Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-06 15:16:51 UTC
Update Date2022-03-07 02:51:54 UTC
HMDB IDHMDB0015214
Secondary Accession Numbers
  • HMDB15214
Metabolite Identification
Common NameStreptomycin
DescriptionStreptomycin, also known as SM or kantrex, belongs to the class of organic compounds known as diphenylacetonitriles. These are cyclic aromatic compounds containing a diphenylacetonitrile moiety, which consists of a diphenylmethane linked to and acetonitrile to form 2,2-diphenylacetonitrile. A amino cyclitol glycoside that consists of streptidine having a disaccharyl moiety attached at the 4-position. Streptomycin is a drug which is used for the treatment of tuberculosis. may also be used in combination with other drugs to treat tularemia (francisella tularensis), plague (yersia pestis), severe m. avium complex, brucellosis, and enterococcal endocarditis (e.g. e. faecalis, e. faecium). Streptomycin is a very strong basic compound (based on its pKa). Streptomycin exists in all living organisms, ranging from bacteria to humans. In humans, streptomycin is involved in streptomycin action pathway.
Structure
Data?1582753271
Synonyms
ValueSource
2,4-Diguanidino-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-(2-deoxy-2-methylamino-alpha-L-glucopyranosyl)-3-C-formyl-beta-L-lyxopentanofuranosideChEBI
[2-Deoxy-2-(dimethylamino)-alpha-L-glucopyranosyl]-(1->2)-[5-deoxy-3-C-formyl-alpha-L-lyxofuranosyl]-(1->4)-{n',n'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine}ChEBI
KantrexChEBI
SMChEBI
StreomycinChEBI
2,4-Diguanidino-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-(2-deoxy-2-methylamino-a-L-glucopyranosyl)-3-C-formyl-b-L-lyxopentanofuranosideGenerator
2,4-Diguanidino-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-(2-deoxy-2-methylamino-α-L-glucopyranosyl)-3-C-formyl-β-L-lyxopentanofuranosideGenerator
[2-Deoxy-2-(dimethylamino)-a-L-glucopyranosyl]-(1->2)-[5-deoxy-3-C-formyl-a-L-lyxofuranosyl]-(1->4)-{n',n'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine}Generator
[2-Deoxy-2-(dimethylamino)-α-L-glucopyranosyl]-(1->2)-[5-deoxy-3-C-formyl-α-L-lyxofuranosyl]-(1->4)-{n',n'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine}Generator
Streptomycin a sulfateHMDB
Streptomycin sesquisulfate hydrateHMDB
Streptomycin sesquisulphate hydrateHMDB
Streptomycin sulfateHMDB
Streptomycin sulphateHMDB
Streptomycin, sulfate saltHMDB
Normon brand OF streptomycin sulfateHMDB
Sanavita brand OF streptomycin sulfateHMDB
Strepto hefaHMDB
Strepto-fatolHMDB
Streptomycin grünenthalHMDB
Wernigerode brand OF streptomycin sulfateHMDB
Clariana brand OF streptomycin sulfateHMDB
Estreptomicina cepaHMDB
Fatol brand OF streptomycin sulfateHMDB
Strepto fatolHMDB
Strepto-hefaHMDB
CEPA brand OF streptomycin sulfateHMDB
Estreptomicina normonHMDB
Grünenthal brand OF streptomycin sulfateHMDB
Panpharma brand OF streptomycin sulfateHMDB
Estreptomicina clarianaHMDB
Streptomycin sulfate (2:3) saltHMDB
Streptomycine panpharmaHMDB
Chemical FormulaC21H39N7O12
Average Molecular Weight581.5741
Monoisotopic Molecular Weight581.265669747
IUPAC Name1-[(1R,2R,3S,4R,5R,6S)-3-carbamimidamido-4-{[(2R,3R,4R,5S)-3-{[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(methylamino)oxan-2-yl]oxy}-4-formyl-4-hydroxy-5-methyloxolan-2-yl]oxy}-2,5,6-trihydroxycyclohexyl]guanidine
Traditional Namestreptomycin
CAS Registry Number57-92-1
SMILES
CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]2NC(N)=N)O[C@@H](C)[C@]1(O)C=O
InChI Identifier
InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1
InChI KeyUCSJYZPVAKXKNQ-HZYVHMACSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as diphenylacetonitriles. These are cyclic aromatic compounds containing a diphenylacetonitrile moiety, which consists of a diphenylmethane linked to and acetonitrile to form 2,2-diphenylacetonitrile.
KingdomOrganic compounds
Super ClassBenzenoids
ClassBenzene and substituted derivatives
Sub ClassDiphenylacetonitriles
Direct ParentDiphenylacetonitriles
Alternative Parents
Substituents
  • Diphenylacetonitrile
  • Diphenylmethane
  • Phenylpiperidine
  • Piperidinecarboxylic acid
  • Aralkylamine
  • Piperidine
  • Amino acid or derivatives
  • Carboxylic acid ester
  • Tertiary amine
  • Tertiary aliphatic amine
  • Nitrile
  • Carbonitrile
  • Monocarboxylic acid or derivatives
  • Carboxylic acid derivative
  • Organoheterocyclic compound
  • Azacycle
  • Hydrocarbon derivative
  • Organic oxide
  • Amine
  • Organooxygen compound
  • Organonitrogen compound
  • Organic oxygen compound
  • Organic nitrogen compound
  • Organopnictogen compound
  • Carbonyl group
  • Aromatic heteromonocyclic compound
Molecular FrameworkAromatic heteromonocyclic compounds
External Descriptors
Ontology
Disposition

Biological location

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility12.8 g/LNot Available
LogP-6.4Not Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility12.8 g/LALOGPS
logP-2.6ALOGPS
logP-7.7ChemAxon
logS-1.7ALOGPS
pKa (Strongest Acidic)10.88ChemAxon
pKa (Strongest Basic)11.9ChemAxon
Physiological Charge3ChemAxon
Hydrogen Acceptor Count19ChemAxon
Hydrogen Donor Count14ChemAxon
Polar Surface Area331.43 ŲChemAxon
Rotatable Bond Count9ChemAxon
Refractivity149.47 m³·mol⁻¹ChemAxon
Polarizability55.76 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+225.33430932474
DeepCCS[M-H]-223.53130932474
DeepCCS[M-2H]-257.56530932474
DeepCCS[M+Na]+231.52630932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
StreptomycinCN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]2NC(N)=N)O[C@@H](C)[C@]1(O)C=O3823.2Standard polar33892256
StreptomycinCN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]2NC(N)=N)O[C@@H](C)[C@]1(O)C=O4463.2Standard non polar33892256
StreptomycinCN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]2NC(N)=N)O[C@@H](C)[C@]1(O)C=O5375.7Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Streptomycin,1TMS,isomer #1CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4696.9Semi standard non polar33892256
Streptomycin,1TMS,isomer #10C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4845.4Semi standard non polar33892256
Streptomycin,1TMS,isomer #11CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4672.0Semi standard non polar33892256
Streptomycin,1TMS,isomer #12CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4618.7Semi standard non polar33892256
Streptomycin,1TMS,isomer #13CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4676.6Semi standard non polar33892256
Streptomycin,1TMS,isomer #14CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4620.0Semi standard non polar33892256
Streptomycin,1TMS,isomer #2CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4697.7Semi standard non polar33892256
Streptomycin,1TMS,isomer #3CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4727.3Semi standard non polar33892256
Streptomycin,1TMS,isomer #4CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4701.2Semi standard non polar33892256
Streptomycin,1TMS,isomer #5CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4694.1Semi standard non polar33892256
Streptomycin,1TMS,isomer #6CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4680.8Semi standard non polar33892256
Streptomycin,1TMS,isomer #7CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4781.1Semi standard non polar33892256
Streptomycin,1TMS,isomer #8CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4841.3Semi standard non polar33892256
Streptomycin,1TMS,isomer #9CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4837.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #1CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4562.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #10CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4559.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #11CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4540.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #12CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4557.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #13CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4539.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #14CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4571.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #15CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4596.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #16CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4602.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #17CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4677.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #18CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4658.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #19CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4762.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #2CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4587.3Semi standard non polar33892256
Streptomycin,2TMS,isomer #20CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4765.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #21C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4776.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #22CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4573.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #23CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4544.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #24CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4571.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #25CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4543.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #26CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4619.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #27CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4644.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #28CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4649.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #29CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4721.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #3CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4592.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #30CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4787.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #31CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4790.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #32C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4788.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #33CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4604.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #34CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4577.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #35CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4604.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #36CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4576.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #37CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4583.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #38CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4628.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #39CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4683.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #4CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4669.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #40CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4763.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #41CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4765.3Semi standard non polar33892256
Streptomycin,2TMS,isomer #42C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4769.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #43CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4578.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #44CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4552.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #45CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4573.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #46CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4546.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #47CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4593.3Semi standard non polar33892256
Streptomycin,2TMS,isomer #48CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4678.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #49CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4761.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #5CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4644.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #50CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4761.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #51C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4766.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #52CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4585.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #53CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4558.3Semi standard non polar33892256
Streptomycin,2TMS,isomer #54CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4575.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #55CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4555.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #56CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4660.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #57CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4742.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #58CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4741.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #59C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4750.3Semi standard non polar33892256
Streptomycin,2TMS,isomer #6CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4623.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #60CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4573.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #61CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4535.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #62CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4575.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #63CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4527.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #64CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4825.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #65CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4828.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #66C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4830.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #67CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4664.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #68CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4638.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #69CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4667.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #7CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4756.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #70CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4635.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #71CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4887.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #72C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4884.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #73CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4721.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #74CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4676.9Semi standard non polar33892256
Streptomycin,2TMS,isomer #75CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4732.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #76CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4699.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #77CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4764.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #78C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4883.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #79CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4728.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #8CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4759.4Semi standard non polar33892256
Streptomycin,2TMS,isomer #80CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4700.5Semi standard non polar33892256
Streptomycin,2TMS,isomer #81CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4764.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #82CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4724.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #83CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4673.8Semi standard non polar33892256
Streptomycin,2TMS,isomer #84C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4728.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #85C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4687.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #86C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4732.1Semi standard non polar33892256
Streptomycin,2TMS,isomer #87C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4682.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #88CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4589.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #89CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4547.2Semi standard non polar33892256
Streptomycin,2TMS,isomer #9C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4777.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #90CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4571.7Semi standard non polar33892256
Streptomycin,2TMS,isomer #91CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4542.0Semi standard non polar33892256
Streptomycin,2TMS,isomer #92CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4481.6Semi standard non polar33892256
Streptomycin,2TMS,isomer #93CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4571.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #1CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4419.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #10CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4389.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #100CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4455.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #101CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4439.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #102CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4517.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #103CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4506.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #104CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4650.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #105CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4652.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #106C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4650.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #107CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4452.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #108CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4435.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #109CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4455.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #11CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4428.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #110CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4432.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #111CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4571.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #112CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4704.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #113CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4705.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #114C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4723.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #115CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4526.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #116CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4495.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #117CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4529.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #118CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4493.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #119CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4685.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #12CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4382.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #120CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4686.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #121C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4715.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #122CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4491.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #123CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4473.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #124CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4492.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #125CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4471.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #126CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4790.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #127C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4806.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #128CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4631.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #129CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4576.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #13CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4453.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #130CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4652.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #131CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4614.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #132CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4576.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #133C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4805.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #134CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4613.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #135CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4579.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #136CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4633.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #137CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4577.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #138CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4650.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #139C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4616.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #14CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4506.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #140C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4590.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #141C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4619.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #142C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4586.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #143CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4443.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #144CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4468.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #145CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4415.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #146CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4424.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #147CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4377.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #148CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4447.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #149CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4468.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #15CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4486.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #150CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4475.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #151CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4524.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #152CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4643.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #153CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4644.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #154C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4664.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #155CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4461.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #156CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4442.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #157CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4461.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #158CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4432.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #159CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4512.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #16CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4459.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #160CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4559.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #161CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4683.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #162CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4684.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #163C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4689.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #164CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4482.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #165CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4477.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #166CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4469.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #167CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4471.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #168CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4559.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #169CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4680.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #17CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4641.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #170CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4682.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #171C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4687.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #172CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4469.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #173CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4467.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #174CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4468.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #175CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4464.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #176CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4729.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #177CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4731.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #178C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4758.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #179CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4540.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #18CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4642.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #180CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4524.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #181CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4544.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #182CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4522.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #183CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4816.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #184C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4819.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #185CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4652.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #186CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4605.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #187CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4666.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #188CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4624.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #189CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4594.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4648.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #190C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4819.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #191CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4621.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #192CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4595.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #193CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4658.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #194CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4605.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #195CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4664.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #196C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4636.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #197C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4614.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #198C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4639.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #199C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4613.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #2CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4431.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #20CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4449.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #200CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4475.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #201CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4476.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #202CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4436.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #203CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4445.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #204CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4399.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #205CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O4482.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #206CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4454.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #207CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4501.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #208CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4625.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #209CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4626.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #21CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4424.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #210C[C@@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4631.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #211CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4449.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #212CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4422.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #213CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4451.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #214CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4415.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #215CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4537.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #216CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4657.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #217CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4657.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #218C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4666.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #219CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4460.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #22CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4437.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #220CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4450.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #221CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4478.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #222CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4454.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #223CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4709.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #224CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4708.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #225C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4720.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #226CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4532.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #227CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4505.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #228CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4528.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #229CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4502.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #23CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4421.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #230CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4785.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #231C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4796.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #232CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4637.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #233CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4590.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #234CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4657.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #235CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4614.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #236CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4581.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #237C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4795.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #238CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4616.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #239CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4584.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #24CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4505.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #240CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4637.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #241CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4584.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #242CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4652.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #243C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4621.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #244C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4593.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #245C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4615.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #246C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4590.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #247CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4449.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #248CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4470.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #249CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4426.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #25CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4478.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #250CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4429.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #251CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4387.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #252CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4448.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #253CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4507.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #254CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4631.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #255CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4633.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #256C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4638.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #257CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4466.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #258CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4425.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #259CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4460.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #26CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4455.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #260CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4426.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #261CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4713.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #262CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4712.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #263C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4722.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #264CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4540.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #265CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4511.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #266CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4528.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #267CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4505.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #268CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4790.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #269C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4795.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #27CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4641.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #270CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4648.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #271CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4592.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #272CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4671.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #273CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4615.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #274CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4591.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #275C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4795.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #276CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4622.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #277CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4597.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #278CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4640.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #279CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4587.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #28CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4642.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #280CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4668.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #281C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4627.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #282C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4606.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #283C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4621.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #284C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4601.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #285CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4467.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #286CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4475.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #287CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4436.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #288CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4432.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #289CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4406.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #29C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4647.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #290CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4453.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #291CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4679.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #292CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4679.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #293C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4700.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #294CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4521.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #295CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4478.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #296CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4521.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #297CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4470.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #298CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4759.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #299C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4773.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #3CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4475.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #30CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4431.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #300CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4629.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #301CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4560.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #302CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4635.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #303CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4609.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #304CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4557.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #305C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4773.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #306CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4607.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #307CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4562.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #308CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4629.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #309CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4553.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #31CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4415.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #310CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4634.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #311C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4612.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #312C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4578.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #313C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4612.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #314C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4569.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #315CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4451.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #316CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4482.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #317CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4418.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #318CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4421.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #319CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4364.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #32CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4435.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #320CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4439.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #321CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4837.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #322C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4855.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #323CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4708.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #324CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4657.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #325CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4734.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #326CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4689.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #327CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4643.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #328C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4854.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #329CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4682.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #33CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4411.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #330CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4644.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #331CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4715.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #332CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4659.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #333CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4732.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #334C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4694.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #335C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4671.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #336C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4698.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #337C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4667.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #338CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4523.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #339CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4553.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #34CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4544.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #340CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4500.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #341CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4509.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #342CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4446.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #343CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4529.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #344C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4914.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #345CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4769.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #346CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4715.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #347CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4790.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #348CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4772.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #349CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4716.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #35CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4516.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #350CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4788.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #351C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4758.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #352C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4715.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #353C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4772.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #354C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4726.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #355C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4803.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #356CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4596.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #357CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4632.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #358CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4565.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #359CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4643.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #36CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4701.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #360CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4585.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #361CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4509.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #362CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4593.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #363CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4582.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #364CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4671.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #365CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4621.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #366C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4770.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #367C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4730.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #368C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4805.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #369C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4761.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #37CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4702.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #370C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4713.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #371CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4576.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #372CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4662.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #373CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4631.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #374CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4577.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #375CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4617.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #376CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4571.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #377CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4507.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #378CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4655.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #379CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4588.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #38C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4723.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #380CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4597.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #381C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4602.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #382C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4610.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #383C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4567.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #384C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4574.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #385C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4518.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #386C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4600.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #387CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4454.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #388CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4454.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #389CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4399.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #39CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4510.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #390CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4390.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #4CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4447.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #40CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4481.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #41CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4510.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #42CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4480.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #43CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4510.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #44CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4675.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #45CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4677.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #46C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4694.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #47CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4456.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #48CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4447.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #49CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4460.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #5CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4422.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #50CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4446.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #51CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4651.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #52CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4651.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #53C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4671.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #54CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4442.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #55CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4419.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #56CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4445.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #57CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4417.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #58CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4779.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #59C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4804.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #6CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4605.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #60CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4622.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #61CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4569.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #62CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4641.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #63CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4602.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #64CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4573.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #65C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4805.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #66CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4602.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #67CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4576.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #68CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4623.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #69CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4569.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #7CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4607.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #70CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4640.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #71C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4614.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #72C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4594.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #73C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4616.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #74C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4591.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #75CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4426.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #76CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4445.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #77CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4395.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #78CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4404.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #79CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4361.1Semi standard non polar33892256
Streptomycin,3TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4613.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #80CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4430.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #81CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4433.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #82CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4444.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #83CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4485.8Semi standard non polar33892256
Streptomycin,3TMS,isomer #84CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4473.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #85CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4616.2Semi standard non polar33892256
Streptomycin,3TMS,isomer #86CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4616.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #87C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4620.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #88CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4445.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #89CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4410.5Semi standard non polar33892256
Streptomycin,3TMS,isomer #9CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4427.7Semi standard non polar33892256
Streptomycin,3TMS,isomer #90CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4448.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #91CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4402.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #92CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4469.0Semi standard non polar33892256
Streptomycin,3TMS,isomer #93CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4515.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #94CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4511.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #95CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4651.6Semi standard non polar33892256
Streptomycin,3TMS,isomer #96CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4652.3Semi standard non polar33892256
Streptomycin,3TMS,isomer #97C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4652.9Semi standard non polar33892256
Streptomycin,3TMS,isomer #98CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4466.4Semi standard non polar33892256
Streptomycin,3TMS,isomer #99CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4444.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4310.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #10CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4334.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #100CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4305.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1000CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4660.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1001CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4577.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1002CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4661.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1003CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4659.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1004CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4573.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1005CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4661.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1006C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4657.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1007C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4583.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1008C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4666.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1009C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4639.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #101CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4342.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1010C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4586.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1011CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4464.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1012CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4565.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1013CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4544.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1014CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4477.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1015CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4475.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1016CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4459.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1017CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4386.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1018CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4527.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1019CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4451.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #102CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4300.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1020CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4471.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1021C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4640.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1022C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4594.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1023C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4659.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1024C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4577.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1025C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4667.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1026CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4488.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1027CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4542.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1028CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4461.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1029CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4533.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #103CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4684.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1030CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4479.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1031CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4389.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1032CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4457.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1033CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4452.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1034CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4559.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1035CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4469.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1036C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4480.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1037C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4522.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1038C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4455.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1039C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4455.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #104C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4678.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1040C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4388.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1041C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4470.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1042CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4368.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1043CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4285.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1044CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4361.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1045CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4279.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1046C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4862.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1047CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4733.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1048CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4651.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1049CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4753.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #105CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4530.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1050CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4741.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1051CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4657.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1052CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4753.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1053C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4737.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1054C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4675.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1055C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4763.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1056C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4727.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1057C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4667.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1058CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4541.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1059CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4632.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #106CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4464.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1060CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4601.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1061CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4535.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1062CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4586.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1063CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4546.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1064CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4466.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1065CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4625.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1066CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4529.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1067CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4560.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1068C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4721.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1069C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4668.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #107CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4536.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1070C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4741.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1071C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4674.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1072C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4760.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1073CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4552.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1074CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4603.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1075CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4536.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1076CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4612.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1077CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4543.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1078CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4466.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1079CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4531.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #108CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4499.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1080CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4549.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1081CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4644.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1082CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4585.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1083C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4564.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1084C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4591.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1085C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4535.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1086C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4547.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1087C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4473.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1088C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4568.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1089CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4439.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #109CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4464.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1090CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4354.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1091CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4438.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1092CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O4364.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1093C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4795.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1094C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4724.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1095C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4823.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1096C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4801.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1097C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4724.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1098C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4821.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1099CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4620.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #11CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4269.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #110C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4676.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1100CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4719.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1101CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4712.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1102CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4626.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1103CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4720.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1104CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4654.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1105CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4630.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1106CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4530.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1107CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4636.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1108CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4733.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1109CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4638.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #111CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4514.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1110CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4734.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1111CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4634.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1112CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4730.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1113CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4658.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1114C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4622.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1115C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4662.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1116C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4594.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1117C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4667.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1118C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4616.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1119C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4535.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #112CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4470.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1120C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4623.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1121C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4606.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1122C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4698.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1123C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4646.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1124CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4505.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1125CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4427.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1126CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4485.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1127CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4470.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #1128CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4562.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1129CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4497.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #113CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4515.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1130CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4400.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1131CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4506.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1132CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4408.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1133CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4493.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1134C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4599.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1135C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4689.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1136C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4660.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1137C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4609.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1138C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4645.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1139C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4598.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #114CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4458.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #1140C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4533.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #1141C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4678.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1142C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4621.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1143C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4624.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1144CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4477.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1145CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4467.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #1146CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4387.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1147CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4562.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1148CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4492.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #1149CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4503.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #115CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4534.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1150CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4508.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1151CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4402.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #1152CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4437.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #1153CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4495.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #1154C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4493.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1155C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4422.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1156C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4491.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #1157C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4427.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #1158CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O4327.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #116C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4526.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #117C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4481.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #118C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2N(C(=N)N)[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4516.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #119C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(N)=N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4477.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #12CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4361.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #120CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4348.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #121CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4373.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #122CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4324.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #123CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4318.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #124CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4263.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #125CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O)[C@@H]3N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4330.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #126CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4411.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #127CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4383.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #128CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4572.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #129CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4571.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #13CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4343.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #130C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4579.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #131CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4395.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #132CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4351.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #133CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4402.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #134CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4350.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #135CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4368.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #136CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4531.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #137CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4531.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #138C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4548.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #139CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4357.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #14CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4320.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #140CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4316.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #141CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4368.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #142CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4315.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #143CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4516.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #144CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4516.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #145C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4521.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #146CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4333.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #147CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4291.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #148CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4342.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #149CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4288.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #15CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4494.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #150CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4679.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #151C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4676.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #152CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4510.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #153CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4458.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #154CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4522.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #155CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4503.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #156CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4456.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #157C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4674.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #158CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4493.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #159CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4458.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #16CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4494.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #160CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4515.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #161CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4451.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #162CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4518.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #163C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4506.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #164C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4468.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #165C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4514.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #166C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4464.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #167CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4320.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #168CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4369.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #169CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4304.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4500.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #170CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4312.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #171CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4246.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #172CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4323.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #173CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4432.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #174CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4594.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #175CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4594.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #176C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4616.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #177CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4424.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #178CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4378.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #179CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4438.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #18CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4358.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #180CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4380.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #181CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4576.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #182CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4573.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #183C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4583.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #184CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4405.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #185CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4353.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #186CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4416.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #187CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4354.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #188CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4734.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #189C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4735.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #19CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4283.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #190CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4569.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #191CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4521.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #192CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4591.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #193CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4572.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #194CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4514.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #195C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4734.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #196CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4563.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #197CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4513.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #198CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4574.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #199CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4520.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #2CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4352.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #20CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4346.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #200CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4591.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #201C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4585.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #202C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4534.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #203C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4592.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #204C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4530.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #205CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4393.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #206CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4444.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #207CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4368.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #208CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4381.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #209CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4304.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #21CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4283.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #210CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4405.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #211CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4548.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #212CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4547.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #213C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4565.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #214CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4375.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #215CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4331.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #216CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4385.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #217CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4331.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #218CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4696.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #219C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4689.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #22CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4386.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #220CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4531.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #221CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4471.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #222CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4537.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #223CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4512.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #224CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4467.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #225C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4688.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #226CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4504.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #227CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4467.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #228CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4535.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #229CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4470.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #23CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4360.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #230CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4537.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #231C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4514.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #232C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4478.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #233C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4524.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #234C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4477.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #235CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4350.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #236CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4383.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #237CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4319.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #238CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4328.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #239CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4260.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #24CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4541.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #240CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4361.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #241CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4681.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #242C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4678.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #243CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4515.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #244CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4453.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #245CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4522.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #246CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4507.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #247CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4453.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #248C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4676.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #249CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4499.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #25CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4544.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #250CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4451.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #251CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4518.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #252CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4452.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #253CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4521.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #254C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4508.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #255C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4462.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #256C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4517.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #257C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4459.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #258CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4320.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #259CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4371.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4546.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #260CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4295.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #261CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4305.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #262CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4235.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #263CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4328.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #264C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4815.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #265CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4661.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #266CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4588.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #267CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4677.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #268CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4665.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #269CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4591.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #27CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4405.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #270CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4676.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #271C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4668.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #272C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4595.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #273C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4686.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #274C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4649.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #275C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4601.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #276CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4445.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #277CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4551.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #278CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4509.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #279CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4456.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #28CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4332.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #280CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4486.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #281CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4455.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #282CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4386.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #283CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4534.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #284CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4448.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #285CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4480.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #286C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4646.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #287C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4602.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #288C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4671.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #289C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4593.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #29CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4399.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #290C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4683.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #291CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4470.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #292CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4509.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #293CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4445.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #294CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4521.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #295CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4461.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #296CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4387.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #297CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4448.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #298CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N[Si](C)(C)C)N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4457.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #299CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(=N)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4563.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #3CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4329.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #30CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4329.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #300CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O)[C@@H](NC(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4488.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #301C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(=N)N)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4477.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #302C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4521.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #303C[C@@H]1O[C@@H](O[C@@H]2[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4458.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #304C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4470.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #305C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4398.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #306C[C@@H]1O[C@@H](O[C@@H]2[C@@H](NC(=N)N)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4484.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #307CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4348.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #308CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4271.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #309CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4347.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #31CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4339.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #310CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(N)=N[Si](C)(C)C)[C@H](O)[C@@H](N(C(N)=N[Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O[Si](C)(C)C4277.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #311CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4326.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #312CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4369.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #313CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4349.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #314CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4497.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #315CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4499.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #316C[C@@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4500.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #317CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@@H]3[C@@H](NC(=N)N)[C@H](O[Si](C)(C)C)[C@@H](N(C(=N)N)[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4346.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #318CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4286.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #319CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4345.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #32CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4501.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #320CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4284.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #321CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4377.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #322CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4361.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #323CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4506.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #324CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4506.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #325C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4507.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #326CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4368.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #327CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4299.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #328CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4359.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #329CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4298.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #33CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4504.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #330CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4403.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #331CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4552.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #332CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4554.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #333C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@]1(C=O)O[Si](C)(C)C4550.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #334CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4419.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #335CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4347.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #336CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4414.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #337CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@@]2(C=O)O[Si](C)(C)C)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4343.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #338CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4517.9Semi standard non polar33892256
Streptomycin,4TMS,isomer #339CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4520.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4515.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #340C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4529.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #341CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4387.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #342CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4318.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #343CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4381.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #344CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4315.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #345CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4664.7Semi standard non polar33892256
Streptomycin,4TMS,isomer #346C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4648.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #347CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4520.1Semi standard non polar33892256
Streptomycin,4TMS,isomer #348CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N[Si](C)(C)C)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4442.5Semi standard non polar33892256
Streptomycin,4TMS,isomer #349CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4510.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #35CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4366.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #350CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4505.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #351CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(N)=N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4442.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #352C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N[Si](C)(C)C)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4648.3Semi standard non polar33892256
Streptomycin,4TMS,isomer #353CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4507.6Semi standard non polar33892256
Streptomycin,4TMS,isomer #354CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4449.8Semi standard non polar33892256
Streptomycin,4TMS,isomer #355CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3N(C(=N)N[Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4518.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #356CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N[Si](C)(C)C)N[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4440.4Semi standard non polar33892256
Streptomycin,4TMS,isomer #357CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O[Si](C)(C)C)[C@@H]3NC(=N)N([Si](C)(C)C)[Si](C)(C)C)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@H]1O4512.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #358C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N(C(=N)N)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4504.2Semi standard non polar33892256
Streptomycin,4TMS,isomer #359C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2NC(=N)N)[C@H](O[C@@H]2O[C@@H](CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2N(C)[Si](C)(C)C)[C@@]1(O)C=O4441.0Semi standard non polar33892256
Streptomycin,4TMS,isomer #36CN[C@@H]1[C@H](O[C@H]2[C@H](O[C