Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:52:37 UTC

Update Date

2022-03-07 02:53:30 UTC

HMDB ID

HMDB0032908

Secondary Accession Numbers

HMDB32908

Metabolite Identification

Common Name

Kaempferol 7-sophoroside

Description

Kaempferol 7-sophoroside belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Kaempferol 7-sophoroside has been detected, but not quantified in, several different foods, such as corns (Zea mays), saffrons (Crocus sativus), quinoas (Chenopodium quinoa), wheats (Triticum), and red rice (Oryza rufipogon). This could make kaempferol 7-sophoroside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Kaempferol 7-sophoroside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061306472D          

 43 47  0  0  0  0            999 V2000
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  9  1  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  2  0  0  0  0
 10  4  1  0  0  0  0
 11  5  2  0  0  0  0
 11  6  1  0  0  0  0
 12  5  1  0  0  0  0
 13  6  2  0  0  0  0
 14  7  1  0  0  0  0
 15  8  1  0  0  0  0
 16 12  2  0  0  0  0
 16 13  1  0  0  0  0
 17 14  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24  9  1  0  0  0  0
 24 22  2  0  0  0  0
 25 21  1  0  0  0  0
 26 23  1  0  0  0  0
 27 25  1  0  0  0  0
 28  7  1  0  0  0  0
 29  8  1  0  0  0  0
 30 10  1  0  0  0  0
 31 12  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 11  1  0  0  0  0
 39 27  1  0  0  0  0
 40 13  1  0  0  0  0
 40 24  1  0  0  0  0
 41 14  1  0  0  0  0
 41 26  1  0  0  0  0
 42 15  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 26  1  0  0  0  0
M  END

HMDB0032908
     RDKit          3D
Kaempferol 7-sophoroside
 73 77  0  0  0  0  0  0  0  0999 V2000
    6.0790   -2.0804   -0.5756 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4301   -1.0768   -0.1922 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0651    0.1169    0.1551 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4376    0.1509    0.0612 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3696    1.2118    0.5719 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9372    2.5060    0.9595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0552    3.5037    1.4083 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4977    4.7395    1.7915 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8406    5.0512    1.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2874    6.3124    2.1414 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6962    4.0714    1.3094 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2524    2.7940    0.9118 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0468    1.0614    0.6237 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4057   -0.0261    0.3122 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0224   -0.0879    0.3991 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2944   -1.2189    0.0809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0560   -1.1849    0.1977 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9588   -2.2137   -0.0784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6329   -2.5653    1.0956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5894   -3.5219    0.9771 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4289   -4.6329    2.0222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2020   -5.2631    1.9013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7038   -4.0765   -0.3997 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7270   -4.9742   -0.7430 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8286   -3.0035   -1.4567 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1712   -2.6980   -1.6114 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0720   -1.7468   -1.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9698   -0.9728   -0.3422 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1954    0.2896   -0.8833 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5061    0.4935   -1.2286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6831    1.8284   -1.5727 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8973    2.0158   -2.4620 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0648    1.5805   -1.8076 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7816    2.6807   -0.3239 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0985    2.8512    0.0929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9313    2.0069    0.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4807    2.8966    1.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7312    1.3880    0.0500 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0543    2.4105   -0.6127 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9748   -2.3237   -0.3377 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3772   -2.3187   -0.4450 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0960   -3.4249   -0.8676 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0678   -1.1628   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9788   -0.6190   -0.2342 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9850    3.2690    1.4473 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8104    5.5165    2.1409 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3439    7.0364    1.4309 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7629    4.2605    1.2542 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9817    2.0788    0.5759 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5092    0.8262    0.7416 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4301   -3.0710   -0.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5663   -3.0299    1.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2349   -5.3905    1.8376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -4.1838    3.0328 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2118   -6.0611    1.3363 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6764   -4.6536   -0.4286 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5730   -5.0232   -1.7194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4389   -3.4196   -2.4027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6401   -2.7071   -0.7254 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6098   -1.3262   -1.9082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5666    0.3747   -1.7928 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7975    2.1664   -2.1371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7786    1.3881   -3.3665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9887    3.0623   -2.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7729    1.4259   -2.4698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3575    3.6949   -0.4873 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2747    2.4101    0.9634 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5230    1.2181    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7005    2.6042    2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0094    0.9839    0.8030 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2772    3.3076   -0.2503 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5064   -3.2357   -0.6017 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6186   -4.2899   -1.1156 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  2  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 16 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  6  1  0
 43 14  1  0
 27 18  1  0
 38 29  1  0
  4 44  1  0
  7 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END


  Mrv0541 05061306472D          

 43 47  0  0  0  0            999 V2000
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  4  2  2  0  0  0  0
  9  1  2  0  0  0  0
  9  2  1  0  0  0  0
 10  3  2  0  0  0  0
 10  4  1  0  0  0  0
 11  5  2  0  0  0  0
 11  6  1  0  0  0  0
 12  5  1  0  0  0  0
 13  6  2  0  0  0  0
 14  7  1  0  0  0  0
 15  8  1  0  0  0  0
 16 12  2  0  0  0  0
 16 13  1  0  0  0  0
 17 14  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 20  1  0  0  0  0
 24  9  1  0  0  0  0
 24 22  2  0  0  0  0
 25 21  1  0  0  0  0
 26 23  1  0  0  0  0
 27 25  1  0  0  0  0
 28  7  1  0  0  0  0
 29  8  1  0  0  0  0
 30 10  1  0  0  0  0
 31 12  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39 11  1  0  0  0  0
 39 27  1  0  0  0  0
 40 13  1  0  0  0  0
 40 24  1  0  0  0  0
 41 14  1  0  0  0  0
 41 26  1  0  0  0  0
 42 15  1  0  0  0  0
 42 27  1  0  0  0  0
 43 25  1  0  0  0  0
 43 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0032908

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC=C(O)C=C2)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)23(38)26(41-14)43-25-21(36)18(33)15(8-29)42-27(25)39-11-5-12(31)16-13(6-11)40-24(22(37)19(16)34)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-21,23,25-33,35-38H,7-8H2

> <INCHI_KEY>
QIIWNLYXERJKDH-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
58.99882354746703

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-3,5-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.74

> <JCHEM_LOGP>
-1.5790389533333333

> <ALOGPS_LOGS>
-2.14

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
8.737688218883571

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.005579634959144

> <JCHEM_PKA_STRONGEST_BASIC>
-3.648377595763173

> <JCHEM_POLAR_SURFACE_AREA>
265.52

> <JCHEM_REFRACTIVITY>
139.43899999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
4.39e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-3,5-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0032908
     RDKit          3D
Kaempferol 7-sophoroside
 73 77  0  0  0  0  0  0  0  0999 V2000
    6.0790   -2.0804   -0.5756 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4301   -1.0768   -0.1922 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0651    0.1169    0.1551 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4376    0.1509    0.0612 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3696    1.2118    0.5719 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9372    2.5060    0.9595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0552    3.5037    1.4083 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4977    4.7395    1.7915 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8406    5.0512    1.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2874    6.3124    2.1414 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6962    4.0714    1.3094 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2524    2.7940    0.9118 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0468    1.0614    0.6237 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4057   -0.0261    0.3122 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0224   -0.0879    0.3991 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2944   -1.2189    0.0809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0560   -1.1849    0.1977 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9588   -2.2137   -0.0784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6329   -2.5653    1.0956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5894   -3.5219    0.9771 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4289   -4.6329    2.0222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2020   -5.2631    1.9013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7038   -4.0765   -0.3997 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7270   -4.9742   -0.7430 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8286   -3.0035   -1.4567 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1712   -2.6980   -1.6114 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0720   -1.7468   -1.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9698   -0.9728   -0.3422 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1954    0.2896   -0.8833 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5061    0.4935   -1.2286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6831    1.8284   -1.5727 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8973    2.0158   -2.4620 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0648    1.5805   -1.8076 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7816    2.6807   -0.3239 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0985    2.8512    0.0929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9313    2.0069    0.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4807    2.8966    1.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7312    1.3880    0.0500 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0543    2.4105   -0.6127 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9748   -2.3237   -0.3377 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3772   -2.3187   -0.4450 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0960   -3.4249   -0.8676 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0678   -1.1628   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9788   -0.6190   -0.2342 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9850    3.2690    1.4473 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8104    5.5165    2.1409 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3439    7.0364    1.4309 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7629    4.2605    1.2542 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9817    2.0788    0.5759 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5092    0.8262    0.7416 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4301   -3.0710   -0.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5663   -3.0299    1.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2349   -5.3905    1.8376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -4.1838    3.0328 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2118   -6.0611    1.3363 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6764   -4.6536   -0.4286 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5730   -5.0232   -1.7194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4389   -3.4196   -2.4027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6401   -2.7071   -0.7254 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6098   -1.3262   -1.9082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5666    0.3747   -1.7928 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7975    2.1664   -2.1371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7786    1.3881   -3.3665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9887    3.0623   -2.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7729    1.4259   -2.4698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3575    3.6949   -0.4873 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2747    2.4101    0.9634 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5230    1.2181    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7005    2.6042    2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0094    0.9839    0.8030 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2772    3.3076   -0.2503 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5064   -3.2357   -0.6017 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6186   -4.2899   -1.1156 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  2  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 16 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  6  1  0
 43 14  1  0
 27 18  1  0
 38 29  1  0
  4 44  1  0
  7 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -5.335  -4.620   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -2.667   4.620   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -4.001   3.850   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      -5.335   0.000   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0       1.334   2.310   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -6.668  -5.390   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       0.000   4.620   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -8.002  -3.080   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -2.667   6.160   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      -8.002   0.000   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -5.335   4.620   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0      -2.667   1.540   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      -4.001  -2.310   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0      -5.335   1.540   0.000  0.00  0.00           O+0
CONECT    1    3    9                                                       
CONECT    2    4    9                                                       
CONECT    3    1   10                                                       
CONECT    4    2   10                                                       
CONECT    5   11   12                                                       
CONECT    6   11   13                                                       
CONECT    7   14   28                                                       
CONECT    8   15   29                                                       
CONECT    9    1    2   24                                                  
CONECT   10    3    4   30                                                  
CONECT   11    5    6   39                                                  
CONECT   12    5   16   31                                                  
CONECT   13    6   16   40                                                  
CONECT   14    7   17   41                                                  
CONECT   15    8   18   42                                                  
CONECT   16   12   13   19                                                  
CONECT   17   14   20   32                                                  
CONECT   18   15   21   33                                                  
CONECT   19   16   22   34                                                  
CONECT   20   17   23   35                                                  
CONECT   21   18   25   36                                                  
CONECT   22   19   24   37                                                  
CONECT   23   20   26   38                                                  
CONECT   24    9   22   40                                                  
CONECT   25   21   27   43                                                  
CONECT   26   23   41   43                                                  
CONECT   27   25   39   42                                                  
CONECT   28    7                                                            
CONECT   29    8                                                            
CONECT   30   10                                                            
CONECT   31   12                                                            
CONECT   32   17                                                            
CONECT   33   18                                                            
CONECT   34   19                                                            
CONECT   35   20                                                            
CONECT   36   21                                                            
CONECT   37   22                                                            
CONECT   38   23                                                            
CONECT   39   11   27                                                       
CONECT   40   13   24                                                       
CONECT   41   14   26                                                       
CONECT   42   15   27                                                       
CONECT   43   25   26                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0032908
HETATM    1  O1  UNL     1       6.079  -2.080  -0.576  1.00  0.00           O  
HETATM    2  C1  UNL     1       5.430  -1.077  -0.192  1.00  0.00           C  
HETATM    3  C2  UNL     1       6.065   0.117   0.155  1.00  0.00           C  
HETATM    4  O2  UNL     1       7.438   0.151   0.061  1.00  0.00           O  
HETATM    5  C3  UNL     1       5.370   1.212   0.572  1.00  0.00           C  
HETATM    6  C4  UNL     1       5.937   2.506   0.959  1.00  0.00           C  
HETATM    7  C5  UNL     1       5.055   3.504   1.408  1.00  0.00           C  
HETATM    8  C6  UNL     1       5.498   4.740   1.791  1.00  0.00           C  
HETATM    9  C7  UNL     1       6.841   5.051   1.749  1.00  0.00           C  
HETATM   10  O3  UNL     1       7.287   6.312   2.141  1.00  0.00           O  
HETATM   11  C8  UNL     1       7.696   4.071   1.309  1.00  0.00           C  
HETATM   12  C9  UNL     1       7.252   2.794   0.912  1.00  0.00           C  
HETATM   13  O4  UNL     1       4.047   1.061   0.624  1.00  0.00           O  
HETATM   14  C10 UNL     1       3.406  -0.026   0.312  1.00  0.00           C  
HETATM   15  C11 UNL     1       2.022  -0.088   0.399  1.00  0.00           C  
HETATM   16  C12 UNL     1       1.294  -1.219   0.081  1.00  0.00           C  
HETATM   17  O5  UNL     1      -0.056  -1.185   0.198  1.00  0.00           O  
HETATM   18  C13 UNL     1      -0.959  -2.214  -0.078  1.00  0.00           C  
HETATM   19  O6  UNL     1      -1.633  -2.565   1.096  1.00  0.00           O  
HETATM   20  C14 UNL     1      -2.589  -3.522   0.977  1.00  0.00           C  
HETATM   21  C15 UNL     1      -2.429  -4.633   2.022  1.00  0.00           C  
HETATM   22  O7  UNL     1      -1.202  -5.263   1.901  1.00  0.00           O  
HETATM   23  C16 UNL     1      -2.704  -4.076  -0.400  1.00  0.00           C  
HETATM   24  O8  UNL     1      -1.727  -4.974  -0.743  1.00  0.00           O  
HETATM   25  C17 UNL     1      -2.829  -3.004  -1.457  1.00  0.00           C  
HETATM   26  O9  UNL     1      -4.171  -2.698  -1.611  1.00  0.00           O  
HETATM   27  C18 UNL     1      -2.072  -1.747  -1.027  1.00  0.00           C  
HETATM   28  O10 UNL     1      -2.970  -0.973  -0.342  1.00  0.00           O  
HETATM   29  C19 UNL     1      -3.195   0.290  -0.883  1.00  0.00           C  
HETATM   30  O11 UNL     1      -4.506   0.494  -1.229  1.00  0.00           O  
HETATM   31  C20 UNL     1      -4.683   1.828  -1.573  1.00  0.00           C  
HETATM   32  C21 UNL     1      -5.897   2.016  -2.462  1.00  0.00           C  
HETATM   33  O12 UNL     1      -7.065   1.580  -1.808  1.00  0.00           O  
HETATM   34  C22 UNL     1      -4.782   2.681  -0.324  1.00  0.00           C  
HETATM   35  O13 UNL     1      -6.098   2.851   0.093  1.00  0.00           O  
HETATM   36  C23 UNL     1      -3.931   2.007   0.740  1.00  0.00           C  
HETATM   37  O14 UNL     1      -3.481   2.897   1.701  1.00  0.00           O  
HETATM   38  C24 UNL     1      -2.731   1.388   0.050  1.00  0.00           C  
HETATM   39  O15 UNL     1      -2.054   2.410  -0.613  1.00  0.00           O  
HETATM   40  C25 UNL     1       1.975  -2.324  -0.338  1.00  0.00           C  
HETATM   41  C26 UNL     1       3.377  -2.319  -0.445  1.00  0.00           C  
HETATM   42  O16 UNL     1       4.096  -3.425  -0.868  1.00  0.00           O  
HETATM   43  C27 UNL     1       4.068  -1.163  -0.116  1.00  0.00           C  
HETATM   44  H1  UNL     1       7.979  -0.619  -0.234  1.00  0.00           H  
HETATM   45  H2  UNL     1       3.985   3.269   1.447  1.00  0.00           H  
HETATM   46  H3  UNL     1       4.810   5.517   2.141  1.00  0.00           H  
HETATM   47  H4  UNL     1       7.344   7.036   1.431  1.00  0.00           H  
HETATM   48  H5  UNL     1       8.763   4.260   1.254  1.00  0.00           H  
HETATM   49  H6  UNL     1       7.982   2.079   0.576  1.00  0.00           H  
HETATM   50  H7  UNL     1       1.509   0.826   0.742  1.00  0.00           H  
HETATM   51  H8  UNL     1      -0.430  -3.071  -0.499  1.00  0.00           H  
HETATM   52  H9  UNL     1      -3.566  -3.030   1.276  1.00  0.00           H  
HETATM   53  H10 UNL     1      -3.235  -5.390   1.838  1.00  0.00           H  
HETATM   54  H11 UNL     1      -2.537  -4.184   3.033  1.00  0.00           H  
HETATM   55  H12 UNL     1      -1.212  -6.061   1.336  1.00  0.00           H  
HETATM   56  H13 UNL     1      -3.676  -4.654  -0.429  1.00  0.00           H  
HETATM   57  H14 UNL     1      -1.573  -5.023  -1.719  1.00  0.00           H  
HETATM   58  H15 UNL     1      -2.439  -3.420  -2.403  1.00  0.00           H  
HETATM   59  H16 UNL     1      -4.640  -2.707  -0.725  1.00  0.00           H  
HETATM   60  H17 UNL     1      -1.610  -1.326  -1.908  1.00  0.00           H  
HETATM   61  H18 UNL     1      -2.567   0.375  -1.793  1.00  0.00           H  
HETATM   62  H19 UNL     1      -3.797   2.166  -2.137  1.00  0.00           H  
HETATM   63  H20 UNL     1      -5.779   1.388  -3.366  1.00  0.00           H  
HETATM   64  H21 UNL     1      -5.989   3.062  -2.748  1.00  0.00           H  
HETATM   65  H22 UNL     1      -7.773   1.426  -2.470  1.00  0.00           H  
HETATM   66  H23 UNL     1      -4.357   3.695  -0.487  1.00  0.00           H  
HETATM   67  H24 UNL     1      -6.275   2.410   0.963  1.00  0.00           H  
HETATM   68  H25 UNL     1      -4.523   1.218   1.288  1.00  0.00           H  
HETATM   69  H26 UNL     1      -3.701   2.604   2.628  1.00  0.00           H  
HETATM   70  H27 UNL     1      -2.009   0.984   0.803  1.00  0.00           H  
HETATM   71  H28 UNL     1      -2.277   3.308  -0.250  1.00  0.00           H  
HETATM   72  H29 UNL     1       1.506  -3.236  -0.602  1.00  0.00           H  
HETATM   73  H30 UNL     1       3.619  -4.290  -1.116  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   43
CONECT    3    4    5    5
CONECT    4   44
CONECT    5    6   13
CONECT    6    7    7   12
CONECT    7    8   45
CONECT    8    9    9   46
CONECT    9   10   11
CONECT   10   47
CONECT   11   12   12   48
CONECT   12   49
CONECT   13   14
CONECT   14   15   15   43
CONECT   15   16   50
CONECT   16   17   40   40
CONECT   17   18
CONECT   18   19   27   51
CONECT   19   20
CONECT   20   21   23   52
CONECT   21   22   53   54
CONECT   22   55
CONECT   23   24   25   56
CONECT   24   57
CONECT   25   26   27   58
CONECT   26   59
CONECT   27   28   60
CONECT   28   29
CONECT   29   30   38   61
CONECT   30   31
CONECT   31   32   34   62
CONECT   32   33   63   64
CONECT   33   65
CONECT   34   35   36   66
CONECT   35   67
CONECT   36   37   38   68
CONECT   37   69
CONECT   38   39   70
CONECT   39   71
CONECT   40   41   72
CONECT   41   42   43   43
CONECT   42   73
END

HMDB0032908
     RDKit          3D
Kaempferol 7-sophoroside
 73 77  0  0  0  0  0  0  0  0999 V2000
    6.0790   -2.0804   -0.5756 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4301   -1.0768   -0.1922 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0651    0.1169    0.1551 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4376    0.1509    0.0612 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3696    1.2118    0.5719 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9372    2.5060    0.9595 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0552    3.5037    1.4083 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4977    4.7395    1.7915 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8406    5.0512    1.7495 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2874    6.3124    2.1414 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6962    4.0714    1.3094 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2524    2.7940    0.9118 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0468    1.0614    0.6237 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4057   -0.0261    0.3122 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0224   -0.0879    0.3991 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2944   -1.2189    0.0809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0560   -1.1849    0.1977 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9588   -2.2137   -0.0784 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6329   -2.5653    1.0956 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5894   -3.5219    0.9771 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4289   -4.6329    2.0222 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2020   -5.2631    1.9013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7038   -4.0765   -0.3997 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7270   -4.9742   -0.7430 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8286   -3.0035   -1.4567 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1712   -2.6980   -1.6114 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0720   -1.7468   -1.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9698   -0.9728   -0.3422 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1954    0.2896   -0.8833 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5061    0.4935   -1.2286 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6831    1.8284   -1.5727 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8973    2.0158   -2.4620 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0648    1.5805   -1.8076 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7816    2.6807   -0.3239 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0985    2.8512    0.0929 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9313    2.0069    0.7403 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4807    2.8966    1.7012 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7312    1.3880    0.0500 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0543    2.4105   -0.6127 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9748   -2.3237   -0.3377 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3772   -2.3187   -0.4450 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0960   -3.4249   -0.8676 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0678   -1.1628   -0.1159 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9788   -0.6190   -0.2342 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9850    3.2690    1.4473 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8104    5.5165    2.1409 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3439    7.0364    1.4309 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7629    4.2605    1.2542 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9817    2.0788    0.5759 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5092    0.8262    0.7416 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4301   -3.0710   -0.4990 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5663   -3.0299    1.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2349   -5.3905    1.8376 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5371   -4.1838    3.0328 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2118   -6.0611    1.3363 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6764   -4.6536   -0.4286 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5730   -5.0232   -1.7194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4389   -3.4196   -2.4027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6401   -2.7071   -0.7254 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6098   -1.3262   -1.9082 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5666    0.3747   -1.7928 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7975    2.1664   -2.1371 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7786    1.3881   -3.3665 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9887    3.0623   -2.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7729    1.4259   -2.4698 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3575    3.6949   -0.4873 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2747    2.4101    0.9634 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5230    1.2181    1.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7005    2.6042    2.6275 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0094    0.9839    0.8030 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2772    3.3076   -0.2503 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5064   -3.2357   -0.6017 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6186   -4.2899   -1.1156 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  2  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 16 40  2  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 43  2  1  0
 12  6  1  0
 43 14  1  0
 27 18  1  0
 38 29  1  0
  4 44  1  0
  7 45  1  0
  8 46  1  0
 10 47  1  0
 11 48  1  0
 12 49  1  0
 15 50  1  0
 18 51  1  0
 20 52  1  0
 21 53  1  0
 21 54  1  0
 22 55  1  0
 23 56  1  0
 24 57  1  0
 25 58  1  0
 26 59  1  0
 27 60  1  0
 29 61  1  0
 31 62  1  0
 32 63  1  0
 32 64  1  0
 33 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 42 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
7-[(2-O-beta-D-Glucopyranosyl-beta-D-glucopyranosyl)oxy]-3,5-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one	HMDB

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-3,5-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

Traditional Name

7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-3,5-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

CAS Registry Number

Not Available

SMILES

OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC=C(O)C=C2)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c28-7-14-17(32)20(35)23(38)26(41-14)43-25-21(36)18(33)15(8-29)42-27(25)39-11-5-12(31)16-13(6-11)40-24(22(37)19(16)34)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-21,23,25-33,35-38H,7-8H2

InChI Key

QIIWNLYXERJKDH-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-7-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-7-O-glycosides

Alternative Parents

Substituents

Flavonoid-7-o-glycoside
3-hydroxyflavone
3-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
Hydroxyflavonoid
Flavone
Phenolic glycoside
Glycosyl compound
O-glycosyl compound
Disaccharide
Chromone
Benzopyran
1-benzopyran
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Pyranone
Oxane
Benzenoid
Monocyclic benzene moiety
Pyran
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Acetal
Oxacycle
Organoheterocyclic compound
Polyol
Organic oxide
Alcohol
Hydrocarbon derivative
Primary alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0032908)
Cytoplasm (HMDB: HMDB0032908)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0032908)

Source

Exogenous

Food

Food (HMDB: HMDB0032908)

Cereal and cereal product

Cereal

Cereal product

Cereals and cereal products (FooDB: FOOD00858)

Soy

Soy bean (FooDB: FOOD00085)

Herb and spice

Spice

Saffron (FooDB: FOOD00063)

Herb

Amaranth (FooDB: FOOD00288)
Teff (FooDB: FOOD00489)

Other seed

Quinoa (FooDB: FOOD00441)

Herbs and Spices (FooDB: FOOD00866)

Endogenous

Plant

Plant (HMDB: HMDB0032908)

Not Available

Nutrient (HMDB: HMDB0032908)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	4.39 g/L	ALOGPS
logP	-0.74	ALOGPS
logP	-1.6	ChemAxon
logS	-2.1	ALOGPS
pKa (Strongest Acidic)	8.01	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	265.52 Å²	ChemAxon
Rotatable Bond Count	7	ChemAxon
Refractivity	139.44 m³·mol⁻¹	ChemAxon
Polarizability	59 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	238.974	31661259
DarkChem	[M-H]-	229.574	31661259
DeepCCS	[M+H]+	228.614	30932474
DeepCCS	[M-H]-	226.461	30932474
DeepCCS	[M-2H]-	259.7	30932474
DeepCCS	[M+Na]+	234.354	30932474
AllCCS	[M+H]+	231.2	32859911
AllCCS	[M+H-H2O]+	230.0	32859911
AllCCS	[M+NH4]+	232.3	32859911
AllCCS	[M+Na]+	232.6	32859911
AllCCS	[M-H]-	226.4	32859911
AllCCS	[M+Na-2H]-	228.6	32859911
AllCCS	[M+HCOO]-	231.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Kaempferol 7-sophoroside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC=C(O)C=C2)C(O)C(O)C1O	5407.1	Standard polar	33892256
Kaempferol 7-sophoroside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC=C(O)C=C2)C(O)C(O)C1O	5402.6	Standard non polar	33892256
Kaempferol 7-sophoroside	OCC1OC(OC2C(O)C(O)C(CO)OC2OC2=CC(O)=C3C(=O)C(O)=C(OC3=C2)C2=CC=C(O)C=C2)C(O)C(O)C1O	5731.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Kaempferol 7-sophoroside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5583.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C1O	5617.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #2	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C1OC1OC(CO)C(O)C(O)C1O	5619.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #3	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C1O	5604.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5585.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #5	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5604.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #6	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5567.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #7	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5637.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #8	C[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5618.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TMS,isomer #9	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C1O	5607.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5454.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #10	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C	5513.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5490.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #12	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5471.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #13	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5470.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #14	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5510.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #15	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O	5487.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #16	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C1O	5474.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #17	C[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5485.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5486.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #19	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5456.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5443.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #20	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5458.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #21	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5492.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #22	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O	5470.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #23	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O	5459.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #24	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O	5470.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5462.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5449.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5498.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5463.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5452.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5489.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5466.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #31	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5453.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #32	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5430.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #33	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5453.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #34	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5484.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #35	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5430.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5476.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #37	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5456.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #38	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5436.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #39	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5450.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5473.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5487.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #41	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5466.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5487.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O	5463.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #44	C[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C	5487.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C	5483.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5465.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5481.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5459.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5449.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5465.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5260.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5296.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #100	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5349.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #101	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5312.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #102	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5303.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #103	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5348.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #104	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5274.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #105	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5315.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #106	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5304.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #107	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5220.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #108	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5340.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #109	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5259.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5289.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #110	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5307.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #111	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5346.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #112	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5299.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #113	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5335.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #114	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5295.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #115	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5296.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #116	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5295.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #117	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5373.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #118	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5362.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #119	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5379.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5293.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #120	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5387.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5290.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5270.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5307.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5364.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5353.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5362.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5365.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5333.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5340.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5369.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5338.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5324.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5327.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5310.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5338.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5352.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5325.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5309.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5298.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5335.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5336.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5320.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5346.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5329.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5325.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5339.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5390.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #38	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5353.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #39	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5335.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5290.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #40	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5411.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5388.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #42	C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5367.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #43	C[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5384.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5315.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5318.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5370.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5348.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5326.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5345.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5299.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #50	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5322.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5286.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #52	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5315.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #53	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5357.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #54	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5268.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5343.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #56	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5314.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #57	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5273.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #58	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5306.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #59	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5379.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5304.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #60	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5351.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #61	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5378.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #62	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5348.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #63	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5364.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #64	C[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	5373.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5321.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5340.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5374.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5364.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5341.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5273.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5358.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #71	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5314.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #72	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5281.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #73	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5310.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5352.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #75	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5267.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5344.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #77	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5312.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #78	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5270.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #79	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5297.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5313.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5375.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #81	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5348.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #82	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5373.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #83	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O	5335.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #84	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O	5353.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #85	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5358.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5275.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5354.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5313.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5279.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5332.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5311.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #91	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5344.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #92	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5314.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #93	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5274.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #94	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5301.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #95	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5371.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #96	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5347.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #97	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5373.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #98	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5344.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,3TMS,isomer #99	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5329.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5156.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5199.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5268.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #101	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5225.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #102	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5261.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #103	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5224.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #104	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5227.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #105	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C	5233.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5135.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5225.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5202.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5149.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5205.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5178.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5211.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5191.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5135.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5168.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5260.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5216.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5250.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #118	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5225.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #119	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5220.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5170.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #120	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5227.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #121	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5170.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #122	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5161.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #123	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5220.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #124	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5130.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #125	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5169.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5167.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #127	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5065.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #128	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5208.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #129	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5104.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5222.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #130	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5161.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #131	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5200.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #132	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5144.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #133	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5183.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #134	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5144.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #135	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5135.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #136	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5135.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #137	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5237.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #138	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5233.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #139	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5241.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5183.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #140	C[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5241.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #141	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5155.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #142	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5230.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #143	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5209.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #144	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5152.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #145	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5183.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #146	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5228.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #147	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5215.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #148	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5161.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #149	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5189.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5175.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #150	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5264.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #151	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5219.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #152	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5255.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #153	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5238.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #154	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5227.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #155	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5234.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #156	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5166.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #157	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5156.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #158	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5221.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #159	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5134.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5164.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #160	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5161.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5167.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #162	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5068.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5205.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #164	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5102.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #165	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5166.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #166	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5202.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #167	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5147.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #168	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5181.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #169	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5145.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5142.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #170	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5133.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #171	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5132.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #172	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5234.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #173	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5229.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #174	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5233.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #175	C[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5231.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #176	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5179.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #177	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5143.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #178	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5079.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #179	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5118.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5191.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #180	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5230.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #181	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5177.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #182	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5216.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #183	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5174.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #184	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5166.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #185	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5172.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #186	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5218.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #187	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5165.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #188	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5206.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #189	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5164.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5177.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #190	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5154.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #191	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5153.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #192	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5248.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #193	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5246.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #194	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5250.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #195	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5241.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #196	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5198.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #197	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5208.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #198	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5113.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #199	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5204.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5120.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5147.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #200	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5107.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=C3O2)C=C1	5181.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #202	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5203.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #203	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C2C1=O	5100.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #204	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5113.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #205	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5163.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #206	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C3O2)C=C1	5186.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #207	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C3O2)C=C1	5182.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #208	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5174.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #209	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5166.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5124.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #210	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C3O2)C=C1	5265.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5173.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5153.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5126.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5175.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5160.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5165.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5168.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5212.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5093.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5180.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5180.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5192.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5158.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5211.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5193.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5171.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5162.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5140.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5188.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5094.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5158.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5131.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5111.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5161.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5135.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5109.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5160.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5143.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5156.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5160.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5104.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5256.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5250.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5257.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5221.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5270.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5252.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5235.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5202.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5250.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5236.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5073.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5202.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5248.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5230.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5236.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5238.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5252.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5222.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5200.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5243.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5215.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O[Si](C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5128.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5192.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5235.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5221.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5218.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5227.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5213.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5186.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5230.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5198.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5200.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5216.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5208.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5200.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5202.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5208.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5237.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5226.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5245.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5282.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5274.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5234.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5199.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5254.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #91	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5210.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #92	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5158.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #93	C[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5193.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #94	C[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5243.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #95	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C)=C2C1=O	5136.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #96	C[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5215.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #97	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5185.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #98	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=CC(O)=C2C1=O	5133.4	Semi standard non polar	33892256
Kaempferol 7-sophoroside,4TMS,isomer #99	C[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=CC(O)=C2C1=O	5161.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5790.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C1O	5861.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C1OC1OC(CO)C(O)C(O)C1O	5857.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C1O	5848.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5788.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5802.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5811.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5842.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)OC(CO)C(O)C1O	5851.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C1O	5850.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5845.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C	5918.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5893.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5884.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5873.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5924.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5907.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5881.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	5873.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5886.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5877.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5840.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O)=C2C1=O	5862.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5917.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5897.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O	5871.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5866.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5858.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O[Si](C)(C)C(C)(C)C)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5848.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O[Si](C)(C)C(C)(C)C)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5902.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5873.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5847.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O[Si](C)(C)C(C)(C)C)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O	5893.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC(O)=C3C(=O)C(O)=C(C4=CC=C(O)C=C4)OC3=C2)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5843.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5867.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5839.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)=CC2=C1C(=O)C(O)=C(C1=CC=C(O)C=C1)O2	5840.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5903.8	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)=CC(O[Si](C)(C)C(C)(C)C)=C2C1=O	5828.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C=C3O2)C=C1	5883.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=CC(O)=C2C1=O	5856.9	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=CC(O)=C2C1=O	5827.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=C(C2=CC=C(O)C=C2)OC2=CC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=CC(O)=C2C1=O	5828.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5855.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C3O2)C=C1	5902.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C3O2)C=C1	5878.5	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=C(O)C(=O)C3=C(O)C=C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5873.7	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5861.1	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5868.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5872.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5877.2	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5881.6	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5847.0	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5858.3	Semi standard non polar	33892256
Kaempferol 7-sophoroside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3=CC(O)=C4C(=O)C(O)=C(C5=CC=C(O)C=C5)OC4=C3)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5867.7	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (Non-derivatized) - 70eV, Positive	splash10-002o-2411190000-bad45f89bac2a54bf79a	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (1 TMS) - 70eV, Positive	splash10-0uxr-6422109000-d0987256d0fc9ab3f7d7	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 7-sophoroside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 10V, Positive-QTOF	splash10-000i-0290622000-0f252c36f1d942ae4462	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 20V, Positive-QTOF	splash10-000i-0190200000-39ab58e81e98fe7dd573	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 40V, Positive-QTOF	splash10-000i-1490100000-b7a45cb2c943eb29dd50	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 10V, Negative-QTOF	splash10-0570-3693756000-d235027ac37cf9fcb10f	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 20V, Negative-QTOF	splash10-000i-1791310000-6fb78af28dc28713a442	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 40V, Negative-QTOF	splash10-000i-5790000000-4b788465fbccba887bae	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 10V, Positive-QTOF	splash10-03di-0000009000-5c4a382bca477bf51f4a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 20V, Positive-QTOF	splash10-03di-0000009000-992613fa5104253e0feb	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 40V, Positive-QTOF	splash10-01t9-2000913000-b9bf431b183716db942e	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 10V, Negative-QTOF	splash10-0a4i-0000009000-1d3f94c71cbb9dffa4b6	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 20V, Negative-QTOF	splash10-0a6r-0000349000-1a643baf4291795a8479	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 7-sophoroside 40V, Negative-QTOF	splash10-056u-4300941000-7949364d569b999e4a68	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB010891

KNApSAcK ID

C00013740

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

73088337

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Kaempferol 7-sophoroside (HMDB0032908)

MOL for HMDB0032908 (Kaempferol 7-sophoroside)

3D MOL for HMDB0032908 (Kaempferol 7-sophoroside)

3D SDF for HMDB0032908 (Kaempferol 7-sophoroside)

3D-SDF for HMDB0032908 (Kaempferol 7-sophoroside)

PDB for HMDB0032908 (Kaempferol 7-sophoroside)

3D PDB for HMDB0032908 (Kaempferol 7-sophoroside)

SMILES for HMDB0032908 (Kaempferol 7-sophoroside)

INCHI for HMDB0032908 (Kaempferol 7-sophoroside)

Structure for HMDB0032908 (Kaempferol 7-sophoroside)

3D Structure for HMDB0032908 (Kaempferol 7-sophoroside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra