Hmdb loader

Showing metabocard for Lucuminamide (HMDB0031697)

Jump To Section:
IdentificationTaxonomyOntologyPhysical propertiesSpectraBiological propertiesConcentrationsLinksReferencesXML
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-11 17:44:54 UTC
Update Date2022-03-07 02:53:05 UTC
HMDB IDHMDB0031697
Secondary Accession Numbers
  • HMDB31697
Metabolite Identification
Common NameLucuminamide
DescriptionLucuminamide belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. Based on a literature review very few articles have been published on Lucuminamide.
Structure
Data?1563862158
MOL3D MOLSDF3D SDFPDB3D PDBSMILESInChI

MOL for HMDB0031697 (Lucuminamide)


  Mrv0541 05061306042D          

 31 33  0  0  0  0            999 V2000
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    4.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  1  1  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  8  4  2  0  0  0  0
  8  5  1  0  0  0  0
  9  6  1  0  0  0  0
 10  7  1  0  0  0  0
 11  9  1  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 11  1  0  0  0  0
 15 13  1  0  0  0  0
 16  8  1  0  0  0  0
 17 16  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 20 17  2  0  0  0  0
 21  9  1  0  0  0  0
 22 11  1  0  0  0  0
 23 12  1  0  0  0  0
 24 13  1  0  0  0  0
 25 14  1  0  0  0  0
 26 15  1  0  0  0  0
 27 17  1  0  0  0  0
 28  6  1  0  0  0  0
 28 18  1  0  0  0  0
 29  7  1  0  0  0  0
 29 18  1  0  0  0  0
 30 10  1  0  0  0  0
 30 19  1  0  0  0  0
 31 16  1  0  0  0  0
 31 19  1  0  0  0  0
M  END
Download

3D MOL for HMDB0031697 (Lucuminamide)

HMDB0031697
     RDKit          3D
Lucuminamide
 58 60  0  0  0  0  0  0  0  0999 V2000
   -3.0242    0.4942    2.6447 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9193   -0.0427    1.8884 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2040   -0.3335    2.3340 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6386   -0.3984    0.4531 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3201   -0.0376    0.1963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5485   -1.1018   -0.2284 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5604   -1.3337    0.7185 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7060   -0.9671    0.2519 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6476   -0.9971    1.4147 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9374   -0.6375    1.1702 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1644    0.6318    0.7165 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7607    0.5678   -0.5331 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9779    1.1896   -0.6341 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9655    0.7535    0.4429 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3423   -0.5742    0.2387 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3434    0.8541    1.8046 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1660    1.5847    2.6831 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9864    1.4616    1.6877 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0214    2.7876    1.3244 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1535   -1.8516   -0.8833 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4164   -3.1542   -0.4574 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0878   -1.8832   -1.9301 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6834   -1.4753   -3.1462 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9692   -0.8786   -1.6064 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0517   -1.0378   -2.5041 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6038    0.3758   -0.3566 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6407   -0.2992   -0.9568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5951    0.3119   -1.7298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5125    1.6754   -1.9164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4696    2.3666   -1.3149 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5174    1.7374   -0.5401 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2962    0.7073    3.6157 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4672   -1.3139    2.3456 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8224   -1.4716    0.2693 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1995   -1.9982   -0.2566 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6111    0.0627   -0.1388 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6824   -2.0752    1.7559 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1787   -0.4635    2.2680 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2131    1.2239    0.5861 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4383    0.8130   -1.5964 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9426    2.2817   -0.7563 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8524    1.4084    0.4049 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0383   -0.8008    0.8986 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2443   -0.1560    2.2897 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2470    2.5234    2.4221 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4946    1.3999    2.6807 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2261    3.1331    0.8901 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1134   -1.4558   -1.2634 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8637   -3.3600    0.3350 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3252   -2.9096   -2.0956 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1798   -1.8737   -3.9043 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5825    0.1226   -1.7836 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8981   -1.8023   -3.1194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7354   -1.3886   -0.8276 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3915   -0.2904   -2.1758 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2599    2.1844   -2.5272 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4241    3.4453   -1.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7091    2.2659   -0.0726 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
  4 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 24  6  1  0
 31 26  1  0
 18 11  1  0
  1 32  1  0
  3 33  1  0
  4 34  1  0
  6 35  1  0
  8 36  1  0
  9 37  1  0
  9 38  1  0
 11 39  1  0
 13 40  1  0
 13 41  1  0
 14 42  1  0
 15 43  1  0
 16 44  1  0
 17 45  1  0
 18 46  1  0
 19 47  1  0
 20 48  1  0
 21 49  1  0
 22 50  1  0
 23 51  1  0
 24 52  1  0
 25 53  1  0
 27 54  1  0
 28 55  1  0
 29 56  1  0
 30 57  1  0
 31 58  1  0
M  END
Download

3D SDF for HMDB0031697 (Lucuminamide)


  Mrv0541 05061306042D          

 31 33  0  0  0  0            999 V2000
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    4.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  1  1  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  8  4  2  0  0  0  0
  8  5  1  0  0  0  0
  9  6  1  0  0  0  0
 10  7  1  0  0  0  0
 11  9  1  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 11  1  0  0  0  0
 15 13  1  0  0  0  0
 16  8  1  0  0  0  0
 17 16  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 20 17  2  0  0  0  0
 21  9  1  0  0  0  0
 22 11  1  0  0  0  0
 23 12  1  0  0  0  0
 24 13  1  0  0  0  0
 25 14  1  0  0  0  0
 26 15  1  0  0  0  0
 27 17  1  0  0  0  0
 28  6  1  0  0  0  0
 28 18  1  0  0  0  0
 29  7  1  0  0  0  0
 29 18  1  0  0  0  0
 30 10  1  0  0  0  0
 30 19  1  0  0  0  0
 31 16  1  0  0  0  0
 31 19  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0031697

> <DATABASE_NAME>
hmdb

> <SMILES>
OC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C19H27NO11/c20-17(27)16(8-4-2-1-3-5-8)31-19-15(26)13(24)12(23)10(30-19)7-29-18-14(25)11(22)9(21)6-28-18/h1-5,9-16,18-19,21-26H,6-7H2,(H2,20,27)

> <INCHI_KEY>
YEFUVRSZAHTXCA-UHFFFAOYSA-N

> <FORMULA>
C19H27NO11

> <MOLECULAR_WEIGHT>
445.4178

> <EXACT_MASS>
445.158410711

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_AVERAGE_POLARIZABILITY>
43.22487868336936

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-phenyl-2-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]ethanimidic acid

> <ALOGPS_LOGP>
-1.57

> <JCHEM_LOGP>
-4.647757236276691

> <ALOGPS_LOGS>
-1.47

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.17983745554075

> <JCHEM_PKA_STRONGEST_ACIDIC>
-2.0139644527716714

> <JCHEM_PKA_STRONGEST_BASIC>
11.721661750776795

> <JCHEM_POLAR_SURFACE_AREA>
202.37999999999997

> <JCHEM_REFRACTIVITY>
110.32669999999999

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.51e+01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-phenyl-2-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]ethanimidic acid

> <JCHEM_VEBER_RULE>
0

$$$$
Download

3D-SDF for HMDB0031697 (Lucuminamide)

HMDB0031697
     RDKit          3D
Lucuminamide
 58 60  0  0  0  0  0  0  0  0999 V2000
   -3.0242    0.4942    2.6447 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9193   -0.0427    1.8884 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2040   -0.3335    2.3340 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6386   -0.3984    0.4531 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3201   -0.0376    0.1963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5485   -1.1018   -0.2284 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5604   -1.3337    0.7185 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7060   -0.9671    0.2519 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6476   -0.9971    1.4147 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9374   -0.6375    1.1702 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1644    0.6318    0.7165 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7607    0.5678   -0.5331 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9779    1.1896   -0.6341 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9655    0.7535    0.4429 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3423   -0.5742    0.2387 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3434    0.8541    1.8046 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1660    1.5847    2.6831 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9864    1.4616    1.6877 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0214    2.7876    1.3244 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1535   -1.8516   -0.8833 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4164   -3.1542   -0.4574 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0878   -1.8832   -1.9301 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6834   -1.4753   -3.1462 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9692   -0.8786   -1.6064 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0517   -1.0378   -2.5041 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6038    0.3758   -0.3566 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6407   -0.2992   -0.9568 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5951    0.3119   -1.7298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5125    1.6754   -1.9164 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4696    2.3666   -1.3149 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5174    1.7374   -0.5401 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2962    0.7073    3.6157 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4672   -1.3139    2.3456 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8224   -1.4716    0.2693 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1995   -1.9982   -0.2566 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6111    0.0627   -0.1388 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6824   -2.0752    1.7559 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1787   -0.4635    2.2680 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2131    1.2239    0.5861 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4383    0.8130   -1.5964 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9426    2.2817   -0.7563 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8524    1.4084    0.4049 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0383   -0.8008    0.8986 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2443   -0.1560    2.2897 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2470    2.5234    2.4221 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4946    1.3999    2.6807 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2261    3.1331    0.8901 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1134   -1.4558   -1.2634 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8637   -3.3600    0.3350 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3252   -2.9096   -2.0956 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1798   -1.8737   -3.9043 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5825    0.1226   -1.7836 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8981   -1.8023   -3.1194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7354   -1.3886   -0.8276 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3915   -0.2904   -2.1758 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2599    2.1844   -2.5272 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4241    3.4453   -1.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7091    2.2659   -0.0726 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
  4 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 24  6  1  0
 31 26  1  0
 18 11  1  0
  1 32  1  0
  3 33  1  0
  4 34  1  0
  6 35  1  0
  8 36  1  0
  9 37  1  0
  9 38  1  0
 11 39  1  0
 13 40  1  0
 13 41  1  0
 14 42  1  0
 15 43  1  0
 16 44  1  0
 17 45  1  0
 18 46  1  0
 19 47  1  0
 20 48  1  0
 21 49  1  0
 22 50  1  0
 23 51  1  0
 24 52  1  0
 25 53  1  0
 27 54  1  0
 28 55  1  0
 29 56  1  0
 30 57  1  0
 31 58  1  0
M  END
Download

PDB for HMDB0031697 (Lucuminamide)

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -4.001   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.667   4.620   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.334   6.930   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -2.667   6.160   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -4.001   6.930   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       0.000   6.160   0.000  0.00  0.00           C+0
HETATM   20  N   UNK     0      -4.001   8.470   0.000  0.00  0.00           N+0
HETATM   21  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0      -2.667  -3.080   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       4.001   3.850   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       4.001   6.930   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      -5.335   6.160   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       1.334  -0.770   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       0.000   4.620   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -1.334   6.930   0.000  0.00  0.00           O+0
CONECT    1    2    3                                                       
CONECT    2    1    4                                                       
CONECT    3    1    5                                                       
CONECT    4    2    8                                                       
CONECT    5    3    8                                                       
CONECT    6    9   28                                                       
CONECT    7   10   29                                                       
CONECT    8    4    5   16                                                  
CONECT    9    6   11   21                                                  
CONECT   10    7   12   30                                                  
CONECT   11    9   14   22                                                  
CONECT   12   10   13   23                                                  
CONECT   13   12   15   24                                                  
CONECT   14   11   18   25                                                  
CONECT   15   13   19   26                                                  
CONECT   16    8   17   31                                                  
CONECT   17   16   20   27                                                  
CONECT   18   14   28   29                                                  
CONECT   19   15   30   31                                                  
CONECT   20   17                                                            
CONECT   21    9                                                            
CONECT   22   11                                                            
CONECT   23   12                                                            
CONECT   24   13                                                            
CONECT   25   14                                                            
CONECT   26   15                                                            
CONECT   27   17                                                            
CONECT   28    6   18                                                       
CONECT   29    7   18                                                       
CONECT   30   10   19                                                       
CONECT   31   16   19                                                       
MASTER        0    0    0    0    0    0    0    0   31    0   66    0
END
Download

3D PDB for HMDB0031697 (Lucuminamide)

COMPND    HMDB0031697
HETATM    1  N1  UNL     1      -3.024   0.494   2.645  1.00  0.00           N  
HETATM    2  C1  UNL     1      -3.919  -0.043   1.888  1.00  0.00           C  
HETATM    3  O1  UNL     1      -5.204  -0.334   2.334  1.00  0.00           O  
HETATM    4  C2  UNL     1      -3.639  -0.398   0.453  1.00  0.00           C  
HETATM    5  O2  UNL     1      -2.320  -0.038   0.196  1.00  0.00           O  
HETATM    6  C3  UNL     1      -1.549  -1.102  -0.228  1.00  0.00           C  
HETATM    7  O3  UNL     1      -0.560  -1.334   0.719  1.00  0.00           O  
HETATM    8  C4  UNL     1       0.706  -0.967   0.252  1.00  0.00           C  
HETATM    9  C5  UNL     1       1.648  -0.997   1.415  1.00  0.00           C  
HETATM   10  O4  UNL     1       2.937  -0.637   1.170  1.00  0.00           O  
HETATM   11  C6  UNL     1       3.164   0.632   0.716  1.00  0.00           C  
HETATM   12  O5  UNL     1       3.761   0.568  -0.533  1.00  0.00           O  
HETATM   13  C7  UNL     1       4.978   1.190  -0.634  1.00  0.00           C  
HETATM   14  C8  UNL     1       5.966   0.753   0.443  1.00  0.00           C  
HETATM   15  O6  UNL     1       6.342  -0.574   0.239  1.00  0.00           O  
HETATM   16  C9  UNL     1       5.343   0.854   1.805  1.00  0.00           C  
HETATM   17  O7  UNL     1       6.166   1.585   2.683  1.00  0.00           O  
HETATM   18  C10 UNL     1       3.986   1.462   1.688  1.00  0.00           C  
HETATM   19  O8  UNL     1       4.021   2.788   1.324  1.00  0.00           O  
HETATM   20  C11 UNL     1       1.153  -1.852  -0.883  1.00  0.00           C  
HETATM   21  O9  UNL     1       1.416  -3.154  -0.457  1.00  0.00           O  
HETATM   22  C12 UNL     1       0.088  -1.883  -1.930  1.00  0.00           C  
HETATM   23  O10 UNL     1       0.683  -1.475  -3.146  1.00  0.00           O  
HETATM   24  C13 UNL     1      -0.969  -0.879  -1.606  1.00  0.00           C  
HETATM   25  O11 UNL     1      -2.052  -1.038  -2.504  1.00  0.00           O  
HETATM   26  C14 UNL     1      -4.604   0.376  -0.357  1.00  0.00           C  
HETATM   27  C15 UNL     1      -5.641  -0.299  -0.957  1.00  0.00           C  
HETATM   28  C16 UNL     1      -6.595   0.312  -1.730  1.00  0.00           C  
HETATM   29  C17 UNL     1      -6.512   1.675  -1.916  1.00  0.00           C  
HETATM   30  C18 UNL     1      -5.470   2.367  -1.315  1.00  0.00           C  
HETATM   31  C19 UNL     1      -4.517   1.737  -0.540  1.00  0.00           C  
HETATM   32  H1  UNL     1      -3.296   0.707   3.616  1.00  0.00           H  
HETATM   33  H2  UNL     1      -5.467  -1.314   2.346  1.00  0.00           H  
HETATM   34  H3  UNL     1      -3.822  -1.472   0.269  1.00  0.00           H  
HETATM   35  H4  UNL     1      -2.200  -1.998  -0.257  1.00  0.00           H  
HETATM   36  H5  UNL     1       0.611   0.063  -0.139  1.00  0.00           H  
HETATM   37  H6  UNL     1       1.682  -2.075   1.756  1.00  0.00           H  
HETATM   38  H7  UNL     1       1.179  -0.464   2.268  1.00  0.00           H  
HETATM   39  H8  UNL     1       2.213   1.224   0.586  1.00  0.00           H  
HETATM   40  H9  UNL     1       5.438   0.813  -1.596  1.00  0.00           H  
HETATM   41  H10 UNL     1       4.943   2.282  -0.756  1.00  0.00           H  
HETATM   42  H11 UNL     1       6.852   1.408   0.405  1.00  0.00           H  
HETATM   43  H12 UNL     1       7.038  -0.801   0.899  1.00  0.00           H  
HETATM   44  H13 UNL     1       5.244  -0.156   2.290  1.00  0.00           H  
HETATM   45  H14 UNL     1       6.247   2.523   2.422  1.00  0.00           H  
HETATM   46  H15 UNL     1       3.495   1.400   2.681  1.00  0.00           H  
HETATM   47  H16 UNL     1       3.226   3.133   0.890  1.00  0.00           H  
HETATM   48  H17 UNL     1       2.113  -1.456  -1.263  1.00  0.00           H  
HETATM   49  H18 UNL     1       0.864  -3.360   0.335  1.00  0.00           H  
HETATM   50  H19 UNL     1      -0.325  -2.910  -2.096  1.00  0.00           H  
HETATM   51  H20 UNL     1       0.180  -1.874  -3.904  1.00  0.00           H  
HETATM   52  H21 UNL     1      -0.583   0.123  -1.784  1.00  0.00           H  
HETATM   53  H22 UNL     1      -1.898  -1.802  -3.119  1.00  0.00           H  
HETATM   54  H23 UNL     1      -5.735  -1.389  -0.828  1.00  0.00           H  
HETATM   55  H24 UNL     1      -7.392  -0.290  -2.176  1.00  0.00           H  
HETATM   56  H25 UNL     1      -7.260   2.184  -2.527  1.00  0.00           H  
HETATM   57  H26 UNL     1      -5.424   3.445  -1.476  1.00  0.00           H  
HETATM   58  H27 UNL     1      -3.709   2.266  -0.073  1.00  0.00           H  
CONECT    1    2    2   32
CONECT    2    3    4
CONECT    3   33
CONECT    4    5   26   34
CONECT    5    6
CONECT    6    7   24   35
CONECT    7    8
CONECT    8    9   20   36
CONECT    9   10   37   38
CONECT   10   11
CONECT   11   12   18   39
CONECT   12   13
CONECT   13   14   40   41
CONECT   14   15   16   42
CONECT   15   43
CONECT   16   17   18   44
CONECT   17   45
CONECT   18   19   46
CONECT   19   47
CONECT   20   21   22   48
CONECT   21   49
CONECT   22   23   24   50
CONECT   23   51
CONECT   24   25   52
CONECT   25   53
CONECT   26   27   27   31
CONECT   27   28   54
CONECT   28   29   29   55
CONECT   29   30   56
CONECT   30   31   31   57
CONECT   31   58
END
Download

SMILES for HMDB0031697 (Lucuminamide)

OC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O
Download

INCHI for HMDB0031697 (Lucuminamide)

InChI=1S/C19H27NO11/c20-17(27)16(8-4-2-1-3-5-8)31-19-15(26)13(24)12(23)10(30-19)7-29-18-14(25)11(22)9(21)6-28-18/h1-5,9-16,18-19,21-26H,6-7H2,(H2,20,27)
Download
View in JSmolView Stereo Labels
Synonyms
ValueSource
2-Phenyl-2-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]ethanimidateHMDB
Chemical FormulaC19H27NO11
Average Molecular Weight445.4178
Monoisotopic Molecular Weight445.158410711
IUPAC Name2-phenyl-2-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]ethanimidic acid
Traditional Name2-phenyl-2-[(3,4,5-trihydroxy-6-{[(3,4,5-trihydroxyoxan-2-yl)oxy]methyl}oxan-2-yl)oxy]ethanimidic acid
CAS Registry NumberNot Available
SMILES
OC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O
InChI Identifier
InChI=1S/C19H27NO11/c20-17(27)16(8-4-2-1-3-5-8)31-19-15(26)13(24)12(23)10(30-19)7-29-18-14(25)11(22)9(21)6-28-18/h1-5,9-16,18-19,21-26H,6-7H2,(H2,20,27)
InChI KeyYEFUVRSZAHTXCA-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentO-glycosyl compounds
Alternative Parents
Substituents
  • Disaccharide
  • O-glycosyl compound
  • Monocyclic benzene moiety
  • Oxane
  • Benzenoid
  • Secondary alcohol
  • Acetal
  • Carboximidic acid
  • Carboximidic acid derivative
  • Oxacycle
  • Polyol
  • Organoheterocyclic compound
  • Organopnictogen compound
  • Hydrocarbon derivative
  • Organonitrogen compound
  • Organic nitrogen compound
  • Alcohol
  • Aromatic heteromonocyclic compound
Molecular FrameworkAromatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
ProcessNot Available
RoleNot Available
Physical Properties
StateNot Available
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility15.1 g/LALOGPS
logP-1.6ALOGPS
logP-4.6ChemAxon
logS-1.5ALOGPS
pKa (Strongest Acidic)-2ChemAxon
pKa (Strongest Basic)11.72ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count12ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area202.38 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity110.33 m³·mol⁻¹ChemAxon
Polarizability43.22 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+199.46631661259
DarkChem[M-H]-190.52131661259
DeepCCS[M+H]+193.45730932474
DeepCCS[M-H]-191.08930932474
DeepCCS[M-2H]-225.3930932474
DeepCCS[M+Na]+200.86930932474
AllCCS[M+H]+202.432859911
AllCCS[M+H-H2O]+200.332859911
AllCCS[M+NH4]+204.432859911
AllCCS[M+Na]+204.932859911
AllCCS[M-H]-195.832859911
AllCCS[M+Na-2H]-196.332859911
AllCCS[M+HCOO]-197.132859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
LucuminamideOC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O3805.4Standard polar33892256
LucuminamideOC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O4137.3Standard non polar33892256
LucuminamideOC1COC(OCC2OC(OC(C(O)=N)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O3874.5Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Lucuminamide,1TMS,isomer #1C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O3683.5Semi standard non polar33892256
Lucuminamide,1TMS,isomer #2C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13685.4Semi standard non polar33892256
Lucuminamide,1TMS,isomer #3C[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O)C2O)C(O)C1O3689.9Semi standard non polar33892256
Lucuminamide,1TMS,isomer #4C[Si](C)(C)OC1C(O)C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C1O3646.3Semi standard non polar33892256
Lucuminamide,1TMS,isomer #5C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O3686.0Semi standard non polar33892256
Lucuminamide,1TMS,isomer #6C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)OCC(O)C1O3667.3Semi standard non polar33892256
Lucuminamide,1TMS,isomer #7C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C1O3618.1Semi standard non polar33892256
Lucuminamide,1TMS,isomer #8C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13726.7Semi standard non polar33892256
Lucuminamide,2TMS,isomer #1C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13599.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #10C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13608.7Semi standard non polar33892256
Lucuminamide,2TMS,isomer #11C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13563.4Semi standard non polar33892256
Lucuminamide,2TMS,isomer #12C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13614.8Semi standard non polar33892256
Lucuminamide,2TMS,isomer #13C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13591.1Semi standard non polar33892256
Lucuminamide,2TMS,isomer #14C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)C1O3574.2Semi standard non polar33892256
Lucuminamide,2TMS,isomer #15C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)OCC(O)C1O3621.3Semi standard non polar33892256
Lucuminamide,2TMS,isomer #16C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C)C1O3604.3Semi standard non polar33892256
Lucuminamide,2TMS,isomer #17C[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C3594.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #18C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13656.8Semi standard non polar33892256
Lucuminamide,2TMS,isomer #19C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O[Si](C)(C)C3596.2Semi standard non polar33892256
Lucuminamide,2TMS,isomer #2C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3623.9Semi standard non polar33892256
Lucuminamide,2TMS,isomer #20C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)C1O3531.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #21C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)OCC(O)C1O3574.7Semi standard non polar33892256
Lucuminamide,2TMS,isomer #22C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13613.8Semi standard non polar33892256
Lucuminamide,2TMS,isomer #23C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C)C1O3561.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #24C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O[Si](C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O3606.9Semi standard non polar33892256
Lucuminamide,2TMS,isomer #25C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13655.8Semi standard non polar33892256
Lucuminamide,2TMS,isomer #26C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C1O[Si](C)(C)C3568.4Semi standard non polar33892256
Lucuminamide,2TMS,isomer #27C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13638.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #28C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13598.1Semi standard non polar33892256
Lucuminamide,2TMS,isomer #3C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3573.2Semi standard non polar33892256
Lucuminamide,2TMS,isomer #4C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3609.7Semi standard non polar33892256
Lucuminamide,2TMS,isomer #5C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3580.7Semi standard non polar33892256
Lucuminamide,2TMS,isomer #6C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3583.2Semi standard non polar33892256
Lucuminamide,2TMS,isomer #7C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13655.4Semi standard non polar33892256
Lucuminamide,2TMS,isomer #8C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13533.5Semi standard non polar33892256
Lucuminamide,2TMS,isomer #9C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13584.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #1C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13508.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #10C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3554.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #11C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13595.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #12C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3551.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #13C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3530.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #14C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3514.4Semi standard non polar33892256
Lucuminamide,3TMS,isomer #15C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13542.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #16C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3562.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #17C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3543.4Semi standard non polar33892256
Lucuminamide,3TMS,isomer #18C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13585.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #19C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3571.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #2C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13523.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #20C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13570.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #21C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13550.5Semi standard non polar33892256
Lucuminamide,3TMS,isomer #22C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13505.5Semi standard non polar33892256
Lucuminamide,3TMS,isomer #23C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13477.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #24C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13447.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #25C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13490.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #26C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13426.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #27C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13538.5Semi standard non polar33892256
Lucuminamide,3TMS,isomer #28C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13496.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #29C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13549.4Semi standard non polar33892256
Lucuminamide,3TMS,isomer #3C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13534.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #30C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13482.5Semi standard non polar33892256
Lucuminamide,3TMS,isomer #31C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13519.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #32C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13527.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #33C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13508.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #34C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13523.1Semi standard non polar33892256
Lucuminamide,3TMS,isomer #35C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13458.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #36C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13514.1Semi standard non polar33892256
Lucuminamide,3TMS,isomer #37C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O3511.1Semi standard non polar33892256
Lucuminamide,3TMS,isomer #38C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O3525.1Semi standard non polar33892256
Lucuminamide,3TMS,isomer #39C[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3553.2Semi standard non polar33892256
Lucuminamide,3TMS,isomer #4C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13489.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #40C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13537.4Semi standard non polar33892256
Lucuminamide,3TMS,isomer #41C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OCC(O)C1O3551.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #42C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O[Si](C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C)C1O3563.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #43C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13582.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #44C[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C)C1O[Si](C)(C)C3563.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #45C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13571.8Semi standard non polar33892256
Lucuminamide,3TMS,isomer #46C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13572.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #47C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3511.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #48C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OCC(O)C1O3550.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #49C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13561.3Semi standard non polar33892256
Lucuminamide,3TMS,isomer #5C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13548.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #50C[Si](C)(C)OC1C(O)C(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C1O3514.1Semi standard non polar33892256
Lucuminamide,3TMS,isomer #51C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13491.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #52C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13535.0Semi standard non polar33892256
Lucuminamide,3TMS,isomer #53C[Si](C)(C)OC1C(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O3543.8Semi standard non polar33892256
Lucuminamide,3TMS,isomer #54C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13526.4Semi standard non polar33892256
Lucuminamide,3TMS,isomer #55C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13575.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #56C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13544.8Semi standard non polar33892256
Lucuminamide,3TMS,isomer #6C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13507.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #7C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3553.6Semi standard non polar33892256
Lucuminamide,3TMS,isomer #8C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3560.7Semi standard non polar33892256
Lucuminamide,3TMS,isomer #9C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3574.4Semi standard non polar33892256
Lucuminamide,4TMS,isomer #1C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13510.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #10C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13455.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #11C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13470.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #12C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13435.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #13C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13460.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #14C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13396.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #15C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13448.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #16C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3517.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #17C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3507.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #18C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3465.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #19C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13529.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #2C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13454.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #20C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3524.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #21C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3486.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #22C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13529.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #23C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3563.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #24C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13553.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #25C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13523.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #26C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3508.4Semi standard non polar33892256
Lucuminamide,4TMS,isomer #27C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3463.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #28C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13518.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #29C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3504.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #3C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13415.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #30C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13504.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #31C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13472.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #32C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3555.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #33C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13545.7Semi standard non polar33892256
Lucuminamide,4TMS,isomer #34C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13514.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #35C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13563.4Semi standard non polar33892256
Lucuminamide,4TMS,isomer #36C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13461.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #37C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13426.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #38C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13468.7Semi standard non polar33892256
Lucuminamide,4TMS,isomer #39C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13394.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #4C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13459.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #40C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13410.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #41C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13425.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #42C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13355.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #43C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13409.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #44C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13319.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #45C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13359.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #46C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13468.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #47C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13479.7Semi standard non polar33892256
Lucuminamide,4TMS,isomer #48C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13422.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #49C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13471.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #5C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13399.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #50C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13376.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #51C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13433.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #52C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13479.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #53C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13398.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #54C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13409.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #55C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13406.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #56C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3459.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #57C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O[Si](C)(C)C3479.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #58C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13462.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #59C[Si](C)(C)OC1C(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C)C1O3497.3Semi standard non polar33892256
Lucuminamide,4TMS,isomer #6C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13490.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #60C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13473.5Semi standard non polar33892256
Lucuminamide,4TMS,isomer #61C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13524.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #62C[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OCC(O)C1O3523.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #63C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13521.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #64C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13523.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #65C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13533.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #66C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3477.2Semi standard non polar33892256
Lucuminamide,4TMS,isomer #67C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13453.9Semi standard non polar33892256
Lucuminamide,4TMS,isomer #68C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13512.0Semi standard non polar33892256
Lucuminamide,4TMS,isomer #69C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13475.8Semi standard non polar33892256
Lucuminamide,4TMS,isomer #7C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13452.6Semi standard non polar33892256
Lucuminamide,4TMS,isomer #70C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13516.4Semi standard non polar33892256
Lucuminamide,4TMS,isomer #8C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13494.1Semi standard non polar33892256
Lucuminamide,4TMS,isomer #9C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13431.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #1C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13457.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #10C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13334.8Semi standard non polar33892256
Lucuminamide,5TMS,isomer #11C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13420.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #12C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13431.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #13C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13378.3Semi standard non polar33892256
Lucuminamide,5TMS,isomer #14C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13419.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #15C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13336.8Semi standard non polar33892256
Lucuminamide,5TMS,isomer #16C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13383.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #17C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13418.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #18C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13346.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #19C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13358.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #2C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13412.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #20C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13352.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #21C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3468.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #22C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3414.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #23C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13492.2Semi standard non polar33892256
Lucuminamide,5TMS,isomer #24C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3459.3Semi standard non polar33892256
Lucuminamide,5TMS,isomer #25C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13499.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #26C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13452.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #27C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3477.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #28C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13511.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #29C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13458.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #3C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13455.3Semi standard non polar33892256
Lucuminamide,5TMS,isomer #30C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13539.8Semi standard non polar33892256
Lucuminamide,5TMS,isomer #31C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3463.7Semi standard non polar33892256
Lucuminamide,5TMS,isomer #32C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13490.8Semi standard non polar33892256
Lucuminamide,5TMS,isomer #33C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13437.3Semi standard non polar33892256
Lucuminamide,5TMS,isomer #34C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13475.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #35C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13533.7Semi standard non polar33892256
Lucuminamide,5TMS,isomer #36C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13390.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #37C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13396.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #38C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13332.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #39C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13397.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #4C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O)C1=CC=CC=C13393.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #40C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13299.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #41C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13339.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #42C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13357.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #43C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13271.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #44C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13284.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #45C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13271.1Semi standard non polar33892256
Lucuminamide,5TMS,isomer #46C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13422.2Semi standard non polar33892256
Lucuminamide,5TMS,isomer #47C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13336.7Semi standard non polar33892256
Lucuminamide,5TMS,isomer #48C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13349.9Semi standard non polar33892256
Lucuminamide,5TMS,isomer #49C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13341.2Semi standard non polar33892256
Lucuminamide,5TMS,isomer #5C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13380.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #50C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13354.8Semi standard non polar33892256
Lucuminamide,5TMS,isomer #51C[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3429.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #52C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13427.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #53C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13463.6Semi standard non polar33892256
Lucuminamide,5TMS,isomer #54C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13469.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #55C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13495.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #56C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13449.2Semi standard non polar33892256
Lucuminamide,5TMS,isomer #6C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13388.5Semi standard non polar33892256
Lucuminamide,5TMS,isomer #7C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13327.0Semi standard non polar33892256
Lucuminamide,5TMS,isomer #8C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13385.4Semi standard non polar33892256
Lucuminamide,5TMS,isomer #9C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13291.4Semi standard non polar33892256
Lucuminamide,6TMS,isomer #1C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13370.3Semi standard non polar33892256
Lucuminamide,6TMS,isomer #10C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13279.6Semi standard non polar33892256
Lucuminamide,6TMS,isomer #11C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13362.6Semi standard non polar33892256
Lucuminamide,6TMS,isomer #12C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13312.2Semi standard non polar33892256
Lucuminamide,6TMS,isomer #13C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13320.2Semi standard non polar33892256
Lucuminamide,6TMS,isomer #14C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13312.4Semi standard non polar33892256
Lucuminamide,6TMS,isomer #15C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13299.1Semi standard non polar33892256
Lucuminamide,6TMS,isomer #16C[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3415.2Semi standard non polar33892256
Lucuminamide,6TMS,isomer #17C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13451.1Semi standard non polar33892256
Lucuminamide,6TMS,isomer #18C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13405.1Semi standard non polar33892256
Lucuminamide,6TMS,isomer #19C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13446.5Semi standard non polar33892256
Lucuminamide,6TMS,isomer #2C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13368.3Semi standard non polar33892256
Lucuminamide,6TMS,isomer #20C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13451.7Semi standard non polar33892256
Lucuminamide,6TMS,isomer #21C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13436.3Semi standard non polar33892256
Lucuminamide,6TMS,isomer #22C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13338.6Semi standard non polar33892256
Lucuminamide,6TMS,isomer #23C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13284.0Semi standard non polar33892256
Lucuminamide,6TMS,isomer #24C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13291.4Semi standard non polar33892256
Lucuminamide,6TMS,isomer #25C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13285.7Semi standard non polar33892256
Lucuminamide,6TMS,isomer #26C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13247.3Semi standard non polar33892256
Lucuminamide,6TMS,isomer #27C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13296.8Semi standard non polar33892256
Lucuminamide,6TMS,isomer #28C[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13413.4Semi standard non polar33892256
Lucuminamide,6TMS,isomer #3C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1=CC=CC=C13325.7Semi standard non polar33892256
Lucuminamide,6TMS,isomer #4C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13369.0Semi standard non polar33892256
Lucuminamide,6TMS,isomer #5C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13298.5Semi standard non polar33892256
Lucuminamide,6TMS,isomer #6C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13326.3Semi standard non polar33892256
Lucuminamide,6TMS,isomer #7C[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1=CC=CC=C13336.7Semi standard non polar33892256
Lucuminamide,6TMS,isomer #8C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1=CC=CC=C13276.0Semi standard non polar33892256
Lucuminamide,6TMS,isomer #9C[Si](C)(C)N=C(O[Si](C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1=CC=CC=C13276.7Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O3930.8Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13926.4Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O)C2O)C(O)C1O3942.7Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1C(O)C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C1O3915.0Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O3936.1Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)OCC(O)C1O3908.8Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C1O3880.6Semi standard non polar33892256
Lucuminamide,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C13955.0Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C14046.6Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14048.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14023.7Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14060.2Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C14016.7Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C1O4015.5Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)OCC(O)C1O4054.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C(C)(C)C)C1O4049.4Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4053.0Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14090.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O[Si](C)(C)C(C)(C)C4047.1Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4061.6Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4007.5Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)OCC(O)C1O4014.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14054.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O3999.1Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O4040.1Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14081.2Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C4012.1Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14051.5Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C14015.5Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4025.9Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4046.0Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4015.5Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4016.3Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C14081.2Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C13990.6Semi standard non polar33892256
Lucuminamide,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14019.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C14086.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4120.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14179.9Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4137.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4135.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4124.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14148.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4135.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4111.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14167.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4152.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14105.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14148.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C14129.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14079.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14071.0Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14088.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14075.8Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O)C1=CC=CC=C14010.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14105.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14088.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14118.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14128.9Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14050.9Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14111.4Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14109.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14066.9Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14118.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14049.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14081.4Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4113.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4105.0Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC1C(OC(C(=N)O)C2=CC=CC=C2)OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4121.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14112.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14119.4Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)OCC(O)C1O4121.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C(C)(C)C)C1O4120.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14163.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O)C2O)OC(OC(C(=N)O)C2=CC=CC=C2)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4148.9Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14151.2Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14170.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC1C(O)COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C1O4114.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC1C(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OCC(O)C1O4118.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14159.6Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC(=N)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1=CC=CC=C14139.0Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC1C(O)C(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C1O4120.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14098.4Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1=CC=CC=C14132.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC1C(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(OC(C(=N)O)C2=CC=CC=C2)C(O)C1O4113.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14107.5Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1=CC=CC=C14149.8Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)N=C(O)C(OC1OC(COC2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1=CC=CC=C14118.7Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)C(OC1OC(COC2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O)C1=CC=CC=C14065.0Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4139.3Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4137.1Semi standard non polar33892256
Lucuminamide,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC1COC(OCC2OC(OC(C(=N)O)C3=CC=CC=C3)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4147.4Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Lucuminamide GC-MS (Non-derivatized) - 70eV, Positivesplash10-00gl-4592700000-c6f1364507156ee23dbb2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Lucuminamide GC-MS (3 TMS) - 70eV, Positivesplash10-0002-5543279000-1f88e107f025b03f318d2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Lucuminamide GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Lucuminamide GC-MS (TBDMS_3_36) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Lucuminamide GC-MS ("Lucuminamide,3TBDMS,#36" TMS) - 70eV, PositiveNot Available2021-10-14Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 10V, Positive-QTOFsplash10-0ugj-0910600000-b9966c9e632bd60abc182016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 20V, Positive-QTOFsplash10-0uei-0910000000-9d8ec01e4a57720ea7b02016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 40V, Positive-QTOFsplash10-0zgi-1900000000-12376a7301182031706e2016-06-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 10V, Negative-QTOFsplash10-0f6x-1922700000-841d8097b02926a8b3552016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 20V, Negative-QTOFsplash10-0f89-1900100000-8af9ad284c6eaefab3842016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 40V, Negative-QTOFsplash10-0f7o-8900000000-1042a02ecffe1fc24c172016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 10V, Negative-QTOFsplash10-0f6x-1117900000-f0a937ab0c466baffa9f2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 20V, Negative-QTOFsplash10-052f-9117100000-5cff53401f57e86598cf2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 40V, Negative-QTOFsplash10-0006-9400000000-8115f5397f7d4aaf47fd2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 10V, Positive-QTOFsplash10-000t-0922800000-d3429cff699b5afd3ce62021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 20V, Positive-QTOFsplash10-0006-9500000000-97038a08dfdc825471252021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Lucuminamide 40V, Positive-QTOFsplash10-0297-3900000000-79b8a87417f82f7370f52021-09-22Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
  • Extracellular
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB008360
KNApSAcK IDNot Available
Chemspider IDNot Available
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound77634301
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .