Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:42:26 UTC

Update Date

2022-03-07 02:52:56 UTC

HMDB ID

HMDB0031347

Secondary Accession Numbers

HMDB31347

Metabolite Identification

Common Name

2-O-Caffeoylarbutin

Description

2-O-Caffeoylarbutin belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Based on a literature review very few articles have been published on 2-O-Caffeoylarbutin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061305532D          

 31 33  0  0  0  0            999 V2000
   -2.1434    9.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    9.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    9.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    8.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  3  1  0  0  0  0
  6  4  2  0  0  0  0
  7  1  2  0  0  0  0
  8  2  2  0  0  0  0
 11  1  1  0  0  0  0
 11  2  1  0  0  0  0
 11  9  2  0  0  0  0
 12  3  2  0  0  0  0
 12  4  1  0  0  0  0
 13  5  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15  9  1  0  0  0  0
 15 14  2  0  0  0  0
 16 10  1  0  0  0  0
 17  8  1  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 10  1  0  0  0  0
 23 12  1  0  0  0  0
 24 14  1  0  0  0  0
 25 15  1  0  0  0  0
 26 17  2  0  0  0  0
 27 18  1  0  0  0  0
 28 19  1  0  0  0  0
 29 13  1  0  0  0  0
 29 21  1  0  0  0  0
 30 16  1  0  0  0  0
 30 21  1  0  0  0  0
 31 17  1  0  0  0  0
 31 20  1  0  0  0  0
M  END

HMDB0031347
     RDKit          3D
2-O-Caffeoylarbutin
 53 55  0  0  0  0  0  0  0  0999 V2000
    1.2004    0.4295   -1.7943 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2741    0.3428   -0.5585 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5629   -0.0728    0.0238 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6126   -0.3475   -0.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9052   -0.7588   -0.2420 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1805   -0.9106    1.0845 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4544   -1.3126    1.4928 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4676   -1.5675    0.5808 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7304   -1.9676    1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1705   -1.4082   -0.7649 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1428   -1.6486   -1.7211 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9049   -1.0096   -1.1550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1731    0.6325    0.1904 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0475    1.0286   -0.4091 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0572   -0.0445    0.0516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3532    0.3133   -0.2342 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2668   -0.3121   -1.0691 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0128   -1.4551   -1.7875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9719   -2.0289   -2.6044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2321   -1.4957   -2.7484 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2147   -2.0461   -3.5581 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4957   -0.3484   -2.0308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5514    0.2266   -1.2194 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7775   -0.2538    1.3826 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8621    0.8079    2.2063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9332    0.5391    3.4012 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9857    1.6154    4.2877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5520    2.1442    1.6849 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4321    3.1190    2.2123 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6083    2.2898    0.1931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0223    3.4374   -0.2589 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6773   -0.1630    1.0928 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4374   -0.2384   -1.8047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592   -0.7357    1.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6572   -1.4290    2.5585 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4262   -2.1382    0.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9355   -1.5355   -2.6969 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7406   -0.9038   -2.2380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9823    1.0666   -1.5055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7737   -0.9574   -0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0321   -1.9096   -1.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7616   -2.9299   -3.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8485   -2.7326   -3.1638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5025    0.0856   -2.1401 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7578    1.1286   -0.6549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8938    0.8372    2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1069    0.3711    3.0611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2767   -0.3911    3.8766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9397    1.7797    4.5108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5266    2.4877    1.9999 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3512    2.9744    1.8548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964    2.3302   -0.0846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5005    3.7482   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 15 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 12  5  1  0
 30 14  1  0
 23 17  1  0
  3 32  1  0
  4 33  1  0
  6 34  1  0
  7 35  1  0
  9 36  1  0
 11 37  1  0
 12 38  1  0
 14 39  1  0
 15 40  1  0
 18 41  1  0
 19 42  1  0
 21 43  1  0
 22 44  1  0
 23 45  1  0
 25 46  1  0
 26 47  1  0
 26 48  1  0
 27 49  1  0
 28 50  1  0
 29 51  1  0
 30 52  1  0
 31 53  1  0
M  END

  Mrv0541 05061305532D          

 31 33  0  0  0  0            999 V2000
   -2.1434    9.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    9.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    9.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    9.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    8.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  3  1  0  0  0  0
  6  4  2  0  0  0  0
  7  1  2  0  0  0  0
  8  2  2  0  0  0  0
 11  1  1  0  0  0  0
 11  2  1  0  0  0  0
 11  9  2  0  0  0  0
 12  3  2  0  0  0  0
 12  4  1  0  0  0  0
 13  5  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15  9  1  0  0  0  0
 15 14  2  0  0  0  0
 16 10  1  0  0  0  0
 17  8  1  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 10  1  0  0  0  0
 23 12  1  0  0  0  0
 24 14  1  0  0  0  0
 25 15  1  0  0  0  0
 26 17  2  0  0  0  0
 27 18  1  0  0  0  0
 28 19  1  0  0  0  0
 29 13  1  0  0  0  0
 29 21  1  0  0  0  0
 30 16  1  0  0  0  0
 30 21  1  0  0  0  0
 31 17  1  0  0  0  0
 31 20  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0031347

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)\C=C\C2=CC(O)=C(O)C=C2)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C21H22O10/c22-10-16-18(27)19(28)20(21(30-16)29-13-5-3-12(23)4-6-13)31-17(26)8-2-11-1-7-14(24)15(25)9-11/h1-9,16,18-25,27-28H,10H2/b8-2+

> <INCHI_KEY>
SAHZOJQMDIDFST-KRXBUXKQSA-N

> <FORMULA>
C21H22O10

> <MOLECULAR_WEIGHT>
434.3934

> <EXACT_MASS>
434.121296924

> <JCHEM_ACCEPTOR_COUNT>
9

> <JCHEM_AVERAGE_POLARIZABILITY>
42.863376080820004

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
6

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
4,5-dihydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenoxy)oxan-3-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate

> <ALOGPS_LOGP>
1.03

> <JCHEM_LOGP>
1.5248071539999999

> <ALOGPS_LOGS>
-2.80

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.915477297208302

> <JCHEM_PKA_STRONGEST_ACIDIC>
9.113847919167958

> <JCHEM_PKA_STRONGEST_BASIC>
-2.98109299141361

> <JCHEM_POLAR_SURFACE_AREA>
166.14

> <JCHEM_REFRACTIVITY>
105.69369999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
6.88e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
4,5-dihydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenoxy)oxan-3-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0031347
     RDKit          3D
2-O-Caffeoylarbutin
 53 55  0  0  0  0  0  0  0  0999 V2000
    1.2004    0.4295   -1.7943 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2741    0.3428   -0.5585 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5629   -0.0728    0.0238 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6126   -0.3475   -0.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9052   -0.7588   -0.2420 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1805   -0.9106    1.0845 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4544   -1.3126    1.4928 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4676   -1.5675    0.5808 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7304   -1.9676    1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1705   -1.4082   -0.7649 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1428   -1.6486   -1.7211 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9049   -1.0096   -1.1550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1731    0.6325    0.1904 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0475    1.0286   -0.4091 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0572   -0.0445    0.0516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3532    0.3133   -0.2342 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2668   -0.3121   -1.0691 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0128   -1.4551   -1.7875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9719   -2.0289   -2.6044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2321   -1.4957   -2.7484 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2147   -2.0461   -3.5581 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4957   -0.3484   -2.0308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5514    0.2266   -1.2194 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7775   -0.2538    1.3826 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8621    0.8079    2.2063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9332    0.5391    3.4012 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9857    1.6154    4.2877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5520    2.1442    1.6849 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4321    3.1190    2.2123 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6083    2.2898    0.1931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0223    3.4374   -0.2589 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6773   -0.1630    1.0928 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4374   -0.2384   -1.8047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592   -0.7357    1.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6572   -1.4290    2.5585 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4262   -2.1382    0.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9355   -1.5355   -2.6969 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7406   -0.9038   -2.2380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9823    1.0666   -1.5055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7737   -0.9574   -0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0321   -1.9096   -1.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7616   -2.9299   -3.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8485   -2.7326   -3.1638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5025    0.0856   -2.1401 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7578    1.1286   -0.6549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8938    0.8372    2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1069    0.3711    3.0611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2767   -0.3911    3.8766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9397    1.7797    4.5108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5266    2.4877    1.9999 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3512    2.9744    1.8548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964    2.3302   -0.0846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5005    3.7482   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 15 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 12  5  1  0
 30 14  1  0
 23 17  1  0
  3 32  1  0
  4 33  1  0
  6 34  1  0
  7 35  1  0
  9 36  1  0
 11 37  1  0
 12 38  1  0
 14 39  1  0
 15 40  1  0
 18 41  1  0
 19 42  1  0
 21 43  1  0
 22 44  1  0
 23 45  1  0
 25 46  1  0
 26 47  1  0
 26 48  1  0
 27 49  1  0
 28 50  1  0
 29 51  1  0
 30 52  1  0
 31 53  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -4.001  17.710   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -2.667  15.400   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -2.667   4.620   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       0.000   6.160   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -2.667   6.160   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -5.335  18.480   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.667  13.860   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -5.335  15.400   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       4.001   8.470   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -4.001  16.170   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -1.334   6.930   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -6.668  17.710   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -6.668  16.170   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.667   9.240   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.334  13.090   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       2.667  10.780   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       1.334  11.550   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       0.000  10.780   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       0.000   9.240   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0       4.001   6.930   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -1.334   2.310   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0      -8.002  18.480   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0      -8.002  15.400   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       0.000  13.860   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       4.001  11.550   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       1.334  13.090   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -1.334   8.470   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -1.334  11.550   0.000  0.00  0.00           O+0
CONECT    1    7   11                                                       
CONECT    2    8   11                                                       
CONECT    3    5   12                                                       
CONECT    4    6   12                                                       
CONECT    5    3   13                                                       
CONECT    6    4   13                                                       
CONECT    7    1   14                                                       
CONECT    8    2   17                                                       
CONECT    9   11   15                                                       
CONECT   10   16   22                                                       
CONECT   11    1    2    9                                                  
CONECT   12    3    4   23                                                  
CONECT   13    5    6   29                                                  
CONECT   14    7   15   24                                                  
CONECT   15    9   14   25                                                  
CONECT   16   10   18   30                                                  
CONECT   17    8   26   31                                                  
CONECT   18   16   19   27                                                  
CONECT   19   18   20   28                                                  
CONECT   20   19   21   31                                                  
CONECT   21   20   29   30                                                  
CONECT   22   10                                                            
CONECT   23   12                                                            
CONECT   24   14                                                            
CONECT   25   15                                                            
CONECT   26   17                                                            
CONECT   27   18                                                            
CONECT   28   19                                                            
CONECT   29   13   21                                                       
CONECT   30   16   21                                                       
CONECT   31   17   20                                                       
MASTER        0    0    0    0    0    0    0    0   31    0   66    0
END

COMPND    HMDB0031347
HETATM    1  O1  UNL     1       1.200   0.430  -1.794  1.00  0.00           O  
HETATM    2  C1  UNL     1       1.274   0.343  -0.559  1.00  0.00           C  
HETATM    3  C2  UNL     1       2.563  -0.073   0.024  1.00  0.00           C  
HETATM    4  C3  UNL     1       3.613  -0.347  -0.721  1.00  0.00           C  
HETATM    5  C4  UNL     1       4.905  -0.759  -0.242  1.00  0.00           C  
HETATM    6  C5  UNL     1       5.180  -0.911   1.085  1.00  0.00           C  
HETATM    7  C6  UNL     1       6.454  -1.313   1.493  1.00  0.00           C  
HETATM    8  C7  UNL     1       7.468  -1.567   0.581  1.00  0.00           C  
HETATM    9  O2  UNL     1       8.730  -1.968   1.016  1.00  0.00           O  
HETATM   10  C8  UNL     1       7.171  -1.408  -0.765  1.00  0.00           C  
HETATM   11  O3  UNL     1       8.143  -1.649  -1.721  1.00  0.00           O  
HETATM   12  C9  UNL     1       5.905  -1.010  -1.155  1.00  0.00           C  
HETATM   13  O4  UNL     1       0.173   0.633   0.190  1.00  0.00           O  
HETATM   14  C10 UNL     1      -1.047   1.029  -0.409  1.00  0.00           C  
HETATM   15  C11 UNL     1      -2.057  -0.044   0.052  1.00  0.00           C  
HETATM   16  O5  UNL     1      -3.353   0.313  -0.234  1.00  0.00           O  
HETATM   17  C12 UNL     1      -4.267  -0.312  -1.069  1.00  0.00           C  
HETATM   18  C13 UNL     1      -4.013  -1.455  -1.788  1.00  0.00           C  
HETATM   19  C14 UNL     1      -4.972  -2.029  -2.604  1.00  0.00           C  
HETATM   20  C15 UNL     1      -6.232  -1.496  -2.748  1.00  0.00           C  
HETATM   21  O6  UNL     1      -7.215  -2.046  -3.558  1.00  0.00           O  
HETATM   22  C16 UNL     1      -6.496  -0.348  -2.031  1.00  0.00           C  
HETATM   23  C17 UNL     1      -5.551   0.227  -1.219  1.00  0.00           C  
HETATM   24  O7  UNL     1      -1.778  -0.254   1.383  1.00  0.00           O  
HETATM   25  C18 UNL     1      -1.862   0.808   2.206  1.00  0.00           C  
HETATM   26  C19 UNL     1      -0.933   0.539   3.401  1.00  0.00           C  
HETATM   27  O8  UNL     1      -0.986   1.615   4.288  1.00  0.00           O  
HETATM   28  C20 UNL     1      -1.552   2.144   1.685  1.00  0.00           C  
HETATM   29  O9  UNL     1      -2.432   3.119   2.212  1.00  0.00           O  
HETATM   30  C21 UNL     1      -1.608   2.290   0.193  1.00  0.00           C  
HETATM   31  O10 UNL     1      -1.022   3.437  -0.259  1.00  0.00           O  
HETATM   32  H1  UNL     1       2.677  -0.163   1.093  1.00  0.00           H  
HETATM   33  H2  UNL     1       3.437  -0.238  -1.805  1.00  0.00           H  
HETATM   34  H3  UNL     1       4.459  -0.736   1.859  1.00  0.00           H  
HETATM   35  H4  UNL     1       6.657  -1.429   2.558  1.00  0.00           H  
HETATM   36  H5  UNL     1       9.426  -2.138   0.305  1.00  0.00           H  
HETATM   37  H6  UNL     1       7.935  -1.535  -2.697  1.00  0.00           H  
HETATM   38  H7  UNL     1       5.741  -0.904  -2.238  1.00  0.00           H  
HETATM   39  H8  UNL     1      -0.982   1.067  -1.505  1.00  0.00           H  
HETATM   40  H9  UNL     1      -1.774  -0.957  -0.488  1.00  0.00           H  
HETATM   41  H10 UNL     1      -3.032  -1.910  -1.704  1.00  0.00           H  
HETATM   42  H11 UNL     1      -4.762  -2.930  -3.166  1.00  0.00           H  
HETATM   43  H12 UNL     1      -7.848  -2.733  -3.164  1.00  0.00           H  
HETATM   44  H13 UNL     1      -7.502   0.086  -2.140  1.00  0.00           H  
HETATM   45  H14 UNL     1      -5.758   1.129  -0.655  1.00  0.00           H  
HETATM   46  H15 UNL     1      -2.894   0.837   2.666  1.00  0.00           H  
HETATM   47  H16 UNL     1       0.107   0.371   3.061  1.00  0.00           H  
HETATM   48  H17 UNL     1      -1.277  -0.391   3.877  1.00  0.00           H  
HETATM   49  H18 UNL     1      -1.940   1.780   4.511  1.00  0.00           H  
HETATM   50  H19 UNL     1      -0.527   2.488   2.000  1.00  0.00           H  
HETATM   51  H20 UNL     1      -3.351   2.974   1.855  1.00  0.00           H  
HETATM   52  H21 UNL     1      -2.696   2.330  -0.085  1.00  0.00           H  
HETATM   53  H22 UNL     1      -1.501   3.748  -1.068  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   13
CONECT    3    4    4   32
CONECT    4    5   33
CONECT    5    6    6   12
CONECT    6    7   34
CONECT    7    8    8   35
CONECT    8    9   10
CONECT    9   36
CONECT   10   11   12   12
CONECT   11   37
CONECT   12   38
CONECT   13   14
CONECT   14   15   30   39
CONECT   15   16   24   40
CONECT   16   17
CONECT   17   18   18   23
CONECT   18   19   41
CONECT   19   20   20   42
CONECT   20   21   22
CONECT   21   43
CONECT   22   23   23   44
CONECT   23   45
CONECT   24   25
CONECT   25   26   28   46
CONECT   26   27   47   48
CONECT   27   49
CONECT   28   29   30   50
CONECT   29   51
CONECT   30   31   52
CONECT   31   53
END

HMDB0031347
     RDKit          3D
2-O-Caffeoylarbutin
 53 55  0  0  0  0  0  0  0  0999 V2000
    1.2004    0.4295   -1.7943 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2741    0.3428   -0.5585 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5629   -0.0728    0.0238 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6126   -0.3475   -0.7211 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9052   -0.7588   -0.2420 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1805   -0.9106    1.0845 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4544   -1.3126    1.4928 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4676   -1.5675    0.5808 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7304   -1.9676    1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1705   -1.4082   -0.7649 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1428   -1.6486   -1.7211 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9049   -1.0096   -1.1550 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1731    0.6325    0.1904 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0475    1.0286   -0.4091 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0572   -0.0445    0.0516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3532    0.3133   -0.2342 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2668   -0.3121   -1.0691 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0128   -1.4551   -1.7875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9719   -2.0289   -2.6044 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2321   -1.4957   -2.7484 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2147   -2.0461   -3.5581 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4957   -0.3484   -2.0308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5514    0.2266   -1.2194 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7775   -0.2538    1.3826 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8621    0.8079    2.2063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9332    0.5391    3.4012 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9857    1.6154    4.2877 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5520    2.1442    1.6849 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4321    3.1190    2.2123 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6083    2.2898    0.1931 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0223    3.4374   -0.2589 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6773   -0.1630    1.0928 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4374   -0.2384   -1.8047 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592   -0.7357    1.8592 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6572   -1.4290    2.5585 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4262   -2.1382    0.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9355   -1.5355   -2.6969 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7406   -0.9038   -2.2380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9823    1.0666   -1.5055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7737   -0.9574   -0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0321   -1.9096   -1.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7616   -2.9299   -3.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8485   -2.7326   -3.1638 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5025    0.0856   -2.1401 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7578    1.1286   -0.6549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8938    0.8372    2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1069    0.3711    3.0611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2767   -0.3911    3.8766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9397    1.7797    4.5108 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5266    2.4877    1.9999 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3512    2.9744    1.8548 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964    2.3302   -0.0846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5005    3.7482   -1.0684 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 15 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 12  5  1  0
 30 14  1  0
 23 17  1  0
  3 32  1  0
  4 33  1  0
  6 34  1  0
  7 35  1  0
  9 36  1  0
 11 37  1  0
 12 38  1  0
 14 39  1  0
 15 40  1  0
 18 41  1  0
 19 42  1  0
 21 43  1  0
 22 44  1  0
 23 45  1  0
 25 46  1  0
 26 47  1  0
 26 48  1  0
 27 49  1  0
 28 50  1  0
 29 51  1  0
 30 52  1  0
 31 53  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
4,5-Dihydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenoxy)oxan-3-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid	HMDB

Chemical Formula

C₂₁H₂₂O₁₀

Average Molecular Weight

434.3934

Monoisotopic Molecular Weight

434.121296924

IUPAC Name

4,5-dihydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenoxy)oxan-3-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate

Traditional Name

4,5-dihydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenoxy)oxan-3-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate

CAS Registry Number

230955-36-9

SMILES

OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)\C=C\C2=CC(O)=C(O)C=C2)C(O)C1O

InChI Identifier

InChI=1S/C21H22O10/c22-10-16-18(27)19(28)20(21(30-16)29-13-5-3-12(23)4-6-13)31-17(26)8-2-11-1-7-14(24)15(25)9-11/h1-9,16,18-25,27-28H,10H2/b8-2+

InChI Key

SAHZOJQMDIDFST-KRXBUXKQSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

Phenolic glycosides

Alternative Parents

Substituents

Phenolic glycoside
Cinnamic acid or derivatives
Coumaric acid or derivatives
Hexose monosaccharide
Hydroxycinnamic acid or derivatives
Cinnamic acid ester
O-glycosyl compound
4-alkoxyphenol
Phenoxy compound
Catechol
Phenol ether
Styrene
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Fatty acid ester
Phenol
Monocyclic benzene moiety
Oxane
Fatty acyl
Monosaccharide
Benzenoid
Enoate ester
Alpha,beta-unsaturated carboxylic ester
Secondary alcohol
Carboxylic acid ester
Organoheterocyclic compound
Monocarboxylic acid or derivatives
Oxacycle
Carboxylic acid derivative
Acetal
Primary alcohol
Hydrocarbon derivative
Carbonyl group
Alcohol
Organic oxide
Aromatic heteromonocyclic compound

Molecular Framework

Aromatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0031347)
Cytoplasm (HMDB: HMDB0031347)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0031347)

Source

Endogenous

Endogenous (HMDB: HMDB0031347)

Plant

Plant (HMDB: HMDB0031347)

Exogenous

Food

Food (HMDB: HMDB0031347)

Fruit

Fruits (FooDB: FOOD00871)

Exogenous (HMDB: HMDB0031347)

Process

Not Available

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	165 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.69 g/L	ALOGPS
logP	1.03	ALOGPS
logP	1.52	ChemAxon
logS	-2.8	ALOGPS
pKa (Strongest Acidic)	9.11	ChemAxon
pKa (Strongest Basic)	-3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	9	ChemAxon
Hydrogen Donor Count	6	ChemAxon
Polar Surface Area	166.14 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	105.69 m³·mol⁻¹	ChemAxon
Polarizability	42.86 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	196.429	30932474
DeepCCS	[M-H]-	194.034	30932474
DeepCCS	[M-2H]-	227.143	30932474
DeepCCS	[M+Na]+	202.445	30932474
AllCCS	[M+H]+	200.7	32859911
AllCCS	[M+H-H2O]+	198.4	32859911
AllCCS	[M+NH4]+	202.9	32859911
AllCCS	[M+Na]+	203.5	32859911
AllCCS	[M-H]-	195.1	32859911
AllCCS	[M+Na-2H]-	195.5	32859911
AllCCS	[M+HCOO]-	196.0	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
2-O-Caffeoylarbutin	OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)\C=C\C2=CC(O)=C(O)C=C2)C(O)C1O	6080.8	Standard polar	33892256
2-O-Caffeoylarbutin	OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)\C=C\C2=CC(O)=C(O)C=C2)C(O)C1O	4370.4	Standard non polar	33892256
2-O-Caffeoylarbutin	OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)\C=C\C2=CC(O)=C(O)C=C2)C(O)C1O	4242.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
2-O-Caffeoylarbutin,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O	4219.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TMS,isomer #2	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4161.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TMS,isomer #3	C[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)=CC=C1O	4163.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TMS,isomer #4	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)C=C1O	4158.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TMS,isomer #5	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(O)C=C2)C1OC(=O)/C=C/C1=CC=C(O)C(O)=C1	4209.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TMS,isomer #6	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1O	4183.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O	4084.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #10	C[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O)=CC=C1O	4059.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #11	C[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C)=CC=C1O	4082.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #12	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)C=C1O[Si](C)(C)C	4115.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O	4044.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #14	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O	4067.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #15	C[Si](C)(C)OC1C(CO)OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C	4119.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	4111.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	4133.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	4171.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4175.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #6	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4047.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #7	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4066.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #8	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1	4026.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TMS,isomer #9	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1	4027.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O	3942.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4104.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #11	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	3963.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #12	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1	3924.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #13	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1	3933.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #14	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1	3940.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #15	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1	3949.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #16	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1	3969.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #17	C[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC=C1O	3958.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #18	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O)C=C1O[Si](C)(C)C	3994.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #19	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3994.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O	3958.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #20	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O	3946.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O	3987.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C	4010.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	4023.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3977.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	4001.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3998.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	4009.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O	3924.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3928.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #11	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1	3848.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #12	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1	3859.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #13	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1	3927.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #14	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1	3916.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #15	C[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3899.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O	3891.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C	3913.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3909.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3924.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3952.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3923.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3960.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3918.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O	3887.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O)C1O[Si](C)(C)C	3927.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3861.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3876.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3915.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,5TMS,isomer #6	C[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1	3853.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,6TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3879.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O	4486.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4448.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)=CC=C1O	4443.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)C=C1O	4441.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=C(O)C=C2)C1OC(=O)/C=C/C1=CC=C(O)C(O)=C1	4490.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1O	4469.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O	4574.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)=CC=C1O	4575.2	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4590.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O)C=C1O[Si](C)(C)C(C)(C)C	4618.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O	4569.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O	4589.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C	4613.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4585.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4600.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4632.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4653.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4559.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4574.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1	4574.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4573.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O	4698.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4756.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C=C1	4677.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1	4705.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4696.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1	4718.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4709.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4730.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)=CC=C1O	4694.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C=C1O[Si](C)(C)C(C)(C)C	4697.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C	4706.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4690.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C=C1O	4702.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4670.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4686.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4704.3	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4694.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4722.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4695.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4714.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O	4829.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4856.4	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1	4850.1	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4832.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4836.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1	4848.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C/C(=O)OC2C(OC3=CC=C(O)C=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C	4799.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4857.8	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4892.9	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4849.5	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4879.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(OC(=O)/C=C/C2=CC=C(O)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4802.6	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O[Si](C)(C)C(C)(C)C)C1O	4817.0	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C(O)C1O[Si](C)(C)C(C)(C)C	4848.7	Semi standard non polar	33892256
2-O-Caffeoylarbutin,4TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=C(O)C=C2)C(OC(=O)/C=C/C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4876.5	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Caffeoylarbutin GC-MS (Non-derivatized) - 70eV, Positive	splash10-022i-7942200000-477cc91bdcceff601ea8	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Caffeoylarbutin GC-MS (3 TMS) - 70eV, Positive	splash10-000i-3921116000-41672bdb24fd5eccd19e	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 2-O-Caffeoylarbutin GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 10V, Positive-QTOF	splash10-03di-0920300000-14be6f4ef537e487a443	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 20V, Positive-QTOF	splash10-03di-0910000000-dc7c6c189c55dd97c36f	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 40V, Positive-QTOF	splash10-03di-5900000000-53ac8f12a98cd6ce4432	2016-08-02	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 10V, Negative-QTOF	splash10-0560-0930400000-23d0b2a081f8f6a0c9fb	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 20V, Negative-QTOF	splash10-0a4i-0910000000-4ac1b0ce503a7c63de2e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 40V, Negative-QTOF	splash10-0a4i-1900000000-7a00bceb20a1d537c30e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 10V, Positive-QTOF	splash10-0a4i-0109000000-a2b54c12f1a9d648f831	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 20V, Positive-QTOF	splash10-08g1-0904100000-528315dd988f2c054b4e	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 40V, Positive-QTOF	splash10-06rj-3910000000-8aa814ab7aef77fd8b7b	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 10V, Negative-QTOF	splash10-01q9-0614900000-48081fabe2e08372332b	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 20V, Negative-QTOF	splash10-0a4i-1924000000-ea36bd5516fffebb334a	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 2-O-Caffeoylarbutin 40V, Negative-QTOF	splash10-0a59-5902000000-3515ac52457fdb090df8	2021-09-22	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB003411

KNApSAcK ID

C00054559

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131751154

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for 2-O-Caffeoylarbutin (HMDB0031347)

MOL for HMDB0031347 (2-O-Caffeoylarbutin)

3D MOL for HMDB0031347 (2-O-Caffeoylarbutin)

3D SDF for HMDB0031347 (2-O-Caffeoylarbutin)

3D-SDF for HMDB0031347 (2-O-Caffeoylarbutin)

PDB for HMDB0031347 (2-O-Caffeoylarbutin)

3D PDB for HMDB0031347 (2-O-Caffeoylarbutin)

SMILES for HMDB0031347 (2-O-Caffeoylarbutin)

INCHI for HMDB0031347 (2-O-Caffeoylarbutin)

Structure for HMDB0031347 (2-O-Caffeoylarbutin)

3D Structure for HMDB0031347 (2-O-Caffeoylarbutin)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra