Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 19:26:48 UTC

Update Date

2022-03-07 02:54:09 UTC

HMDB ID

HMDB0034570

Secondary Accession Numbers

HMDB34570

Metabolite Identification

Common Name

Norrubrofusarin 6-beta-gentiobioside

Description

Norrubrofusarin 6-beta-gentiobioside belongs to the class of organic compounds known as naphthopyranone glycosides. Naphthopyranone glycosides are compounds containing a carbohydrate moiety glycosidically linked to a naphthopyranone moiety. Norrubrofusarin 6-beta-gentiobioside has been detected, but not quantified in, several different foods, such as arabica coffees (Coffea arabica), coffee and coffee products, herbs and spices, pulses, and robusta coffees (Coffea canephora). This could make norrubrofusarin 6-beta-gentiobioside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Norrubrofusarin 6-beta-gentiobioside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061307552D          

 41 45  0  0  0  0            999 V2000
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0  0  0  0
  8  2  2  0  0  0  0
  9  3  2  0  0  0  0
  9  4  1  0  0  0  0
 10  3  1  0  0  0  0
 10  5  2  0  0  0  0
 11  2  1  0  0  0  0
 12  4  2  0  0  0  0
 13  5  1  0  0  0  0
 14  6  1  0  0  0  0
 15  7  1  0  0  0  0
 16  9  1  0  0  0  0
 16 13  2  0  0  0  0
 17 11  1  0  0  0  0
 17 12  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 20 16  1  0  0  0  0
 20 17  2  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 24  1  0  0  0  0
 27  6  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  2  0  0  0  0
 30 18  1  0  0  0  0
 31 19  1  0  0  0  0
 32 20  1  0  0  0  0
 33 21  1  0  0  0  0
 34 22  1  0  0  0  0
 35 23  1  0  0  0  0
 36 24  1  0  0  0  0
 37  7  1  0  0  0  0
 37 25  1  0  0  0  0
 38  8  1  0  0  0  0
 38 12  1  0  0  0  0
 39 13  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  1  0  0  0  0
 40 25  1  0  0  0  0
 41 15  1  0  0  0  0
 41 26  1  0  0  0  0
M  END

HMDB0034570
     RDKit          3D
Norrubrofusarin 6-beta-gentiobioside
 71 75  0  0  0  0  0  0  0  0999 V2000
    6.7495   -2.3639   -4.5930 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8314   -1.6544   -3.6340 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4659   -1.7399   -3.7681 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6359   -1.0762   -2.8698 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3860   -1.1581   -2.9961 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1774   -0.3288   -1.8394 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4091    0.3516   -0.9164 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0659    0.3501   -0.9381 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0260    1.0937    0.1084 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    1.7743    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8765    1.6942    0.9142 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8570    2.2223    1.7167 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0270    1.2007    2.0889 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9933    0.9154    1.2188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9034   -0.2064    1.6286 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.3299    0.6126 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7808   -1.3472    0.8497 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6760   -2.2249   -0.2234 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7099   -3.1364   -0.3047 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4677   -4.0437   -1.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5285   -4.9686   -1.5687 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9736   -2.3396   -0.6192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0047   -3.1338   -1.0614 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2889   -1.5639    0.6294 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3913   -0.7392    0.3403 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1319   -0.6743    0.9442 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1700    0.4352    0.0998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8146    2.1259    0.8495 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2079    2.8666    1.9383 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8547    2.9984    0.0299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4355    2.3265   -1.0959 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2448    3.3703    0.9864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3123    4.3057    1.8823 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292    2.4969    2.0398 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2173    2.5457    2.1214 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042    3.2945    3.1584 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9824    1.8682    1.1972 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3889    1.1256    0.1689 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1468    0.4469   -0.7516 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5539   -0.2968   -1.7773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3063   -0.9378   -2.6465 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7619   -2.3829   -4.1054 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8532   -1.8017   -5.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4020   -3.4072   -4.7107 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0778   -2.3336   -4.5820 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3698   -0.0305   -1.4736 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3414    2.6395    2.6377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5071    0.5845    0.2543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3590   -1.1955    1.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3323   -0.1085    2.6296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5875   -1.8704    1.8072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8497   -3.6855    0.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4948   -4.5615   -1.4457 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4903   -3.4699   -2.4368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894   -5.8894   -1.6403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7388   -1.6060   -1.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8995   -2.8204   -0.8390 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6088   -2.2213    1.4606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1735    0.2101    0.4576 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2438   -0.3636    2.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5993    0.2421   -0.6917 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6292    1.8354    0.1605 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6928    2.3617    2.6317 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3753    3.9143   -0.3173 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4661    2.5625   -1.4147 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9844    3.9557    0.4009 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2076    4.2342    2.7246 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885    3.0492    2.7929 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0268    4.2761    3.0380 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0653    1.8885    1.2349 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2252    0.4490   -0.7316 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41  2  1  0
 40  6  1  0
 38  9  1  0
 32 12  1  0
 26 17  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  3 45  1  0
  8 46  1  0
 12 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 17 51  1  0
 19 52  1  0
 20 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 26 60  1  0
 27 61  1  0
 28 62  1  0
 29 63  1  0
 30 64  1  0
 31 65  1  0
 32 66  1  0
 33 67  1  0
 34 68  1  0
 36 69  1  0
 37 70  1  0
 39 71  1  0
M  END


  Mrv0541 05061307552D          

 41 45  0  0  0  0            999 V2000
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    8.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    8.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    7.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    9.4875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    8.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    7.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    6.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    7.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0  0  0  0
  8  2  2  0  0  0  0
  9  3  2  0  0  0  0
  9  4  1  0  0  0  0
 10  3  1  0  0  0  0
 10  5  2  0  0  0  0
 11  2  1  0  0  0  0
 12  4  2  0  0  0  0
 13  5  1  0  0  0  0
 14  6  1  0  0  0  0
 15  7  1  0  0  0  0
 16  9  1  0  0  0  0
 16 13  2  0  0  0  0
 17 11  1  0  0  0  0
 17 12  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 20 16  1  0  0  0  0
 20 17  2  0  0  0  0
 21 18  1  0  0  0  0
 22 19  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26 24  1  0  0  0  0
 27  6  1  0  0  0  0
 28 10  1  0  0  0  0
 29 11  2  0  0  0  0
 30 18  1  0  0  0  0
 31 19  1  0  0  0  0
 32 20  1  0  0  0  0
 33 21  1  0  0  0  0
 34 22  1  0  0  0  0
 35 23  1  0  0  0  0
 36 24  1  0  0  0  0
 37  7  1  0  0  0  0
 37 25  1  0  0  0  0
 38  8  1  0  0  0  0
 38 12  1  0  0  0  0
 39 13  1  0  0  0  0
 39 26  1  0  0  0  0
 40 14  1  0  0  0  0
 40 25  1  0  0  0  0
 41 15  1  0  0  0  0
 41 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034570

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1

> <INCHI_IDENTIFIER>
InChI=1S/C26H30O15/c1-8-2-11(29)17-12(38-8)4-9-3-10(28)5-13(16(9)20(17)32)39-26-24(36)22(34)19(31)15(41-26)7-37-25-23(35)21(33)18(30)14(6-27)40-25/h2-5,14-15,18-19,21-28,30-36H,6-7H2,1H3

> <INCHI_KEY>
CUEQARUDPRWNCW-UHFFFAOYSA-N

> <FORMULA>
C26H30O15

> <MOLECULAR_WEIGHT>
582.5074

> <EXACT_MASS>
582.15847029

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
56.322789509487

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,8-dihydroxy-2-methyl-6-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4H-benzo[g]chromen-4-one

> <ALOGPS_LOGP>
-0.86

> <JCHEM_LOGP>
-1.4385696779999995

> <ALOGPS_LOGS>
-2.00

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
8.85720341429956

> <JCHEM_PKA_STRONGEST_ACIDIC>
7.925136834358677

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6483773177512537

> <JCHEM_POLAR_SURFACE_AREA>
245.28999999999994

> <JCHEM_REFRACTIVITY>
134.05779999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
5.77e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,8-dihydroxy-2-methyl-6-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}benzo[g]chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034570
     RDKit          3D
Norrubrofusarin 6-beta-gentiobioside
 71 75  0  0  0  0  0  0  0  0999 V2000
    6.7495   -2.3639   -4.5930 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8314   -1.6544   -3.6340 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4659   -1.7399   -3.7681 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6359   -1.0762   -2.8698 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3860   -1.1581   -2.9961 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1774   -0.3288   -1.8394 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4091    0.3516   -0.9164 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0659    0.3501   -0.9381 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0260    1.0937    0.1084 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    1.7743    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8765    1.6942    0.9142 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8570    2.2223    1.7167 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0270    1.2007    2.0889 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9933    0.9154    1.2188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9034   -0.2064    1.6286 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.3299    0.6126 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7808   -1.3472    0.8497 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6760   -2.2249   -0.2234 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7099   -3.1364   -0.3047 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4677   -4.0437   -1.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5285   -4.9686   -1.5687 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9736   -2.3396   -0.6192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0047   -3.1338   -1.0614 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2889   -1.5639    0.6294 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3913   -0.7392    0.3403 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1319   -0.6743    0.9442 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1700    0.4352    0.0998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8146    2.1259    0.8495 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2079    2.8666    1.9383 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8547    2.9984    0.0299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4355    2.3265   -1.0959 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2448    3.3703    0.9864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3123    4.3057    1.8823 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292    2.4969    2.0398 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2173    2.5457    2.1214 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042    3.2945    3.1584 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9824    1.8682    1.1972 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3889    1.1256    0.1689 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1468    0.4469   -0.7516 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5539   -0.2968   -1.7773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3063   -0.9378   -2.6465 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7619   -2.3829   -4.1054 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8532   -1.8017   -5.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4020   -3.4072   -4.7107 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0778   -2.3336   -4.5820 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3698   -0.0305   -1.4736 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3414    2.6395    2.6377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5071    0.5845    0.2543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3590   -1.1955    1.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3323   -0.1085    2.6296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5875   -1.8704    1.8072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8497   -3.6855    0.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4948   -4.5615   -1.4457 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4903   -3.4699   -2.4368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894   -5.8894   -1.6403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7388   -1.6060   -1.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8995   -2.8204   -0.8390 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6088   -2.2213    1.4606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1735    0.2101    0.4576 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2438   -0.3636    2.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5993    0.2421   -0.6917 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6292    1.8354    0.1605 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6928    2.3617    2.6317 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3753    3.9143   -0.3173 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4661    2.5625   -1.4147 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9844    3.9557    0.4009 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2076    4.2342    2.7246 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885    3.0492    2.7929 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0268    4.2761    3.0380 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0653    1.8885    1.2349 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2252    0.4490   -0.7316 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41  2  1  0
 40  6  1  0
 38  9  1  0
 32 12  1  0
 26 17  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  3 45  1  0
  8 46  1  0
 12 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 17 51  1  0
 19 52  1  0
 20 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 26 60  1  0
 27 61  1  0
 28 62  1  0
 29 63  1  0
 30 64  1  0
 31 65  1  0
 32 66  1  0
 33 67  1  0
 34 68  1  0
 36 69  1  0
 37 70  1  0
 39 71  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       9.336  16.170   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       8.002  10.780   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002  15.400   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       8.002   9.240   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       6.668  16.170   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       9.336   8.470   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       5.335  15.400   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       9.336   6.930   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       5.335  13.860   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668  13.090   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0       9.336  17.710   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       8.002   1.540   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       0.000   6.160   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       6.668  17.710   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      10.669   9.240   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       2.667   6.160   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       4.001  16.170   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      10.669   6.160   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       4.001  13.090   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       8.002   4.620   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       6.668  11.550   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       5.335   6.160   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       8.002  13.860   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       6.668   8.470   0.000  0.00  0.00           O+0
CONECT    1    8                                                            
CONECT    2    8   11                                                       
CONECT    3    9   10                                                       
CONECT    4    9   12                                                       
CONECT    5   10   13                                                       
CONECT    6   14   27                                                       
CONECT    7   15   37                                                       
CONECT    8    1    2   38                                                  
CONECT    9    3    4   16                                                  
CONECT   10    3    5   28                                                  
CONECT   11    2   17   29                                                  
CONECT   12    4   17   38                                                  
CONECT   13    5   16   39                                                  
CONECT   14    6   18   40                                                  
CONECT   15    7   19   41                                                  
CONECT   16    9   13   20                                                  
CONECT   17   11   12   20                                                  
CONECT   18   14   21   30                                                  
CONECT   19   15   22   31                                                  
CONECT   20   16   17   32                                                  
CONECT   21   18   23   33                                                  
CONECT   22   19   24   34                                                  
CONECT   23   21   25   35                                                  
CONECT   24   22   26   36                                                  
CONECT   25   23   37   40                                                  
CONECT   26   24   39   41                                                  
CONECT   27    6                                                            
CONECT   28   10                                                            
CONECT   29   11                                                            
CONECT   30   18                                                            
CONECT   31   19                                                            
CONECT   32   20                                                            
CONECT   33   21                                                            
CONECT   34   22                                                            
CONECT   35   23                                                            
CONECT   36   24                                                            
CONECT   37    7   25                                                       
CONECT   38    8   12                                                       
CONECT   39   13   26                                                       
CONECT   40   14   25                                                       
CONECT   41   15   26                                                       
MASTER        0    0    0    0    0    0    0    0   41    0   90    0
END

COMPND    HMDB0034570
HETATM    1  C1  UNL     1       6.749  -2.364  -4.593  1.00  0.00           C  
HETATM    2  C2  UNL     1       5.831  -1.654  -3.634  1.00  0.00           C  
HETATM    3  C3  UNL     1       4.466  -1.740  -3.768  1.00  0.00           C  
HETATM    4  C4  UNL     1       3.636  -1.076  -2.870  1.00  0.00           C  
HETATM    5  O1  UNL     1       2.386  -1.158  -2.996  1.00  0.00           O  
HETATM    6  C5  UNL     1       4.177  -0.329  -1.839  1.00  0.00           C  
HETATM    7  C6  UNL     1       3.409   0.352  -0.916  1.00  0.00           C  
HETATM    8  O2  UNL     1       2.066   0.350  -0.938  1.00  0.00           O  
HETATM    9  C7  UNL     1       4.026   1.094   0.108  1.00  0.00           C  
HETATM   10  C8  UNL     1       3.222   1.774   1.037  1.00  0.00           C  
HETATM   11  O3  UNL     1       1.877   1.694   0.914  1.00  0.00           O  
HETATM   12  C9  UNL     1       0.857   2.222   1.717  1.00  0.00           C  
HETATM   13  O4  UNL     1       0.027   1.201   2.089  1.00  0.00           O  
HETATM   14  C10 UNL     1      -0.993   0.915   1.219  1.00  0.00           C  
HETATM   15  C11 UNL     1      -1.903  -0.206   1.629  1.00  0.00           C  
HETATM   16  O5  UNL     1      -2.857  -0.330   0.613  1.00  0.00           O  
HETATM   17  C12 UNL     1      -3.781  -1.347   0.850  1.00  0.00           C  
HETATM   18  O6  UNL     1      -3.676  -2.225  -0.223  1.00  0.00           O  
HETATM   19  C13 UNL     1      -4.710  -3.136  -0.305  1.00  0.00           C  
HETATM   20  C14 UNL     1      -4.468  -4.044  -1.492  1.00  0.00           C  
HETATM   21  O7  UNL     1      -5.529  -4.969  -1.569  1.00  0.00           O  
HETATM   22  C15 UNL     1      -5.974  -2.340  -0.619  1.00  0.00           C  
HETATM   23  O8  UNL     1      -7.005  -3.134  -1.061  1.00  0.00           O  
HETATM   24  C16 UNL     1      -6.289  -1.564   0.629  1.00  0.00           C  
HETATM   25  O9  UNL     1      -7.391  -0.739   0.340  1.00  0.00           O  
HETATM   26  C17 UNL     1      -5.132  -0.674   0.944  1.00  0.00           C  
HETATM   27  O10 UNL     1      -5.170   0.435   0.100  1.00  0.00           O  
HETATM   28  C18 UNL     1      -1.815   2.126   0.850  1.00  0.00           C  
HETATM   29  O11 UNL     1      -2.208   2.867   1.938  1.00  0.00           O  
HETATM   30  C19 UNL     1      -0.855   2.998   0.030  1.00  0.00           C  
HETATM   31  O12 UNL     1      -0.435   2.326  -1.096  1.00  0.00           O  
HETATM   32  C20 UNL     1       0.245   3.370   0.986  1.00  0.00           C  
HETATM   33  O13 UNL     1      -0.312   4.306   1.882  1.00  0.00           O  
HETATM   34  C21 UNL     1       3.829   2.497   2.040  1.00  0.00           C  
HETATM   35  C22 UNL     1       5.217   2.546   2.121  1.00  0.00           C  
HETATM   36  O14 UNL     1       5.804   3.295   3.158  1.00  0.00           O  
HETATM   37  C23 UNL     1       5.982   1.868   1.197  1.00  0.00           C  
HETATM   38  C24 UNL     1       5.389   1.126   0.169  1.00  0.00           C  
HETATM   39  C25 UNL     1       6.147   0.447  -0.752  1.00  0.00           C  
HETATM   40  C26 UNL     1       5.554  -0.297  -1.777  1.00  0.00           C  
HETATM   41  O15 UNL     1       6.306  -0.938  -2.647  1.00  0.00           O  
HETATM   42  H1  UNL     1       7.762  -2.383  -4.105  1.00  0.00           H  
HETATM   43  H2  UNL     1       6.853  -1.802  -5.523  1.00  0.00           H  
HETATM   44  H3  UNL     1       6.402  -3.407  -4.711  1.00  0.00           H  
HETATM   45  H4  UNL     1       4.078  -2.334  -4.582  1.00  0.00           H  
HETATM   46  H5  UNL     1       1.370  -0.031  -1.474  1.00  0.00           H  
HETATM   47  H6  UNL     1       1.341   2.639   2.638  1.00  0.00           H  
HETATM   48  H7  UNL     1      -0.507   0.585   0.254  1.00  0.00           H  
HETATM   49  H8  UNL     1      -1.359  -1.195   1.629  1.00  0.00           H  
HETATM   50  H9  UNL     1      -2.332  -0.109   2.630  1.00  0.00           H  
HETATM   51  H10 UNL     1      -3.587  -1.870   1.807  1.00  0.00           H  
HETATM   52  H11 UNL     1      -4.850  -3.686   0.631  1.00  0.00           H  
HETATM   53  H12 UNL     1      -3.495  -4.561  -1.446  1.00  0.00           H  
HETATM   54  H13 UNL     1      -4.490  -3.470  -2.437  1.00  0.00           H  
HETATM   55  H14 UNL     1      -5.189  -5.889  -1.640  1.00  0.00           H  
HETATM   56  H15 UNL     1      -5.739  -1.606  -1.426  1.00  0.00           H  
HETATM   57  H16 UNL     1      -7.899  -2.820  -0.839  1.00  0.00           H  
HETATM   58  H17 UNL     1      -6.609  -2.221   1.461  1.00  0.00           H  
HETATM   59  H18 UNL     1      -7.174   0.210   0.458  1.00  0.00           H  
HETATM   60  H19 UNL     1      -5.244  -0.364   2.012  1.00  0.00           H  
HETATM   61  H20 UNL     1      -4.599   0.242  -0.692  1.00  0.00           H  
HETATM   62  H21 UNL     1      -2.629   1.835   0.160  1.00  0.00           H  
HETATM   63  H22 UNL     1      -2.693   2.362   2.632  1.00  0.00           H  
HETATM   64  H23 UNL     1      -1.375   3.914  -0.317  1.00  0.00           H  
HETATM   65  H24 UNL     1       0.466   2.562  -1.415  1.00  0.00           H  
HETATM   66  H25 UNL     1       0.984   3.956   0.401  1.00  0.00           H  
HETATM   67  H26 UNL     1       0.208   4.234   2.725  1.00  0.00           H  
HETATM   68  H27 UNL     1       3.289   3.049   2.793  1.00  0.00           H  
HETATM   69  H28 UNL     1       6.027   4.276   3.038  1.00  0.00           H  
HETATM   70  H29 UNL     1       7.065   1.889   1.235  1.00  0.00           H  
HETATM   71  H30 UNL     1       7.225   0.449  -0.732  1.00  0.00           H  
CONECT    1    2   42   43   44
CONECT    2    3    3   41
CONECT    3    4   45
CONECT    4    5    5    6
CONECT    6    7    7   40
CONECT    7    8    9
CONECT    8   46
CONECT    9   10   10   38
CONECT   10   11   34
CONECT   11   12
CONECT   12   13   32   47
CONECT   13   14
CONECT   14   15   28   48
CONECT   15   16   49   50
CONECT   16   17
CONECT   17   18   26   51
CONECT   18   19
CONECT   19   20   22   52
CONECT   20   21   53   54
CONECT   21   55
CONECT   22   23   24   56
CONECT   23   57
CONECT   24   25   26   58
CONECT   25   59
CONECT   26   27   60
CONECT   27   61
CONECT   28   29   30   62
CONECT   29   63
CONECT   30   31   32   64
CONECT   31   65
CONECT   32   33   66
CONECT   33   67
CONECT   34   35   35   68
CONECT   35   36   37
CONECT   36   69
CONECT   37   38   38   70
CONECT   38   39
CONECT   39   40   40   71
CONECT   40   41
END

HMDB0034570
     RDKit          3D
Norrubrofusarin 6-beta-gentiobioside
 71 75  0  0  0  0  0  0  0  0999 V2000
    6.7495   -2.3639   -4.5930 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8314   -1.6544   -3.6340 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4659   -1.7399   -3.7681 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6359   -1.0762   -2.8698 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3860   -1.1581   -2.9961 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1774   -0.3288   -1.8394 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4091    0.3516   -0.9164 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0659    0.3501   -0.9381 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0260    1.0937    0.1084 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    1.7743    1.0370 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8765    1.6942    0.9142 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8570    2.2223    1.7167 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0270    1.2007    2.0889 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9933    0.9154    1.2188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9034   -0.2064    1.6286 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571   -0.3299    0.6126 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7808   -1.3472    0.8497 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6760   -2.2249   -0.2234 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7099   -3.1364   -0.3047 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4677   -4.0437   -1.4915 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5285   -4.9686   -1.5687 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9736   -2.3396   -0.6192 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0047   -3.1338   -1.0614 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2889   -1.5639    0.6294 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3913   -0.7392    0.3403 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1319   -0.6743    0.9442 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1700    0.4352    0.0998 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8146    2.1259    0.8495 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2079    2.8666    1.9383 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8547    2.9984    0.0299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4355    2.3265   -1.0959 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2448    3.3703    0.9864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3123    4.3057    1.8823 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8292    2.4969    2.0398 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2173    2.5457    2.1214 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042    3.2945    3.1584 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9824    1.8682    1.1972 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3889    1.1256    0.1689 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1468    0.4469   -0.7516 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5539   -0.2968   -1.7773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3063   -0.9378   -2.6465 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7619   -2.3829   -4.1054 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8532   -1.8017   -5.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4020   -3.4072   -4.7107 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0778   -2.3336   -4.5820 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3698   -0.0305   -1.4736 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3414    2.6395    2.6377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5071    0.5845    0.2543 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3590   -1.1955    1.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3323   -0.1085    2.6296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5875   -1.8704    1.8072 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8497   -3.6855    0.6310 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4948   -4.5615   -1.4457 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4903   -3.4699   -2.4368 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894   -5.8894   -1.6403 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7388   -1.6060   -1.4264 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8995   -2.8204   -0.8390 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6088   -2.2213    1.4606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1735    0.2101    0.4576 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2438   -0.3636    2.0120 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5993    0.2421   -0.6917 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6292    1.8354    0.1605 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6928    2.3617    2.6317 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3753    3.9143   -0.3173 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4661    2.5625   -1.4147 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9844    3.9557    0.4009 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2076    4.2342    2.7246 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885    3.0492    2.7929 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0268    4.2761    3.0380 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0653    1.8885    1.2349 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2252    0.4490   -0.7316 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 10 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41  2  1  0
 40  6  1  0
 38  9  1  0
 32 12  1  0
 26 17  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  3 45  1  0
  8 46  1  0
 12 47  1  0
 14 48  1  0
 15 49  1  0
 15 50  1  0
 17 51  1  0
 19 52  1  0
 20 53  1  0
 20 54  1  0
 21 55  1  0
 22 56  1  0
 23 57  1  0
 24 58  1  0
 25 59  1  0
 26 60  1  0
 27 61  1  0
 28 62  1  0
 29 63  1  0
 30 64  1  0
 31 65  1  0
 32 66  1  0
 33 67  1  0
 34 68  1  0
 36 69  1  0
 37 70  1  0
 39 71  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Norrubrofusarin 6-b-gentiobioside	Generator
Norrubrofusarin 6-β-gentiobioside	Generator

Chemical Formula

C₂₆H₃₀O₁₅

Average Molecular Weight

582.5074

Monoisotopic Molecular Weight

582.15847029

IUPAC Name

5,8-dihydroxy-2-methyl-6-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4H-benzo[g]chromen-4-one

Traditional Name

5,8-dihydroxy-2-methyl-6-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}benzo[g]chromen-4-one

CAS Registry Number

Not Available

SMILES

CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1

InChI Identifier

InChI=1S/C26H30O15/c1-8-2-11(29)17-12(38-8)4-9-3-10(28)5-13(16(9)20(17)32)39-26-24(36)22(34)19(31)15(41-26)7-37-25-23(35)21(33)18(30)14(6-27)40-25/h2-5,14-15,18-19,21-28,30-36H,6-7H2,1H3

InChI Key

CUEQARUDPRWNCW-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as naphthopyranone glycosides. Naphthopyranone glycosides are compounds containing a carbohydrate moiety glycosidically linked to a naphthopyranone moiety.

Kingdom

Organic compounds

Super Class

Organoheterocyclic compounds

Class

Naphthopyrans

Sub Class

Naphthopyranones

Direct Parent

Naphthopyranone glycosides

Alternative Parents

Substituents

Naphthopyranone glycoside
Phenolic glycoside
O-glycosyl compound
1-naphthol
Chromone
Disaccharide
2-naphthol
Glycosyl compound
Benzopyran
Naphthalene
1-benzopyran
Pyranone
1-hydroxy-2-unsubstituted benzenoid
1-hydroxy-4-unsubstituted benzenoid
Pyran
Oxane
Benzenoid
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Acetal
Oxacycle
Polyol
Alcohol
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Primary alcohol
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034570)
Cytoplasm (HMDB: HMDB0034570)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0034570)

Source

Exogenous

Food

Food (HMDB: HMDB0034570)

Coffee and coffee product

Coffee

Arabica coffee (FooDB: FOOD00059)
Robusta coffee (FooDB: FOOD00060)

Coffee and coffee products (FooDB: FOOD00861)

Herb and spice

Herbs and Spices (FooDB: FOOD00866)

Pulse

Pulses (FooDB: FOOD00867)

Not Available

Nutrient (HMDB: HMDB0034570)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	5.77 g/L	ALOGPS
logP	-0.86	ALOGPS
logP	-1.4	ChemAxon
logS	-2	ALOGPS
pKa (Strongest Acidic)	7.93	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	245.29 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	134.06 m³·mol⁻¹	ChemAxon
Polarizability	56.32 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	222.246	30932474
DeepCCS	[M-H]-	219.851	30932474
DeepCCS	[M-2H]-	252.735	30932474
DeepCCS	[M+Na]+	228.159	30932474
AllCCS	[M+H]+	227.1	32859911
AllCCS	[M+H-H2O]+	225.8	32859911
AllCCS	[M+NH4]+	228.3	32859911
AllCCS	[M+Na]+	228.7	32859911
AllCCS	[M-H]-	221.4	32859911
AllCCS	[M+Na-2H]-	223.4	32859911
AllCCS	[M+HCOO]-	225.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Norrubrofusarin 6-beta-gentiobioside	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5299.5	Standard polar	33892256
Norrubrofusarin 6-beta-gentiobioside	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4802.4	Standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5491.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5212.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #2	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5228.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #3	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5250.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #4	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5239.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #5	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5257.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #6	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5254.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #7	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5245.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #8	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5269.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TMS,isomer #9	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5274.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5086.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #10	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5067.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #11	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5091.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #12	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5080.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #13	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5073.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #14	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5102.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #15	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5095.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #16	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5101.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #17	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5095.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #18	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5102.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #19	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5080.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #2	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5094.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #20	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5123.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #21	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5109.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #22	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5127.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #23	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5078.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #24	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5049.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #25	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5097.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #26	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5070.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #27	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5113.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #28	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5087.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #29	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5133.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #3	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5046.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #30	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5106.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #31	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5120.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #32	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5128.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #33	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5117.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #34	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5144.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #35	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5091.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #36	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5139.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #4	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5097.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #5	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5102.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #6	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5073.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #7	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5127.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #8	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5112.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TMS,isomer #9	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5092.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4974.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #10	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4993.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #11	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4956.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #12	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5023.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #13	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4991.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #14	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4962.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #15	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4923.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #16	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4882.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #17	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4956.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #18	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4908.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #19	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4979.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #2	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4899.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #20	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4940.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #21	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5012.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #22	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4973.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #23	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4979.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #24	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5047.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #25	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4998.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #26	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5012.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #27	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4955.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #28	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5030.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #29	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5008.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #3	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4964.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #30	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5018.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #31	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5017.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #32	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4992.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #33	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5040.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #34	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5007.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #35	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5013.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #36	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4974.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #37	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4942.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #38	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4999.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #39	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4956.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #4	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4965.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #40	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5011.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #41	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4984.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #42	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5034.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #43	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5003.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #44	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5004.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #45	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5019.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #46	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4996.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #47	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5028.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #48	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4965.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #49	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5026.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #5	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4923.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #50	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5052.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #51	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5012.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #52	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4980.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #53	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5036.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #54	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4997.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #55	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5013.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #56	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4985.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #57	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5036.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #58	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4998.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #59	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5026.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #6	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4997.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #60	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5049.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #61	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5019.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #62	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5051.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #63	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4990.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #64	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5043.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #65	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5032.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #66	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4999.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #67	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5056.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #68	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5016.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #69	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4989.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #7	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4964.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #70	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5013.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #71	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4977.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #72	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5012.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #73	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4943.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #74	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4998.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #75	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	5031.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #76	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5049.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #77	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5015.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #78	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5054.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #79	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4985.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #8	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4941.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #80	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5040.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #81	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	5108.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #82	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	5014.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #83	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5041.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #84	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	5043.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,3TMS,isomer #9	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4955.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4796.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #10	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4791.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #100	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4855.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #101	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4925.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #102	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4875.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #103	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4895.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #104	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4897.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #105	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4897.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #106	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4864.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #107	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4926.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #108	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4978.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #109	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4923.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #11	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4743.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #110	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4955.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #111	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4957.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #112	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4886.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #113	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4913.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #114	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4914.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #115	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4912.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #116	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4877.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #117	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4944.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #118	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4939.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #119	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4856.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #12	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4810.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #120	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4895.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #121	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4892.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #122	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4978.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #123	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4904.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #124	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4932.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #125	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4938.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #126	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4989.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #13	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4774.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #14	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4853.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #15	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4808.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #16	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4808.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #17	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4854.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #18	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4809.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #19	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4831.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #2	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4838.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #20	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4771.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #21	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4851.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #22	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4813.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #23	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4789.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #24	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4753.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #25	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4821.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #26	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4793.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #27	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4796.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #28	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4767.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #29	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4829.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #3	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4821.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #30	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4803.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #31	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4844.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #32	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4889.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #33	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4850.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #34	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4865.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #35	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4804.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #36	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4885.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #37	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4804.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #38	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4770.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #39	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4839.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #4	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4788.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #40	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4811.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #41	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4771.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #42	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4823.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #43	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4765.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #44	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4793.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #45	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4731.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #46	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4797.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #47	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4818.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #48	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4866.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #49	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4823.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #5	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4863.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #50	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4842.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #51	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4784.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #52	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4859.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #53	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4925.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #54	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4841.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #55	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4883.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #56	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4869.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #57	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4942.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #58	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4882.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #59	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4850.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #6	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4823.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #60	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4917.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #61	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4884.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #62	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4899.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #63	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4872.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #64	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4935.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #65	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4906.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #66	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4894.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #67	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4919.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #68	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4919.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #69	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4925.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #7	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	4803.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #70	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4890.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #71	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4955.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #72	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4886.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #73	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4855.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #74	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4919.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #75	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4890.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #76	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4839.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #77	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4864.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #78	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4854.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #79	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4866.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #8	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4749.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #80	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4818.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #81	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4892.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #82	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4884.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #83	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4909.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #84	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4907.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #85	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4917.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #86	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4874.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #87	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4947.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #88	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4947.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #89	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4889.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #9	CC1=CC(=O)C2=C(O[Si](C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4713.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #90	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4917.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #91	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3C=C2O1	4920.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #92	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	4914.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #93	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4878.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #94	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4942.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #95	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O[Si](C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4922.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #96	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=C(O)C=C3C=C2O1	4871.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #97	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4897.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #98	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O[Si](C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C)C=C3C=C2O1	4895.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,4TMS,isomer #99	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C5O)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=C(O)C=C3C=C2O1	4893.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5418.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #2	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5413.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #3	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5487.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #4	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5469.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #5	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5483.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #6	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5483.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #7	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5481.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #8	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5502.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,1TBDMS,isomer #9	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5438.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #1	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5443.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #10	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5449.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #11	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5454.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #12	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5457.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #13	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5462.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #14	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5483.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #15	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5471.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #16	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5468.5	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #17	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5472.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #18	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5504.2	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #19	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5500.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #2	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5474.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #20	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5527.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #21	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5501.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #22	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5486.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #23	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5461.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #24	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5457.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #25	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5480.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #26	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5453.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #27	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5475.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #28	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5470.3	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #29	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5501.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #3	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5427.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #30	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5469.4	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #31	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5506.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #32	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5522.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #33	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5502.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #34	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5536.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #35	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5498.1	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #36	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5522.6	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #4	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5446.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #5	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=C(O)C=C3C=C2O1	5476.0	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #6	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=C(O)C=C3C=C2O1	5473.7	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #7	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=C(O)C=C3C=C2O1	5495.9	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #8	CC1=CC(=O)C2=C(O[Si](C)(C)C(C)(C)C)C3=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C=C(O[Si](C)(C)C(C)(C)C)C=C3C=C2O1	5482.8	Semi standard non polar	33892256
Norrubrofusarin 6-beta-gentiobioside,2TBDMS,isomer #9	CC1=CC(=O)C2=C(O)C3=C(OC4OC(COC5OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C5O)C(O)C(O)C4O)C=C(O)C=C3C=C2O1	5465.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0jb9-3631290000-9af2a5b7bdb296d78f3b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (1 TMS) - 70eV, Positive	splash10-000i-5620139000-99336df35fcef6678769	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS ("Norrubrofusarin 6-beta-gentiobioside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Norrubrofusarin 6-beta-gentiobioside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 10V, Positive-QTOF	splash10-0aor-0190180000-8f509c751b2d460ca64e	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 20V, Positive-QTOF	splash10-0a4i-0190110000-f3f4cf1533a14797c9d0	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 40V, Positive-QTOF	splash10-0a4l-1390000000-f8ac21cdc128bf69acdb	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 10V, Negative-QTOF	splash10-0bu0-2580290000-93b385809de23304848a	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 20V, Negative-QTOF	splash10-0a4i-2490020000-dda097c811a582dff861	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 40V, Negative-QTOF	splash10-0a4i-3390000000-53058b3f3594ceba2f69	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 10V, Negative-QTOF	splash10-001i-0030090000-4fa20511ed7285a84e2f	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 20V, Negative-QTOF	splash10-0a4i-3190420000-1d048ef9a466d667f796	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 40V, Negative-QTOF	splash10-0a4i-2090010000-35330f02831e23d096e5	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 10V, Positive-QTOF	splash10-0ab9-0090650000-085742d858ade4c81509	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 20V, Positive-QTOF	splash10-0a4i-0090000000-2c2397558d8ea9cdd3e7	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Norrubrofusarin 6-beta-gentiobioside 40V, Positive-QTOF	splash10-0a4j-0490100000-a1015a2960d2b2209ef2	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB013083

KNApSAcK ID

C00057282

Chemspider ID

74886408

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

85236943

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Norrubrofusarin 6-beta-gentiobioside (HMDB0034570)

MOL for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

3D MOL for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

3D SDF for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

3D-SDF for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

PDB for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

3D PDB for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

SMILES for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

INCHI for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

Structure for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

3D Structure for HMDB0034570 (Norrubrofusarin 6-beta-gentiobioside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra