You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.

Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (2) Show 2 proteins XML

enzymes (2) Show 2 proteins

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:38:33 UTC

Update Date

2021-10-13 06:10:14 UTC

HMDB ID

HMDB0030708

Secondary Accession Numbers

HMDB30708

Metabolite Identification

Common Name

Vicenin 2

Description

Vicenin 2, also known as vicenin II, belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone. Vicenin 2 is found, on average, in the highest concentration within sweet oranges (Citrus sinensis). Vicenin 2 has also been detected, but not quantified in, several different foods, such as barleys (Hordeum vulgare), sweet basils (Ocimum basilicum), bulgur, quinoas (Chenopodium quinoa), and red rice (Oryza rufipogon). This could make vicenin 2 a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Vicenin 2.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061305272D          

 42 46  0  0  0  0            999 V2000
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  8  1  2  0  0  0  0
  8  2  1  0  0  0  0
  9  3  2  0  0  0  0
  9  4  1  0  0  0  0
 10  5  1  0  0  0  0
 11  5  2  0  0  0  0
 11  8  1  0  0  0  0
 12  6  1  0  0  0  0
 13  7  1  0  0  0  0
 14 10  1  0  0  0  0
 17 12  1  0  0  0  0
 18 13  1  0  0  0  0
 19 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22 18  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 14  1  0  0  0  0
 25 16  2  0  0  0  0
 26 15  1  0  0  0  0
 26 23  1  0  0  0  0
 27 16  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30  9  1  0  0  0  0
 31 10  2  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  1  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 24  1  0  0  0  0
 40 11  1  0  0  0  0
 40 25  1  0  0  0  0
 41 12  1  0  0  0  0
 41 26  1  0  0  0  0
 42 13  1  0  0  0  0
 42 27  1  0  0  0  0
M  END

HMDB0030708
     RDKit          3D
Vicenin 2
 72 76  0  0  0  0  0  0  0  0999 V2000
   -0.8931    3.9112   -0.3774 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0501    2.9921   -0.2568 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2940    3.2791   -0.5081 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2064    2.2667   -0.3671 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6061    2.6435   -0.6435 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0650    3.0962   -1.8608 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3699    3.5454   -1.9964 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2395    3.5546   -0.9239 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5785    4.0079   -1.0356 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7721    3.0992    0.2946 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4902    2.6474    0.4471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502    1.0764   -0.0134 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5817    0.7481    0.2382 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2748   -0.5721    0.5981 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4164   -1.4681    0.7143 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4613   -1.0488   -0.1012 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9482   -1.8261   -1.0815 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4800   -1.5626   -1.0660 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1611   -2.3002   -1.9884 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -3.3094   -0.9294 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0075   -3.9906   -1.3482 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6184   -3.5901    0.5207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5761   -4.9244    0.8014 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2472   -2.9175    0.8697 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0787   -3.3209    2.2152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0165   -0.8644    0.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5360   -2.0694    1.1738 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0349    0.1456    0.6974 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4774   -0.2973    0.8389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0149    0.0331   -0.4375 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2460   -0.4985   -0.6304 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9650    0.2474   -1.7931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2072   -0.3234   -1.9207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1621   -0.5012    0.5669 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1969   -1.7557    1.1955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7240    0.5532    1.5722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2104    1.8065    1.3090 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2657    0.4756    1.8331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7228    1.6247    2.3213 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7238    1.4007    0.3517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5834    2.4717    0.1718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3620    1.7157    0.1136 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6081    4.2746   -0.8026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3538    3.0801   -2.7063 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7075    3.8842   -2.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8614    4.9559   -0.8809 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4334    3.0938    1.1622 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1220    2.2962    1.4074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8738   -1.1485    1.7689 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6759   -1.5880   -2.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.4742   -1.1539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7840   -1.8908   -0.0442 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2123   -1.8587   -2.8585 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0158   -3.7367   -1.5526 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7747   -4.9565   -1.3107 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994   -3.0833    1.0749 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3761   -5.1030    1.7504 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5661   -3.4127    0.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6043   -4.1902    2.2545 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2545   -2.9341    1.4126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5204   -1.3489    1.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1425   -1.5441   -1.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3598    0.0524   -2.7190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0676    1.3217   -1.5713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1656   -1.0178   -2.6498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1862   -0.2449    0.2455 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9411   -1.8396    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2551    0.2343    2.5327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7810    2.2785    0.5788 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1656   -0.2229    2.8152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3801    2.3452    2.4827 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5333    2.5768    0.1489 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 14 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 28 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 24 15  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END


  Mrv0541 05061305272D          

 42 46  0  0  0  0            999 V2000
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  8  1  2  0  0  0  0
  8  2  1  0  0  0  0
  9  3  2  0  0  0  0
  9  4  1  0  0  0  0
 10  5  1  0  0  0  0
 11  5  2  0  0  0  0
 11  8  1  0  0  0  0
 12  6  1  0  0  0  0
 13  7  1  0  0  0  0
 14 10  1  0  0  0  0
 17 12  1  0  0  0  0
 18 13  1  0  0  0  0
 19 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22 18  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 14  1  0  0  0  0
 25 16  2  0  0  0  0
 26 15  1  0  0  0  0
 26 23  1  0  0  0  0
 27 16  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30  9  1  0  0  0  0
 31 10  2  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  1  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 24  1  0  0  0  0
 40 11  1  0  0  0  0
 40 25  1  0  0  0  0
 41 12  1  0  0  0  0
 41 26  1  0  0  0  0
 42 13  1  0  0  0  0
 42 27  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0030708

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(O)C(O)C1O)C1=C(O)C(C2OC(CO)C(O)C(O)C2O)=C2OC(=CC(=O)C2=C1O)C1=CC=C(O)C=C1

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2

> <INCHI_KEY>
FIAAVMJLAGNUKW-UHFFFAOYSA-N

> <FORMULA>
C27H30O15

> <MOLECULAR_WEIGHT>
594.5181

> <EXACT_MASS>
594.15847029

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
57.5816809914175

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.97

> <JCHEM_LOGP>
-2.8079526763333336

> <ALOGPS_LOGS>
-1.78

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.477498109060173

> <JCHEM_PKA_STRONGEST_ACIDIC>
5.763431124601631

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6447308976215727

> <JCHEM_POLAR_SURFACE_AREA>
267.28999999999996

> <JCHEM_REFRACTIVITY>
139.15049999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
5

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
9.88e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0030708
     RDKit          3D
Vicenin 2
 72 76  0  0  0  0  0  0  0  0999 V2000
   -0.8931    3.9112   -0.3774 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0501    2.9921   -0.2568 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2940    3.2791   -0.5081 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2064    2.2667   -0.3671 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6061    2.6435   -0.6435 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0650    3.0962   -1.8608 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3699    3.5454   -1.9964 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2395    3.5546   -0.9239 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5785    4.0079   -1.0356 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7721    3.0992    0.2946 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4902    2.6474    0.4471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502    1.0764   -0.0134 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5817    0.7481    0.2382 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2748   -0.5721    0.5981 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4164   -1.4681    0.7143 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4613   -1.0488   -0.1012 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9482   -1.8261   -1.0815 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4800   -1.5626   -1.0660 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1611   -2.3002   -1.9884 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -3.3094   -0.9294 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0075   -3.9906   -1.3482 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6184   -3.5901    0.5207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5761   -4.9244    0.8014 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2472   -2.9175    0.8697 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0787   -3.3209    2.2152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0165   -0.8644    0.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5360   -2.0694    1.1738 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0349    0.1456    0.6974 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4774   -0.2973    0.8389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0149    0.0331   -0.4375 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2460   -0.4985   -0.6304 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9650    0.2474   -1.7931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2072   -0.3234   -1.9207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1621   -0.5012    0.5669 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1969   -1.7557    1.1955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7240    0.5532    1.5722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2104    1.8065    1.3090 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2657    0.4756    1.8331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7228    1.6247    2.3213 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7238    1.4007    0.3517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5834    2.4717    0.1718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3620    1.7157    0.1136 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6081    4.2746   -0.8026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3538    3.0801   -2.7063 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7075    3.8842   -2.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8614    4.9559   -0.8809 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4334    3.0938    1.1622 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1220    2.2962    1.4074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8738   -1.1485    1.7689 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6759   -1.5880   -2.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.4742   -1.1539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7840   -1.8908   -0.0442 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2123   -1.8587   -2.8585 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0158   -3.7367   -1.5526 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7747   -4.9565   -1.3107 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994   -3.0833    1.0749 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3761   -5.1030    1.7504 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5661   -3.4127    0.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6043   -4.1902    2.2545 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2545   -2.9341    1.4126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5204   -1.3489    1.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1425   -1.5441   -1.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3598    0.0524   -2.7190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0676    1.3217   -1.5713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1656   -1.0178   -2.6498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1862   -0.2449    0.2455 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9411   -1.8396    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2551    0.2343    2.5327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7810    2.2785    0.5788 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1656   -0.2229    2.8152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3801    2.3452    2.4827 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5333    2.5768    0.1489 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 14 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 28 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 24 15  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -4.001   3.850   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -5.335   1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.335   4.620   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -6.668   2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       4.001   6.930   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -6.668   3.850   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       1.334   6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       0.000   6.160   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0       6.668  -5.390   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       5.335   6.160   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -8.002   4.620   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       8.002  -3.080   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       4.001   2.310   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       8.002   0.000   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      -1.334   6.930   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      -1.334   3.850   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0      -1.334   2.310   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       4.001  -2.310   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       2.667   4.620   0.000  0.00  0.00           O+0
CONECT    1    3    8                                                       
CONECT    2    4    8                                                       
CONECT    3    1    9                                                       
CONECT    4    2    9                                                       
CONECT    5   10   11                                                       
CONECT    6   12   28                                                       
CONECT    7   13   29                                                       
CONECT    8    1    2   11                                                  
CONECT    9    3    4   30                                                  
CONECT   10    5   14   31                                                  
CONECT   11    5    8   40                                                  
CONECT   12    6   17   41                                                  
CONECT   13    7   18   42                                                  
CONECT   14   10   19   25                                                  
CONECT   15   19   20   26                                                  
CONECT   16   20   25   27                                                  
CONECT   17   12   21   32                                                  
CONECT   18   13   22   33                                                  
CONECT   19   14   15   34                                                  
CONECT   20   15   16   35                                                  
CONECT   21   17   23   36                                                  
CONECT   22   18   24   37                                                  
CONECT   23   21   26   38                                                  
CONECT   24   22   27   39                                                  
CONECT   25   14   16   40                                                  
CONECT   26   15   23   41                                                  
CONECT   27   16   24   42                                                  
CONECT   28    6                                                            
CONECT   29    7                                                            
CONECT   30    9                                                            
CONECT   31   10                                                            
CONECT   32   17                                                            
CONECT   33   18                                                            
CONECT   34   19                                                            
CONECT   35   20                                                            
CONECT   36   21                                                            
CONECT   37   22                                                            
CONECT   38   23                                                            
CONECT   39   24                                                            
CONECT   40   11   25                                                       
CONECT   41   12   26                                                       
CONECT   42   13   27                                                       
MASTER        0    0    0    0    0    0    0    0   42    0   92    0
END

COMPND    HMDB0030708
HETATM    1  O1  UNL     1      -0.893   3.911  -0.377  1.00  0.00           O  
HETATM    2  C1  UNL     1      -0.050   2.992  -0.257  1.00  0.00           C  
HETATM    3  C2  UNL     1       1.294   3.279  -0.508  1.00  0.00           C  
HETATM    4  C3  UNL     1       2.206   2.267  -0.367  1.00  0.00           C  
HETATM    5  C4  UNL     1       3.606   2.643  -0.643  1.00  0.00           C  
HETATM    6  C5  UNL     1       4.065   3.096  -1.861  1.00  0.00           C  
HETATM    7  C6  UNL     1       5.370   3.545  -1.996  1.00  0.00           C  
HETATM    8  C7  UNL     1       6.239   3.555  -0.924  1.00  0.00           C  
HETATM    9  O2  UNL     1       7.578   4.008  -1.036  1.00  0.00           O  
HETATM   10  C8  UNL     1       5.772   3.099   0.295  1.00  0.00           C  
HETATM   11  C9  UNL     1       4.490   2.647   0.447  1.00  0.00           C  
HETATM   12  O3  UNL     1       1.850   1.076  -0.013  1.00  0.00           O  
HETATM   13  C10 UNL     1       0.582   0.748   0.238  1.00  0.00           C  
HETATM   14  C11 UNL     1       0.275  -0.572   0.598  1.00  0.00           C  
HETATM   15  C12 UNL     1       1.416  -1.468   0.714  1.00  0.00           C  
HETATM   16  O4  UNL     1       2.461  -1.049  -0.101  1.00  0.00           O  
HETATM   17  C13 UNL     1       2.948  -1.826  -1.081  1.00  0.00           C  
HETATM   18  C14 UNL     1       4.480  -1.563  -1.066  1.00  0.00           C  
HETATM   19  O5  UNL     1       5.161  -2.300  -1.988  1.00  0.00           O  
HETATM   20  C15 UNL     1       2.820  -3.309  -0.929  1.00  0.00           C  
HETATM   21  O6  UNL     1       4.007  -3.991  -1.348  1.00  0.00           O  
HETATM   22  C16 UNL     1       2.618  -3.590   0.521  1.00  0.00           C  
HETATM   23  O7  UNL     1       2.576  -4.924   0.801  1.00  0.00           O  
HETATM   24  C17 UNL     1       1.247  -2.917   0.870  1.00  0.00           C  
HETATM   25  O8  UNL     1       1.079  -3.321   2.215  1.00  0.00           O  
HETATM   26  C18 UNL     1      -1.017  -0.864   0.821  1.00  0.00           C  
HETATM   27  O9  UNL     1      -1.536  -2.069   1.174  1.00  0.00           O  
HETATM   28  C19 UNL     1      -2.035   0.146   0.697  1.00  0.00           C  
HETATM   29  C20 UNL     1      -3.477  -0.297   0.839  1.00  0.00           C  
HETATM   30  O10 UNL     1      -4.015   0.033  -0.437  1.00  0.00           O  
HETATM   31  C21 UNL     1      -5.246  -0.499  -0.630  1.00  0.00           C  
HETATM   32  C22 UNL     1      -5.965   0.247  -1.793  1.00  0.00           C  
HETATM   33  O11 UNL     1      -7.207  -0.323  -1.921  1.00  0.00           O  
HETATM   34  C23 UNL     1      -6.162  -0.501   0.567  1.00  0.00           C  
HETATM   35  O12 UNL     1      -6.197  -1.756   1.196  1.00  0.00           O  
HETATM   36  C24 UNL     1      -5.724   0.553   1.572  1.00  0.00           C  
HETATM   37  O13 UNL     1      -6.210   1.807   1.309  1.00  0.00           O  
HETATM   38  C25 UNL     1      -4.266   0.476   1.833  1.00  0.00           C  
HETATM   39  O14 UNL     1      -3.723   1.625   2.321  1.00  0.00           O  
HETATM   40  C26 UNL     1      -1.724   1.401   0.352  1.00  0.00           C  
HETATM   41  O15 UNL     1      -2.583   2.472   0.172  1.00  0.00           O  
HETATM   42  C27 UNL     1      -0.362   1.716   0.114  1.00  0.00           C  
HETATM   43  H1  UNL     1       1.608   4.275  -0.803  1.00  0.00           H  
HETATM   44  H2  UNL     1       3.354   3.080  -2.706  1.00  0.00           H  
HETATM   45  H3  UNL     1       5.707   3.884  -2.956  1.00  0.00           H  
HETATM   46  H4  UNL     1       7.861   4.956  -0.881  1.00  0.00           H  
HETATM   47  H5  UNL     1       6.433   3.094   1.162  1.00  0.00           H  
HETATM   48  H6  UNL     1       4.122   2.296   1.407  1.00  0.00           H  
HETATM   49  H7  UNL     1       1.874  -1.148   1.769  1.00  0.00           H  
HETATM   50  H8  UNL     1       2.676  -1.588  -2.129  1.00  0.00           H  
HETATM   51  H9  UNL     1       4.634  -0.474  -1.154  1.00  0.00           H  
HETATM   52  H10 UNL     1       4.784  -1.891  -0.044  1.00  0.00           H  
HETATM   53  H11 UNL     1       5.212  -1.859  -2.859  1.00  0.00           H  
HETATM   54  H12 UNL     1       2.016  -3.737  -1.553  1.00  0.00           H  
HETATM   55  H13 UNL     1       3.775  -4.957  -1.311  1.00  0.00           H  
HETATM   56  H14 UNL     1       3.399  -3.083   1.075  1.00  0.00           H  
HETATM   57  H15 UNL     1       2.376  -5.103   1.750  1.00  0.00           H  
HETATM   58  H16 UNL     1       0.566  -3.413   0.192  1.00  0.00           H  
HETATM   59  H17 UNL     1       0.604  -4.190   2.255  1.00  0.00           H  
HETATM   60  H18 UNL     1      -1.255  -2.934   1.413  1.00  0.00           H  
HETATM   61  H19 UNL     1      -3.520  -1.349   1.020  1.00  0.00           H  
HETATM   62  H20 UNL     1      -5.142  -1.544  -1.001  1.00  0.00           H  
HETATM   63  H21 UNL     1      -5.360   0.052  -2.719  1.00  0.00           H  
HETATM   64  H22 UNL     1      -6.068   1.322  -1.571  1.00  0.00           H  
HETATM   65  H23 UNL     1      -7.166  -1.018  -2.650  1.00  0.00           H  
HETATM   66  H24 UNL     1      -7.186  -0.245   0.245  1.00  0.00           H  
HETATM   67  H25 UNL     1      -6.941  -1.840   1.794  1.00  0.00           H  
HETATM   68  H26 UNL     1      -6.255   0.234   2.533  1.00  0.00           H  
HETATM   69  H27 UNL     1      -5.781   2.278   0.579  1.00  0.00           H  
HETATM   70  H28 UNL     1      -4.166  -0.223   2.815  1.00  0.00           H  
HETATM   71  H29 UNL     1      -4.380   2.345   2.483  1.00  0.00           H  
HETATM   72  H30 UNL     1      -3.533   2.577   0.149  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   42
CONECT    3    4    4   43
CONECT    4    5   12
CONECT    5    6    6   11
CONECT    6    7   44
CONECT    7    8    8   45
CONECT    8    9   10
CONECT    9   46
CONECT   10   11   11   47
CONECT   11   48
CONECT   12   13
CONECT   13   14   14   42
CONECT   14   15   26
CONECT   15   16   24   49
CONECT   16   17
CONECT   17   18   20   50
CONECT   18   19   51   52
CONECT   19   53
CONECT   20   21   22   54
CONECT   21   55
CONECT   22   23   24   56
CONECT   23   57
CONECT   24   25   58
CONECT   25   59
CONECT   26   27   28   28
CONECT   27   60
CONECT   28   29   40
CONECT   29   30   38   61
CONECT   30   31
CONECT   31   32   34   62
CONECT   32   33   63   64
CONECT   33   65
CONECT   34   35   36   66
CONECT   35   67
CONECT   36   37   38   68
CONECT   37   69
CONECT   38   39   70
CONECT   39   71
CONECT   40   41   42   42
CONECT   41   72
END

HMDB0030708
     RDKit          3D
Vicenin 2
 72 76  0  0  0  0  0  0  0  0999 V2000
   -0.8931    3.9112   -0.3774 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0501    2.9921   -0.2568 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2940    3.2791   -0.5081 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2064    2.2667   -0.3671 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6061    2.6435   -0.6435 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0650    3.0962   -1.8608 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3699    3.5454   -1.9964 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2395    3.5546   -0.9239 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5785    4.0079   -1.0356 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7721    3.0992    0.2946 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4902    2.6474    0.4471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8502    1.0764   -0.0134 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5817    0.7481    0.2382 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2748   -0.5721    0.5981 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4164   -1.4681    0.7143 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4613   -1.0488   -0.1012 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9482   -1.8261   -1.0815 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4800   -1.5626   -1.0660 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1611   -2.3002   -1.9884 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -3.3094   -0.9294 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0075   -3.9906   -1.3482 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6184   -3.5901    0.5207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5761   -4.9244    0.8014 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2472   -2.9175    0.8697 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0787   -3.3209    2.2152 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0165   -0.8644    0.8206 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5360   -2.0694    1.1738 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0349    0.1456    0.6974 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4774   -0.2973    0.8389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0149    0.0331   -0.4375 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2460   -0.4985   -0.6304 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9650    0.2474   -1.7931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2072   -0.3234   -1.9207 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1621   -0.5012    0.5669 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1969   -1.7557    1.1955 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7240    0.5532    1.5722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2104    1.8065    1.3090 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2657    0.4756    1.8331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7228    1.6247    2.3213 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7238    1.4007    0.3517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5834    2.4717    0.1718 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3620    1.7157    0.1136 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6081    4.2746   -0.8026 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3538    3.0801   -2.7063 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7075    3.8842   -2.9556 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8614    4.9559   -0.8809 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4334    3.0938    1.1622 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1220    2.2962    1.4074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8738   -1.1485    1.7689 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6759   -1.5880   -2.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -0.4742   -1.1539 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7840   -1.8908   -0.0442 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2123   -1.8587   -2.8585 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0158   -3.7367   -1.5526 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7747   -4.9565   -1.3107 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994   -3.0833    1.0749 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3761   -5.1030    1.7504 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5661   -3.4127    0.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6043   -4.1902    2.2545 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2545   -2.9341    1.4126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5204   -1.3489    1.0202 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1425   -1.5441   -1.0009 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3598    0.0524   -2.7190 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0676    1.3217   -1.5713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1656   -1.0178   -2.6498 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1862   -0.2449    0.2455 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9411   -1.8396    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2551    0.2343    2.5327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7810    2.2785    0.5788 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1656   -0.2229    2.8152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3801    2.3452    2.4827 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5333    2.5768    0.1489 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 14 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 28 40  1  0
 40 41  1  0
 40 42  2  0
 42  2  1  0
 11  5  1  0
 42 13  1  0
 24 15  1  0
 38 29  1  0
  3 43  1  0
  6 44  1  0
  7 45  1  0
  9 46  1  0
 10 47  1  0
 11 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 18 52  1  0
 19 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 41 72  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Apigenin-6,8-di-C-glycopyranoside	MeSH
Vicenin-2	MeSH
Vicenin II	MeSH
5,7,4'-Trihydroxyflavone-6,8-di-C-glucoside	HMDB
6,8-Di-b-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one, 9ci	HMDB
6,8-Di-C-glucopyranosylapigenin	HMDB
6,8-Di-C-glucosyl-4',5,7-trihydroxyflavone	HMDB
6,8-Di-C-glucosylapigenin	HMDB
Apigenin 6,8-di-C-glucoside	HMDB
Vicenin-1	MeSH
6-C-beta-D-Xylopyranosyl-8-C-beta-D-glucopyranosyl apigenin	MeSH
Vicenin	MeSH

Chemical Formula

C₂₇H₃₀O₁₅

Average Molecular Weight

594.5181

Monoisotopic Molecular Weight

594.15847029

IUPAC Name

5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one

Traditional Name

5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one

CAS Registry Number

23666-13-9

SMILES

OCC1OC(C(O)C(O)C1O)C1=C(O)C(C2OC(CO)C(O)C(O)C2O)=C2OC(=CC(=O)C2=C1O)C1=CC=C(O)C=C1

InChI Identifier

InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2

InChI Key

FIAAVMJLAGNUKW-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid 8-C-glycosides

Alternative Parents

Substituents

Flavonoid-8-c-glycoside
Hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Phenolic glycoside
Hexose monosaccharide
Glycosyl compound
C-glycosyl compound
Chromone
1-benzopyran
Benzopyran
Pyranone
Phenol
1-hydroxy-2-unsubstituted benzenoid
Pyran
Monosaccharide
Monocyclic benzene moiety
Benzenoid
Oxane
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Ether
Dialkyl ether
Organoheterocyclic compound
Oxacycle
Polyol
Primary alcohol
Organic oxide
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Disposition

Biological location

Cellular substructure

Ingestion

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	233 - 236 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	605600 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	9.88 g/L	ALOGPS
logP	10^(-0.97) g/L	ALOGPS
logP	10^(-2.8) g/L	ChemAxon
logS	10^(-1.8) g/L	ALOGPS
pKa (Strongest Acidic)	5.76	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	267.29 Å²	ChemAxon
Rotatable Bond Count	5	ChemAxon
Refractivity	139.15 m³·mol⁻¹	ChemAxon
Polarizability	57.58 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Vicenin 2	OCC1OC(C(O)C(O)C1O)C1=C(O)C(C2OC(CO)C(O)C(O)C2O)=C2OC(=CC(=O)C2=C1O)C1=CC=C(O)C=C1	5530.0	Standard polar	33892256
Vicenin 2	OCC1OC(C(O)C(O)C1O)C1=C(O)C(C2OC(CO)C(O)C(O)C2O)=C2OC(=CC(=O)C2=C1O)C1=CC=C(O)C=C1	4547.2	Standard non polar	33892256
Vicenin 2	OCC1OC(C(O)C(O)C1O)C1=C(O)C(C2OC(CO)C(O)C(O)C2O)=C2OC(=CC(=O)C2=C1O)C1=CC=C(O)C=C1	5829.8	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Vicenin 2,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5566.2	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #10	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5561.9	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #11	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5640.6	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #2	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5605.4	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5624.4	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5612.0	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #5	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5561.9	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5564.7	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #7	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5613.5	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #8	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C1O	5624.4	Semi standard non polar	33892256
Vicenin 2,1TMS,isomer #9	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5603.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5502.9	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5531.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #11	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5526.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5516.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #13	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5543.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #14	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5548.7	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #15	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5542.0	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #16	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5575.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #17	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5538.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #18	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5547.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #19	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O[Si](C)(C)C	5566.0	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5509.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #20	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5572.3	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #21	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5526.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5525.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #23	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5545.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #24	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5554.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #25	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5549.4	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #26	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5577.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #27	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5544.7	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #28	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5531.4	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5520.4	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5521.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #30	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5546.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #31	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5550.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #32	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5547.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #33	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5583.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #34	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5546.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #35	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5551.7	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5559.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5504.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #38	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5532.6	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #39	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5527.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5529.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #40	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5528.4	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5515.7	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5561.0	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5527.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5531.9	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5533.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #46	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5546.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #47	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5585.7	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #48	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5549.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #49	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O[Si](C)(C)C	5575.8	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5517.5	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #50	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5544.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #51	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5584.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #52	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C	5570.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #53	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5538.4	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #54	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5581.0	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5573.9	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5560.2	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5515.1	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5525.9	Semi standard non polar	33892256
Vicenin 2,2TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5529.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5373.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5453.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #100	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5425.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5452.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #102	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5449.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #103	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5452.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #104	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5457.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #105	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5439.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #106	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5409.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #107	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5435.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #108	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5461.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5470.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5434.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #110	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5427.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5454.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #112	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5390.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #113	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5415.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #114	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5396.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #115	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5423.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #116	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5425.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #117	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5469.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #118	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5449.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #119	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5430.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5444.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #120	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5457.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #121	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5469.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #122	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5463.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5473.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #124	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5442.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #125	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5473.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5459.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #127	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5423.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #128	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5480.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #129	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5450.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5474.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #130	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5484.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #131	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5493.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #132	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5410.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #133	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5425.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #134	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5406.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #135	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5423.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #136	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5434.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #137	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5456.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #138	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5442.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #139	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5460.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5407.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #140	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5407.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #141	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5390.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #142	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5409.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #143	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5439.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #144	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5435.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #145	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5436.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #146	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5469.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #147	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5438.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #148	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5421.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #149	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5440.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5439.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #150	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5490.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #151	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5474.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #152	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5497.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #153	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5472.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #154	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5479.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #155	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5485.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #156	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5468.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #157	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5454.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #158	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5481.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #159	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5503.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5429.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5492.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #161	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5518.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #162	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5463.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5468.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #164	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5499.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #165	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5485.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5452.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5464.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5454.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5390.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5472.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5424.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5446.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5426.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5458.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5464.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5458.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5406.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5433.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5416.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5371.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5444.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5477.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5425.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5453.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5434.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5463.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5470.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5484.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5466.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5494.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5392.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5439.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5422.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5440.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5467.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5474.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5480.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #46	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5431.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #47	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5438.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #48	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5424.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #49	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5458.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5433.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5393.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #51	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5424.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #52	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5406.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #53	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5428.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5451.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5459.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5426.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5469.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5453.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5435.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5408.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5459.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #61	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5460.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #62	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5470.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #63	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5449.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #64	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5474.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #65	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5464.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #66	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5475.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #67	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5476.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #68	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5460.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #69	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5432.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5404.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #70	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5450.6	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #71	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C1O	5458.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5479.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #73	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5451.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #74	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5465.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #75	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5476.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5484.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5485.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5492.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #79	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5456.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5388.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #80	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5464.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #81	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5514.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #82	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5435.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #83	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5458.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #84	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5464.9	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #85	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C1O	5451.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #86	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5475.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5495.1	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #88	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5467.8	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #89	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5410.4	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5406.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #90	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5442.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #91	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5371.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #92	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5396.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #93	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5381.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #94	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5406.0	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #95	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5407.2	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #96	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5450.5	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #97	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5431.7	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #98	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5415.3	Semi standard non polar	33892256
Vicenin 2,3TMS,isomer #99	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5439.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5249.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5257.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #100	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5297.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #101	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5314.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #102	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5355.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #103	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5326.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #104	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5362.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #105	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5284.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #106	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5249.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #107	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5280.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #108	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5319.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #109	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5332.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5289.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #110	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5319.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #111	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5335.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #112	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5307.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #113	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5336.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #114	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5366.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #115	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5378.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #116	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5369.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #117	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5298.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #118	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5316.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #119	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5304.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5244.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #120	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5384.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #121	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5330.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #122	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5274.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5318.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #124	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5258.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #125	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5262.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #126	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5241.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #127	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5279.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #128	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5268.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #129	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5322.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5259.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #130	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5259.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #131	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5266.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #132	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5248.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #133	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5281.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #134	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5329.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #135	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5253.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #136	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5251.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #137	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5227.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #138	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5265.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #139	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5295.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5222.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #140	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5300.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #141	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5280.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #142	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5310.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #143	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5269.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #144	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5235.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #145	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5264.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #146	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5269.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #147	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5278.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #148	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5280.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #149	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5355.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5253.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #150	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5275.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #151	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5342.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #152	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5314.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #153	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5286.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #154	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5319.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #155	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5280.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #156	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5350.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #157	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5324.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #158	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5299.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #159	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5334.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5258.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #160	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5316.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #161	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5283.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #162	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5253.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #163	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5287.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #164	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5355.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #165	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5329.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #166	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5359.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #167	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5317.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #168	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5332.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #169	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5322.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5259.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #170	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5380.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #171	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5281.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #172	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5363.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #173	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5339.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #174	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5338.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #175	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5289.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #176	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5371.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #177	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5352.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #178	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O[Si](C)(C)C	5357.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #179	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5291.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5218.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #180	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5292.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #181	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5325.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #182	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5370.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #183	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5372.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #184	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5385.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #185	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5376.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #186	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5296.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #187	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5348.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #188	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O[Si](C)(C)C	5365.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #189	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5299.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5239.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #190	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5345.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #191	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5353.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #192	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5254.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #193	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5265.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #194	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C1O	5365.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #195	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5330.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #196	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5372.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #197	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5379.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #198	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5293.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #199	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5300.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5218.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5202.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #200	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5388.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5339.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #202	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5341.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #203	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5421.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #204	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5351.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #205	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5268.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5320.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #207	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5249.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #208	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5258.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #209	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5239.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5230.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #210	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5270.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #211	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5272.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #212	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5340.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #213	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5315.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #214	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5286.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #215	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5324.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #216	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5280.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #217	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5359.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #218	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5337.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #219	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5346.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5297.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #220	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5256.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #221	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5340.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #222	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5354.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #223	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5289.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #224	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5368.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #225	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5342.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #226	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5280.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #227	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5221.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #228	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5214.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #229	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5186.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5253.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #230	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5231.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #231	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5261.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #232	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5267.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #233	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5246.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #234	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5283.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #235	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5239.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #236	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5202.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #237	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5231.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #238	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5238.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #239	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5243.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5269.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #240	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5246.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #241	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5281.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #242	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5254.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #243	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5221.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #244	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5256.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #245	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5328.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #246	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5300.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #247	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5329.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #248	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5292.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #249	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5305.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5234.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #250	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5297.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #251	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5259.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #252	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5255.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #253	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5287.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #254	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5341.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #255	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5344.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #256	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5359.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #257	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5349.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #258	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5264.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #259	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5263.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5263.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #260	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5300.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #261	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5318.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #262	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5249.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #263	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5239.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #264	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5215.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #265	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5255.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #266	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5291.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #267	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5290.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #268	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5267.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #269	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5303.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5313.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #270	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5259.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #271	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5224.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #272	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5254.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #273	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5256.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #274	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5264.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #275	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5265.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #276	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5311.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #277	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5274.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #278	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5241.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #279	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5277.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5315.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #280	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5353.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #281	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5327.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #282	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5356.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #283	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5310.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #284	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5324.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #285	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5315.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #286	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5376.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #287	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5366.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #288	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5279.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #289	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5369.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5286.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #290	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5278.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #291	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5312.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #292	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5373.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #293	C[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5283.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #294	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5283.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #295	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5323.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #296	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5312.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #297	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1	5311.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #298	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5274.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #299	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5328.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5248.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5315.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #300	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5272.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #301	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5235.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #302	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5267.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #303	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5263.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #304	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5270.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #305	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5266.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #306	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5319.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #307	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5285.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #308	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5317.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #309	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5319.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5275.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #310	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5318.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #311	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5319.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #312	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5279.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #313	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5298.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #314	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5283.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #315	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5329.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #316	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5334.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #317	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5307.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #318	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5339.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #319	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5290.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5240.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #320	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5311.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #321	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5302.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #322	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5367.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #323	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5385.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #324	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5378.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #325	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5384.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #326	C[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5345.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #327	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1	5344.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #328	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1	5339.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #329	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5423.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5271.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #330	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1	5337.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5280.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5297.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5283.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5300.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5308.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5346.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5288.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5270.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5304.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5277.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5315.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5289.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5305.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5236.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5267.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5239.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5277.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5257.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5333.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5263.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5292.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5265.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5302.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5312.5	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5328.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5296.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5341.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5271.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5249.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5241.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #61	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5270.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #62	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5307.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #63	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5292.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #64	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5297.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5353.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5350.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5267.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5318.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5287.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5217.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5325.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #71	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5348.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #72	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5268.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #73	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5314.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #74	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5285.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #75	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5316.7	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #76	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5311.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #77	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5349.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #78	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5321.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #79	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5355.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5249.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #80	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5279.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #81	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5244.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #82	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5274.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #83	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5315.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #84	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5325.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #85	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5314.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #86	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5352.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #87	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5269.8	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #88	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5322.4	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #89	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5294.9	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5249.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #90	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5329.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #91	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	5278.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #92	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	5330.6	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #93	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	5300.3	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #94	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	5335.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #95	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5255.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #96	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5219.0	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #97	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5249.2	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #98	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5298.1	Semi standard non polar	33892256
Vicenin 2,4TMS,isomer #99	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5308.3	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5752.2	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5788.1	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5825.8	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5836.1	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5856.3	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5845.6	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5785.0	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5752.2	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5846.1	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C1O	5856.9	Semi standard non polar	33892256
Vicenin 2,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5834.2	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5910.0	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5947.1	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5941.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5939.2	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5972.1	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5979.9	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O	5980.0	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	6013.8	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5961.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5978.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5995.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5913.8	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5989.0	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5945.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5941.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O	5965.6	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C1O	5981.5	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O	5976.9	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	6015.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5968.5	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5939.9	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5935.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5937.3	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5963.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5970.8	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C1O	5974.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	6009.3	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5961.3	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5959.8	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	5984.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5911.0	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5939.8	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5945.3	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5946.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5944.3	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O	5927.2	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)=CC3=O)C(O)C(O)C1O	5975.1	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5957.5	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5955.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5951.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5960.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1	6013.9	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C1O	5983.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)C(O)C1O[Si](C)(C)C(C)(C)C	5995.6	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5941.6	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5968.5	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1	6024.5	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5999.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=C(C2OC(CO)C(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C=C1)O2	5962.4	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1	6019.7	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1	6000.1	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	5972.9	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5926.2	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5952.1	Semi standard non polar	33892256
Vicenin 2,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5949.6	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (Non-derivatized) - 70eV, Positive	splash10-0w59-0000390000-4715bf8584b5737232b4	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (1 TMS) - 70eV, Positive	splash10-0571-2300179000-2bd75622b8a0edf7d54f	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS ("Vicenin 2,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Vicenin 2 GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 , negative-QTOF	splash10-0006-0005290000-9a78bec3e031b476b983	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 , negative-QTOF	splash10-0006-0094770000-4a713c915b058c32b42c	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 , negative-QTOF	splash10-01ox-0052950000-b3d4ef3891bc5396575c	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 , positive-QTOF	splash10-056r-0029730000-195463720c0564fc0e41	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 , positive-QTOF	splash10-01q9-0049410000-b9e46e9b61fd04b1fd54	2017-09-14	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-0006-0005190000-c3bc69d503efe086b104	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-002b-0159000000-73201d25ff9bd498fbbc	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-0002-0006590000-0b790319282d96c7f1b2	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-0002-0294000000-c48ccbabbc82b2e70436	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-004i-0009810000-02776207343f58da4e29	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-0570-0009710000-467ea3b5a1fccdb37cb6	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-0ue9-0009100000-3c3c2fcb4c9126028467	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Vicenin 2 6V, Positive-QTOF	splash10-002b-0005690000-6661389fc4db228fec6b	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 10V, Positive-QTOF	splash10-002b-0000190000-48ccaded9e493aef6078	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 20V, Positive-QTOF	splash10-06vj-1200390000-d10e5bb5b26e0eefb0f7	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 40V, Positive-QTOF	splash10-0550-1007940000-a8fcd22df6cf3cfc5458	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 10V, Positive-QTOF	splash10-002b-0000190000-48ccaded9e493aef6078	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 20V, Positive-QTOF	splash10-06vj-1200390000-d10e5bb5b26e0eefb0f7	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 40V, Positive-QTOF	splash10-0550-1007940000-a8fcd22df6cf3cfc5458	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 10V, Negative-QTOF	splash10-0006-0000390000-d59360ecaa9a1208b0d4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 20V, Negative-QTOF	splash10-00fu-3100690000-9b42c7acc566ef75a9f7	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 40V, Negative-QTOF	splash10-0f7c-7306960000-804c13a60653afea62e1	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 10V, Negative-QTOF	splash10-0006-0000390000-d59360ecaa9a1208b0d4	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 20V, Negative-QTOF	splash10-00fu-3100690000-9b42c7acc566ef75a9f7	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Vicenin 2 40V, Negative-QTOF	splash10-0f7c-7306960000-804c13a60653afea62e1	2015-04-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

KNApSAcK ID

Chemspider ID

KEGG Compound ID

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

3084407

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1822101

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Sulfotransferase family cytosolic 2B member 1

General function:: Involved in sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of many hormones, neurotransmitters, drugs and xenobiotic compounds. Sulfonation increases the water solubility of most compounds, and therefore their renal excretion, but it can also result in bioactivation to form active metabolites. Sulfates hydroxysteroids like DHEA. Isoform 1 preferentially sulfonates cholesterol, and isoform 2 avidly sulfonates pregnenolone but not cholesterol.
Gene Name:: SULT2B1
Uniprot ID:: O00204
Molecular weight:: 39598.595

Reactions

Vicenin 2 → ({6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-8-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
Vicenin 2 → ({6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
Vicenin 2 → {2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-8-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
Vicenin 2 → {2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-8-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
Vicenin 2 → {6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-8-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
Vicenin 2 → {6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
Vicenin 2 → {2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
Vicenin 2 → {2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details

Enzyme Details

2. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

Vicenin 2 → 6-(4-{5,7-dihydroxy-4-oxo-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-2-yl}phenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid	details
Vicenin 2 → 3,4,5-trihydroxy-6-{[7-hydroxy-2-(4-hydroxyphenyl)-4-oxo-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-5-yl]oxy}oxane-2-carboxylic acid	details
Vicenin 2 → 3,4,5-trihydroxy-6-{[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-6,8-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-7-yl]oxy}oxane-2-carboxylic acid	details

Showing metabocard for Vicenin 2 (HMDB0030708)

MOL for HMDB0030708 (Vicenin 2)

3D MOL for HMDB0030708 (Vicenin 2)

3D SDF for HMDB0030708 (Vicenin 2)

3D-SDF for HMDB0030708 (Vicenin 2)

PDB for HMDB0030708 (Vicenin 2)

3D PDB for HMDB0030708 (Vicenin 2)

SMILES for HMDB0030708 (Vicenin 2)

INCHI for HMDB0030708 (Vicenin 2)

Structure for HMDB0030708 (Vicenin 2)

3D Structure for HMDB0030708 (Vicenin 2)

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions