C4998.8Standard polar33892256
Queuosine,6TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3633.3Semi standard non polar33892256
Queuosine,6TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3278.3Standard non polar33892256
Queuosine,6TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4791.5Standard polar33892256
Queuosine,6TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3653.8Semi standard non polar33892256
Queuosine,6TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3443.5Standard non polar33892256
Queuosine,6TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4772.3Standard polar33892256
Queuosine,6TMS,isomer #24C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3650.4Semi standard non polar33892256
Queuosine,6TMS,isomer #24C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3207.8Standard non polar33892256
Queuosine,6TMS,isomer #24C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C4912.0Standard polar33892256
Queuosine,6TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3712.4Semi standard non polar33892256
Queuosine,6TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3411.8Standard non polar33892256
Queuosine,6TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4926.5Standard polar33892256
Queuosine,6TMS,isomer #26C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C3643.5Semi standard non polar33892256
Queuosine,6TMS,isomer #26C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C3362.2Standard non polar33892256
Queuosine,6TMS,isomer #26C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C4326.4Standard polar33892256
Queuosine,6TMS,isomer #27C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3664.7Semi standard non polar33892256
Queuosine,6TMS,isomer #27C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3081.0Standard non polar33892256
Queuosine,6TMS,isomer #27C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C4525.3Standard polar33892256
Queuosine,6TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3670.9Semi standard non polar33892256
Queuosine,6TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3290.3Standard non polar33892256
Queuosine,6TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C4470.1Standard polar33892256
Queuosine,6TMS,isomer #29C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3674.5Semi standard non polar33892256
Queuosine,6TMS,isomer #29C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3041.5Standard non polar33892256
Queuosine,6TMS,isomer #29C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4890.3Standard polar33892256
Queuosine,6TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3589.2Semi standard non polar33892256
Queuosine,6TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3146.7Standard non polar33892256
Queuosine,6TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4878.8Standard polar33892256
Queuosine,6TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3682.0Semi standard non polar33892256
Queuosine,6TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3251.9Standard non polar33892256
Queuosine,6TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O4404.2Standard polar33892256
Queuosine,6TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3702.3Semi standard non polar33892256
Queuosine,6TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3452.7Standard non polar33892256
Queuosine,6TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O4392.0Standard polar33892256
Queuosine,6TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3701.4Semi standard non polar33892256
Queuosine,6TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3173.2Standard non polar33892256
Queuosine,6TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4545.1Standard polar33892256
Queuosine,6TMS,isomer #33C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O3658.7Semi standard non polar33892256
Queuosine,6TMS,isomer #33C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O3264.5Standard non polar33892256
Queuosine,6TMS,isomer #33C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O4759.4Standard polar33892256
Queuosine,6TMS,isomer #34C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O3673.1Semi standard non polar33892256
Queuosine,6TMS,isomer #34C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O3432.8Standard non polar33892256
Queuosine,6TMS,isomer #34C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O4732.9Standard polar33892256
Queuosine,6TMS,isomer #35C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3677.3Semi standard non polar33892256
Queuosine,6TMS,isomer #35C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3197.0Standard non polar33892256
Queuosine,6TMS,isomer #35C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C4871.6Standard polar33892256
Queuosine,6TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3712.3Semi standard non polar33892256
Queuosine,6TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3361.3Standard non polar33892256
Queuosine,6TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O4800.5Standard polar33892256
Queuosine,6TMS,isomer #37C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3689.2Semi standard non polar33892256
Queuosine,6TMS,isomer #37C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3307.3Standard non polar33892256
Queuosine,6TMS,isomer #37C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]3)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4504.0Standard polar33892256
Queuosine,6TMS,isomer #38C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3709.4Semi standard non polar33892256
Queuosine,6TMS,isomer #38C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C3493.4Standard non polar33892256
Queuosine,6TMS,isomer #38C[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[C@H]1O[Si](C)(C)C4488.7Standard polar33892256
Queuosine,6TMS,isomer #39C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3715.4Semi standard non polar33892256
Queuosine,6TMS,isomer #39C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3229.2Standard non polar33892256
Queuosine,6TMS,isomer #39C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4640.2Standard polar33892256
Queuosine,6TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3627.8Semi standard non polar33892256
Queuosine,6TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3422.6Standard non polar33892256
Queuosine,6TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4471.1Standard polar33892256
Queuosine,6TMS,isomer #40C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3721.2Semi standard non polar33892256
Queuosine,6TMS,isomer #40C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O3405.9Standard non polar33892256
Queuosine,6TMS,isomer #40C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O4885.8Standard polar33892256
Queuosine,6TMS,isomer #41C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3750.8Semi standard non polar33892256
Queuosine,6TMS,isomer #41C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3390.6Standard non polar33892256
Queuosine,6TMS,isomer #41C[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N3[Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4561.7Standard polar33892256
Queuosine,6TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3619.6Semi standard non polar33892256
Queuosine,6TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3453.6Standard non polar33892256
Queuosine,6TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4537.9Standard polar33892256
Queuosine,6TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3631.9Semi standard non polar33892256
Queuosine,6TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3192.9Standard non polar33892256
Queuosine,6TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C4740.7Standard polar33892256
Queuosine,6TMS,isomer #44C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3655.1Semi standard non polar33892256
Queuosine,6TMS,isomer #44C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3394.4Standard non polar33892256
Queuosine,6TMS,isomer #44C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C4679.8Standard polar33892256
Queuosine,6TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3639.2Semi standard non polar33892256
Queuosine,6TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3166.1Standard non polar33892256
Queuosine,6TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C5072.8Standard polar33892256
Queuosine,6TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3653.6Semi standard non polar33892256
Queuosine,6TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3401.8Standard non polar33892256
Queuosine,6TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4733.1Standard polar33892256
Queuosine,6TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3689.6Semi standard non polar33892256
Queuosine,6TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3578.5Standard non polar33892256
Queuosine,6TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4709.1Standard polar33892256
Queuosine,6TMS,isomer #48C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3678.7Semi standard non polar33892256
Queuosine,6TMS,isomer #48C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3335.7Standard non polar33892256
Queuosine,6TMS,isomer #48C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4850.5Standard polar33892256
Queuosine,6TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3641.7Semi standard non polar33892256
Queuosine,6TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3352.6Standard non polar33892256
Queuosine,6TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4629.1Standard polar33892256
Queuosine,6TMS,isomer #5C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3648.7Semi standard non polar33892256
Queuosine,6TMS,isomer #5C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3145.0Standard non polar33892256
Queuosine,6TMS,isomer #5C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C4665.5Standard polar33892256
Queuosine,6TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3673.4Semi standard non polar33892256
Queuosine,6TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3537.9Standard non polar33892256
Queuosine,6TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4614.2Standard polar33892256
Queuosine,6TMS,isomer #51C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3661.6Semi standard non polar33892256
Queuosine,6TMS,isomer #51C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3286.1Standard non polar33892256
Queuosine,6TMS,isomer #51C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4762.4Standard polar33892256
Queuosine,6TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3719.4Semi standard non polar33892256
Queuosine,6TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O3489.0Standard non polar33892256
Queuosine,6TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4777.8Standard polar33892256
Queuosine,6TMS,isomer #53C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[Si](C)(C)C3669.9Semi standard non polar33892256
Queuosine,6TMS,isomer #53C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[Si](C)(C)C3343.1Standard non polar33892256
Queuosine,6TMS,isomer #53C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]2)[Si](C)(C)C4591.0Standard polar33892256
Queuosine,6TMS,isomer #54C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C3693.1Semi standard non polar33892256
Queuosine,6TMS,isomer #54C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C3527.5Standard non polar33892256
Queuosine,6TMS,isomer #54C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C4567.2Standard polar33892256
Queuosine,6TMS,isomer #55C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3688.2Semi standard non polar33892256
Queuosine,6TMS,isomer #55C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3279.1Standard non polar33892256
Queuosine,6TMS,isomer #55C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4723.4Standard polar33892256
Queuosine,6TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3725.2Semi standard non polar33892256
Queuosine,6TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O3442.6Standard non polar33892256
Queuosine,6TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]1O4649.7Standard polar33892256
Queuosine,6TMS,isomer #57C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C)[Si](C)(C)C3734.0Semi standard non polar33892256
Queuosine,6TMS,isomer #57C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C)[Si](C)(C)C3490.0Standard non polar33892256
Queuosine,6TMS,isomer #57C[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N2[Si](C)(C)C)[Si](C)(C)C4738.4Standard polar33892256
Queuosine,6TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3645.3Semi standard non polar33892256
Queuosine,6TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3371.7Standard non polar33892256
Queuosine,6TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4816.9Standard polar33892256
Queuosine,6TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3658.2Semi standard non polar33892256
Queuosine,6TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3540.5Standard non polar33892256
Queuosine,6TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4791.7Standard polar33892256
Queuosine,6TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3665.8Semi standard non polar33892256
Queuosine,6TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C3352.5Standard non polar33892256
Queuosine,6TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)N1[Si](C)(C)C4612.8Standard polar33892256
Queuosine,6TMS,isomer #60C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3663.5Semi standard non polar33892256
Queuosine,6TMS,isomer #60C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C3312.8Standard non polar33892256
Queuosine,6TMS,isomer #60C[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C)N1[Si](C)(C)C4930.1Standard polar33892256
Queuosine,6TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3704.8Semi standard non polar33892256
Queuosine,6TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3511.6Standard non polar33892256
Queuosine,6TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4959.5Standard polar33892256
Queuosine,6TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3686.6Semi standard non polar33892256
Queuosine,6TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3467.4Standard non polar33892256
Queuosine,6TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4872.9Standard polar33892256
Queuosine,6TMS,isomer #63C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3702.1Semi standard non polar33892256
Queuosine,6TMS,isomer #63C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C3465.4Standard non polar33892256
Queuosine,6TMS,isomer #63C[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C4835.9Standard polar33892256
Queuosine,6TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3659.5Semi standard non polar33892256
Queuosine,6TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O3098.6Standard non polar33892256
Queuosine,6TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[Si](C)(C)C)C3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C)[C@@H]1O4988.6Standard polar33892256
Queuosine,6TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3616.5Semi standard non polar33892256
Queuosine,6TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C3379.8Standard non polar33892256
Queuosine,6TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C4366.2Standard polar33892256
Queuosine,6TMS,isomer #9C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3632.3Semi standard non polar33892256
Queuosine,6TMS,isomer #9C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3098.7Standard non polar33892256
Queuosine,6TMS,isomer #9C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C4563.5Standard polar33892256
Queuosine,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O3934.6Semi standard non polar33892256
Queuosine,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]23932.1Semi standard non polar33892256
Queuosine,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O3947.5Semi standard non polar33892256
Queuosine,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@@H]1O3927.8Semi standard non polar33892256
Queuosine,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O3927.9Semi standard non polar33892256
Queuosine,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4028.0Semi standard non polar33892256
Queuosine,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)N1C(N)=NC(=O)C2=C1N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O3993.2Semi standard non polar33892256
Queuosine,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]2)[C@H]1C=C[C@H](O)[C@@H]1O3988.9Semi standard non polar33892256
Queuosine,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4050.3Semi standard non polar33892256
Queuosine,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)[NH]24040.9Semi standard non polar33892256
Queuosine,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4113.8Semi standard non polar33892256
Queuosine,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C(C)(C)C4085.0Semi standard non polar33892256
Queuosine,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C4127.5Semi standard non polar33892256
Queuosine,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4029.0Semi standard non polar33892256
Queuosine,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4021.2Semi standard non polar33892256
Queuosine,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4121.6Semi standard non polar33892256
Queuosine,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4107.7Semi standard non polar33892256
Queuosine,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4130.8Semi standard non polar33892256
Queuosine,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4013.3Semi standard non polar33892256
Queuosine,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4026.9Semi standard non polar33892256
Queuosine,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4102.9Semi standard non polar33892256
Queuosine,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4096.9Semi standard non polar33892256
Queuosine,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4124.7Semi standard non polar33892256
Queuosine,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4104.0Semi standard non polar33892256
Queuosine,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O4091.5Semi standard non polar33892256
Queuosine,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O4116.3Semi standard non polar33892256
Queuosine,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4124.7Semi standard non polar33892256
Queuosine,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4146.1Semi standard non polar33892256
Queuosine,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4188.1Semi standard non polar33892256
Queuosine,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@H](O)[C@@H]1O4167.1Semi standard non polar33892256
Queuosine,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O4030.7Semi standard non polar33892256
Queuosine,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C(C)(C)C4038.6Semi standard non polar33892256
Queuosine,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4116.5Semi standard non polar33892256
Queuosine,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O4091.1Semi standard non polar33892256
Queuosine,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[C@H]1O4131.5Semi standard non polar33892256
Queuosine,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4057.0Semi standard non polar33892256
Queuosine,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4034.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4150.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4203.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4238.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C(C)(C)C4130.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4207.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O4202.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[C@H]1O4233.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4206.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4207.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4251.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]3)[C@H]1O4221.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4126.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4242.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4286.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O4305.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4120.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4119.9Semi standard non polar33892256
Queuosine,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4204.1Semi standard non polar33892256
Queuosine,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4194.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4243.6Semi standard non polar33892256
Queuosine,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)[NH]24114.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4203.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4125.6Semi standard non polar33892256
Queuosine,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4190.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4242.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4212.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C(C)(C)C4188.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C4240.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]24226.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4251.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4286.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4305.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4115.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4201.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4183.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4184.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4219.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4176.1Semi standard non polar33892256
Queuosine,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4183.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4217.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4206.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4245.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4283.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4305.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4209.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4175.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4181.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4209.8Semi standard non polar33892256
Queuosine,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]1O4213.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4245.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4275.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4308.7Semi standard non polar33892256
Queuosine,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O4207.9Semi standard non polar33892256
Queuosine,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4244.0Semi standard non polar33892256
Queuosine,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4277.5Semi standard non polar33892256
Queuosine,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4239.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O4301.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]2)[C@H]1C=C[C@H](O)[C@@H]1O4277.6Semi standard non polar33892256
Queuosine,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4322.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4325.4Semi standard non polar33892256
Queuosine,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4114.2Semi standard non polar33892256
Queuosine,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O4113.3Semi standard non polar33892256
Queuosine,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4200.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4240.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4302.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4303.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4344.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4317.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4345.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4378.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4428.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[C@H]1O[Si](C)(C)C(C)(C)C4225.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4324.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@@H]1O4327.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4238.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4380.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4303.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O4303.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[C@H]1O4348.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]1O4330.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4361.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4396.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4434.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4325.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4330.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4316.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4383.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]3)[C@H]1O4329.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4358.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4394.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O4426.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]3)[C@H]1O[Si](C)(C)C(C)(C)C4340.2Semi standard non polar33892256
Queuosine,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4375.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4396.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N)N3[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4451.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](N(CC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]3)[Si](C)(C)C(C)(C)C)[C@H]1O4397.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O4326.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H](NCC2=CN(C3O[C@H](CO)[C@@H](O)[C@H]3O)C3=C2C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N3[Si](C)(C)C(C)(C)C)[C@H]1O4421.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4433.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4211.2Semi standard non polar33892256
Queuosine,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4290.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4295.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4334.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4293.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4293.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4338.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4314.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4375.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4355.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4373.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O4427.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4302.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)[NH]2)[Si](C)(C)C(C)(C)C4297.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C4345.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]1O4332.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4372.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4392.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]1O4435.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4236.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]24329.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4369.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4392.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)N=C(N)N2[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4428.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]2)[Si](C)(C)C(C)(C)C4403.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)C=C[C@@H]1NCC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N2[Si](C)(C)C(C)(C)C4421.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4445.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O)[C@@H]1O4283.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4303.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4341.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4300.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4307.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4344.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4378.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4416.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4302.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4342.0Semi standard non polar33892256
Queuosine,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4367.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4415.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4383.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@H](O)[C@@H]1O4410.2Semi standard non polar33892256
Queuosine,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN([C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4305.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4428.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4307.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N(C1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]1C=C[C@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4343.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN[C@H]2C=C[C@H](O)[C@@H]2O)N1[Si](C)(C)C(C)(C)C4373.8Semi standard non polar33892256
Queuosine,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4420.4Semi standard non polar33892256
Queuosine,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]1O4388.6Semi standard non polar33892256
Queuosine,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]1O4418.7Semi standard non polar33892256
Queuosine,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4436.5Semi standard non polar33892256
Queuosine,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN([C@H]3C=C[C@H](O)[C@@H]3O)[Si](C)(C)C(C)(C)C)C3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O4389.9Semi standard non polar33892256
Queuosine,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@H]1C(N2C=C(CN[C@H]3C=C[C@H](O)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)O[C@H](CO)[C@H]1O4424.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1OC(N2C=C(CN[C@H]3C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4339.1Semi standard non polar33892256
Queuosine,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N(C3O[C@H](CO)[C@@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C2CN([C@H]2C=C[C@H](O)[C@@H]2O)[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C4437.3Semi standard non polar33892256
Queuosine,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)N(CC1=CN(C2O[C@H](CO)[C@@H](O)[C@H]2O)C2=C1C(=O)N=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N2[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@H](O)[C@@H]1O4493.1Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Queuosine GC-MS (Non-derivatized) - 70eV, Positivesplash10-00bd-6019000000-e97e68fb7379782ccbb02017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Queuosine GC-MS (4 TMS) - 70eV, Positivesplash10-001i-5800029000-6c77c52dfdcc39c7eb282017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Queuosine GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Queuosine GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 10V, Positive-QTOFsplash10-03fr-0192300000-6d96e8b639678c99d0d62017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 20V, Positive-QTOFsplash10-03di-1691000000-524209d74b19824bc9722017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 40V, Positive-QTOFsplash10-03fr-2690000000-5c2418d2190c7fa5e1282017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 10V, Negative-QTOFsplash10-0a4i-0365900000-b72401c13028067c334e2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 20V, Negative-QTOFsplash10-004m-1391000000-0ccfb7d7c8d18f40744b2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 40V, Negative-QTOFsplash10-0f92-0690000000-c42312dc0243346876ee2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 10V, Negative-QTOFsplash10-056r-0591100000-55e36d79b18c6ad4b7412021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 20V, Negative-QTOFsplash10-056s-1298000000-338ad1fc154e81dbc4f52021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 40V, Negative-QTOFsplash10-03di-3930000000-5beee39681f5a456565c2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 10V, Positive-QTOFsplash10-03di-0095800000-a6a4827073b05adf7ee42021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 20V, Positive-QTOFsplash10-03di-0296100000-238e5543b1cc74580c912021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Queuosine 40V, Positive-QTOFsplash10-004i-1695000000-2a21e1ea9e5c0aa036792021-09-22Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB028309
KNApSAcK IDNot Available
Chemspider ID35032074
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkQueuosine
METLIN IDNot Available
PubChem Compound137185891
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available