| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 18:47:45 UTC |
|---|
| Update Date | 2022-03-07 02:53:57 UTC |
|---|
| HMDB ID | HMDB0034021 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Artobiloxanthone |
|---|
| Description | Artobiloxanthone belongs to the class of organic compounds known as pyranoxanthones. These are organic aromatic compounds containing a pyran or a hydrogenated derivative fused to a xanthone ring system. Artobiloxanthone has been detected, but not quantified in, breadfruits (Artocarpus altilis) and fruits. This could make artobiloxanthone a potential biomarker for the consumption of these foods. Based on a literature review a small amount of articles have been published on Artobiloxanthone. |
|---|
| Structure | CC(=C)C1CC2=C(OC3=C(C(O)=CC4=C3C=CC(C)(C)O4)C2=O)C2=C1C(O)=C(O)C=C2O InChI=1S/C25H22O7/c1-10(2)12-7-13-21(29)20-15(27)9-17-11(5-6-25(3,4)32-17)23(20)31-24(13)19-14(26)8-16(28)22(30)18(12)19/h5-6,8-9,12,26-28,30H,1,7H2,2-4H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 8,9-dihydro-6,10,11,13-Tetrahydroxy-3,3-dimethyl-9-(1-methylethenyl)-3H,7H-benzo[c]pyrano[3,2-H]xanthen-7-one, 9ci | HMDB | | KB 1 | HMDB | | Artobiloxanthone | MeSH |
|
|---|
| Chemical Formula | C25H22O7 |
|---|
| Average Molecular Weight | 434.438 |
|---|
| Monoisotopic Molecular Weight | 434.136553058 |
|---|
| IUPAC Name | 11,18,19,21-tetrahydroxy-7,7-dimethyl-16-(prop-1-en-2-yl)-2,8-dioxapentacyclo[12.8.0.0³,¹².0⁴,⁹.0¹⁷,²²]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
|---|
| Traditional Name | 11,18,19,21-tetrahydroxy-7,7-dimethyl-16-(prop-1-en-2-yl)-2,8-dioxapentacyclo[12.8.0.0³,¹².0⁴,⁹.0¹⁷,²²]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
|---|
| CAS Registry Number | 121748-25-2 |
|---|
| SMILES | CC(=C)C1CC2=C(OC3=C(C(O)=CC4=C3C=CC(C)(C)O4)C2=O)C2=C1C(O)=C(O)C=C2O |
|---|
| InChI Identifier | InChI=1S/C25H22O7/c1-10(2)12-7-13-21(29)20-15(27)9-17-11(5-6-25(3,4)32-17)23(20)31-24(13)19-14(26)8-16(28)22(30)18(12)19/h5-6,8-9,12,26-28,30H,1,7H2,2-4H3 |
|---|
| InChI Key | ZIYAGIMFLYOZDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as pyranoxanthones. These are organic aromatic compounds containing a pyran or a hydrogenated derivative fused to a xanthone ring system. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Benzopyrans |
|---|
| Sub Class | 1-benzopyrans |
|---|
| Direct Parent | Pyranoxanthones |
|---|
| Alternative Parents | |
|---|
| Substituents | - Pyranoxanthone
- Naphthopyranone
- Naphthopyran
- Pyranochromene
- 2,2-dimethyl-1-benzopyran
- Chromone
- 1-naphthol
- Naphthalene
- 1-hydroxy-2-unsubstituted benzenoid
- Alkyl aryl ether
- Pyranone
- Benzenoid
- Pyran
- Vinylogous acid
- Heteroaromatic compound
- Polyol
- Oxacycle
- Ether
- Organooxygen compound
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 162 - 164 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.54 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 14.6521 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 1.57 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2828.6 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 240.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 194.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 147.9 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 209.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 803.7 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 809.1 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 123.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1253.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 559.5 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1620.8 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 461.1 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 455.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 266.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 208.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 10.8 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Artobiloxanthone,1TMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O)C=C(O)C(O)=C21 | 3745.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O)C(O[Si](C)(C)C)=C21 | 3734.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C)C(O)=C21 | 3778.0 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O)C(O)=C21 | 3762.8 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O)C(O)=C21 | 3659.7 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C)C(O)=C21 | 3687.2 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O)C=C(O)C(O[Si](C)(C)C)=C21 | 3627.4 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O)C(O[Si](C)(C)C)=C21 | 3669.3 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #5 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C21 | 3627.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TMS,isomer #6 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(O)=C21 | 3687.0 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(O)=C21 | 3666.7 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O)C(O[Si](C)(C)C)=C21 | 3631.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C21 | 3581.0 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C21 | 3603.2 | Semi standard non polar | 33892256 | | Artobiloxanthone,4TMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C21 | 3597.4 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TBDMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O)C=C(O)C(O)=C21 | 3974.9 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TBDMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O)C(O[Si](C)(C)C(C)(C)C)=C21 | 3950.7 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TBDMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(O)=C21 | 4009.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,1TBDMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(O)=C21 | 3987.1 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(O)=C21 | 4086.1 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(O)=C21 | 4136.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O)C=C(O)C(O[Si](C)(C)C(C)(C)C)=C21 | 4059.7 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(O[Si](C)(C)C(C)(C)C)=C21 | 4091.2 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #5 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C21 | 4065.0 | Semi standard non polar | 33892256 | | Artobiloxanthone,2TBDMS,isomer #6 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(O)=C21 | 4133.5 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TBDMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(O)=C21 | 4257.8 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TBDMS,isomer #2 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O)C(O[Si](C)(C)C(C)(C)C)=C21 | 4225.2 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TBDMS,isomer #3 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O)C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C21 | 4165.6 | Semi standard non polar | 33892256 | | Artobiloxanthone,3TBDMS,isomer #4 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C21 | 4180.5 | Semi standard non polar | 33892256 | | Artobiloxanthone,4TBDMS,isomer #1 | C=C(C)C1CC2=C(OC3=C4C=CC(C)(C)OC4=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C21 | 4323.3 | Semi standard non polar | 33892256 |
|
|---|