Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 17:57:36 UTC |
---|
Update Date | 2022-03-07 02:53:38 UTC |
---|
HMDB ID | HMDB0033246 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Grevilline D |
---|
Description | Grevilline D belongs to the class of organic compounds known as hydroquinones. Hydroquinones are compounds containing a hydroquinone moiety, which consists of a benzene ring with a hydroxyl groups at positions 1 and 4. Grevilline D has been detected, but not quantified in, a few different foods, such as common mushrooms (Agaricus bisporus), mushrooms, and oyster mushrooms (Pleurotus ostreatus). This could make grevilline D a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on Grevilline D. |
---|
Structure | OC1=CC(=C(O)C=C1)C1=C(O)C(=O)O\C(=C\C2=CC(O)=C(O)C=C2)C1=O InChI=1S/C18H12O8/c19-9-2-4-11(20)10(7-9)15-16(23)14(26-18(25)17(15)24)6-8-1-3-12(21)13(22)5-8/h1-7,19-22,24H/b14-6+ |
---|
Synonyms | Not Available |
---|
Chemical Formula | C18H12O8 |
---|
Average Molecular Weight | 356.2831 |
---|
Monoisotopic Molecular Weight | 356.05321736 |
---|
IUPAC Name | (6E)-4-(2,5-dihydroxyphenyl)-6-[(3,4-dihydroxyphenyl)methylidene]-3-hydroxy-5,6-dihydro-2H-pyran-2,5-dione |
---|
Traditional Name | (6E)-4-(2,5-dihydroxyphenyl)-6-[(3,4-dihydroxyphenyl)methylidene]-3-hydroxypyran-2,5-dione |
---|
CAS Registry Number | 54707-49-2 |
---|
SMILES | OC1=CC(=C(O)C=C1)C1=C(O)C(=O)O\C(=C\C2=CC(O)=C(O)C=C2)C1=O |
---|
InChI Identifier | InChI=1S/C18H12O8/c19-9-2-4-11(20)10(7-9)15-16(23)14(26-18(25)17(15)24)6-8-1-3-12(21)13(22)5-8/h1-7,19-22,24H/b14-6+ |
---|
InChI Key | PVXXMVFQPHEMMT-MKMNVTDBSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as hydroquinones. Hydroquinones are compounds containing a hydroquinone moiety, which consists of a benzene ring with a hydroxyl groups at positions 1 and 4. |
---|
Kingdom | Organic compounds |
---|
Super Class | Benzenoids |
---|
Class | Phenols |
---|
Sub Class | Benzenediols |
---|
Direct Parent | Hydroquinones |
---|
Alternative Parents | |
---|
Substituents | - Catechol
- Hydroquinone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Dihydropyranone
- Monocyclic benzene moiety
- Pyran
- Enol ester
- Vinylogous acid
- Alpha,beta-unsaturated carboxylic ester
- Enoate ester
- Carboxylic acid ester
- Cyclic ketone
- Ketone
- Lactone
- Carboxylic acid derivative
- Oxacycle
- Organoheterocyclic compound
- Enol
- Monocarboxylic acid or derivatives
- Hydrocarbon derivative
- Organic oxygen compound
- Carbonyl group
- Organooxygen compound
- Organic oxide
- Aromatic heteromonocyclic compound
|
---|
Molecular Framework | Aromatic heteromonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | |
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Grevilline D,1TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O)=C3)C2=O)=C1 | 3532.9 | Semi standard non polar | 33892256 | Grevilline D,1TMS,isomer #2 | C[Si](C)(C)OC1=CC=C(O)C=C1C1=C(O)C(=O)O/C(=C/C2=CC=C(O)C(O)=C2)C1=O | 3491.4 | Semi standard non polar | 33892256 | Grevilline D,1TMS,isomer #3 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3467.0 | Semi standard non polar | 33892256 | Grevilline D,1TMS,isomer #4 | C[Si](C)(C)OC1=CC(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)=CC=C1O | 3473.7 | Semi standard non polar | 33892256 | Grevilline D,1TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)C=C1O | 3506.7 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O)=C3)C2=O)=C1 | 3427.5 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #10 | C[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)C=C1O[Si](C)(C)C | 3434.9 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #2 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3382.6 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C)C(O)=C3)C2=O)=C1 | 3520.8 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #4 | C[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O[Si](C)(C)C)=C3)C2=O)=C1 | 3475.4 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #5 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3423.9 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #6 | C[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C)C2=O)C=C1O | 3457.2 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #7 | C[Si](C)(C)OC1=CC(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C)C2=O)=CC=C1O | 3423.8 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #8 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O)=C2)OC1=O | 3376.3 | Semi standard non polar | 33892256 | Grevilline D,2TMS,isomer #9 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C)=C2)OC1=O | 3343.5 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #1 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3343.8 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #10 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC1=O | 3340.3 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #2 | C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C)C(O)=C3)C2=O)=C1 | 3426.5 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O[Si](C)(C)C)=C3)C2=O)=C1 | 3397.2 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #4 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O)=C2)OC1=O | 3394.6 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #5 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C)=C2)OC1=O | 3361.2 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #6 | C[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C2=O)=C1 | 3425.8 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #7 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O)=C2)OC1=O | 3344.5 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #8 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C)=C2)OC1=O | 3315.1 | Semi standard non polar | 33892256 | Grevilline D,3TMS,isomer #9 | C[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C)C2=O)C=C1O[Si](C)(C)C | 3372.9 | Semi standard non polar | 33892256 | Grevilline D,4TMS,isomer #1 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O)=C2)OC1=O | 3369.8 | Semi standard non polar | 33892256 | Grevilline D,4TMS,isomer #2 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C)=C2)OC1=O | 3348.6 | Semi standard non polar | 33892256 | Grevilline D,4TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(O[Si](C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)C2=O)=C1 | 3351.2 | Semi standard non polar | 33892256 | Grevilline D,4TMS,isomer #4 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC1=O | 3357.3 | Semi standard non polar | 33892256 | Grevilline D,4TMS,isomer #5 | C[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC1=O | 3327.6 | Semi standard non polar | 33892256 | Grevilline D,5TMS,isomer #1 | C[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C)=CC=C2O[Si](C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)OC1=O | 3379.8 | Semi standard non polar | 33892256 | Grevilline D,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O)=C3)C2=O)=C1 | 3784.1 | Semi standard non polar | 33892256 | Grevilline D,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C(O)C=C1C1=C(O)C(=O)O/C(=C/C2=CC=C(O)C(O)=C2)C1=O | 3774.9 | Semi standard non polar | 33892256 | Grevilline D,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3782.6 | Semi standard non polar | 33892256 | Grevilline D,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)=CC=C1O | 3756.1 | Semi standard non polar | 33892256 | Grevilline D,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)C=C1O | 3779.7 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(O[Si](C)(C)C(C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O)=C3)C2=O)=C1 | 3899.1 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O)C2=O)C=C1O[Si](C)(C)C(C)(C)C | 3927.8 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3958.1 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=O)=C1 | 3997.6 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C2=O)=C1 | 3991.8 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 3953.0 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C(C)(C)C)C2=O)C=C1O | 3959.6 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C(C)(C)C)C2=O)=CC=C1O | 3938.7 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC1=O | 3958.2 | Semi standard non polar | 33892256 | Grevilline D,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 3938.5 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O)=C2)OC1=O | 4102.6 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4117.7 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C(O[Si](C)(C)C(C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=O)=C1 | 4165.3 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(O[Si](C)(C)C(C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)C2=O)=C1 | 4152.2 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC1=O | 4182.6 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4158.3 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC=C(O)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)C2=O)=C1 | 4157.5 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC1=O | 4150.1 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4133.7 | Semi standard non polar | 33892256 | Grevilline D,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC=C(/C=C2/OC(=O)C(O)=C(C3=CC(O)=CC=C3O[Si](C)(C)C(C)(C)C)C2=O)C=C1O[Si](C)(C)C(C)(C)C | 4118.9 | Semi standard non polar | 33892256 | Grevilline D,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)OC1=O | 4333.4 | Semi standard non polar | 33892256 | Grevilline D,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4315.2 | Semi standard non polar | 33892256 | Grevilline D,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(O[Si](C)(C)C(C)(C)C)C(C2=C(O)C(=O)O/C(=C/C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)C2=O)=C1 | 4329.6 | Semi standard non polar | 33892256 | Grevilline D,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O[Si](C)(C)C(C)(C)C)=CC=C2O)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4306.6 | Semi standard non polar | 33892256 | Grevilline D,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C(C2=CC(O)=CC=C2O[Si](C)(C)C(C)(C)C)C(=O)/C(=C\C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)OC1=O | 4256.2 | Semi standard non polar | 33892256 |
|
---|
| GC-MS SpectraSpectrum Type | Description | Splash Key | Deposition Date | Source | View |
---|
Predicted GC-MS | Predicted GC-MS Spectrum - Grevilline D GC-MS (Non-derivatized) - 70eV, Positive | splash10-0fmi-0902000000-aff7aa5aaccd8d456f83 | 2017-09-01 | Wishart Lab | View Spectrum | Predicted GC-MS | Predicted GC-MS Spectrum - Grevilline D GC-MS (4 TMS) - 70eV, Positive | splash10-0ukc-4079048000-19b42adb25a043e2c938 | 2017-10-06 | Wishart Lab | View Spectrum | Predicted GC-MS | Predicted GC-MS Spectrum - Grevilline D GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS SpectraSpectrum Type | Description | Splash Key | Deposition Date | Source | View |
---|
Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 10V, Positive-QTOF | splash10-0a4i-0329000000-742986c18401636ce61f | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 20V, Positive-QTOF | splash10-0adr-0926000000-7e3808fb08062e8610d0 | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 40V, Positive-QTOF | splash10-00av-4900000000-cafb3cde3c1aefb79c42 | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 10V, Negative-QTOF | splash10-0bt9-0229000000-f65fc3602987a4cfdfcc | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 20V, Negative-QTOF | splash10-0a4j-0954000000-63d24f28d9aa369f209e | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 40V, Negative-QTOF | splash10-0a4i-1900000000-b0108094c9b52850a4dc | 2016-08-03 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 10V, Negative-QTOF | splash10-0a4i-0009000000-8ad19c4fdfe860f47082 | 2021-09-22 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 20V, Negative-QTOF | splash10-052b-0397000000-bdcddd52dffa47229571 | 2021-09-22 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 40V, Negative-QTOF | splash10-0h9s-0984000000-7a0e1362e0050be83f60 | 2021-09-22 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 10V, Positive-QTOF | splash10-0a4i-0009000000-131bd73012911c56ccac | 2021-09-23 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 20V, Positive-QTOF | splash10-0a4i-0139000000-2fb729198b4670531641 | 2021-09-23 | Wishart Lab | View Spectrum | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Grevilline D 40V, Positive-QTOF | splash10-000i-0892000000-bd647c747c386c45245a | 2021-09-23 | Wishart Lab | View Spectrum |
|
---|