Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-06 15:16:51 UTC
Update Date2021-09-16 15:29:28 UTC
HMDB IDHMDB0015303
Secondary Accession Numbers
  • HMDB15303
Metabolite Identification
Common NameKanamycin
DescriptionKanamycin is only found in individuals that have used or taken this drug. It is an antibiotic complex produced by Streptomyces kanamyceticus from Japanese soil. Comprises 3 components: kanamycin A, the major component, and kanamycins B and C, the minor components. [PubChem]Aminoglycosides like kanamycin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically Kanamycin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
Structure
Data?1582753281
Synonyms
ValueSource
4,6-Diamino-2-hydroxy-1,3-cyclohexane 3,6'diamino-3,6'-dideoxydi-alpha-D-glucosideChEBI
4,6-Diamino-2-hydroxy-1,3-cyclohexylene 3,6'-diamino-3,6'-dideoxydi-D-glucopyranosideChEBI
O-3-Amino-3-deoxy-alpha-D-glucopyranosyl-(1->6)-O-(6-amino-6-deoxy-alpha-D-glucopyranosyl-(1->4))-2-deoxy-D-streptamineChEBI
4,6-Diamino-2-hydroxy-1,3-cyclohexane 3,6'diamino-3,6'-dideoxydi-a-D-glucosideGenerator
4,6-Diamino-2-hydroxy-1,3-cyclohexane 3,6'diamino-3,6'-dideoxydi-α-D-glucosideGenerator
O-3-Amino-3-deoxy-a-D-glucopyranosyl-(1->6)-O-(6-amino-6-deoxy-a-D-glucopyranosyl-(1->4))-2-deoxy-D-streptamineGenerator
O-3-Amino-3-deoxy-α-D-glucopyranosyl-(1->6)-O-(6-amino-6-deoxy-α-D-glucopyranosyl-(1->4))-2-deoxy-D-streptamineGenerator
AminodeoxykanamycinHMDB
KANHMDB
Kanamycin baseHMDB
Kanamycin sulfateHMDB
Nebramycin factor 5HMDB
KantrexHMDB
Kanamycin aHMDB
Chemical FormulaC18H36N4O11
Average Molecular Weight484.4986
Monoisotopic Molecular Weight484.238058014
IUPAC Name(2R,3S,4S,5R,6R)-2-(aminomethyl)-6-{[(1R,2R,3S,4R,6S)-4,6-diamino-3-{[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-hydroxycyclohexyl]oxy}oxane-3,4,5-triol
Traditional Namekanamycin
CAS Registry Number8063-07-8
SMILES
NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H36N4O11/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17/h4-18,23-29H,1-3,19-22H2/t4-,5+,6-,7-,8+,9-,10-,11-,12+,13-,14-,15+,16-,17-,18-/m1/s1
InChI KeySBUJHOSQTJFQJX-NOAMYHISSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as 4,6-disubstituted 2-deoxystreptamines. These are 2-deoxystreptamine aminoglycosides that are glycosidically linked to a pyranose of furanose unit at the C4- and C6-positions.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct Parent4,6-disubstituted 2-deoxystreptamines
Alternative Parents
Substituents
  • 4,6-disubstituted 2-deoxystreptamine
  • Glycosyl compound
  • O-glycosyl compound
  • Aminocyclitol or derivatives
  • Cyclohexanol
  • Cyclohexylamine
  • Cyclitol or derivatives
  • Monosaccharide
  • Oxane
  • Cyclic alcohol
  • Secondary alcohol
  • 1,2-aminoalcohol
  • Polyol
  • Organoheterocyclic compound
  • Acetal
  • Oxacycle
  • Alcohol
  • Hydrocarbon derivative
  • Organopnictogen compound
  • Primary aliphatic amine
  • Organonitrogen compound
  • Organic nitrogen compound
  • Amine
  • Primary alcohol
  • Primary amine
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Disposition

Biological location

Source

Route of exposure

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility92.3 g/LNot Available
LogP-6.3Not Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility92.3 g/LALOGPS
logP10(-3.1) g/LALOGPS
logP10(-7.1) g/LChemAxon
logS10(-0.72) g/LALOGPS
pKa (Strongest Acidic)12.11ChemAxon
pKa (Strongest Basic)9.75ChemAxon
Physiological Charge4ChemAxon
Hydrogen Acceptor Count15ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area282.61 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity106.13 m³·mol⁻¹ChemAxon
Polarizability47.57 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+209.58830932474
DeepCCS[M-H]-207.69230932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
KanamycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3162.6Standard polar33892256
KanamycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4762.2Standard non polar33892256
KanamycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4251.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Kanamycin,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4143.1Semi standard non polar33892256
Kanamycin,1TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4188.8Semi standard non polar33892256
Kanamycin,1TMS,isomer #11C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4204.5Semi standard non polar33892256
Kanamycin,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4135.8Semi standard non polar33892256
Kanamycin,1TMS,isomer #3C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4138.7Semi standard non polar33892256
Kanamycin,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4147.0Semi standard non polar33892256
Kanamycin,1TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4134.8Semi standard non polar33892256
Kanamycin,1TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4143.3Semi standard non polar33892256
Kanamycin,1TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4135.0Semi standard non polar33892256
Kanamycin,1TMS,isomer #8C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4206.7Semi standard non polar33892256
Kanamycin,1TMS,isomer #9C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4188.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4023.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #10C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4102.5Semi standard non polar33892256
Kanamycin,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4009.2Semi standard non polar33892256
Kanamycin,2TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4006.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4016.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N4038.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #15C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4023.6Semi standard non polar33892256
Kanamycin,2TMS,isomer #16C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4088.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #17C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4088.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #18C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4094.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #19C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4089.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4011.1Semi standard non polar33892256
Kanamycin,2TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4043.5Semi standard non polar33892256
Kanamycin,2TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4017.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #22C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O4012.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4020.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #24C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4092.6Semi standard non polar33892256
Kanamycin,2TMS,isomer #25C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4100.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #26C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4099.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #27C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4096.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O4030.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O4021.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4022.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4034.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #31C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4112.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #32C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4107.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #33C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4106.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #34C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4098.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C4018.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4004.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #37C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4081.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #38C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4093.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #39C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4096.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4043.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #40C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4101.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C4013.1Semi standard non polar33892256
Kanamycin,2TMS,isomer #42C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4083.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #43C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4091.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #44C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4094.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #45C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4097.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #46C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4090.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #47C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4086.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #48C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4088.0Semi standard non polar33892256
Kanamycin,2TMS,isomer #49C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4095.1Semi standard non polar33892256
Kanamycin,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4041.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #50C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4144.1Semi standard non polar33892256
Kanamycin,2TMS,isomer #51C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4144.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #52C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4162.7Semi standard non polar33892256
Kanamycin,2TMS,isomer #53C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)[Si](C)(C)C4292.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #54C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4137.8Semi standard non polar33892256
Kanamycin,2TMS,isomer #55C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4165.1Semi standard non polar33892256
Kanamycin,2TMS,isomer #56C[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O)[Si](C)(C)C4190.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #57C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4163.9Semi standard non polar33892256
Kanamycin,2TMS,isomer #58C[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O)[Si](C)(C)C4190.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #59C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O)[Si](C)(C)C4215.2Semi standard non polar33892256
Kanamycin,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4044.6Semi standard non polar33892256
Kanamycin,2TMS,isomer #7C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4100.4Semi standard non polar33892256
Kanamycin,2TMS,isomer #8C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4099.3Semi standard non polar33892256
Kanamycin,2TMS,isomer #9C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4105.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3904.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3910.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #100C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3969.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #101C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3970.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #102C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3972.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #103C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3915.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #104C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3976.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #105C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3976.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #106C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3977.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #107C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3979.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #108C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3978.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #109C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3977.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3923.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #110C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3966.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #111C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3973.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #112C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4023.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #113C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4021.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #114C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4018.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #115C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4193.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #116C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4020.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #117C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C4036.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #118C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4086.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #119C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4036.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3930.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #120C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4081.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #121C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4129.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #122C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3904.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #123C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3913.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #124C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3961.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #125C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3959.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #126C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3962.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #127C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3990.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #128C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3923.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #129C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3966.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3932.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #130C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3963.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #131C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3967.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #132C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3998.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #133C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3955.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #134C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3963.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #135C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3964.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #136C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3995.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #137C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4044.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #138C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4042.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #139C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4034.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #14C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3964.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4125.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #141C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4006.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #142C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4004.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #143C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4079.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #144C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4006.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #145C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4082.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #146C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4209.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #147C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3901.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #148C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3952.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #149C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3966.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #15C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3963.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #150C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3966.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #151C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3993.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #152C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3952.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #153C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3957.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #154C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3988.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #155C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3957.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #156C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4003.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #157C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4007.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #158C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4036.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #159C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4196.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #16C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3963.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #160C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4014.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #161C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4046.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #162C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4080.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #163C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4048.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #164C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4084.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #165C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4118.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #166C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3950.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #167C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3958.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #168C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3959.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #169C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3991.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #17C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3984.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #170C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4006.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #171C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4008.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #172C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4048.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #173C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4174.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #174C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4016.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #175C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4048.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #176C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4077.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #177C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4050.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #178C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4079.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #179C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4107.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3916.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #180C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4006.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #181C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4006.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #182C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4040.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #183C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4197.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #184C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4009.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #185C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4043.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #186C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4081.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #187C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4044.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #188C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4082.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #189C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4113.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3930.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #190C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4037.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #191C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4089.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #192C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4253.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #193C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4169.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #194C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4089.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #195C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4254.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #196C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4170.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #197C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4268.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #198C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4207.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #199C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4098.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3900.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3934.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #200C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4164.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #201C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4161.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #202C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4179.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #203C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4168.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #204C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4178.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #205C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4166.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #21C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3965.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #22C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3962.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #23C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3959.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #24C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3979.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3939.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3943.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #27C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3965.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #28C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3962.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #29C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3969.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3909.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #30C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3983.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3952.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #32C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3983.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #33C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3983.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #34C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3981.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #35C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3972.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #36C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3986.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #37C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3986.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #38C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3990.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #39C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3971.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3925.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #40C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4007.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #41C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4013.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #42C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4042.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4089.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #44C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4041.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #45C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4013.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4088.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #47C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4030.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4204.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4116.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3929.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #50C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N3906.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3903.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3919.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3917.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #54C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3964.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #55C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3963.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #56C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3973.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #57C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3968.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #58C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N3913.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #59C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3926.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #6C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3960.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #60C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3919.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #61C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3969.8Semi standard non polar33892256
Kanamycin,3TMS,isomer #62C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3968.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #63C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3976.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #64C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3977.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #65C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3928.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #66C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3923.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #67C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3972.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #68C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3970.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #69C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3966.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #7C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3959.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #70C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3971.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #71C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3937.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #72C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3975.3Semi standard non polar33892256
Kanamycin,3TMS,isomer #73C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3972.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #74C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3976.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #75C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3969.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #76C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3958.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #77C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3986.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #78C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3987.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #79C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3984.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #8C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3965.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #80C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4004.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #81C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4014.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #82C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4027.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #83C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4080.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #84C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4026.1Semi standard non polar33892256
Kanamycin,3TMS,isomer #85C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4015.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #86C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4081.7Semi standard non polar33892256
Kanamycin,3TMS,isomer #87C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4017.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #88C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4185.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #89C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4116.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #9C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3979.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #90C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3921.5Semi standard non polar33892256
Kanamycin,3TMS,isomer #91C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3930.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #92C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3928.0Semi standard non polar33892256
Kanamycin,3TMS,isomer #93C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3972.9Semi standard non polar33892256
Kanamycin,3TMS,isomer #94C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3977.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #95C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3974.6Semi standard non polar33892256
Kanamycin,3TMS,isomer #96C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3976.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #97C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3903.2Semi standard non polar33892256
Kanamycin,3TMS,isomer #98C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N3907.4Semi standard non polar33892256
Kanamycin,3TMS,isomer #99C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3973.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3786.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3828.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #100C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3874.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #101C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3880.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #102C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3896.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #103C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3884.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #104C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3881.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #105C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3902.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #106C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3896.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #107C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3876.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #108C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3891.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #109C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3934.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3831.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3962.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #111C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3929.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #112C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3890.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3962.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #114C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3949.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4086.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4014.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #117C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3922.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #118C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3924.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #119C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3916.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #12C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3861.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #120C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3878.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #121C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3931.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #122C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3929.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #123C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3940.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4083.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #125C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3926.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #126C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3940.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3974.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #128C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3940.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3975.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #13C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3860.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #130C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4008.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #131C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3935.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #132C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3934.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #133C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3941.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3979.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #135C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3939.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #136C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3935.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3977.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #138C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3941.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4087.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #14C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3873.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4004.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #141C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4010.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #142C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3952.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #143C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4040.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #144C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4040.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #145C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4003.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #146C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4139.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #147C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4017.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #148C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4058.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #149C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4028.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #15C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3915.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #150C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4005.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #151C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4061.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #152C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4030.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #153C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4139.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #154C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4017.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #155C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4151.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #156C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4078.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #157C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N3806.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #158C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3843.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #159C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3833.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3838.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #160C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3885.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #161C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3884.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #162C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3894.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #163C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3901.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #164C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3832.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #165C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3832.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #166C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3883.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #167C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3885.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #168C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3897.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #169C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3894.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3841.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #170C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3843.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #171C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3875.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #172C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3871.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #173C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3897.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #174C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3903.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #175C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3869.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #176C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3904.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #177C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3897.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #178C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3897.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #179C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3930.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #18C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3849.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #180C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3933.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #181C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3948.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #182C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N3966.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #183C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3946.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #184C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3935.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #185C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N3966.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #186C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3956.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #187C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4084.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #188C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4008.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #189C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3858.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #19C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3848.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #190C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3836.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #191C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3894.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #192C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3895.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #193C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3896.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #194C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3907.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #195C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3860.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #196C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3895.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #197C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3890.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #198C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3912.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #199C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3924.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3819.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #20C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3871.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #200C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3891.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #201C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3919.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #202C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3910.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #203C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3914.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #204C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3937.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #205C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3950.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #206C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3962.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #207C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N3986.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #208C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3956.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #209C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3948.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #21C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3914.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #210C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N3982.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #211C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3977.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #212C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4072.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #213C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4019.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #214C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3845.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #215C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3880.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #216C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3877.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #217C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3886.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #218C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3902.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #219C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3866.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3846.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #220C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3905.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #221C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3906.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #222C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3898.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #223C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3930.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #224C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3928.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #225C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3949.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #226C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N3978.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #227C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3945.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #228C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3928.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #229C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N3973.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #23C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3896.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #230C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3949.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #231C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4083.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #232C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4012.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #233C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3874.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #234C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3904.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #235C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3889.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #236C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3893.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #237C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3905.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #238C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3917.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #239C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3933.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #24C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3889.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #240C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3982.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #241C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3930.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #242C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3917.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #243C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3981.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #244C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3943.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #245C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N4091.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #246C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4027.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #247C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3932.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #248C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3939.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #249C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3940.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #25C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3891.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #250C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4022.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #251C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3955.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #252C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3951.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #253C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4083.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #254C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3949.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #255C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)O[C@@H]1CO3982.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #256C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3981.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #257C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4011.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #258C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3975.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #259C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4045.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #26C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3894.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #260C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4044.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #261C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4005.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #262C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4130.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #263C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4031.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #264C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4034.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #265C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4071.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #266C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4005.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #267C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4035.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #268C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4072.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #269C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4130.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #27C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3889.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #270C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4030.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #271C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4133.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #272C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4080.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #273C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3832.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #274C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3820.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #275C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3898.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #276C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3878.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #277C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3871.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #278C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3889.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #279C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3848.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #28C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3889.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #280C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3918.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #281C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3896.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #282C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3889.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #283C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3905.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #284C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3880.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #285C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3874.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #286C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3876.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #287C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3896.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #288C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3937.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #289C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3931.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #29C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3901.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #290C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3937.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #291C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4035.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #292C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3909.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #293C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3923.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #294C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3984.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #295C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3919.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #296C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3979.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #297C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4095.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #298C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3799.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #299C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3881.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3831.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #30C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3895.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #300C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3885.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #301C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3889.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #302C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3886.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #303C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3884.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #304C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3885.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #305C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3887.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #306C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3894.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #307C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3940.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #308C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3939.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #309C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3948.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #31C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3908.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #310C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4084.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #311C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3932.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #312C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3945.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #313C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3965.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #314C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3947.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #315C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3965.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #316C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4014.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #317C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3886.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #318C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3896.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #319C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3896.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #32C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3907.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #320C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3901.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #321C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3951.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #322C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3954.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #323C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3966.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #324C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O4075.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #325C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3942.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #326C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3957.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #327C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O3980.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #328C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3964.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #329C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O3984.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #33C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3949.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #330C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O4026.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #331C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3934.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #332C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3932.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #333C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3950.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #334C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3973.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #335C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3947.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #336C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3932.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #337C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N3968.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #338C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3940.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #339C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4087.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3955.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #340C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4021.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #341C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3975.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #342C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4003.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #343C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4137.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #344C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4033.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #345C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4002.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #346C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4136.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #347C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4033.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #348C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4136.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #349C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4091.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #35C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3948.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #350C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4009.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #351C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4049.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #352C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4046.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #353C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4081.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #354C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C4035.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #355C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4080.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #356C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4035.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #357C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3803.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #358C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3856.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #359C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3857.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #36C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3908.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #360C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3927.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #361C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3870.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #362C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3933.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #363C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3861.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #364C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3860.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #365C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3869.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #366C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3909.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #367C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3907.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #368C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3972.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #369C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O4090.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3954.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #370C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3894.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #371C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3950.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #372C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3962.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #373C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3953.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #374C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3961.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #375C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O4028.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #376C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3873.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #377C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3871.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #378C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3869.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #379C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3940.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #38C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3962.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #380C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3916.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #381C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3920.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #382C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3990.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #383C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O4079.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #384C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3906.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #385C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3966.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #386C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O3971.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #387C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3971.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #388C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3974.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #389C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O4043.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4079.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #390C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3897.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #391C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3897.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #392C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3962.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #393C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4089.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #394C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3894.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #395C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3951.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #396C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3968.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #397C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3951.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #398C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3967.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #399C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C4040.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3834.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4004.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #400C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4000.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #401C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3998.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #402C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4075.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #403C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4045.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #404C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4003.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #405C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4074.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #406C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4045.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #407C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4162.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #408C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4090.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #409C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3939.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3832.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #410C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4029.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #411C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4026.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #412C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4134.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #413C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4017.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #414C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4133.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #415C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4017.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #416C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3851.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #417C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3865.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #418C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3864.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #419C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3912.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3835.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #420C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3918.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #421C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3918.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #422C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3977.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #423C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C4070.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #424C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3925.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #425C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3973.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #426C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3965.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #427C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3971.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #428C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3967.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #429C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C4029.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3839.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #430C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3918.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #431C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3968.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #432C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3918.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #433C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3951.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #434C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3920.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #435C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3973.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #436C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3958.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #437C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3982.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #438C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)O[C@@H]1CN4024.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #439C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4080.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #44C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3870.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #440C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3959.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #441C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4012.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #442C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4140.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #443C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4017.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #444C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4013.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #445C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4142.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #446C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4021.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #447C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4159.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #448C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4093.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #449C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4020.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #45C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3872.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #450C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4043.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #451C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4042.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #452C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4076.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #453C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4049.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #454C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4075.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #455C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4049.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #456C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3913.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #457C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3913.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #458C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3973.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #459C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C4077.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #46C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3867.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #460C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3920.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #461C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3970.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #462C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3958.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #463C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3970.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #464C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3962.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #465C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C4020.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #466C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3975.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #467C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4031.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #468C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4130.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #469C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4030.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #47C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3919.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #470C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4033.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #471C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4131.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #472C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4032.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #473C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4153.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #474C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4101.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #475C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4032.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #476C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4042.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #477C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4041.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #478C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4074.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #479C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4061.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3862.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #480C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4075.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #481C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4062.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #482C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3969.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #483C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4018.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #484C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4140.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #485C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4025.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #486C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4018.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #487C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4142.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #488C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4024.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #489C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4161.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3865.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #490C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4095.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #491C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4031.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #492C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4038.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #493C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4036.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #494C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4073.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #495C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4049.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #496C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4073.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #497C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4046.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #498C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4075.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #499C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4216.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #5C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3861.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #50C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3873.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #500C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4114.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #501C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4115.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #502C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4240.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #503C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4133.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #504C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4160.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #505C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)[Si](C)(C)C4235.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #506C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4239.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #507C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4131.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #508C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4158.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #509C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)[Si](C)(C)C4235.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #51C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3869.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #510C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)[Si](C)(C)C4266.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #511C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4140.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #512C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4143.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #513C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4147.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #514C[Si](C)(C)N([C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O)[Si](C)(C)C4169.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #515C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O)[Si](C)(C)C4170.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #516C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C4169.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #52C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3889.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #53C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3935.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3863.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #55C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3908.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #56C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3904.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #57C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3908.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #58C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3911.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #59C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3906.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #6C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3862.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #60C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3904.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #61C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3913.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #62C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3912.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #63C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3918.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #64C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3922.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #65C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3964.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3968.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #67C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3960.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #68C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3921.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3964.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #7C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3867.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #70C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3975.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4066.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4011.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3843.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3847.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #75C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3850.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #76C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3850.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #77C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3861.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #78C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3917.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3849.9Semi standard non polar33892256
Kanamycin,4TMS,isomer #8C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3918.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #80C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3893.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #81C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3893.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #82C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3888.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #83C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3893.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #84C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3896.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #85C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3896.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #86C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3895.7Semi standard non polar33892256
Kanamycin,4TMS,isomer #87C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3894.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #88C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3907.0Semi standard non polar33892256
Kanamycin,4TMS,isomer #89C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3904.4Semi standard non polar33892256
Kanamycin,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3808.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #90C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3951.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3962.2Semi standard non polar33892256
Kanamycin,4TMS,isomer #92C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3948.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #93C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3903.8Semi standard non polar33892256
Kanamycin,4TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3957.1Semi standard non polar33892256
Kanamycin,4TMS,isomer #95C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3957.6Semi standard non polar33892256
Kanamycin,4TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4081.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4007.3Semi standard non polar33892256
Kanamycin,4TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3860.5Semi standard non polar33892256
Kanamycin,4TMS,isomer #99C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3893.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3722.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3789.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3925.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #101C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3975.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #102C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3906.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #103C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3955.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #104C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3954.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #105C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3965.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #106C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4040.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #107C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3935.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #108C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3997.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #109C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3971.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #11C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3793.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #110C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3966.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #111C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4000.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #112C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3971.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #113C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4038.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #114C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3935.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #115C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4072.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #116C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4001.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3778.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3789.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #119C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3795.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #12C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3808.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #120C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3803.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #121C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3806.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #122C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3883.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3772.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #124C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3835.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #125C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3843.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #126C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3821.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #127C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3832.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #128C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3843.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #129C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3852.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #13C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3879.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #130C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3830.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #131C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3838.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #132C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3865.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #133C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3861.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #134C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3929.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3879.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #136C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3928.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #137C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3864.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3878.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #139C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3917.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3775.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3980.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3950.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3804.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #143C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3852.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #144C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3834.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #145C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3835.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #146C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3865.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #147C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3841.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #148C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3842.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #149C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3863.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #15C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3825.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #150C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3872.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #151C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3844.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #152C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3859.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #153C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3926.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3887.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #155C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3921.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #156C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3860.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3888.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #158C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3941.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3990.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #16C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3834.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3965.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #161C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3859.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #162C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3864.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #163C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3855.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #164C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3829.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #165C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3898.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #166C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3898.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #167C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3912.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4000.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #169C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3891.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #17C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3828.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #170C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3915.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3906.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #172C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3918.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #173C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3908.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #174C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3945.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #175C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3901.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #176C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3909.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #177C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3925.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #178C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3914.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #179C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3920.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #18C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3832.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #180C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3909.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3911.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #182C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3920.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #183C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4003.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #184C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3947.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #185C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3979.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #186C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3921.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #187C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3969.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #188C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3968.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #189C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3985.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #19C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3838.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #190C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4043.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #191C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3954.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #192C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4019.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #193C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3997.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #194C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3980.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #195C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4019.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #196C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3991.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #197C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4040.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #198C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3949.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #199C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4077.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3736.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #20C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3844.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #200C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4019.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3783.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #202C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3809.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #203C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3807.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #204C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3825.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #205C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3838.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #206C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3816.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #207C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3818.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #208C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3837.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #209C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3843.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #21C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3834.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #210C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3815.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #211C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3830.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #212C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3894.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3873.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #214C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3891.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #215C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3836.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3874.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #217C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3910.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3992.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3950.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #22C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3839.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #220C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3840.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #221C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3847.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #222C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3837.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #223C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3798.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #224C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3867.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #225C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3868.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #226C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3891.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3892.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #228C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3889.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #229C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3871.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #23C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3863.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3888.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #231C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3879.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #232C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4002.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #233C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3925.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #234C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3881.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #235C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3884.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #236C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3898.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3900.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #238C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3895.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #239C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3884.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #24C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3858.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3896.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #241C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3887.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4005.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #243C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3927.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #244C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3958.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #245C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3892.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #246C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3952.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #247C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3952.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #248C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3953.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #249C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4038.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #25C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3928.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #250C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3931.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #251C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3994.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #252C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3969.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #253C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3952.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #254C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3997.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #255C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3965.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #256C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4035.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #257C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3927.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #258C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4070.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #259C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3994.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3878.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #260C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3854.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #261C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3826.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #262C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3825.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #263C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3810.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #264C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3857.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #265C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3858.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #266C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3885.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #267C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4008.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #268C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3841.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #269C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3871.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #27C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3927.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #270C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3896.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #271C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3874.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #272C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3894.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #273C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3947.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #274C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3858.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #275C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3873.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #276C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3882.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3904.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #278C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3882.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #279C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3876.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #28C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3862.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #280C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3905.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #281C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3894.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4012.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #283C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3949.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #284C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3932.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #285C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3867.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #286C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3934.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #287C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3932.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #288C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3942.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #289C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4019.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3876.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #290C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3931.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #291C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3989.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #292C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3973.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #293C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3941.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #294C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3989.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #295C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3971.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #296C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4017.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #297C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3930.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #298C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4072.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #299C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4003.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3742.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #30C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3918.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #300C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3910.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #301C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3898.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #302C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3871.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #303C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C4009.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #304C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3897.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #305C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3884.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3908.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #307C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3878.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3903.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #309C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3930.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3988.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #310C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3914.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #311C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3943.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #312C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4050.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #313C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3950.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #314C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3942.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #315C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4050.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #316C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3950.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #317C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4042.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #318C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3990.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #319C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3947.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3948.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #320C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3977.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #321C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3975.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #322C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3997.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #323C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3955.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #324C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3996.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #325C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3955.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #326C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3958.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #327C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3934.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #328C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3987.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #329C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3986.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3770.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #330C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3953.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #331C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4055.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #332C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3962.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #333C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3963.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #334C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4002.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #335C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3953.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #336C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3962.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #337C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4004.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #338C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4056.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #339C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3960.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3778.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #340C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4044.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #341C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3996.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #342C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4013.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #343C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4064.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #344C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4050.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #345C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4052.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #346C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4104.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #347C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4015.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #348C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4015.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4121.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #35C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3782.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #350C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4130.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #351C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4032.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #352C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4063.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4180.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4095.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #355C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4130.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #356C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4033.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #357C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4068.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #358C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4096.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #359C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4178.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #36C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3783.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #360C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4189.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #361C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3755.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #362C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3739.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #363C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3821.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #364C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3822.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #365C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3803.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #366C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3816.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #367C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3777.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #368C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3824.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #369C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3824.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #37C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3808.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #370C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3837.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #371C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3855.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #372C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3797.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #373C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3822.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #374C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3840.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #375C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3836.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #376C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3889.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #377C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3888.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #378C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3915.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #379C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N3905.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #38C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3874.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #380C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3911.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #381C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3889.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #382C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N3903.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #383C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3897.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #384C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4011.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #385C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3939.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #386C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3770.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #387C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3791.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #388C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3827.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #389C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3825.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3781.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #390C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3821.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #391C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3807.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #392C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3810.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #393C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3843.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #394C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3831.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #395C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3878.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #396C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3898.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #397C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3880.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #398C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3890.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #399C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3881.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #4C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3795.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #40C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3827.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #400C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3904.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #401C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3895.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #402C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3890.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #403C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)O[C@@H]1CN3932.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #404C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4010.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #405C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3809.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #406C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3834.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #407C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3815.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #408C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3814.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #409C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3861.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #41C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3826.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #410C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3877.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #411C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3891.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #412C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3908.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #413C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3885.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #414C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3878.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #415C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3910.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #416C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3900.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #417C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N4027.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #418C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3950.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #419C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3865.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #42C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3826.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #420C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3878.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #421C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3879.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #422C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3925.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #423C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3895.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #424C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3888.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #425C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4011.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #426C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3891.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #427C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)O[C@@H]1CO3899.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #428C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3896.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #429C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3975.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #43C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3828.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #430C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3940.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #431C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3988.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #432C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3985.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #433C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3965.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #434C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4066.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #435C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3968.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #436C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3973.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #437C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4011.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #438C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3966.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #439C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O3974.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #44C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3834.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #440C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4010.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #441C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4062.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #442C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3968.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #443C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4068.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #444C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4010.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #445C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3778.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #446C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3832.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #447C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3836.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #448C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3838.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #449C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3860.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #45C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3833.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #450C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3799.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #451C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3843.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #452C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3848.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #453C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3820.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #454C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3894.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #455C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3889.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #456C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3916.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #457C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N3909.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #458C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3914.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #459C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3890.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #46C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3833.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #460C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N3908.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #461C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3897.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #462C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4004.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #463C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3941.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #464C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3834.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #465C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3852.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #466C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3836.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #467C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3836.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #468C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3874.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #469C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3889.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #47C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3834.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #470C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3912.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #471C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3924.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #472C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3905.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #473C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3887.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #474C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3924.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #475C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3924.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #476C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N4013.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #477C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O3961.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #478C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3887.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #479C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3891.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #48C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3852.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #480C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3898.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #481C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3944.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #482C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3907.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #483C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3907.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #484C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4009.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #485C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3906.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #486C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)O[C@@H]1CO3920.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #487C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3921.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #488C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3978.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #489C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3949.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #49C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3856.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #490C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3995.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #491C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3993.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #492C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3984.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #493C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4063.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #494C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3984.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #495C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3996.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #496C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4026.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #497C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3977.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #498C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3989.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #499C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4022.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #5C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3800.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #50C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3923.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #500C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4059.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #501C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3978.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #502C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4070.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #503C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4023.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #504C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3802.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #505C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3813.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #506C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3813.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #507C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3826.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #508C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3850.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #509C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3863.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3873.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #510C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3881.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #511C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3912.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #512C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3875.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #513C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3862.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #514C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3910.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #515C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3886.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #516C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N4022.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #517C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3951.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #518C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3872.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #519C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3866.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #52C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3919.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #520C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3853.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #521C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3926.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #522C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3882.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #523C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3878.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #524C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3903.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #525C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3881.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #526C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3900.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #527C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO4006.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #528C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3959.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #529C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3924.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #53C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3856.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #530C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3983.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #531C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3983.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #532C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3953.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #533C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4061.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #534C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3960.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #535C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3970.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #536C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4007.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #537C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3951.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #538C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3966.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #539C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4007.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3867.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #540C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4058.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #541C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3956.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #542C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4062.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #543C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4000.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #544C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3869.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #545C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3860.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #546C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3866.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #547C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO3957.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #548C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3873.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #549C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3871.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #55C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3917.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #550C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4020.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #551C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3863.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #552C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3917.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #553C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3917.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #554C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3937.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #555C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3902.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #556C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3968.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #557C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3966.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #558C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3935.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #559C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4045.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3991.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #560C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3969.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #561C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3982.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #562C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4005.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #563C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3933.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #564C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3979.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #565C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4002.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #566C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4041.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #567C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3967.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #568C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4070.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #569C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4014.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3944.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #570C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3934.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #571C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3935.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #572C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4031.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #573C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4000.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #574C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3943.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #575C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4015.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #576C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3952.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #577C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4016.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #578C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3952.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #579C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3941.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3784.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #580C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4068.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #581C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3971.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #582C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C4066.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #583C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3968.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #584C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3998.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #585C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3997.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #586C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4017.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #587C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4058.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #588C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4055.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #589C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4069.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #59C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3834.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #590C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4112.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #591C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4039.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #592C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4038.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #593C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4130.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #594C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4127.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #595C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4033.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #596C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4067.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #597C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4185.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #598C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4125.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #599C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4125.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #6C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3780.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #60C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3810.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #600C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4034.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #601C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4069.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #602C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4125.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #603C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4184.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #604C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4204.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #605C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3739.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #606C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3844.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #607C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3808.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #608C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3808.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #609C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3823.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #61C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3812.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #610C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3795.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #611C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3797.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #612C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3835.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #613C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3820.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #614C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3891.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #615C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3881.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #616C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3885.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #617C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3954.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #618C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3850.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #619C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3868.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #62C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3839.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #620C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3896.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #621C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3869.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #622C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3896.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #623C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4020.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #624C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3822.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #625C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3820.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #626C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3815.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #627C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3852.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #628C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3914.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #629C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3901.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #63C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3819.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #630C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3907.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #631C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3964.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #632C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3863.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #633C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3881.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #634C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3910.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #635C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3878.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #636C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3909.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #637C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4007.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #638C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3839.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #639C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3854.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #64C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3821.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #640C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3876.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #641C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3899.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #642C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3871.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #643C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3853.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #644C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3894.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #645C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3878.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #646C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4019.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #647C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C3957.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #648C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3926.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #649C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3928.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #65C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3844.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #650C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4061.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #651C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4017.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #652C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3930.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #653C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4005.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #654C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3972.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #655C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4009.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #656C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3973.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #657C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3891.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #658C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3963.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #659C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O3961.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #66C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3845.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #660C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4046.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #661C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3961.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #662C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4040.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #663C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3956.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #664C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3794.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #665C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3813.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #666C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3811.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #667C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3808.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #668C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3870.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #669C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3894.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #67C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3827.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #670C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3874.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #671C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3880.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #672C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3874.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #673C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3898.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #674C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3884.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #675C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3879.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #676C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3931.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #677C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4002.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #678C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3882.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #679C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3879.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #68C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3843.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #680C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3884.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #681C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4006.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #682C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3884.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #683C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3909.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #684C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N3890.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #685C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3910.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #686C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3891.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #687C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C3938.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #688C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3930.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #689C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3954.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #69C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3906.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #690C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4062.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #691C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3959.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #692C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3953.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #693C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4065.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #694C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3955.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #695C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4057.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #696C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4012.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #697C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3967.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #698C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3982.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #699C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3978.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #7C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3848.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3874.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #700C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4011.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #701C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3960.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #702C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4012.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #703C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3958.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #704C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3885.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #705C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3882.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #706C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3886.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #707C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3998.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #708C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3889.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #709C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3915.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #71C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3902.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #710C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3894.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #711C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3915.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #712C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3895.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #713C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3940.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #714C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3939.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #715C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3965.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #716C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4060.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #717C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3968.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #718C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3972.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #719C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4063.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #72C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3848.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #720C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3972.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #721C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4059.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #722C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4021.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #723C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3971.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #724C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3990.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #725C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3985.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #726C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4022.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #727C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3975.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #728C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4027.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #729C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3981.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3877.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #730C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3952.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #731C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3912.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #732C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3979.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #733C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3977.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #734C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3938.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #735C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4059.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #736C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3948.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #737C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4012.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #738C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3959.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #739C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3937.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #74C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3920.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #740C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4011.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #741C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3956.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #742C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4056.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #743C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3947.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #744C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C4052.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #745C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4002.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #746C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4005.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #747C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4114.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #748C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4037.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #749C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4033.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3995.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #750C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C4122.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #751C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4020.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #752C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4075.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #753C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4176.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #754C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4124.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #755C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4018.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #756C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4072.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #757C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4180.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #758C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4210.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #759C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C4049.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3947.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #760C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4044.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #761C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4070.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #762C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4122.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #763C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4128.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #764C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4130.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #765C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3787.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #766C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3791.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #767C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3786.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #768C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3867.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #769C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3835.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #77C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3844.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #770C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3911.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #771C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3846.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #772C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3880.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #773C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3843.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #774C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3914.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #775C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3881.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #776C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3927.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #777C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3965.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #778C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4007.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #779C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3925.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #78C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3851.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #780C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3921.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #781C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3927.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #782C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3967.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #783C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3849.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #784C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3849.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #785C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3895.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #786C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3853.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #787C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3897.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #788C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4014.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #789C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3893.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #79C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3839.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #790C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3961.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #791C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4039.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #792C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3955.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #793C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3960.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #794C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4043.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #795C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3952.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #796C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4097.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #797C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4034.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #798C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3964.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #799C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3952.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3774.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #80C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3804.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #800C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3946.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #801C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4011.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #802C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3994.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #803C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4011.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #804C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3994.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #805C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3858.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #806C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #807C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3931.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #808C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4007.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #809C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3855.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #81C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3885.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #810C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3927.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #811C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3900.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #812C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3927.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #813C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3900.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #814C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3977.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #815C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3904.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #816C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3975.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #817C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4037.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #818C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3958.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #819C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3978.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #82C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3879.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #820C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4041.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #821C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3960.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #822C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4095.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #823C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4045.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #824C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3972.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #825C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3960.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #826C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3957.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #827C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4023.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #828C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4004.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #829C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4024.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #83C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3888.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #830C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4008.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #831C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3872.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #832C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3941.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #833C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4036.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #834C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3940.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #835C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3943.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #836C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4035.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #837C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3941.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #838C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O4093.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #839C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4028.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4003.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #840C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3946.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #841C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3948.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #842C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3944.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #843C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4011.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #844C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3988.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #845C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4010.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #846C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3990.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #847C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3999.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #848C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4132.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #849C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4050.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #85C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3876.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #850C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4074.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #851C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4062.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #852C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4049.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #853C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4051.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #854C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4115.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #855C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H]1O4131.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #856C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4047.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #857C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4076.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #858C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4117.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #859C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4202.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #86C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3902.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #860C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4092.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #861C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4010.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #862C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4010.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #863C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4119.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #864C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4182.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #865C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4180.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #866C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3862.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #867C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3859.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #868C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3905.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #869C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3983.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3885.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #870C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3868.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #871C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3927.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #872C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3879.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #873C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3930.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #874C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3880.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #875C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C3949.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #876C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3919.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #877C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3984.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #878C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4052.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #879C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3951.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #88C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3899.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #880C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3982.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #881C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4054.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #882C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3954.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #883C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4086.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #884C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O4032.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #885C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3991.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #886C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3978.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #887C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3982.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #888C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4031.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #889C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3996.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3884.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #890C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4027.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #891C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3999.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #892C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3992.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #893C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3917.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #894C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3965.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #895C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3965.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #896C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3975.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #897C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4022.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #898C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3990.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #899C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C4051.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3783.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3925.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #900C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3945.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #901C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3976.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #902C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4059.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #903C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3949.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #904C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4021.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #905C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3994.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #906C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4100.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #907C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C4029.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #908C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4025.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #909C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4116.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #91C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3887.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #910C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4023.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #911C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4025.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #912C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4149.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #913C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4041.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #914C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4082.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #915C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4183.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #916C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4150.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #917C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4043.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #918C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O4078.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #919C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4185.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #92C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3892.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #920C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4206.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #921C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C4076.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #922C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4065.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #923C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H]1O4065.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #924C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4123.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #925C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4113.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #926C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4114.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #927C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3920.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #928C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3981.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #929C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4054.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #93C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3906.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #930C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3952.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #931C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3982.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #932C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4056.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #933C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3955.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #934C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4095.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #935C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4034.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #936C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O3995.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #937C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3977.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #938C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3977.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #939C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O4029.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3893.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #940C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4000.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #941C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4027.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #942C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4005.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #943C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4050.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #944C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4117.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #945C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4041.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #946C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4039.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #947C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4153.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #948C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4064.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #949C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4094.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #95C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3906.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #950C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4174.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #951C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4155.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #952C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4070.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #953C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O4093.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #954C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4179.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #955C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4200.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #956C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O4080.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #957C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4075.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #958C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4076.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #959C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4125.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #96C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3897.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #960C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4115.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #961C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4117.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #962C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4040.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #963C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4122.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #964C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4036.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #965C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4036.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #966C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4155.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #967C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4052.4Semi standard non polar33892256
Kanamycin,5TMS,isomer #968C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4089.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #969C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4192.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3893.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #970C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4156.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #971C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4050.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #972C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C4085.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #973C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4193.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #974C[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4211.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #975C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O4082.7Semi standard non polar33892256
Kanamycin,5TMS,isomer #976C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4072.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #977C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4074.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #978C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4119.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #979C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4115.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #98C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3895.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #980C[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4113.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #981C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4228.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #982C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4138.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #983C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4137.6Semi standard non polar33892256
Kanamycin,5TMS,isomer #984C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4157.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #985C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4261.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #986C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4260.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #987C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4181.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #988C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4267.1Semi standard non polar33892256
Kanamycin,5TMS,isomer #989C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4257.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4007.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #990C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4186.5Semi standard non polar33892256
Kanamycin,5TMS,isomer #991C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4266.0Semi standard non polar33892256
Kanamycin,5TMS,isomer #992C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4260.2Semi standard non polar33892256
Kanamycin,5TMS,isomer #993C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4184.8Semi standard non polar33892256
Kanamycin,5TMS,isomer #994C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4178.3Semi standard non polar33892256
Kanamycin,5TMS,isomer #995C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4176.9Semi standard non polar33892256
Kanamycin,5TMS,isomer #996C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4189.6Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4357.1Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #10CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4417.0Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #11CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4443.4Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4346.1Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4351.6Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4365.9Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4344.2Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4355.4Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4341.3Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4423.1Semi standard non polar33892256
Kanamycin,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4416.2Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4413.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4493.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4399.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4401.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4408.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4432.1Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4409.1Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4465.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4465.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4476.2Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4466.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4420.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4431.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4406.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O4405.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4412.1Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4479.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4471.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4469.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4483.3Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4426.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4427.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4417.8Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C4432.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4510.2Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4471.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4471.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4499.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C4413.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4400.3Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #37CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4480.3Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #38CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4465.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #39CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4468.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4441.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #40CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4489.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4414.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #42CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4492.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #43CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4477.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #44CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4477.2Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #45CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4491.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #46CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4490.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #47CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4462.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #48CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4464.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #49CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4483.4Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O4436.3Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #50CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4550.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #51CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4552.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #52CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4579.0Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #53CC(C)(C)[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4660.3Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #54CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4535.8Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #55CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4579.5Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #56CC(C)(C)[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O)[Si](C)(C)C(C)(C)C4609.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #57CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4578.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #58CC(C)(C)[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O)[Si](C)(C)C(C)(C)C4609.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #59CC(C)(C)[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O)[Si](C)(C)C(C)(C)C4634.9Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4432.7Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4478.6Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4477.2Semi standard non polar33892256
Kanamycin,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4490.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4498.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4493.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #100CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4516.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #101CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4516.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #102CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4525.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #103CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C4489.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #104CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4545.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #105CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4530.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #106CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4528.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #107CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4533.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #108CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4520.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #109CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4520.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4506.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #110CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4536.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #111CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C4528.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #112CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4565.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #113CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4564.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #114CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4571.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #115CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4752.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #116CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4555.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #117CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C4568.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #118CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4684.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #119CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4566.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O4505.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #120CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4683.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #121CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4704.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #122CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CN4489.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #123CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4499.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #124CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4544.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #125CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4501.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #126CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4502.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #127CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4545.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #128CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4497.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #129CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4549.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4492.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #130CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4515.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #131CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4516.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #132CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4551.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #133CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4536.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #134CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4504.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #135CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4504.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #136CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4546.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #137CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4576.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #138CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4579.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #139CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4591.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4528.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #140CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4717.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #141CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4524.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #142CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4555.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #143CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4674.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #144CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4556.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #145CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4676.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #146CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4776.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #147CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C4492.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #148CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4529.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #149CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4507.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4529.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #150CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4510.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #151CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4540.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #152CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4511.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #153CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4513.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #154CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4542.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #155CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4532.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #156CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4565.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #157CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4564.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #158CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4597.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #159CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4756.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4547.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #160CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4554.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #161CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4588.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #162CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4682.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #163CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4587.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #164CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4682.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #165CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H]1O4698.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #166CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4532.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #167CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4515.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #168CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4516.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #169CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4545.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4544.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #170CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4582.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #171CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4581.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #172CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4615.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #173CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4756.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #174CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4575.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #175CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4605.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #176CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4682.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #177CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4603.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #178CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@@H]1O4680.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #179CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@@H]1O4692.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4511.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #180CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4570.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #181CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4570.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #182CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4604.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #183CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4770.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #184CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4555.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #185CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4590.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #186CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4680.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #187CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4589.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #188CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4680.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #189CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CN)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1O4694.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O4517.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #190CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4590.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #191CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4644.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #192CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O4799.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #193CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4747.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #194CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4642.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #195CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4798.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #196CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4747.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #197CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4823.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #198CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4766.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #199CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C(C)(C)C)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4641.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4487.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4507.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #200CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4730.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #201CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4729.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #202CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4756.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #203CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4756.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #204CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O4755.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #205CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4753.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4521.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4520.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4544.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4543.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O4530.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4523.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4515.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4515.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4551.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4507.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4550.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4523.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4557.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4541.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4539.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4538.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4533.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4533.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4553.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4526.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)[C@@H]1O4512.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4563.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4575.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4591.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4688.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4593.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4576.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4688.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4595.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4753.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4695.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C(C)(C)C4501.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4486.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4476.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4498.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4483.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4513.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4513.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4544.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4518.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4484.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4498.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4521.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4475.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4521.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4523.3Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4543.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H]2O)[C@@H]1O4521.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4505.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@@H]1CO4488.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4518.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4517.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4537.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4521.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O4520.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@@H]1CO4503.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4507.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4507.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4541.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O4518.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4513.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4534.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #78CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4515.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #79CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4513.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4550.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #80CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4556.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #81CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4565.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #82CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]1O4559.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #83CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4682.8Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #84CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4561.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #85CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C(C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4566.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4682.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #87CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4563.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #88CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N4757.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4691.6Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H]1O4543.0Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4501.5Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4501.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #92CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4506.7Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #93CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4527.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #94CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4508.4Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #95CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O4508.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #96CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4540.1Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #97CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H]1CN4479.9Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #98CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4490.2Semi standard non polar33892256
Kanamycin,3TBDMS,isomer #99CC(C)(C)[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4545.0Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (Non-derivatized) - 70eV, Positivesplash10-02ai-9543500000-ec5e97948b788974569f2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (2 TMS) - 70eV, Positivesplash10-03e9-9221213000-0d2218e341a1e472caab2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_2_56) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_2_58) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_46) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_86) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_143) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_162) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_164) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_178) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_188) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_196) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_3_203) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_37) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_69) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_94) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_113) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_127) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_137) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_147) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_152) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_185) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_210) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Kanamycin GC-MS (TMS_4_229) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin DI-ESI-Ion Trap , Positive-QTOFsplash10-00di-2901000023-e1b4c2a4d54a44d851b12017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin DI-ESI-Hybrid FT , Positive-QTOFsplash10-00di-2901000023-e1b4c2a4d54a44d851b12017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin 10V, Positive-QTOFsplash10-0229-0829000000-f16628522b8cb19f02152021-09-20HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin 20V, Positive-QTOFsplash10-03di-0910000000-2474517847292b897b8e2021-09-20HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin 30V, Positive-QTOFsplash10-03di-0900000000-bf025fb5432b884933e02021-09-20HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin 20V, Positive-QTOFsplash10-03di-0910000000-320fee58379d18150c612021-09-20HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Kanamycin 10V, Positive-QTOFsplash10-0229-0829000000-2527173e0feeba5dac072021-09-20HMDB team, MONAView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 10V, Positive-QTOFsplash10-0cki-0409400000-07db8e9644e08a0b579c2016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 20V, Positive-QTOFsplash10-08fr-0916000000-7a0e33b6f175ffea26272016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 40V, Positive-QTOFsplash10-03di-2902000000-8b1a93b98307c301f6a52016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 10V, Negative-QTOFsplash10-0089-4977800000-03d3651e5cdc96e9168b2016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 20V, Negative-QTOFsplash10-0fdo-6649300000-8fcfeb60017d81263bcb2016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 40V, Negative-QTOFsplash10-0r6r-4921000000-9827643510b1b217ad832016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 10V, Positive-QTOFsplash10-000i-0100900000-2295a5f34094ab52bbf72021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 20V, Positive-QTOFsplash10-08mj-0906300000-99cd114db5c17ff08fac2021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 40V, Positive-QTOFsplash10-000g-9412000000-2ac1831892d371ace6832021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 10V, Negative-QTOFsplash10-001i-0302900000-61d28f79122a335d54a82021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 20V, Negative-QTOFsplash10-053r-6407900000-9f9274e9dfd4fecb92382021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Kanamycin 40V, Negative-QTOFsplash10-0a4i-9664000000-b4e98eff95fbd3f0a44a2021-10-11Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
Biospecimen Locations
  • Blood
  • Urine
Tissue LocationsNot Available
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableTaking drug identified by DrugBank entry DB01172 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableTaking drug identified by DrugBank entry DB01172 details
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDDB01172
Phenol Explorer Compound IDNot Available
FooDB IDNot Available
KNApSAcK IDC00018690
Chemspider ID5810
KEGG Compound IDC01822
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkKanamycin
METLIN IDNot Available
PubChem Compound6032
PDB IDNot Available
ChEBI ID17630
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDrw1306611
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available