| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 20:44:48 UTC |
|---|
| Update Date | 2023-02-21 17:24:53 UTC |
|---|
| HMDB ID | HMDB0035731 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Boric acid (H3BO3) |
|---|
| Description | Boric acid (H3BO3), also known as H3BO3 or [b(OH)3], belongs to the class of inorganic compounds known as miscellaneous borates. These are inorganic compounds in which the largest metallic oxoanion is borate, to which either no atom or a non metal atom is bonded. Boric acid (H3BO3) exists in all living organisms, ranging from bacteria to humans. Boric acid (H3BO3) is found, on average, in the highest concentration within pomegranates (Punica granatum). Boric acid (H3BO3) has also been detected, but not quantified in, a few different foods, such as figs (Ficus carica), french plantains (Musa X paradisiaca), and redcurrants (Ribes rubrum). This could make boric acid (H3bo3) a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on Boric acid (H3BO3). |
|---|
| Structure | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
|---|
| Synonyms | | Value | Source |
|---|
| [b(OH)3] | ChEBI | | b(OH)3 | ChEBI | | Boron trihydroxide | ChEBI | | H3BO3 | ChEBI | | Orthoboric acid | ChEBI | | Orthobate | Generator | | Orthobic acid | Generator | | bate (H3BO3) | Generator | | bic acid (H3BO3) | Generator | | bate | Generator, HMDB | | bic acid | Generator, HMDB | | (10b)Orthoboric acid | HMDB | | 1332-77-0 (Di-potassium salt) | HMDB | | Acidum boricum | HMDB | | Ant flip | HMDB | | Basilit b | HMDB | | Bluboro | HMDB | | Boracic acid | HMDB | | Borate | HMDB | | Borate (b4O7(2-)) | HMDB | | boric acid (BH3O3) | HMDB | | boric acid (H310BO3) | HMDB | | boric acid (JP15/nf) | HMDB | | boric acid, Acs | HMDB | | Borofax | HMDB | | Boron hydroxide | HMDB | | Collyrium eye wash | HMDB | | Dr.'S 1 flea terminator DF | HMDB | | Dr.'S 1 flea terminator dfpbo | HMDB | | Dr.'S 1 flea terminator DT | HMDB | | Dr.'S 1 flea terminator dtpbo | HMDB | | Flea prufe | HMDB | | Heptaoxotetra-borate(2-) | HMDB | | Homberg'S salt | HMDB | | Hydrogen orthoborate | HMDB | | Kill-OFF | HMDB | | Kjel-sorb | HMDB | | Orthboric acid | HMDB | | Orthoboric acid (b(OH)3) | HMDB | | Orthoboric acid (H3bo3) | HMDB | | Super flea eliminator | HMDB | | Tetraborate | HMDB | | Three elephant | HMDB | | Trihydroxidoboron | HMDB | | Trihydroxyborane | HMDB | | Trihydroxyborone | HMDB | | Boron oxide hydroxide | MeSH |
|
|---|
| Chemical Formula | BH3O3 |
|---|
| Average Molecular Weight | 61.833 |
|---|
| Monoisotopic Molecular Weight | 62.017524428 |
|---|
| IUPAC Name | boric acid |
|---|
| Traditional Name | boric acid |
|---|
| CAS Registry Number | 10043-35-3 |
|---|
| SMILES | OB(O)O |
|---|
| InChI Identifier | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
|---|
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of inorganic compounds known as miscellaneous borates. These are inorganic compounds in which the largest metallic oxoanion is borate, to which either no atom or a non metal atom is bonded. |
|---|
| Kingdom | Inorganic compounds |
|---|
| Super Class | Mixed metal/non-metal compounds |
|---|
| Class | Miscellaneous mixed metal/non-metals |
|---|
| Sub Class | Miscellaneous metallic oxoanionic compounds |
|---|
| Direct Parent | Miscellaneous borates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Borate
- Inorganic salt
- Inorganic metalloid salt
|
|---|
| Molecular Framework | Not Available |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 171 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 50 mg/mL at 25 °C | Not Available | | LogP | 0.18 | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 213.4 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1010.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 404.9 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 138.9 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 314.1 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 143.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 319.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 411.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 553.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 675.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 160.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 877.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 268.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 349.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 775.3 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 307.4 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 338.2 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatized| Metabolite | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Boric acid (H3BO3) | OB(O)O | 2097.1 | Standard polar | 33892256 | | Boric acid (H3BO3) | OB(O)O | 664.5 | Standard non polar | 33892256 | | Boric acid (H3BO3) | OB(O)O | 706.8 | Semi standard non polar | 33892256 |
|
|---|