| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:30:14 UTC |
|---|
| Update Date | 2022-03-07 02:52:09 UTC |
|---|
| HMDB ID | HMDB0029407 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Betanidin |
|---|
| Description | Betanidin belongs to the class of organic compounds known as indolecarboxylic acids. Indolecarboxylic acids are compounds containing a carboxylic acid group linked to an indole. Betanidin has been detected, but not quantified in, root vegetables and swiss chards (Beta vulgaris ssp. cicla). This could make betanidin a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on Betanidin. |
|---|
| Structure | OC(=O)C1C\C(=C/C=[N+]2\C(CC3=CC(O)=C(O)C=C23)C([O-])=O)C=C(N1)C(O)=O InChI=1S/C18H16N2O8/c21-14-6-9-5-13(18(27)28)20(12(9)7-15(14)22)2-1-8-3-10(16(23)24)19-11(4-8)17(25)26/h1-3,6-7,11,13H,4-5H2,(H5,21,22,23,24,25,26,27,28) |
|---|
| Synonyms | | Value | Source |
|---|
| 2-Carboxy-1-[(2,6-dicarboxy-2,3-dihydro-4(1H)-pyridinylidene)ethylidene]-2,3-dihydro-5,6-dihydroxy-1H-indolium hydroxide inner salt | HMDB | | 4-[2-[(2S)-2-Carboxy-2,3-dihydro-5,6-dihydroxy-1H-indol-1-yl]ethenyl]-2,3-dihydro-(2S)-2,6-pyridinedicarboxylic acid | HMDB | | Betanidine | HMDB | | 2-Carboxy-1-[2-(2,6-dicarboxy-1,2,3,4-tetrahydropyridin-4-ylidene)ethylidene]-6-hydroxy-2,3-dihydro-1H-1λ⁵-indol-1-ylium-5-olic acid | Generator |
|
|---|
| Chemical Formula | C18H16N2O8 |
|---|
| Average Molecular Weight | 388.3282 |
|---|
| Monoisotopic Molecular Weight | 388.090665498 |
|---|
| IUPAC Name | (1E)-1-{2-[(4E)-2,6-dicarboxy-1,2,3,4-tetrahydropyridin-4-ylidene]ethylidene}-5,6-dihydroxy-2,3-dihydro-1H-1λ⁵-indol-1-ylium-2-carboxylate |
|---|
| Traditional Name | (1E)-1-{2-[(4E)-2,6-dicarboxy-2,3-dihydro-1H-pyridin-4-ylidene]ethylidene}-5,6-dihydroxy-2,3-dihydro-1H-1λ⁵-indol-1-ylium-2-carboxylate |
|---|
| CAS Registry Number | 2181-76-2 |
|---|
| SMILES | OC(=O)C1C\C(=C/C=[N+]2\C(CC3=CC(O)=C(O)C=C23)C([O-])=O)C=C(N1)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C18H16N2O8/c21-14-6-9-5-13(18(27)28)20(12(9)7-15(14)22)2-1-8-3-10(16(23)24)19-11(4-8)17(25)26/h1-3,6-7,11,13H,4-5H2,(H5,21,22,23,24,25,26,27,28) |
|---|
| InChI Key | XHJKHSXHWJCBLX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as indolecarboxylic acids. Indolecarboxylic acids are compounds containing a carboxylic acid group linked to an indole. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Indoles and derivatives |
|---|
| Sub Class | Indolecarboxylic acids and derivatives |
|---|
| Direct Parent | Indolecarboxylic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Indolecarboxylic acid
- Alpha-amino acid
- Alpha-amino acid or derivatives
- Tricarboxylic acid or derivatives
- 1-hydroxy-2-unsubstituted benzenoid
- Tetrahydropyridine
- Hydropyridine
- Benzenoid
- Amino acid or derivatives
- Carboxylic acid salt
- Amino acid
- Shiff base
- Carboxylic acid derivative
- Carboxylic acid
- Secondary aliphatic amine
- Enamine
- Azacycle
- Secondary amine
- Organic 1,3-dipolar compound
- Propargyl-type 1,3-dipolar organic compound
- Hydrocarbon derivative
- Organopnictogen compound
- Amine
- Organic oxygen compound
- Organonitrogen compound
- Organooxygen compound
- Carbonyl group
- Organic salt
- Organic nitrogen compound
- Organic oxide
- Organic zwitterion
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.51 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 12.2383 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.11 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 166.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1567.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 219.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 91.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 150.0 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 73.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 410.4 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 406.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 295.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 765.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 348.8 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1401.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 279.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 247.9 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 604.5 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 209.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 335.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Betanidin,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 3726.1 | Semi standard non polar | 33892256 | | Betanidin,1TMS,isomer #2 | C[Si](C)(C)OC1=CC2=C(C=C1O)/[N+](=C/C=C1/C=C(C(=O)O)NC(C(=O)O)C1)C(C(=O)[O-])C2 | 3719.2 | Semi standard non polar | 33892256 | | Betanidin,1TMS,isomer #3 | C[Si](C)(C)OC1=CC2=C(C=C1O)CC(C(=O)[O-])/[N+]2=C\C=C1\C=C(C(=O)O)NC(C(=O)O)C1 | 3705.3 | Semi standard non polar | 33892256 | | Betanidin,1TMS,isomer #4 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 3710.2 | Semi standard non polar | 33892256 | | Betanidin,1TMS,isomer #5 | C[Si](C)(C)N1C(C(=O)O)=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC1C(=O)O | 3730.2 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 3625.2 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #10 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C | 3610.9 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 3648.0 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #3 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1 | 3604.0 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #4 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C | 3618.8 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #5 | C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)/[N+](=C/C=C1/C=C(C(=O)O)NC(C(=O)O)C1)C(C(=O)[O-])C2 | 3678.1 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #6 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 3621.7 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #7 | C[Si](C)(C)OC1=CC2=C(C=C1O)/[N+](=C/C=C1/C=C(C(=O)O)N([Si](C)(C)C)C(C(=O)O)C1)C(C(=O)[O-])C2 | 3667.7 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #8 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 3593.0 | Semi standard non polar | 33892256 | | Betanidin,2TMS,isomer #9 | C[Si](C)(C)OC1=CC2=C(C=C1O)CC(C(=O)[O-])/[N+]2=C\C=C1\C=C(C(=O)O)N([Si](C)(C)C)C(C(=O)O)C1 | 3638.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 3618.4 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #10 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C | 3559.9 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1 | 3564.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C | 3558.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1 | 3581.6 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C | 3595.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #6 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1[Si](C)(C)C | 3523.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #7 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 3604.7 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #8 | C[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C)/[N+](=C/C=C1/C=C(C(=O)O)N([Si](C)(C)C)C(C(=O)O)C1)C(C(=O)[O-])C2 | 3637.6 | Semi standard non polar | 33892256 | | Betanidin,3TMS,isomer #9 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C | 3587.1 | Semi standard non polar | 33892256 | | Betanidin,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1 | 3602.5 | Semi standard non polar | 33892256 | | Betanidin,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C | 3578.4 | Semi standard non polar | 33892256 | | Betanidin,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1[Si](C)(C)C | 3523.6 | Semi standard non polar | 33892256 | | Betanidin,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1[Si](C)(C)C | 3554.5 | Semi standard non polar | 33892256 | | Betanidin,4TMS,isomer #5 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C | 3578.9 | Semi standard non polar | 33892256 | | Betanidin,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1[Si](C)(C)C | 3561.0 | Semi standard non polar | 33892256 | | Betanidin,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C)N1[Si](C)(C)C | 3375.6 | Standard non polar | 33892256 | | Betanidin,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 3997.8 | Semi standard non polar | 33892256 | | Betanidin,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)/[N+](=C/C=C1/C=C(C(=O)O)NC(C(=O)O)C1)C(C(=O)[O-])C2 | 3984.4 | Semi standard non polar | 33892256 | | Betanidin,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)CC(C(=O)[O-])/[N+]2=C\C=C1\C=C(C(=O)O)NC(C(=O)O)C1 | 3972.6 | Semi standard non polar | 33892256 | | Betanidin,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 3976.8 | Semi standard non polar | 33892256 | | Betanidin,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N1C(C(=O)O)=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC1C(=O)O | 3989.8 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 4118.6 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4102.6 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 4135.2 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1 | 4081.6 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4102.3 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)/[N+](=C/C=C1/C=C(C(=O)O)NC(C(=O)O)C1)C(C(=O)[O-])C2 | 4139.9 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 4150.1 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)/[N+](=C/C=C1/C=C(C(=O)O)N([Si](C)(C)C(C)(C)C)C(C(=O)O)C1)C(C(=O)[O-])C2 | 4159.1 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 4126.4 | Semi standard non polar | 33892256 | | Betanidin,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)CC(C(=O)[O-])/[N+]2=C\C=C1\C=C(C(=O)O)N([Si](C)(C)C(C)(C)C)C(C(=O)O)C1 | 4137.4 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1 | 4271.5 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4301.4 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1 | 4269.6 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4292.6 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1 | 4273.0 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4313.1 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 4212.2 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1 | 4299.0 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O[Si](C)(C)C(C)(C)C)/[N+](=C/C=C1/C=C(C(=O)O)N([Si](C)(C)C(C)(C)C)C(C(=O)O)C1)C(C(=O)[O-])C2 | 4332.7 | Semi standard non polar | 33892256 | | Betanidin,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4326.1 | Semi standard non polar | 33892256 | | Betanidin,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1 | 4429.4 | Semi standard non polar | 33892256 | | Betanidin,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1C/C(=C\C=[N+]2\C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])C=C(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4478.3 | Semi standard non polar | 33892256 | | Betanidin,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 4422.2 | Semi standard non polar | 33892256 | | Betanidin,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C | 4438.9 | Semi standard non polar | 33892256 | | Betanidin,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C1=C/C(=C/C=[N+]2/C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3CC2C(=O)[O-])CC(C(=O)O)N1[Si](C)(C)C(C)(C)C | 4476.6 | Semi standard non polar | 33892256 |
|
|---|