Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:34:52 UTC

Update Date

2022-03-07 02:52:26 UTC

HMDB ID

HMDB0030116

Secondary Accession Numbers

HMDB30116

Metabolite Identification

Common Name

Withaperuvin D

Description

Withaperuvin D belongs to the class of organic compounds known as withanolides and derivatives. These are c28 steroids structurally characterized by an ergostane skeleton usually functionalized at carbons 1, 22 and 26 to form a lactone ring. Withaperuvin D is an extremely weak basic (essentially neutral) compound (based on its pKa).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061305002D          

 37 42  0  0  0  0            999 V2000
    7.4438    0.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3266    2.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1625   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3785   -1.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3595   -1.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4422   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2643   -1.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9848    0.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7079   -0.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3923   -0.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1644    0.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2857   -0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6388    0.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801    1.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614   -0.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2280    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4238   -1.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5872   -0.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2878    0.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3117    0.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2751    1.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7350   -0.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2225   -0.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3407   -1.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3835   -0.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5534   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0766    0.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3209   -1.9261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3234   -0.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7165    1.7224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1280   -1.3129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1120    0.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8093   -1.6210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9007   -0.0152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4162    1.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0286    0.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  6  1  0  0  0  0
  9  8  1  0  0  0  0
 13  1  1  0  0  0  0
 13 10  1  0  0  0  0
 14  2  1  0  0  0  0
 14 13  2  0  0  0  0
 15  6  1  0  0  0  0
 16 11  1  0  0  0  0
 16 15  1  0  0  0  0
 17 12  1  0  0  0  0
 18 12  1  0  0  0  0
 19 10  1  0  0  0  0
 20 11  1  0  0  0  0
 21 17  1  0  0  0  0
 22 14  1  0  0  0  0
 23  3  1  0  0  0  0
 23  7  1  0  0  0  0
 24  4  1  0  0  0  0
 24 15  1  0  0  0  0
 24 18  1  0  0  0  0
 25  5  1  0  0  0  0
 25 19  1  0  0  0  0
 26  8  1  0  0  0  0
 26 16  1  0  0  0  0
 26 23  1  0  0  0  0
 27  9  1  0  0  0  0
 27 23  1  0  0  0  0
 27 25  1  0  0  0  0
 28 20  1  0  0  0  0
 28 21  1  0  0  0  0
 28 24  1  0  0  0  0
 29 18  2  0  0  0  0
 30 21  1  0  0  0  0
 31 22  2  0  0  0  0
 32 25  1  0  0  0  0
 33 26  1  0  0  0  0
 34 27  1  0  0  0  0
 35 28  1  0  0  0  0
 36 17  1  0  0  0  0
 36 20  1  0  0  0  0
 37 19  1  0  0  0  0
 37 22  1  0  0  0  0
M  END

HMDB0030116
     RDKit          3D
Withaperuvin D
 77 82  0  0  0  0  0  0  0  0999 V2000
    5.1626   -2.2321   -2.0143 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1228   -1.1889   -0.9584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404   -0.9580   -0.3066 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5072   -1.6836   -0.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1993    0.0551    0.7378 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2557    0.3216    1.4025 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088    0.6831    0.9594 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9035    0.7344    0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7133    1.0260    0.9882 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6326    0.1494    2.1832 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332    2.2763    1.5870 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4723    1.4532    0.3515 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7807    2.4396   -0.5862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6663    2.2552    1.4280 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3807    2.8083    0.5252 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7496    1.5606   -0.3000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7457    2.0727   -1.6270 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1119    1.1051   -0.0057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0533    1.3252   -1.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0016    0.2330   -1.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0818    0.1131   -1.9940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6668   -1.0458   -1.4155 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7053   -2.1556   -1.1427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9128   -2.0362    0.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4314   -3.0445    0.5739 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6216   -0.7626    0.8381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0649   -0.9010    2.2807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2521   -0.2339    0.6512 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2395   -1.1648    0.0810 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1218   -0.6481    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4124    0.6080   -0.1618 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7313    0.1510   -1.5816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5996    0.1755    0.1797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8023    1.3653    0.7572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9807   -0.4672   -0.0226 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2120   -1.4657    0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8365   -0.4801   -0.7261 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9772   -2.9662   -1.8443 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4334   -1.7037   -2.9739 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770   -2.7153   -2.1612 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3380   -1.0853   -0.2093 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5222   -2.6598   -0.0858 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6633   -1.7748   -1.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0308    1.6431   -0.5455 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9598    0.5943    2.9166 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4496   -0.9165    1.9764 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6558    0.1561    2.6700 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9660    2.1557    2.0683 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2963    3.1875   -0.2099 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3645    3.0083    1.7919 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2858    1.5638    2.1880 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0434    3.6158   -0.0569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2520    3.1434    1.1318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0345    3.0016   -1.6550 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5408    1.8372    0.7523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4083    1.2653   -2.1375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4957    2.3179   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3855   -0.6745   -1.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5638   -1.3577   -1.9403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3747   -3.0600   -0.9749 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1340   -2.4548   -2.0458 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6912   -0.0306    2.5891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5355   -1.8652    2.4874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1467   -0.8359    2.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8910   -0.0563    1.7224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1236   -1.1899   -0.9983 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2885   -2.1977    0.5284 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0220   -0.5392    1.6646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8184   -1.4440    0.2588 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1197   -0.8602   -1.6504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2148    0.1734   -2.1986 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4260    0.8497   -2.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.7237    0.7233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7659    0.2900   -0.0738 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9494   -1.1610    1.4853 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5512   -0.1731   -1.7825 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1157   -1.2485   -0.4052 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  3  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 26 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  8 37  1  0
 37  2  1  0
 31 12  1  0
 31 16  1  0
 28 18  1  0
 33 20  1  0
 35 22  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  4 42  1  0
  4 43  1  0
  8 44  1  0
 10 45  1  0
 10 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 22 59  1  0
 23 60  1  0
 23 61  1  0
 27 62  1  0
 27 63  1  0
 27 64  1  0
 28 65  1  0
 29 66  1  0
 29 67  1  0
 30 68  1  0
 30 69  1  0
 32 70  1  0
 32 71  1  0
 32 72  1  0
 34 73  1  0
 35 74  1  0
 36 75  1  0
 37 76  1  0
 37 77  1  0
M  END


  Mrv0541 05061305002D          

 37 42  0  0  0  0            999 V2000
    7.4438    0.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3266    2.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1625   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3785   -1.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3595   -1.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4422   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2643   -1.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9848    0.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7079   -0.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3923   -0.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1644    0.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2857   -0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6388    0.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801    1.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614   -0.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2280    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4238   -1.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5872   -0.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2878    0.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3117    0.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2751    1.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7350   -0.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2225   -0.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3407   -1.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3835   -0.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5534   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0766    0.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3209   -1.9261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3234   -0.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7165    1.7224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1280   -1.3129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1120    0.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8093   -1.6210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9007   -0.0152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4162    1.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0286    0.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  6  1  0  0  0  0
  9  8  1  0  0  0  0
 13  1  1  0  0  0  0
 13 10  1  0  0  0  0
 14  2  1  0  0  0  0
 14 13  2  0  0  0  0
 15  6  1  0  0  0  0
 16 11  1  0  0  0  0
 16 15  1  0  0  0  0
 17 12  1  0  0  0  0
 18 12  1  0  0  0  0
 19 10  1  0  0  0  0
 20 11  1  0  0  0  0
 21 17  1  0  0  0  0
 22 14  1  0  0  0  0
 23  3  1  0  0  0  0
 23  7  1  0  0  0  0
 24  4  1  0  0  0  0
 24 15  1  0  0  0  0
 24 18  1  0  0  0  0
 25  5  1  0  0  0  0
 25 19  1  0  0  0  0
 26  8  1  0  0  0  0
 26 16  1  0  0  0  0
 26 23  1  0  0  0  0
 27  9  1  0  0  0  0
 27 23  1  0  0  0  0
 27 25  1  0  0  0  0
 28 20  1  0  0  0  0
 28 21  1  0  0  0  0
 28 24  1  0  0  0  0
 29 18  2  0  0  0  0
 30 21  1  0  0  0  0
 31 22  2  0  0  0  0
 32 25  1  0  0  0  0
 33 26  1  0  0  0  0
 34 27  1  0  0  0  0
 35 28  1  0  0  0  0
 36 17  1  0  0  0  0
 36 20  1  0  0  0  0
 37 19  1  0  0  0  0
 37 22  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0030116

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC5CC(=O)C(C)(C3CCC12C)C4(O)C5O

> <INCHI_IDENTIFIER>
InChI=1S/C28H40O9/c1-13-10-19(37-22(31)14(13)2)25(5,32)27(34)9-8-26(33)16-11-20-28(35)21(30)17(36-20)12-18(29)24(28,4)15(16)6-7-23(26,27)3/h15-17,19-21,30,32-35H,6-12H2,1-5H3

> <INCHI_KEY>
DMAZCUJZFYKTRY-UHFFFAOYSA-N

> <FORMULA>
C28H40O9

> <MOLECULAR_WEIGHT>
520.6118

> <EXACT_MASS>
520.267232878

> <JCHEM_ACCEPTOR_COUNT>
8

> <JCHEM_AVERAGE_POLARIZABILITY>
54.940512598019815

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
5

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
7-[1-(4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-1-hydroxyethyl]-4,7,16,17-tetrahydroxy-8,12-dimethyl-18-oxapentacyclo[13.2.1.0³,¹¹.0⁴,⁸.0¹²,¹⁷]octadecan-13-one

> <ALOGPS_LOGP>
0.62

> <JCHEM_LOGP>
0.7018875293333329

> <ALOGPS_LOGS>
-2.59

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
6

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.799927704223862

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.122805555692773

> <JCHEM_PKA_STRONGEST_BASIC>
-3.201006701285194

> <JCHEM_POLAR_SURFACE_AREA>
153.74999999999997

> <JCHEM_REFRACTIVITY>
129.88749999999993

> <JCHEM_ROTATABLE_BOND_COUNT>
2

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.35e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
7-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-4,7,16,17-tetrahydroxy-8,12-dimethyl-18-oxapentacyclo[13.2.1.0³,¹¹.0⁴,⁸.0¹²,¹⁷]octadecan-13-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0030116
     RDKit          3D
Withaperuvin D
 77 82  0  0  0  0  0  0  0  0999 V2000
    5.1626   -2.2321   -2.0143 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1228   -1.1889   -0.9584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404   -0.9580   -0.3066 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5072   -1.6836   -0.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1993    0.0551    0.7378 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2557    0.3216    1.4025 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088    0.6831    0.9594 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9035    0.7344    0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7133    1.0260    0.9882 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6326    0.1494    2.1832 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332    2.2763    1.5870 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4723    1.4532    0.3515 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7807    2.4396   -0.5862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6663    2.2552    1.4280 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3807    2.8083    0.5252 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7496    1.5606   -0.3000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7457    2.0727   -1.6270 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1119    1.1051   -0.0057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0533    1.3252   -1.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0016    0.2330   -1.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0818    0.1131   -1.9940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6668   -1.0458   -1.4155 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7053   -2.1556   -1.1427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9128   -2.0362    0.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4314   -3.0445    0.5739 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6216   -0.7626    0.8381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0649   -0.9010    2.2807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2521   -0.2339    0.6512 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2395   -1.1648    0.0810 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1218   -0.6481    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4124    0.6080   -0.1618 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7313    0.1510   -1.5816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5996    0.1755    0.1797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8023    1.3653    0.7572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9807   -0.4672   -0.0226 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2120   -1.4657    0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8365   -0.4801   -0.7261 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9772   -2.9662   -1.8443 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4334   -1.7037   -2.9739 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770   -2.7153   -2.1612 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3380   -1.0853   -0.2093 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5222   -2.6598   -0.0858 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6633   -1.7748   -1.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0308    1.6431   -0.5455 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9598    0.5943    2.9166 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4496   -0.9165    1.9764 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6558    0.1561    2.6700 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9660    2.1557    2.0683 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2963    3.1875   -0.2099 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3645    3.0083    1.7919 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2858    1.5638    2.1880 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0434    3.6158   -0.0569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2520    3.1434    1.1318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0345    3.0016   -1.6550 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5408    1.8372    0.7523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4083    1.2653   -2.1375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4957    2.3179   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3855   -0.6745   -1.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5638   -1.3577   -1.9403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3747   -3.0600   -0.9749 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1340   -2.4548   -2.0458 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6912   -0.0306    2.5891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5355   -1.8652    2.4874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1467   -0.8359    2.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8910   -0.0563    1.7224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1236   -1.1899   -0.9983 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2885   -2.1977    0.5284 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0220   -0.5392    1.6646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8184   -1.4440    0.2588 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1197   -0.8602   -1.6504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2148    0.1734   -2.1986 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4260    0.8497   -2.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.7237    0.7233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7659    0.2900   -0.0738 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9494   -1.1610    1.4853 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5512   -0.1731   -1.7825 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1157   -1.2485   -0.4052 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  3  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 26 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  8 37  1  0
 37  2  1  0
 31 12  1  0
 31 16  1  0
 28 18  1  0
 33 20  1  0
 35 22  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  4 42  1  0
  4 43  1  0
  8 44  1  0
 10 45  1  0
 10 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 22 59  1  0
 23 60  1  0
 23 61  1  0
 27 62  1  0
 27 63  1  0
 27 64  1  0
 28 65  1  0
 29 66  1  0
 29 67  1  0
 30 68  1  0
 30 69  1  0
 32 70  1  0
 32 71  1  0
 32 72  1  0
 34 73  1  0
 35 74  1  0
 36 75  1  0
 37 76  1  0
 37 77  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      13.895   1.621   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      11.810   3.888   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       7.770  -3.041   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       2.573  -2.928   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      10.004  -3.460   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       4.559  -2.860   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       6.093  -2.989   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       7.438   0.724   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       8.788  -0.018   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      11.932  -0.185   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       4.040   1.227   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -0.533  -1.036   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      12.392   1.285   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      11.350   2.418   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       3.903  -1.467   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.781  -0.202   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -0.426   0.697   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.791  -2.067   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      10.429  -0.521   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.404   1.436   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       0.582   0.326   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       9.847   2.082   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.972  -1.724   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       2.282  -1.416   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       9.969  -1.991   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       6.316  -0.330   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       8.500  -1.530   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       2.010   0.042   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0       0.599  -3.595   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       0.604  -1.156   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       8.804   3.215   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      11.439  -2.451   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       5.809   1.124   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       8.977  -3.026   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       3.548  -0.028   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       0.777   1.982   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       9.387   0.612   0.000  0.00  0.00           O+0
CONECT    1   13                                                            
CONECT    2   14                                                            
CONECT    3   23                                                            
CONECT    4   24                                                            
CONECT    5   25                                                            
CONECT    6    7   15                                                       
CONECT    7    6   23                                                       
CONECT    8    9   26                                                       
CONECT    9    8   27                                                       
CONECT   10   13   19                                                       
CONECT   11   16   20                                                       
CONECT   12   17   18                                                       
CONECT   13    1   10   14                                                  
CONECT   14    2   13   22                                                  
CONECT   15    6   16   24                                                  
CONECT   16   11   15   26                                                  
CONECT   17   12   21   36                                                  
CONECT   18   12   24   29                                                  
CONECT   19   10   25   37                                                  
CONECT   20   11   28   36                                                  
CONECT   21   17   28   30                                                  
CONECT   22   14   31   37                                                  
CONECT   23    3    7   26   27                                             
CONECT   24    4   15   18   28                                             
CONECT   25    5   19   27   32                                             
CONECT   26    8   16   23   33                                             
CONECT   27    9   23   25   34                                             
CONECT   28   20   21   24   35                                             
CONECT   29   18                                                            
CONECT   30   21                                                            
CONECT   31   22                                                            
CONECT   32   25                                                            
CONECT   33   26                                                            
CONECT   34   27                                                            
CONECT   35   28                                                            
CONECT   36   17   20                                                       
CONECT   37   19   22                                                       
MASTER        0    0    0    0    0    0    0    0   37    0   84    0
END

COMPND    HMDB0030116
HETATM    1  C1  UNL     1       5.163  -2.232  -2.014  1.00  0.00           C  
HETATM    2  C2  UNL     1       5.123  -1.189  -0.958  1.00  0.00           C  
HETATM    3  C3  UNL     1       6.240  -0.958  -0.307  1.00  0.00           C  
HETATM    4  C4  UNL     1       7.507  -1.684  -0.583  1.00  0.00           C  
HETATM    5  C5  UNL     1       6.199   0.055   0.738  1.00  0.00           C  
HETATM    6  O1  UNL     1       7.256   0.322   1.403  1.00  0.00           O  
HETATM    7  O2  UNL     1       5.009   0.683   0.959  1.00  0.00           O  
HETATM    8  C6  UNL     1       3.903   0.734   0.083  1.00  0.00           C  
HETATM    9  C7  UNL     1       2.713   1.026   0.988  1.00  0.00           C  
HETATM   10  C8  UNL     1       2.633   0.149   2.183  1.00  0.00           C  
HETATM   11  O3  UNL     1       3.133   2.276   1.587  1.00  0.00           O  
HETATM   12  C9  UNL     1       1.472   1.453   0.351  1.00  0.00           C  
HETATM   13  O4  UNL     1       1.781   2.440  -0.586  1.00  0.00           O  
HETATM   14  C10 UNL     1       0.666   2.255   1.428  1.00  0.00           C  
HETATM   15  C11 UNL     1      -0.381   2.808   0.525  1.00  0.00           C  
HETATM   16  C12 UNL     1      -0.750   1.561  -0.300  1.00  0.00           C  
HETATM   17  O5  UNL     1      -0.746   2.073  -1.627  1.00  0.00           O  
HETATM   18  C13 UNL     1      -2.112   1.105  -0.006  1.00  0.00           C  
HETATM   19  C14 UNL     1      -3.053   1.325  -1.210  1.00  0.00           C  
HETATM   20  C15 UNL     1      -4.002   0.233  -1.229  1.00  0.00           C  
HETATM   21  O6  UNL     1      -5.082   0.113  -1.994  1.00  0.00           O  
HETATM   22  C16 UNL     1      -5.667  -1.046  -1.415  1.00  0.00           C  
HETATM   23  C17 UNL     1      -4.705  -2.156  -1.143  1.00  0.00           C  
HETATM   24  C18 UNL     1      -3.913  -2.036   0.087  1.00  0.00           C  
HETATM   25  O7  UNL     1      -3.431  -3.044   0.574  1.00  0.00           O  
HETATM   26  C19 UNL     1      -3.622  -0.763   0.838  1.00  0.00           C  
HETATM   27  C20 UNL     1      -4.065  -0.901   2.281  1.00  0.00           C  
HETATM   28  C21 UNL     1      -2.252  -0.234   0.651  1.00  0.00           C  
HETATM   29  C22 UNL     1      -1.240  -1.165   0.081  1.00  0.00           C  
HETATM   30  C23 UNL     1       0.122  -0.648   0.593  1.00  0.00           C  
HETATM   31  C24 UNL     1       0.412   0.608  -0.162  1.00  0.00           C  
HETATM   32  C25 UNL     1       0.731   0.151  -1.582  1.00  0.00           C  
HETATM   33  C26 UNL     1      -4.600   0.176   0.180  1.00  0.00           C  
HETATM   34  O8  UNL     1      -4.802   1.365   0.757  1.00  0.00           O  
HETATM   35  C27 UNL     1      -5.981  -0.467  -0.023  1.00  0.00           C  
HETATM   36  O9  UNL     1      -6.212  -1.466   0.894  1.00  0.00           O  
HETATM   37  C28 UNL     1       3.836  -0.480  -0.726  1.00  0.00           C  
HETATM   38  H1  UNL     1       5.977  -2.966  -1.844  1.00  0.00           H  
HETATM   39  H2  UNL     1       5.433  -1.704  -2.974  1.00  0.00           H  
HETATM   40  H3  UNL     1       4.177  -2.715  -2.161  1.00  0.00           H  
HETATM   41  H4  UNL     1       8.338  -1.085  -0.209  1.00  0.00           H  
HETATM   42  H5  UNL     1       7.522  -2.660  -0.086  1.00  0.00           H  
HETATM   43  H6  UNL     1       7.663  -1.775  -1.696  1.00  0.00           H  
HETATM   44  H7  UNL     1       4.031   1.643  -0.545  1.00  0.00           H  
HETATM   45  H8  UNL     1       1.960   0.594   2.917  1.00  0.00           H  
HETATM   46  H9  UNL     1       2.450  -0.917   1.976  1.00  0.00           H  
HETATM   47  H10 UNL     1       3.656   0.156   2.670  1.00  0.00           H  
HETATM   48  H11 UNL     1       3.966   2.156   2.068  1.00  0.00           H  
HETATM   49  H12 UNL     1       2.296   3.188  -0.210  1.00  0.00           H  
HETATM   50  H13 UNL     1       1.364   3.008   1.792  1.00  0.00           H  
HETATM   51  H14 UNL     1       0.286   1.564   2.188  1.00  0.00           H  
HETATM   52  H15 UNL     1       0.043   3.616  -0.057  1.00  0.00           H  
HETATM   53  H16 UNL     1      -1.252   3.143   1.132  1.00  0.00           H  
HETATM   54  H17 UNL     1      -1.034   3.002  -1.655  1.00  0.00           H  
HETATM   55  H18 UNL     1      -2.541   1.837   0.752  1.00  0.00           H  
HETATM   56  H19 UNL     1      -2.408   1.265  -2.137  1.00  0.00           H  
HETATM   57  H20 UNL     1      -3.496   2.318  -1.223  1.00  0.00           H  
HETATM   58  H21 UNL     1      -3.386  -0.674  -1.487  1.00  0.00           H  
HETATM   59  H22 UNL     1      -6.564  -1.358  -1.940  1.00  0.00           H  
HETATM   60  H23 UNL     1      -5.375  -3.060  -0.975  1.00  0.00           H  
HETATM   61  H24 UNL     1      -4.134  -2.455  -2.046  1.00  0.00           H  
HETATM   62  H25 UNL     1      -4.691  -0.031   2.589  1.00  0.00           H  
HETATM   63  H26 UNL     1      -4.536  -1.865   2.487  1.00  0.00           H  
HETATM   64  H27 UNL     1      -3.147  -0.836   2.916  1.00  0.00           H  
HETATM   65  H28 UNL     1      -1.891  -0.056   1.722  1.00  0.00           H  
HETATM   66  H29 UNL     1      -1.124  -1.190  -0.998  1.00  0.00           H  
HETATM   67  H30 UNL     1      -1.288  -2.198   0.528  1.00  0.00           H  
HETATM   68  H31 UNL     1       0.022  -0.539   1.665  1.00  0.00           H  
HETATM   69  H32 UNL     1       0.818  -1.444   0.259  1.00  0.00           H  
HETATM   70  H33 UNL     1       1.120  -0.860  -1.650  1.00  0.00           H  
HETATM   71  H34 UNL     1      -0.215   0.173  -2.199  1.00  0.00           H  
HETATM   72  H35 UNL     1       1.426   0.850  -2.079  1.00  0.00           H  
HETATM   73  H36 UNL     1      -5.707   1.724   0.723  1.00  0.00           H  
HETATM   74  H37 UNL     1      -6.766   0.290  -0.074  1.00  0.00           H  
HETATM   75  H38 UNL     1      -6.949  -1.161   1.485  1.00  0.00           H  
HETATM   76  H39 UNL     1       3.551  -0.173  -1.782  1.00  0.00           H  
HETATM   77  H40 UNL     1       3.116  -1.248  -0.405  1.00  0.00           H  
CONECT    1    2   38   39   40
CONECT    2    3    3   37
CONECT    3    4    5
CONECT    4   41   42   43
CONECT    5    6    6    7
CONECT    7    8
CONECT    8    9   37   44
CONECT    9   10   11   12
CONECT   10   45   46   47
CONECT   11   48
CONECT   12   13   14   31
CONECT   13   49
CONECT   14   15   50   51
CONECT   15   16   52   53
CONECT   16   17   18   31
CONECT   17   54
CONECT   18   19   28   55
CONECT   19   20   56   57
CONECT   20   21   33   58
CONECT   21   22
CONECT   22   23   35   59
CONECT   23   24   60   61
CONECT   24   25   25   26
CONECT   26   27   28   33
CONECT   27   62   63   64
CONECT   28   29   65
CONECT   29   30   66   67
CONECT   30   31   68   69
CONECT   31   32
CONECT   32   70   71   72
CONECT   33   34   35
CONECT   34   73
CONECT   35   36   74
CONECT   36   75
CONECT   37   76   77
END

HMDB0030116
     RDKit          3D
Withaperuvin D
 77 82  0  0  0  0  0  0  0  0999 V2000
    5.1626   -2.2321   -2.0143 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1228   -1.1889   -0.9584 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404   -0.9580   -0.3066 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5072   -1.6836   -0.5830 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1993    0.0551    0.7378 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2557    0.3216    1.4025 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088    0.6831    0.9594 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9035    0.7344    0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7133    1.0260    0.9882 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6326    0.1494    2.1832 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332    2.2763    1.5870 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4723    1.4532    0.3515 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7807    2.4396   -0.5862 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6663    2.2552    1.4280 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3807    2.8083    0.5252 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7496    1.5606   -0.3000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7457    2.0727   -1.6270 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1119    1.1051   -0.0057 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0533    1.3252   -1.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0016    0.2330   -1.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0818    0.1131   -1.9940 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6668   -1.0458   -1.4155 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7053   -2.1556   -1.1427 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9128   -2.0362    0.0874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4314   -3.0445    0.5739 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6216   -0.7626    0.8381 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0649   -0.9010    2.2807 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2521   -0.2339    0.6512 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2395   -1.1648    0.0810 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1218   -0.6481    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4124    0.6080   -0.1618 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7313    0.1510   -1.5816 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5996    0.1755    0.1797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8023    1.3653    0.7572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9807   -0.4672   -0.0226 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2120   -1.4657    0.8938 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8365   -0.4801   -0.7261 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9772   -2.9662   -1.8443 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4334   -1.7037   -2.9739 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770   -2.7153   -2.1612 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3380   -1.0853   -0.2093 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5222   -2.6598   -0.0858 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6633   -1.7748   -1.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0308    1.6431   -0.5455 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9598    0.5943    2.9166 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4496   -0.9165    1.9764 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6558    0.1561    2.6700 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9660    2.1557    2.0683 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2963    3.1875   -0.2099 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3645    3.0083    1.7919 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2858    1.5638    2.1880 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0434    3.6158   -0.0569 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2520    3.1434    1.1318 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0345    3.0016   -1.6550 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5408    1.8372    0.7523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4083    1.2653   -2.1375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4957    2.3179   -1.2226 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3855   -0.6745   -1.4871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5638   -1.3577   -1.9403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3747   -3.0600   -0.9749 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1340   -2.4548   -2.0458 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6912   -0.0306    2.5891 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5355   -1.8652    2.4874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1467   -0.8359    2.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8910   -0.0563    1.7224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1236   -1.1899   -0.9983 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2885   -2.1977    0.5284 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0220   -0.5392    1.6646 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8184   -1.4440    0.2588 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1197   -0.8602   -1.6504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2148    0.1734   -2.1986 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4260    0.8497   -2.0793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.7237    0.7233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7659    0.2900   -0.0738 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9494   -1.1610    1.4853 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5512   -0.1731   -1.7825 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1157   -1.2485   -0.4052 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  3  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 26 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  8 37  1  0
 37  2  1  0
 31 12  1  0
 31 16  1  0
 28 18  1  0
 33 20  1  0
 35 22  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  4 42  1  0
  4 43  1  0
  8 44  1  0
 10 45  1  0
 10 46  1  0
 10 47  1  0
 11 48  1  0
 13 49  1  0
 14 50  1  0
 14 51  1  0
 15 52  1  0
 15 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 19 57  1  0
 20 58  1  0
 22 59  1  0
 23 60  1  0
 23 61  1  0
 27 62  1  0
 27 63  1  0
 27 64  1  0
 28 65  1  0
 29 66  1  0
 29 67  1  0
 30 68  1  0
 30 69  1  0
 32 70  1  0
 32 71  1  0
 32 72  1  0
 34 73  1  0
 35 74  1  0
 36 75  1  0
 37 76  1  0
 37 77  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
4b,5a,14a,17b,20S-Pentahydroxy-3a,6a-oxido-1-oxo-24-ergosten-26,22R-olide	HMDB

Chemical Formula

C₂₈H₄₀O₉

Average Molecular Weight

520.6118

Monoisotopic Molecular Weight

520.267232878

IUPAC Name

7-[1-(4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-1-hydroxyethyl]-4,7,16,17-tetrahydroxy-8,12-dimethyl-18-oxapentacyclo[13.2.1.0³,¹¹.0⁴,⁸.0¹²,¹⁷]octadecan-13-one

Traditional Name

7-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-4,7,16,17-tetrahydroxy-8,12-dimethyl-18-oxapentacyclo[13.2.1.0³,¹¹.0⁴,⁸.0¹²,¹⁷]octadecan-13-one

CAS Registry Number

87749-17-5

SMILES

CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC5CC(=O)C(C)(C3CCC12C)C4(O)C5O

InChI Identifier

InChI=1S/C28H40O9/c1-13-10-19(37-22(31)14(13)2)25(5,32)27(34)9-8-26(33)16-11-20-28(35)21(30)17(36-20)12-18(29)24(28,4)15(16)6-7-23(26,27)3/h15-17,19-21,30,32-35H,6-12H2,1-5H3

InChI Key

DMAZCUJZFYKTRY-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as withanolides and derivatives. These are c28 steroids structurally characterized by an ergostane skeleton usually functionalized at carbons 1, 22 and 26 to form a lactone ring.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Steroids and steroid derivatives

Sub Class

Steroid lactones

Direct Parent

Withanolides and derivatives

Alternative Parents

Substituents

Withanolide-skeleton
5-hydroxysteroid
Hydroxysteroid
Naphthofuran
Dihydropyranone
Oxepane
Pyran
Monosaccharide
Enoate ester
Alpha,beta-unsaturated carboxylic ester
Tetrahydrofuran
Tertiary alcohol
Cyclic alcohol
Secondary alcohol
Carboxylic acid ester
Ketone
Lactone
Organoheterocyclic compound
Oxacycle
Carboxylic acid derivative
Polyol
Dialkyl ether
Ether
Monocarboxylic acid or derivatives
Alcohol
Organic oxygen compound
Organic oxide
Organooxygen compound
Hydrocarbon derivative
Carbonyl group
Aliphatic heteropolycyclic compound

Molecular Framework

Aliphatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cytoplasm (HMDB: HMDB0030116)
Cell membrane (HMDB: HMDB0030116)

Biofluid or Excreta

Urine (HMDB: HMDB0030116)

Tissue substructure

Hepatic tissue (HMDB: HMDB0030116)

Cellular substructure

Extracellular (HMDB: HMDB0030116)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0030116)

Source

Endogenous

Endogenous (HMDB: HMDB0030116)

Plant

Plant (HMDB: HMDB0030116)

Animal

Animal (HMDB: HMDB0030116)

Exogenous

Food

Food (HMDB: HMDB0030116)

Fruit

Fruits (FooDB: FOOD00871)

Process

Naturally occurring process

Biological process

Chemical reaction

Lipid peroxidation (HMDB: HMDB0030116)

Biochemical process

Fatty acid metabolism (HMDB: HMDB0030116)

Cellular process

Cell signaling (HMDB: HMDB0030116)

Biochemical pathway

Lipid metabolism pathway (HMDB: HMDB0030116)

Role

Biological role

Membrane stabilizer (HMDB: HMDB0030116)

Molecular messenger

Signaling molecule (HMDB: HMDB0030116)

Industrial application

Manufacturing industry

Material processing agent

Fluid processing agent

Surfactant

Surfactant (HMDB: HMDB0030116)

Emulsifier (HMDB: HMDB0030116)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	209 - 211 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.35 g/L	ALOGPS
logP	0.62	ALOGPS
logP	0.7	ChemAxon
logS	-2.6	ALOGPS
pKa (Strongest Acidic)	12.12	ChemAxon
pKa (Strongest Basic)	-3.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	8	ChemAxon
Hydrogen Donor Count	5	ChemAxon
Polar Surface Area	153.75 Å²	ChemAxon
Rotatable Bond Count	2	ChemAxon
Refractivity	129.89 m³·mol⁻¹	ChemAxon
Polarizability	54.94 Å³	ChemAxon
Number of Rings	6	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	218.938	31661259
DarkChem	[M-H]-	207.85	31661259
DeepCCS	[M-2H]-	244.695	30932474
DeepCCS	[M+Na]+	220.119	30932474
AllCCS	[M+H]+	220.0	32859911
AllCCS	[M+H-H2O]+	218.5	32859911
AllCCS	[M+NH4]+	221.4	32859911
AllCCS	[M+Na]+	221.8	32859911
AllCCS	[M-H]-	223.1	32859911
AllCCS	[M+Na-2H]-	225.3	32859911
AllCCS	[M+HCOO]-	227.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Withaperuvin D	CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC5CC(=O)C(C)(C3CCC12C)C4(O)C5O	3911.7	Standard polar	33892256
Withaperuvin D	CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC5CC(=O)C(C)(C3CCC12C)C4(O)C5O	3783.7	Standard non polar	33892256
Withaperuvin D	CC1=C(C)C(=O)OC(C1)C(C)(O)C1(O)CCC2(O)C3CC4OC5CC(=O)C(C)(C3CCC12C)C4(O)C5O	4438.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Withaperuvin D,1TMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4263.3	Semi standard non polar	33892256
Withaperuvin D,1TMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4267.7	Semi standard non polar	33892256
Withaperuvin D,1TMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4279.2	Semi standard non polar	33892256
Withaperuvin D,1TMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4273.3	Semi standard non polar	33892256
Withaperuvin D,1TMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4284.1	Semi standard non polar	33892256
Withaperuvin D,1TMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4240.6	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4234.5	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #10	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4228.0	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #11	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4229.4	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #12	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4197.9	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #13	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4240.7	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #14	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4181.7	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #15	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4207.9	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4246.2	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4217.6	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4226.1	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4196.2	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4234.4	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #7	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4218.0	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #8	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4227.1	Semi standard non polar	33892256
Withaperuvin D,2TMS,isomer #9	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4195.9	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4175.8	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #10	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4124.0	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #11	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4132.6	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #12	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4139.3	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #13	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4120.8	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #14	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4142.2	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #15	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4083.5	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #16	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4112.7	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #17	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4141.6	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #18	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4084.2	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #19	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4106.1	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4142.7	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #20	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4100.8	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4163.4	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4134.2	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4146.8	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4149.6	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #7	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4130.9	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #8	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4148.4	Semi standard non polar	33892256
Withaperuvin D,3TMS,isomer #9	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4096.0	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4081.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #10	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4013.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #11	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4062.1	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #12	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	3988.8	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #13	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4002.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #14	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	3986.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #15	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	3974.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4085.9	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4074.5	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4085.8	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4028.6	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4048.8	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #7	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4073.2	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #8	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	4017.6	Semi standard non polar	33892256
Withaperuvin D,4TMS,isomer #9	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	4026.4	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	4043.4	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O)C1	3960.7	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C)C1	3965.0	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O[Si](C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	3960.7	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C)C2(O)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	3933.9	Semi standard non polar	33892256
Withaperuvin D,5TMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C)CCC3(O[Si](C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C)C6O[Si](C)(C)C)C1	3907.7	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4490.1	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4492.5	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4504.7	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4503.9	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4521.4	Semi standard non polar	33892256
Withaperuvin D,1TBDMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4474.8	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4700.2	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #10	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4689.4	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #11	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4699.3	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #12	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4662.1	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #13	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O[Si](C)(C)C(C)(C)C)C1	4706.2	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #14	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4652.9	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #15	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4681.4	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4705.1	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4686.7	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4701.0	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4667.2	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4684.8	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #7	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4684.1	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #8	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4700.6	Semi standard non polar	33892256
Withaperuvin D,2TBDMS,isomer #9	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4665.6	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #1	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1	4850.1	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #10	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4804.8	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #11	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4816.5	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #12	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4821.2	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #13	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4793.7	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #14	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O[Si](C)(C)C(C)(C)C)C1	4835.4	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #15	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4756.3	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #16	CC1=C(C)C(=O)OC(C(C)(O)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4781.3	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #17	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O[Si](C)(C)C(C)(C)C)C1	4827.5	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #18	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4750.1	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #19	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4765.5	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #2	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4834.1	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #20	CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O[Si](C)(C)C(C)(C)C)C1	4772.5	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #3	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4858.9	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #4	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4816.3	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #5	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4835.7	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #6	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O[Si](C)(C)C(C)(C)C)C1	4840.6	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #7	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O[Si](C)(C)C(C)(C)C)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O)C6O)C1	4809.5	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #8	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O[Si](C)(C)C(C)(C)C)C1	4850.2	Semi standard non polar	33892256
Withaperuvin D,3TBDMS,isomer #9	CC1=C(C)C(=O)OC(C(C)(O[Si](C)(C)C(C)(C)C)C2(O)CCC3(O)C4CC5OC6C=C(O[Si](C)(C)C(C)(C)C)C(C)(C4CCC32C)C5(O[Si](C)(C)C(C)(C)C)C6O)C1	4776.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Withaperuvin D GC-MS (Non-derivatized) - 70eV, Positive	splash10-0zfv-4279130000-aa7bfd361599ba23dc1b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Withaperuvin D GC-MS (2 TMS) - 70eV, Positive	splash10-0f7d-6140629000-55bb8423303c12a0ac15	2017-10-06	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 10V, Positive-QTOF	splash10-0uk9-0003390000-31b34b905d9d29c831c9	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 20V, Positive-QTOF	splash10-0udi-9224540000-7b9d408036a102b7d3a7	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 40V, Positive-QTOF	splash10-0uy0-6069100000-7c4b896e06f4c92be4a4	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 10V, Negative-QTOF	splash10-016r-0103590000-f80f26b2f869dda95007	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 20V, Negative-QTOF	splash10-0gb9-1906120000-f6877ea6c94139ee6da9	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 40V, Negative-QTOF	splash10-014i-9404000000-f2cee4f61b39c3ba53d1	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 10V, Positive-QTOF	splash10-00di-0000290000-da0a7f19c69082fea3d4	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 20V, Positive-QTOF	splash10-00c0-7009450000-f42d9d4b0119736e95fa	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 40V, Positive-QTOF	splash10-00b9-5439000000-f033b3872b97504a992c	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 10V, Negative-QTOF	splash10-014i-0002190000-06511588915f6f24691c	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 20V, Negative-QTOF	splash10-016r-2109040000-a2b7bf519fbdcf2dcdc9	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Withaperuvin D 40V, Negative-QTOF	splash10-0gdl-9402000000-f2cf24fe86542434e36e	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB001917

KNApSAcK ID

Not Available

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131750960

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.

Showing metabocard for Withaperuvin D (HMDB0030116)

MOL for HMDB0030116 (Withaperuvin D)

3D MOL for HMDB0030116 (Withaperuvin D)

3D SDF for HMDB0030116 (Withaperuvin D)

3D-SDF for HMDB0030116 (Withaperuvin D)

PDB for HMDB0030116 (Withaperuvin D)

3D PDB for HMDB0030116 (Withaperuvin D)

SMILES for HMDB0030116 (Withaperuvin D)

INCHI for HMDB0030116 (Withaperuvin D)

Structure for HMDB0030116 (Withaperuvin D)

3D Structure for HMDB0030116 (Withaperuvin D)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra