Showing metabocard for AzI (HMDB0031775)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-11 17:45:23 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:53:06 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0031775 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | AzI | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | AzI belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. Based on a literature review a small amount of articles have been published on AzI. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0031775 (AzI)Mrv0541 05061306072D 66 73 0 0 0 0 999 V2000 -4.0931 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0931 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3784 -0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3784 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 -0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 2.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 2.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6062 2.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6062 3.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 3.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 3.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3102 4.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4840 4.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3206 1.9710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6131 1.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6131 0.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4393 1.5615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 0.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 1.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 1.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8077 -0.4975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9654 -1.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7915 -1.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1391 -1.2145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0351 2.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0353 3.2084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7498 3.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4642 3.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 2.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7496 1.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7499 4.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1787 3.6206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1785 1.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5218 0.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2361 1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9507 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9510 -0.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2366 -0.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5220 -0.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2359 1.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5213 2.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2369 -1.3221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6656 -0.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6651 1.1534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9515 -1.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6658 -1.3216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3804 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3807 -2.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6663 -2.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9517 -2.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0948 -1.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0945 -0.4962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2374 -2.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6666 -3.7966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0953 -2.9712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 32 1 0 0 0 0 3 4 1 0 0 0 0 3 33 1 0 0 0 0 3 34 1 0 0 0 0 4 5 1 0 0 0 0 4 7 1 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 31 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 30 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 29 1 0 0 0 0 12 13 2 0 0 0 0 12 18 1 0 0 0 0 13 14 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 17 26 1 0 0 0 0 18 22 1 0 0 0 0 19 20 1 0 0 0 0 19 25 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 1 0 0 0 0 21 24 1 0 0 0 0 25 36 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 32 50 1 0 0 0 0 33 35 1 0 0 0 0 36 37 1 0 0 0 0 36 41 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 38 42 1 0 0 0 0 39 40 1 0 0 0 0 39 43 1 0 0 0 0 40 41 1 0 0 0 0 40 44 2 0 0 0 0 45 46 1 0 0 0 0 45 50 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 47 55 1 0 0 0 0 48 49 1 0 0 0 0 48 54 1 0 0 0 0 49 50 1 0 0 0 0 49 53 1 0 0 0 0 51 52 1 0 0 0 0 53 56 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 62 1 0 0 0 0 59 60 1 0 0 0 0 59 66 1 0 0 0 0 60 61 1 0 0 0 0 60 65 1 0 0 0 0 61 64 1 0 0 0 0 62 63 1 0 0 0 0 M END 3D MOL for HMDB0031775 (AzI)HMDB0031775 RDKit 3D AzI 140147 0 0 0 0 0 0 0 0999 V2000 11.9304 -1.0026 -2.9779 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2137 -1.6728 -1.8466 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9229 -2.2635 -0.8866 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3163 -2.2573 -0.9295 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1906 -2.9052 0.1917 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7568 -3.8884 0.7582 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8589 -2.4205 0.5887 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1833 -1.6502 -0.4728 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8174 -1.8949 -0.6419 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0245 -0.8002 -0.4595 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5471 -0.2362 -1.8220 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1198 1.2015 -1.6403 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2001 2.2043 -1.8913 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9740 1.3910 -2.6530 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4577 1.4109 -0.2629 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8718 0.0764 0.0918 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6736 0.0513 0.8957 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1567 1.0407 1.6053 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8676 0.7178 2.3365 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0232 0.1721 1.2035 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4067 0.5696 1.1548 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3221 2.0801 1.4872 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3172 -0.0049 2.1524 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7198 -0.3099 1.6391 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1362 0.7826 0.6651 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4610 0.5987 0.3287 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3335 1.4029 0.9609 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9716 2.4249 0.3266 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2436 3.3946 1.2867 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2673 4.3552 0.6572 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4221 3.6674 0.3140 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6718 2.9715 2.6251 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0029 3.7310 3.5864 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6169 1.4980 2.9664 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6782 1.0978 3.7653 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4761 0.6697 1.7017 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5977 0.6277 0.9642 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0296 -0.5296 0.3626 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0697 -0.2081 -1.0236 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4789 -1.2674 -1.7990 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2586 -0.9595 -3.2402 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9237 0.1653 -3.7017 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9070 -1.6692 -1.5047 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1415 -2.9006 -2.1075 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1184 -1.7986 -0.0110 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5013 -1.7791 0.2126 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4616 -0.7184 0.7927 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1781 0.4857 0.6961 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2929 0.7768 -0.5470 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8381 -0.3759 -1.4450 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5087 1.9716 -1.4535 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8697 1.9160 -1.8398 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8368 0.4556 -0.2945 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2943 -0.7053 -1.0413 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1195 -1.1357 -0.7685 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4811 -1.1238 0.7115 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7841 -2.3628 1.2388 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9397 -1.2797 0.9802 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2531 -1.7901 2.3706 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6917 -2.1954 0.0506 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1598 -2.2775 0.3282 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8685 -0.9609 0.5037 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4386 -0.7413 1.8522 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2105 0.2520 2.5805 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2953 -1.6993 2.3672 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8545 -1.7247 -1.7237 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0215 -1.7652 -3.7842 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3346 -0.1645 -3.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9476 -0.7560 -2.6730 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8172 -1.4381 -0.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9197 -1.8227 1.5466 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2540 -3.3528 0.8125 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2311 -0.5492 -0.2013 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6677 0.0414 -0.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4793 -0.2212 -2.4428 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8544 -0.8821 -2.3371 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1881 1.7241 -1.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1034 2.5195 -2.9670 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1083 3.1232 -1.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1435 0.7516 -3.5470 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9894 1.1890 -2.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9261 2.4430 -3.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2403 1.7711 0.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6410 2.1476 -0.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5204 -0.3262 -0.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6258 1.9817 1.6453 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9844 0.0841 3.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4679 1.6906 2.7395 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3797 0.8826 0.3247 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4680 2.2877 2.5422 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6727 2.5086 1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0246 2.6835 0.8977 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9674 -0.9198 2.6554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4990 0.6852 3.0352 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3904 -0.3493 2.5050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7303 -1.2873 1.1401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9878 1.7003 1.2684 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7160 1.9124 1.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3005 4.0205 1.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8249 4.9387 -0.1694 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5377 5.0723 1.4596 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1820 4.2868 0.1760 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7625 3.2647 2.7591 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5538 3.7114 4.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7020 1.3378 3.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1741 1.9058 4.0979 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0675 -0.3213 1.8523 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4786 -1.4347 0.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8336 -2.1286 -1.5383 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5036 -1.8255 -3.9010 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1711 -0.7846 -3.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4579 0.6234 -4.4505 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6385 -0.9470 -1.8920 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1424 -3.0448 -2.1474 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7438 -2.7924 0.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9922 -1.7651 -0.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4685 -1.0801 1.8554 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6648 0.4120 -0.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9312 -0.1411 -1.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8868 -1.3233 -0.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3735 -0.3703 -2.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9513 1.8204 -2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3843 2.9407 -0.9988 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1944 2.8052 -2.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3138 1.3511 -0.7853 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9127 -1.6125 -0.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4230 -0.5460 -2.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7795 -0.4920 -1.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2335 -2.1594 -1.1709 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6975 -2.4712 2.3027 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2493 -2.4693 0.8374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3103 -3.2208 0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9093 -2.7111 2.2743 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4208 -2.1819 2.9459 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9106 -1.1064 2.9654 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2970 -3.2285 0.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5315 -2.0661 -1.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6251 -2.7482 -0.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4669 -2.9749 1.1285 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0544 -1.4872 3.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 25 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 49 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 8 66 1 0 66 2 1 0 62 10 1 0 62 16 1 0 58 17 1 0 56 20 1 0 53 21 1 0 36 27 1 0 47 38 1 0 1 67 1 0 1 68 1 0 1 69 1 0 4 70 1 0 7 71 1 0 7 72 1 0 8 73 1 0 10 74 1 0 11 75 1 0 11 76 1 0 13 77 1 0 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 14 82 1 0 15 83 1 0 15 84 1 0 16 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 20 89 1 0 22 90 1 0 22 91 1 0 22 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 25 97 1 0 27 98 1 0 29 99 1 0 30100 1 0 30101 1 0 31102 1 0 32103 1 0 33104 1 0 34105 1 0 35106 1 0 36107 1 0 38108 1 0 40109 1 0 41110 1 0 41111 1 0 42112 1 0 43113 1 0 44114 1 0 45115 1 0 46116 1 0 47117 1 0 48118 1 0 50119 1 0 50120 1 0 50121 1 0 51122 1 0 51123 1 0 52124 1 0 53125 1 0 54126 1 0 54127 1 0 55128 1 0 55129 1 0 57130 1 0 57131 1 0 57132 1 0 59133 1 0 59134 1 0 59135 1 0 60136 1 0 60137 1 0 61138 1 0 61139 1 0 65140 1 0 M END 3D SDF for HMDB0031775 (AzI)Mrv0541 05061306072D 66 73 0 0 0 0 999 V2000 -4.0931 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0931 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3784 -0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3784 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 -0.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 -0.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 2.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9503 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 1.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 2.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6062 2.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6062 3.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8970 3.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 3.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3102 4.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4840 4.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3206 1.9710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6131 1.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6131 0.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4393 1.5615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5252 0.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2371 1.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6650 1.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8077 -0.4975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9654 -1.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7915 -1.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1391 -1.2145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0351 2.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0353 3.2084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7498 3.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4642 3.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 2.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7496 1.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7499 4.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1787 3.6206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1785 1.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5218 0.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2361 1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9507 0.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9510 -0.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2366 -0.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5220 -0.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2359 1.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5213 2.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2369 -1.3221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6656 -0.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6651 1.1534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9515 -1.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6658 -1.3216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3804 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3807 -2.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6663 -2.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9517 -2.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0948 -1.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0945 -0.4962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2374 -2.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6666 -3.7966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0953 -2.9712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 32 1 0 0 0 0 3 4 1 0 0 0 0 3 33 1 0 0 0 0 3 34 1 0 0 0 0 4 5 1 0 0 0 0 4 7 1 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 31 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 30 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 29 1 0 0 0 0 12 13 2 0 0 0 0 12 18 1 0 0 0 0 13 14 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 17 26 1 0 0 0 0 18 22 1 0 0 0 0 19 20 1 0 0 0 0 19 25 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 21 23 1 0 0 0 0 21 24 1 0 0 0 0 25 36 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 32 50 1 0 0 0 0 33 35 1 0 0 0 0 36 37 1 0 0 0 0 36 41 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 38 42 1 0 0 0 0 39 40 1 0 0 0 0 39 43 1 0 0 0 0 40 41 1 0 0 0 0 40 44 2 0 0 0 0 45 46 1 0 0 0 0 45 50 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 47 55 1 0 0 0 0 48 49 1 0 0 0 0 48 54 1 0 0 0 0 49 50 1 0 0 0 0 49 53 1 0 0 0 0 51 52 1 0 0 0 0 53 56 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 62 1 0 0 0 0 59 60 1 0 0 0 0 59 66 1 0 0 0 0 60 61 1 0 0 0 0 60 65 1 0 0 0 0 61 64 1 0 0 0 0 62 63 1 0 0 0 0 M END > <DATABASE_ID> HMDB0031775 > <DATABASE_NAME> hmdb > <SMILES> CC1=C(O)C(=O)CC(OC2CC(C)(C)CC3C4=CCC5C6(C)CCC(OC7OC(CO)C(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C(C)(CO)C6CCC5(C)C4(C)CCC23C(O)=O)O1 > <INCHI_IDENTIFIER> InChI=1S/C48H74O18/c1-22-33(53)25(52)16-32(61-22)64-31-18-43(2,3)17-24-23-8-9-29-44(4)12-11-30(45(5,21-51)28(44)10-13-47(29,7)46(23,6)14-15-48(24,31)42(59)60)65-41-39(37(57)35(55)27(20-50)63-41)66-40-38(58)36(56)34(54)26(19-49)62-40/h8,24,26-32,34-41,49-51,53-58H,9-21H2,1-7H3,(H,59,60) > <INCHI_KEY> XLEIKFRILRTCIS-UHFFFAOYSA-N > <FORMULA> C48H74O18 > <MOLECULAR_WEIGHT> 939.0904 > <EXACT_MASS> 938.487515564 > <JCHEM_ACCEPTOR_COUNT> 18 > <JCHEM_AVERAGE_POLARIZABILITY> 100.70465272999174 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 10-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4-[(5-hydroxy-6-methyl-4-oxo-3,4-dihydro-2H-pyran-2-yl)oxy]-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid > <ALOGPS_LOGP> 1.84 > <JCHEM_LOGP> 1.2160707369999981 > <ALOGPS_LOGS> -3.73 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 7.962373840654227 > <JCHEM_PKA_STRONGEST_ACIDIC> 4.390302847877288 > <JCHEM_PKA_STRONGEST_BASIC> -2.981083769434366 > <JCHEM_POLAR_SURFACE_AREA> 291.81999999999994 > <JCHEM_REFRACTIVITY> 232.75930000000008 > <JCHEM_ROTATABLE_BOND_COUNT> 10 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.75e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 10-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4-[(5-hydroxy-6-methyl-4-oxo-2,3-dihydropyran-2-yl)oxy]-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-4a-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0031775 (AzI)HMDB0031775 RDKit 3D AzI 140147 0 0 0 0 0 0 0 0999 V2000 11.9304 -1.0026 -2.9779 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2137 -1.6728 -1.8466 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9229 -2.2635 -0.8866 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3163 -2.2573 -0.9295 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1906 -2.9052 0.1917 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7568 -3.8884 0.7582 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8589 -2.4205 0.5887 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1833 -1.6502 -0.4728 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8174 -1.8949 -0.6419 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0245 -0.8002 -0.4595 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5471 -0.2362 -1.8220 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1198 1.2015 -1.6403 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2001 2.2043 -1.8913 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9740 1.3910 -2.6530 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4577 1.4109 -0.2629 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8718 0.0764 0.0918 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6736 0.0513 0.8957 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1567 1.0407 1.6053 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8676 0.7178 2.3365 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0232 0.1721 1.2035 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4067 0.5696 1.1548 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3221 2.0801 1.4872 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3172 -0.0049 2.1524 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7198 -0.3099 1.6391 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1362 0.7826 0.6651 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4610 0.5987 0.3287 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3335 1.4029 0.9609 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9716 2.4249 0.3266 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2436 3.3946 1.2867 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2673 4.3552 0.6572 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4221 3.6674 0.3140 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6718 2.9715 2.6251 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0029 3.7310 3.5864 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6169 1.4980 2.9664 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6782 1.0978 3.7653 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4761 0.6697 1.7017 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5977 0.6277 0.9642 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0296 -0.5296 0.3626 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0697 -0.2081 -1.0236 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4789 -1.2674 -1.7990 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2586 -0.9595 -3.2402 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9237 0.1653 -3.7017 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9070 -1.6692 -1.5047 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1415 -2.9006 -2.1075 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1184 -1.7986 -0.0110 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5013 -1.7791 0.2126 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4616 -0.7184 0.7927 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1781 0.4857 0.6961 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2929 0.7768 -0.5470 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8381 -0.3759 -1.4450 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5087 1.9716 -1.4535 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8697 1.9160 -1.8398 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8368 0.4556 -0.2945 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2943 -0.7053 -1.0413 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1195 -1.1357 -0.7685 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4811 -1.1238 0.7115 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7841 -2.3628 1.2388 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9397 -1.2797 0.9802 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2531 -1.7901 2.3706 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6917 -2.1954 0.0506 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1598 -2.2775 0.3282 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8685 -0.9609 0.5037 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4386 -0.7413 1.8522 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2105 0.2520 2.5805 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2953 -1.6993 2.3672 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8545 -1.7247 -1.7237 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0215 -1.7652 -3.7842 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3346 -0.1645 -3.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9476 -0.7560 -2.6730 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8172 -1.4381 -0.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9197 -1.8227 1.5466 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2540 -3.3528 0.8125 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2311 -0.5492 -0.2013 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6677 0.0414 -0.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4793 -0.2212 -2.4428 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8544 -0.8821 -2.3371 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1881 1.7241 -1.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1034 2.5195 -2.9670 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1083 3.1232 -1.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1435 0.7516 -3.5470 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9894 1.1890 -2.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9261 2.4430 -3.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2403 1.7711 0.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6410 2.1476 -0.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5204 -0.3262 -0.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6258 1.9817 1.6453 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9844 0.0841 3.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4679 1.6906 2.7395 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3797 0.8826 0.3247 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4680 2.2877 2.5422 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6727 2.5086 1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0246 2.6835 0.8977 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9674 -0.9198 2.6554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4990 0.6852 3.0352 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3904 -0.3493 2.5050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7303 -1.2873 1.1401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9878 1.7003 1.2684 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7160 1.9124 1.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3005 4.0205 1.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8249 4.9387 -0.1694 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5377 5.0723 1.4596 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1820 4.2868 0.1760 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7625 3.2647 2.7591 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5538 3.7114 4.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7020 1.3378 3.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1741 1.9058 4.0979 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0675 -0.3213 1.8523 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4786 -1.4347 0.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8336 -2.1286 -1.5383 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5036 -1.8255 -3.9010 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1711 -0.7846 -3.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4579 0.6234 -4.4505 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6385 -0.9470 -1.8920 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1424 -3.0448 -2.1474 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7438 -2.7924 0.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9922 -1.7651 -0.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4685 -1.0801 1.8554 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6648 0.4120 -0.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9312 -0.1411 -1.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8868 -1.3233 -0.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3735 -0.3703 -2.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9513 1.8204 -2.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3843 2.9407 -0.9988 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1944 2.8052 -2.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3138 1.3511 -0.7853 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9127 -1.6125 -0.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4230 -0.5460 -2.1660 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7795 -0.4920 -1.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2335 -2.1594 -1.1709 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6975 -2.4712 2.3027 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2493 -2.4693 0.8374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3103 -3.2208 0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9093 -2.7111 2.2743 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4208 -2.1819 2.9459 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9106 -1.1064 2.9654 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2970 -3.2285 0.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5315 -2.0661 -1.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6251 -2.7482 -0.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4669 -2.9749 1.1285 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0544 -1.4872 3.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 25 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 49 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 8 66 1 0 66 2 1 0 62 10 1 0 62 16 1 0 58 17 1 0 56 20 1 0 53 21 1 0 36 27 1 0 47 38 1 0 1 67 1 0 1 68 1 0 1 69 1 0 4 70 1 0 7 71 1 0 7 72 1 0 8 73 1 0 10 74 1 0 11 75 1 0 11 76 1 0 13 77 1 0 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 14 82 1 0 15 83 1 0 15 84 1 0 16 85 1 0 18 86 1 0 19 87 1 0 19 88 1 0 20 89 1 0 22 90 1 0 22 91 1 0 22 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 25 97 1 0 27 98 1 0 29 99 1 0 30100 1 0 30101 1 0 31102 1 0 32103 1 0 33104 1 0 34105 1 0 35106 1 0 36107 1 0 38108 1 0 40109 1 0 41110 1 0 41111 1 0 42112 1 0 43113 1 0 44114 1 0 45115 1 0 46116 1 0 47117 1 0 48118 1 0 50119 1 0 50120 1 0 50121 1 0 51122 1 0 51123 1 0 52124 1 0 53125 1 0 54126 1 0 54127 1 0 55128 1 0 55129 1 0 57130 1 0 57131 1 0 57132 1 0 59133 1 0 59134 1 0 59135 1 0 60136 1 0 60137 1 0 61138 1 0 61139 1 0 65140 1 0 M END PDB for HMDB0031775 (AzI)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 -7.640 1.383 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -7.640 -0.159 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -6.306 -0.930 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -4.975 -0.159 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -4.975 1.383 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -6.306 2.151 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -3.641 -0.930 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -2.309 -0.159 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -2.309 1.383 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -3.641 2.151 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -0.980 2.151 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -0.980 3.686 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -2.309 4.452 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -3.641 3.686 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 0.348 1.385 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 1.674 2.151 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 1.674 3.686 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 0.348 4.449 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 2.998 4.449 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 2.998 5.979 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 1.674 6.740 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 0.348 5.979 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 2.446 8.076 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 0.903 8.076 0.000 0.00 0.00 C+0 HETATM 25 O UNK 0 4.332 3.679 0.000 0.00 0.00 O+0 HETATM 26 C UNK 0 3.011 2.915 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 3.011 1.372 0.000 0.00 0.00 O+0 HETATM 28 O UNK 0 4.553 2.915 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 -0.980 0.609 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -2.309 2.925 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -4.975 2.925 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 -8.974 -0.929 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 -5.535 -2.267 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -7.077 -2.267 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -3.993 -2.267 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 5.666 4.449 0.000 0.00 0.00 C+0 HETATM 37 O UNK 0 5.666 5.989 0.000 0.00 0.00 O+0 HETATM 38 C UNK 0 7.000 6.759 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 8.333 5.989 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 8.333 4.449 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 6.999 3.679 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 7.000 8.299 0.000 0.00 0.00 C+0 HETATM 43 O UNK 0 9.667 6.758 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 9.667 3.678 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 -10.307 1.382 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -11.641 2.152 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -12.975 1.383 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -12.975 -0.157 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -11.642 -0.928 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -10.308 -0.158 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -11.640 3.692 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 -10.306 4.462 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -11.642 -2.468 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -14.309 -0.927 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -14.308 2.153 0.000 0.00 0.00 O+0 HETATM 56 C UNK 0 -12.976 -3.237 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 -14.309 -2.467 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 -15.643 -3.237 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -15.644 -4.777 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -14.310 -5.547 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -12.977 -4.777 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -16.977 -2.466 0.000 0.00 0.00 C+0 HETATM 63 O UNK 0 -16.976 -0.926 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -11.643 -5.548 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 -14.311 -7.087 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 -16.978 -5.546 0.000 0.00 0.00 O+0 CONECT 1 2 6 CONECT 2 1 3 32 CONECT 3 2 4 33 34 CONECT 4 3 5 7 CONECT 5 4 6 10 31 CONECT 6 1 5 CONECT 7 4 8 CONECT 8 7 9 CONECT 9 8 10 11 30 CONECT 10 5 9 14 CONECT 11 9 12 15 29 CONECT 12 11 13 18 CONECT 13 12 14 CONECT 14 10 13 CONECT 15 11 16 CONECT 16 15 17 CONECT 17 16 18 19 26 CONECT 18 12 17 22 CONECT 19 17 20 25 CONECT 20 19 21 CONECT 21 20 22 23 24 CONECT 22 18 21 CONECT 23 21 CONECT 24 21 CONECT 25 19 36 CONECT 26 17 27 28 CONECT 27 26 CONECT 28 26 CONECT 29 11 CONECT 30 9 CONECT 31 5 CONECT 32 2 50 CONECT 33 3 35 CONECT 34 3 CONECT 35 33 CONECT 36 25 37 41 CONECT 37 36 38 CONECT 38 37 39 42 CONECT 39 38 40 43 CONECT 40 39 41 44 CONECT 41 36 40 CONECT 42 38 CONECT 43 39 CONECT 44 40 CONECT 45 46 50 CONECT 46 45 47 51 CONECT 47 46 48 55 CONECT 48 47 49 54 CONECT 49 48 50 53 CONECT 50 32 45 49 CONECT 51 46 52 CONECT 52 51 CONECT 53 49 56 CONECT 54 48 CONECT 55 47 CONECT 56 53 57 61 CONECT 57 56 58 CONECT 58 57 59 62 CONECT 59 58 60 66 CONECT 60 59 61 65 CONECT 61 56 60 64 CONECT 62 58 63 CONECT 63 62 CONECT 64 61 CONECT 65 60 CONECT 66 59 MASTER 0 0 0 0 0 0 0 0 66 0 146 0 END 3D PDB for HMDB0031775 (AzI)COMPND HMDB0031775 HETATM 1 C1 UNL 1 11.930 -1.003 -2.978 1.00 0.00 C HETATM 2 C2 UNL 1 11.214 -1.673 -1.847 1.00 0.00 C HETATM 3 C3 UNL 1 11.923 -2.263 -0.887 1.00 0.00 C HETATM 4 O1 UNL 1 13.316 -2.257 -0.930 1.00 0.00 O HETATM 5 C4 UNL 1 11.191 -2.905 0.192 1.00 0.00 C HETATM 6 O2 UNL 1 11.757 -3.888 0.758 1.00 0.00 O HETATM 7 C5 UNL 1 9.859 -2.420 0.589 1.00 0.00 C HETATM 8 C6 UNL 1 9.183 -1.650 -0.473 1.00 0.00 C HETATM 9 O3 UNL 1 7.817 -1.895 -0.642 1.00 0.00 O HETATM 10 C7 UNL 1 7.025 -0.800 -0.459 1.00 0.00 C HETATM 11 C8 UNL 1 6.547 -0.236 -1.822 1.00 0.00 C HETATM 12 C9 UNL 1 6.120 1.201 -1.640 1.00 0.00 C HETATM 13 C10 UNL 1 7.200 2.204 -1.891 1.00 0.00 C HETATM 14 C11 UNL 1 4.974 1.391 -2.653 1.00 0.00 C HETATM 15 C12 UNL 1 5.458 1.411 -0.263 1.00 0.00 C HETATM 16 C13 UNL 1 4.872 0.076 0.092 1.00 0.00 C HETATM 17 C14 UNL 1 3.674 0.051 0.896 1.00 0.00 C HETATM 18 C15 UNL 1 3.157 1.041 1.605 1.00 0.00 C HETATM 19 C16 UNL 1 1.868 0.718 2.337 1.00 0.00 C HETATM 20 C17 UNL 1 1.023 0.172 1.204 1.00 0.00 C HETATM 21 C18 UNL 1 -0.407 0.570 1.155 1.00 0.00 C HETATM 22 C19 UNL 1 -0.322 2.080 1.487 1.00 0.00 C HETATM 23 C20 UNL 1 -1.317 -0.005 2.152 1.00 0.00 C HETATM 24 C21 UNL 1 -2.720 -0.310 1.639 1.00 0.00 C HETATM 25 C22 UNL 1 -3.136 0.783 0.665 1.00 0.00 C HETATM 26 O4 UNL 1 -4.461 0.599 0.329 1.00 0.00 O HETATM 27 C23 UNL 1 -5.333 1.403 0.961 1.00 0.00 C HETATM 28 O5 UNL 1 -5.972 2.425 0.327 1.00 0.00 O HETATM 29 C24 UNL 1 -6.244 3.395 1.287 1.00 0.00 C HETATM 30 C25 UNL 1 -7.267 4.355 0.657 1.00 0.00 C HETATM 31 O6 UNL 1 -8.422 3.667 0.314 1.00 0.00 O HETATM 32 C26 UNL 1 -6.672 2.971 2.625 1.00 0.00 C HETATM 33 O7 UNL 1 -6.003 3.731 3.586 1.00 0.00 O HETATM 34 C27 UNL 1 -6.617 1.498 2.966 1.00 0.00 C HETATM 35 O8 UNL 1 -7.678 1.098 3.765 1.00 0.00 O HETATM 36 C28 UNL 1 -6.476 0.670 1.702 1.00 0.00 C HETATM 37 O9 UNL 1 -7.598 0.628 0.964 1.00 0.00 O HETATM 38 C29 UNL 1 -8.030 -0.530 0.363 1.00 0.00 C HETATM 39 O10 UNL 1 -8.070 -0.208 -1.024 1.00 0.00 O HETATM 40 C30 UNL 1 -8.479 -1.267 -1.799 1.00 0.00 C HETATM 41 C31 UNL 1 -8.259 -0.959 -3.240 1.00 0.00 C HETATM 42 O11 UNL 1 -8.924 0.165 -3.702 1.00 0.00 O HETATM 43 C32 UNL 1 -9.907 -1.669 -1.505 1.00 0.00 C HETATM 44 O12 UNL 1 -10.142 -2.901 -2.108 1.00 0.00 O HETATM 45 C33 UNL 1 -10.118 -1.799 -0.011 1.00 0.00 C HETATM 46 O13 UNL 1 -11.501 -1.779 0.213 1.00 0.00 O HETATM 47 C34 UNL 1 -9.462 -0.718 0.793 1.00 0.00 C HETATM 48 O14 UNL 1 -10.178 0.486 0.696 1.00 0.00 O HETATM 49 C35 UNL 1 -2.293 0.777 -0.547 1.00 0.00 C HETATM 50 C36 UNL 1 -2.838 -0.376 -1.445 1.00 0.00 C HETATM 51 C37 UNL 1 -2.509 1.972 -1.454 1.00 0.00 C HETATM 52 O15 UNL 1 -3.870 1.916 -1.840 1.00 0.00 O HETATM 53 C38 UNL 1 -0.837 0.456 -0.295 1.00 0.00 C HETATM 54 C39 UNL 1 -0.294 -0.705 -1.041 1.00 0.00 C HETATM 55 C40 UNL 1 1.119 -1.136 -0.769 1.00 0.00 C HETATM 56 C41 UNL 1 1.481 -1.124 0.712 1.00 0.00 C HETATM 57 C42 UNL 1 0.784 -2.363 1.239 1.00 0.00 C HETATM 58 C43 UNL 1 2.940 -1.280 0.980 1.00 0.00 C HETATM 59 C44 UNL 1 3.253 -1.790 2.371 1.00 0.00 C HETATM 60 C45 UNL 1 3.692 -2.195 0.051 1.00 0.00 C HETATM 61 C46 UNL 1 5.160 -2.278 0.328 1.00 0.00 C HETATM 62 C47 UNL 1 5.869 -0.961 0.504 1.00 0.00 C HETATM 63 C48 UNL 1 6.439 -0.741 1.852 1.00 0.00 C HETATM 64 O16 UNL 1 6.211 0.252 2.580 1.00 0.00 O HETATM 65 O17 UNL 1 7.295 -1.699 2.367 1.00 0.00 O HETATM 66 O18 UNL 1 9.854 -1.725 -1.724 1.00 0.00 O HETATM 67 H1 UNL 1 12.022 -1.765 -3.784 1.00 0.00 H HETATM 68 H2 UNL 1 11.335 -0.165 -3.388 1.00 0.00 H HETATM 69 H3 UNL 1 12.948 -0.756 -2.673 1.00 0.00 H HETATM 70 H4 UNL 1 13.817 -1.438 -0.600 1.00 0.00 H HETATM 71 H5 UNL 1 9.920 -1.823 1.547 1.00 0.00 H HETATM 72 H6 UNL 1 9.254 -3.353 0.813 1.00 0.00 H HETATM 73 H7 UNL 1 9.231 -0.549 -0.201 1.00 0.00 H HETATM 74 H8 UNL 1 7.668 0.041 -0.112 1.00 0.00 H HETATM 75 H9 UNL 1 7.479 -0.221 -2.443 1.00 0.00 H HETATM 76 H10 UNL 1 5.854 -0.882 -2.337 1.00 0.00 H HETATM 77 H11 UNL 1 8.188 1.724 -1.789 1.00 0.00 H HETATM 78 H12 UNL 1 7.103 2.520 -2.967 1.00 0.00 H HETATM 79 H13 UNL 1 7.108 3.123 -1.274 1.00 0.00 H HETATM 80 H14 UNL 1 5.143 0.752 -3.547 1.00 0.00 H HETATM 81 H15 UNL 1 3.989 1.189 -2.193 1.00 0.00 H HETATM 82 H16 UNL 1 4.926 2.443 -3.002 1.00 0.00 H HETATM 83 H17 UNL 1 6.240 1.771 0.401 1.00 0.00 H HETATM 84 H18 UNL 1 4.641 2.148 -0.343 1.00 0.00 H HETATM 85 H19 UNL 1 4.520 -0.326 -0.944 1.00 0.00 H HETATM 86 H20 UNL 1 3.626 1.982 1.645 1.00 0.00 H HETATM 87 H21 UNL 1 1.984 0.084 3.194 1.00 0.00 H HETATM 88 H22 UNL 1 1.468 1.691 2.740 1.00 0.00 H HETATM 89 H23 UNL 1 1.380 0.883 0.325 1.00 0.00 H HETATM 90 H24 UNL 1 -0.468 2.288 2.542 1.00 0.00 H HETATM 91 H25 UNL 1 0.673 2.509 1.188 1.00 0.00 H HETATM 92 H26 UNL 1 -1.025 2.684 0.898 1.00 0.00 H HETATM 93 H27 UNL 1 -0.967 -0.920 2.655 1.00 0.00 H HETATM 94 H28 UNL 1 -1.499 0.685 3.035 1.00 0.00 H HETATM 95 H29 UNL 1 -3.390 -0.349 2.505 1.00 0.00 H HETATM 96 H30 UNL 1 -2.730 -1.287 1.140 1.00 0.00 H HETATM 97 H31 UNL 1 -2.988 1.700 1.268 1.00 0.00 H HETATM 98 H32 UNL 1 -4.716 1.912 1.766 1.00 0.00 H HETATM 99 H33 UNL 1 -5.301 4.020 1.346 1.00 0.00 H HETATM 100 H34 UNL 1 -6.825 4.939 -0.169 1.00 0.00 H HETATM 101 H35 UNL 1 -7.538 5.072 1.460 1.00 0.00 H HETATM 102 H36 UNL 1 -9.182 4.287 0.176 1.00 0.00 H HETATM 103 H37 UNL 1 -7.762 3.265 2.759 1.00 0.00 H HETATM 104 H38 UNL 1 -6.554 3.711 4.409 1.00 0.00 H HETATM 105 H39 UNL 1 -5.702 1.338 3.558 1.00 0.00 H HETATM 106 H40 UNL 1 -8.174 1.906 4.098 1.00 0.00 H HETATM 107 H41 UNL 1 -6.067 -0.321 1.852 1.00 0.00 H HETATM 108 H42 UNL 1 -7.479 -1.435 0.539 1.00 0.00 H HETATM 109 H43 UNL 1 -7.834 -2.129 -1.538 1.00 0.00 H HETATM 110 H44 UNL 1 -8.504 -1.825 -3.901 1.00 0.00 H HETATM 111 H45 UNL 1 -7.171 -0.785 -3.388 1.00 0.00 H HETATM 112 H46 UNL 1 -8.458 0.623 -4.450 1.00 0.00 H HETATM 113 H47 UNL 1 -10.638 -0.947 -1.892 1.00 0.00 H HETATM 114 H48 UNL 1 -11.142 -3.045 -2.147 1.00 0.00 H HETATM 115 H49 UNL 1 -9.744 -2.792 0.294 1.00 0.00 H HETATM 116 H50 UNL 1 -11.992 -1.765 -0.627 1.00 0.00 H HETATM 117 H51 UNL 1 -9.469 -1.080 1.855 1.00 0.00 H HETATM 118 H52 UNL 1 -10.665 0.412 -0.187 1.00 0.00 H HETATM 119 H53 UNL 1 -3.931 -0.141 -1.670 1.00 0.00 H HETATM 120 H54 UNL 1 -2.887 -1.323 -0.912 1.00 0.00 H HETATM 121 H55 UNL 1 -2.374 -0.370 -2.437 1.00 0.00 H HETATM 122 H56 UNL 1 -1.951 1.820 -2.396 1.00 0.00 H HETATM 123 H57 UNL 1 -2.384 2.941 -0.999 1.00 0.00 H HETATM 124 H58 UNL 1 -4.194 2.805 -2.149 1.00 0.00 H HETATM 125 H59 UNL 1 -0.314 1.351 -0.785 1.00 0.00 H HETATM 126 H60 UNL 1 -0.913 -1.613 -0.855 1.00 0.00 H HETATM 127 H61 UNL 1 -0.423 -0.546 -2.166 1.00 0.00 H HETATM 128 H62 UNL 1 1.779 -0.492 -1.381 1.00 0.00 H HETATM 129 H63 UNL 1 1.234 -2.159 -1.171 1.00 0.00 H HETATM 130 H64 UNL 1 0.697 -2.471 2.303 1.00 0.00 H HETATM 131 H65 UNL 1 -0.249 -2.469 0.837 1.00 0.00 H HETATM 132 H66 UNL 1 1.310 -3.221 0.712 1.00 0.00 H HETATM 133 H67 UNL 1 3.909 -2.711 2.274 1.00 0.00 H HETATM 134 H68 UNL 1 2.421 -2.182 2.946 1.00 0.00 H HETATM 135 H69 UNL 1 3.911 -1.106 2.965 1.00 0.00 H HETATM 136 H70 UNL 1 3.297 -3.229 0.313 1.00 0.00 H HETATM 137 H71 UNL 1 3.531 -2.066 -1.008 1.00 0.00 H HETATM 138 H72 UNL 1 5.625 -2.748 -0.596 1.00 0.00 H HETATM 139 H73 UNL 1 5.467 -2.975 1.128 1.00 0.00 H HETATM 140 H74 UNL 1 8.054 -1.487 3.002 1.00 0.00 H CONECT 1 2 67 68 69 CONECT 2 3 3 66 CONECT 3 4 5 CONECT 4 70 CONECT 5 6 6 7 CONECT 7 8 71 72 CONECT 8 9 66 73 CONECT 9 10 CONECT 10 11 62 74 CONECT 11 12 75 76 CONECT 12 13 14 15 CONECT 13 77 78 79 CONECT 14 80 81 82 CONECT 15 16 83 84 CONECT 16 17 62 85 CONECT 17 18 18 58 CONECT 18 19 86 CONECT 19 20 87 88 CONECT 20 21 56 89 CONECT 21 22 23 53 CONECT 22 90 91 92 CONECT 23 24 93 94 CONECT 24 25 95 96 CONECT 25 26 49 97 CONECT 26 27 CONECT 27 28 36 98 CONECT 28 29 CONECT 29 30 32 99 CONECT 30 31 100 101 CONECT 31 102 CONECT 32 33 34 103 CONECT 33 104 CONECT 34 35 36 105 CONECT 35 106 CONECT 36 37 107 CONECT 37 38 CONECT 38 39 47 108 CONECT 39 40 CONECT 40 41 43 109 CONECT 41 42 110 111 CONECT 42 112 CONECT 43 44 45 113 CONECT 44 114 CONECT 45 46 47 115 CONECT 46 116 CONECT 47 48 117 CONECT 48 118 CONECT 49 50 51 53 CONECT 50 119 120 121 CONECT 51 52 122 123 CONECT 52 124 CONECT 53 54 125 CONECT 54 55 126 127 CONECT 55 56 128 129 CONECT 56 57 58 CONECT 57 130 131 132 CONECT 58 59 60 CONECT 59 133 134 135 CONECT 60 61 136 137 CONECT 61 62 138 139 CONECT 62 63 CONECT 63 64 64 65 CONECT 65 140 END SMILES for HMDB0031775 (AzI)CC1=C(O)C(=O)CC(OC2CC(C)(C)CC3C4=CCC5C6(C)CCC(OC7OC(CO)C(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C(C)(CO)C6CCC5(C)C4(C)CCC23C(O)=O)O1 INCHI for HMDB0031775 (AzI)InChI=1S/C48H74O18/c1-22-33(53)25(52)16-32(61-22)64-31-18-43(2,3)17-24-23-8-9-29-44(4)12-11-30(45(5,21-51)28(44)10-13-47(29,7)46(23,6)14-15-48(24,31)42(59)60)65-41-39(37(57)35(55)27(20-50)63-41)66-40-38(58)36(56)34(54)26(19-49)62-40/h8,24,26-32,34-41,49-51,53-58H,9-21H2,1-7H3,(H,59,60) 3D Structure for HMDB0031775 (AzI) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C48H74O18 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 939.0904 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 938.487515564 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 10-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4-[(5-hydroxy-6-methyl-4-oxo-3,4-dihydro-2H-pyran-2-yl)oxy]-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 10-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4-[(5-hydroxy-6-methyl-4-oxo-2,3-dihydropyran-2-yl)oxy]-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydropicene-4a-carboxylic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1=C(O)C(=O)CC(OC2CC(C)(C)CC3C4=CCC5C6(C)CCC(OC7OC(CO)C(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C(C)(CO)C6CCC5(C)C4(C)CCC23C(O)=O)O1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C48H74O18/c1-22-33(53)25(52)16-32(61-22)64-31-18-43(2,3)17-24-23-8-9-29-44(4)12-11-30(45(5,21-51)28(44)10-13-47(29,7)46(23,6)14-15-48(24,31)42(59)60)65-41-39(37(57)35(55)27(20-50)63-41)66-40-38(58)36(56)34(54)26(19-49)62-40/h8,24,26-32,34-41,49-51,53-58H,9-21H2,1-7H3,(H,59,60) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | XLEIKFRILRTCIS-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triterpene saponins. These are glycosylated derivatives of triterpene sapogenins. The sapogenin moiety backbone is usually based on the oleanane, ursane, taraxastane, bauerane, lanostane, lupeol, lupane, dammarane, cycloartane, friedelane, hopane, 9b,19-cyclo-lanostane, cycloartane, or cycloartanol skeleton. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Terpene glycosides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triterpene saponins | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB008448 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | C00000950 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Azi | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131751192 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|