Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (2) Show 2 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:39:34 UTC

Update Date

2022-03-07 02:55:19 UTC

HMDB ID

HMDB0037413

Secondary Accession Numbers

HMDB37413

Metabolite Identification

Common Name

3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone

Description

3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone has been detected, but not quantified in, fruits. This could make 3,6-diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061309472D          

 43 47  0  0  0  0            999 V2000
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  2  0  0  0  0
 10  5  1  0  0  0  0
 11  6  2  0  0  0  0
 12  6  1  0  0  0  0
 13  7  1  0  0  0  0
 14  8  1  0  0  0  0
 15 11  1  0  0  0  0
 16 12  2  0  0  0  0
 18 13  1  0  0  0  0
 19 14  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22 18  1  0  0  0  0
 23 19  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26  9  1  0  0  0  0
 26 17  2  0  0  0  0
 27 15  1  0  0  0  0
 27 24  1  0  0  0  0
 28 17  1  0  0  0  0
 28 25  1  0  0  0  0
 29  7  1  0  0  0  0
 30  8  1  0  0  0  0
 31 11  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  2  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39 25  1  0  0  0  0
 40  1  1  0  0  0  0
 40 10  1  0  0  0  0
 41 12  1  0  0  0  0
 41 26  1  0  0  0  0
 42 13  1  0  0  0  0
 42 27  1  0  0  0  0
 43 14  1  0  0  0  0
 43 28  1  0  0  0  0
M  END

HMDB0037413
     RDKit          3D
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone
 75 79  0  0  0  0  0  0  0  0999 V2000
   -6.4488    5.4254   -3.0201 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2530    4.7734   -1.8048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1766    3.9697   -1.4797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1238    3.6990   -2.3637 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0916    2.8858   -1.9649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0200    2.2887   -0.6866 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8116    1.5451   -0.4200 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6687    1.9700   -1.0025 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4660    1.3807   -0.8260 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6229    1.8284   -1.4379 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8518    1.2051   -1.2508 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9759    1.7203   -1.9102 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0006    0.1069   -0.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2620   -0.6262   -0.2742 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9780   -0.8566   -1.3673 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1900   -1.4930   -1.1532 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1406   -2.7869   -0.3770 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4339   -3.3570   -0.2747 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0579   -0.4603   -0.4428 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3531   -0.9657   -0.1922 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4326   -0.0079    0.8259 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8084    1.3768    0.9366 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9665   -0.1764    0.9859 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5758   -0.8309    2.1005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8103   -0.3550    0.1771 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9568   -1.4494    0.9739 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5963    0.2588   -0.0142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5340   -0.2245    0.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5191   -1.2126    1.3318 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7511    0.4404    0.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9476   -0.1781    1.0048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5060   -0.9166    2.1018 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9272   -2.1609    2.2981 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1677   -2.1892    3.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6162   -3.5156    3.3478 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0513   -3.1190    1.1463 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3398   -3.6571    1.1892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9750   -2.3822   -0.1755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6915   -3.0953   -1.1691 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5687   -1.0553   -0.0570 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9654   -1.1033    0.0730 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0508    2.5806    0.1332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1111    3.4003   -0.2489 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8896    4.7992   -3.8224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0914    6.3342   -2.8126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4620    5.8578   -3.3140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1947    4.1581   -3.3349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3110    2.7081   -2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5549    2.7013   -2.0822 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8676    1.3235   -1.7678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8822   -1.7130    0.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034   -1.7371   -2.1709 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -2.5560    0.7035 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4788   -3.5548   -0.7613 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863   -3.6094    0.6251 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2193    0.3679   -1.2060 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8504   -0.1868    0.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9793   -0.4891    1.6785 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034    1.6771    1.8604 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5670    0.9019    1.1239 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2671   -0.2159    2.8411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4729   -2.0406    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.4946    1.3509 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.6493    2.9763 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9231   -1.8382    4.2306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9564   -1.5017    2.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4674   -3.4925    3.8201 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -3.9423    1.2196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3551   -4.6240    1.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9386   -2.3797   -0.5404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6911   -2.5551   -2.0121 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4235   -0.4889   -1.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2469   -0.2611    0.5077 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0865    2.2599    1.1584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9059    3.5713    0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 13 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
  6 42  1  0
 42 43  2  0
 43  3  1  0
 30  7  2  0
 40 31  1  0
 27  9  1  0
 23 14  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
 10 49  1  0
 12 50  1  0
 14 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 22 59  1  0
 23 60  1  0
 24 61  1  0
 26 62  1  0
 31 63  1  0
 33 64  1  0
 34 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 42 74  1  0
 43 75  1  0
M  END


  Mrv0541 05061309472D          

 43 47  0  0  0  0            999 V2000
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  2  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  2  0  0  0  0
 10  5  1  0  0  0  0
 11  6  2  0  0  0  0
 12  6  1  0  0  0  0
 13  7  1  0  0  0  0
 14  8  1  0  0  0  0
 15 11  1  0  0  0  0
 16 12  2  0  0  0  0
 18 13  1  0  0  0  0
 19 14  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 16  1  0  0  0  0
 21 17  1  0  0  0  0
 22 18  1  0  0  0  0
 23 19  1  0  0  0  0
 24 22  1  0  0  0  0
 25 23  1  0  0  0  0
 26  9  1  0  0  0  0
 26 17  2  0  0  0  0
 27 15  1  0  0  0  0
 27 24  1  0  0  0  0
 28 17  1  0  0  0  0
 28 25  1  0  0  0  0
 29  7  1  0  0  0  0
 30  8  1  0  0  0  0
 31 11  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  1  0  0  0  0
 34 20  1  0  0  0  0
 35 21  2  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 24  1  0  0  0  0
 39 25  1  0  0  0  0
 40  1  1  0  0  0  0
 40 10  1  0  0  0  0
 41 12  1  0  0  0  0
 41 26  1  0  0  0  0
 42 13  1  0  0  0  0
 42 27  1  0  0  0  0
 43 14  1  0  0  0  0
 43 28  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0037413

> <DATABASE_NAME>
hmdb

> <SMILES>
COC1=CC=C(C=C1)C1=C(C2OC(CO)C(O)C(O)C2O)C(=O)C2=C(O1)C=C(O)C(C1OC(CO)C(O)C(O)C1O)=C2O

> <INCHI_IDENTIFIER>
InChI=1S/C28H32O15/c1-40-10-4-2-9(3-5-10)26-17(28-25(39)23(37)19(33)14(8-30)43-28)21(35)16-12(41-26)6-11(31)15(20(16)34)27-24(38)22(36)18(32)13(7-29)42-27/h2-6,13-14,18-19,22-25,27-34,36-39H,7-8H2,1H3

> <INCHI_KEY>
RRYBNEMBSQZZBH-UHFFFAOYSA-N

> <FORMULA>
C28H32O15

> <MOLECULAR_WEIGHT>
608.5447

> <EXACT_MASS>
608.174120354

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
59.68319024984076

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5,7-dihydroxy-2-(4-methoxyphenyl)-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.79

> <JCHEM_LOGP>
-2.779929520333332

> <ALOGPS_LOGS>
-2.03

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.838446017351341

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.140227279538342

> <JCHEM_PKA_STRONGEST_BASIC>
-3.64473089178441

> <JCHEM_POLAR_SURFACE_AREA>
256.28999999999996

> <JCHEM_REFRACTIVITY>
142.94869999999997

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
5.65e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5,7-dihydroxy-2-(4-methoxyphenyl)-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037413
     RDKit          3D
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone
 75 79  0  0  0  0  0  0  0  0999 V2000
   -6.4488    5.4254   -3.0201 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2530    4.7734   -1.8048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1766    3.9697   -1.4797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1238    3.6990   -2.3637 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0916    2.8858   -1.9649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0200    2.2887   -0.6866 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8116    1.5451   -0.4200 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6687    1.9700   -1.0025 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4660    1.3807   -0.8260 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6229    1.8284   -1.4379 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8518    1.2051   -1.2508 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9759    1.7203   -1.9102 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0006    0.1069   -0.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2620   -0.6262   -0.2742 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9780   -0.8566   -1.3673 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1900   -1.4930   -1.1532 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1406   -2.7869   -0.3770 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4339   -3.3570   -0.2747 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0579   -0.4603   -0.4428 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3531   -0.9657   -0.1922 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4326   -0.0079    0.8259 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8084    1.3768    0.9366 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9665   -0.1764    0.9859 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5758   -0.8309    2.1005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8103   -0.3550    0.1771 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9568   -1.4494    0.9739 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5963    0.2588   -0.0142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5340   -0.2245    0.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5191   -1.2126    1.3318 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7511    0.4404    0.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9476   -0.1781    1.0048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5060   -0.9166    2.1018 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9272   -2.1609    2.2981 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1677   -2.1892    3.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6162   -3.5156    3.3478 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0513   -3.1190    1.1463 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3398   -3.6571    1.1892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9750   -2.3822   -0.1755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6915   -3.0953   -1.1691 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5687   -1.0553   -0.0570 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9654   -1.1033    0.0730 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0508    2.5806    0.1332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1111    3.4003   -0.2489 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8896    4.7992   -3.8224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0914    6.3342   -2.8126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4620    5.8578   -3.3140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1947    4.1581   -3.3349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3110    2.7081   -2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5549    2.7013   -2.0822 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8676    1.3235   -1.7678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8822   -1.7130    0.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034   -1.7371   -2.1709 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -2.5560    0.7035 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4788   -3.5548   -0.7613 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863   -3.6094    0.6251 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2193    0.3679   -1.2060 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8504   -0.1868    0.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9793   -0.4891    1.6785 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034    1.6771    1.8604 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5670    0.9019    1.1239 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2671   -0.2159    2.8411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4729   -2.0406    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.4946    1.3509 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.6493    2.9763 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9231   -1.8382    4.2306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9564   -1.5017    2.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4674   -3.4925    3.8201 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -3.9423    1.2196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3551   -4.6240    1.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9386   -2.3797   -0.5404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6911   -2.5551   -2.0121 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4235   -0.4889   -1.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2469   -0.2611    0.5077 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0865    2.2599    1.1584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9059    3.5713    0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 13 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
  6 42  1  0
 42 43  2  0
 43  3  1  0
 30  7  2  0
 40 31  1  0
 27  9  1  0
 23 14  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
 10 49  1  0
 12 50  1  0
 14 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 22 59  1  0
 23 60  1  0
 24 61  1  0
 26 62  1  0
 31 63  1  0
 33 64  1  0
 34 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 42 74  1  0
 43 75  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -4.001  -6.930   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       9.336  -2.310   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -4.001  -5.390   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       8.002  -3.080   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       8.002  -4.620   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      -5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0      -5.335  -7.700   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -6.668  -5.390   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       9.336  -5.390   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      -6.668  -2.310   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       6.668  -6.930   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -4.001  -0.770   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       4.001  -5.390   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      -2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       6.668  -2.310   0.000  0.00  0.00           O+0
CONECT    1   40                                                            
CONECT    2    4    9                                                       
CONECT    3    5    9                                                       
CONECT    4    2   10                                                       
CONECT    5    3   10                                                       
CONECT    6   11   12                                                       
CONECT    7   13   29                                                       
CONECT    8   14   30                                                       
CONECT    9    2    3   26                                                  
CONECT   10    4    5   40                                                  
CONECT   11    6   15   31                                                  
CONECT   12    6   16   41                                                  
CONECT   13    7   18   42                                                  
CONECT   14    8   19   43                                                  
CONECT   15   11   20   27                                                  
CONECT   16   12   20   21                                                  
CONECT   17   21   26   28                                                  
CONECT   18   13   22   32                                                  
CONECT   19   14   23   33                                                  
CONECT   20   15   16   34                                                  
CONECT   21   16   17   35                                                  
CONECT   22   18   24   36                                                  
CONECT   23   19   25   37                                                  
CONECT   24   22   27   38                                                  
CONECT   25   23   28   39                                                  
CONECT   26    9   17   41                                                  
CONECT   27   15   24   42                                                  
CONECT   28   17   25   43                                                  
CONECT   29    7                                                            
CONECT   30    8                                                            
CONECT   31   11                                                            
CONECT   32   18                                                            
CONECT   33   19                                                            
CONECT   34   20                                                            
CONECT   35   21                                                            
CONECT   36   22                                                            
CONECT   37   23                                                            
CONECT   38   24                                                            
CONECT   39   25                                                            
CONECT   40    1   10                                                       
CONECT   41   12   26                                                       
CONECT   42   13   27                                                       
CONECT   43   14   28                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0037413
HETATM    1  C1  UNL     1      -6.449   5.425  -3.020  1.00  0.00           C  
HETATM    2  O1  UNL     1      -6.253   4.773  -1.805  1.00  0.00           O  
HETATM    3  C2  UNL     1      -5.177   3.970  -1.480  1.00  0.00           C  
HETATM    4  C3  UNL     1      -4.124   3.699  -2.364  1.00  0.00           C  
HETATM    5  C4  UNL     1      -3.092   2.886  -1.965  1.00  0.00           C  
HETATM    6  C5  UNL     1      -3.020   2.289  -0.687  1.00  0.00           C  
HETATM    7  C6  UNL     1      -1.812   1.545  -0.420  1.00  0.00           C  
HETATM    8  O2  UNL     1      -0.669   1.970  -1.003  1.00  0.00           O  
HETATM    9  C7  UNL     1       0.466   1.381  -0.826  1.00  0.00           C  
HETATM   10  C8  UNL     1       1.623   1.828  -1.438  1.00  0.00           C  
HETATM   11  C9  UNL     1       2.852   1.205  -1.251  1.00  0.00           C  
HETATM   12  O3  UNL     1       3.976   1.720  -1.910  1.00  0.00           O  
HETATM   13  C10 UNL     1       3.001   0.107  -0.446  1.00  0.00           C  
HETATM   14  C11 UNL     1       4.262  -0.626  -0.274  1.00  0.00           C  
HETATM   15  O4  UNL     1       4.978  -0.857  -1.367  1.00  0.00           O  
HETATM   16  C12 UNL     1       6.190  -1.493  -1.153  1.00  0.00           C  
HETATM   17  C13 UNL     1       6.141  -2.787  -0.377  1.00  0.00           C  
HETATM   18  O5  UNL     1       7.434  -3.357  -0.275  1.00  0.00           O  
HETATM   19  C14 UNL     1       7.058  -0.460  -0.443  1.00  0.00           C  
HETATM   20  O6  UNL     1       8.353  -0.966  -0.192  1.00  0.00           O  
HETATM   21  C15 UNL     1       6.433  -0.008   0.826  1.00  0.00           C  
HETATM   22  O7  UNL     1       6.808   1.377   0.937  1.00  0.00           O  
HETATM   23  C16 UNL     1       4.966  -0.176   0.986  1.00  0.00           C  
HETATM   24  O8  UNL     1       4.576  -0.831   2.101  1.00  0.00           O  
HETATM   25  C17 UNL     1       1.810  -0.355   0.177  1.00  0.00           C  
HETATM   26  O9  UNL     1       1.957  -1.449   0.974  1.00  0.00           O  
HETATM   27  C18 UNL     1       0.596   0.259  -0.014  1.00  0.00           C  
HETATM   28  C19 UNL     1      -0.534  -0.225   0.597  1.00  0.00           C  
HETATM   29  O10 UNL     1      -0.519  -1.213   1.332  1.00  0.00           O  
HETATM   30  C20 UNL     1      -1.751   0.440   0.375  1.00  0.00           C  
HETATM   31  C21 UNL     1      -2.948  -0.178   1.005  1.00  0.00           C  
HETATM   32  O11 UNL     1      -2.506  -0.917   2.102  1.00  0.00           O  
HETATM   33  C22 UNL     1      -2.927  -2.161   2.298  1.00  0.00           C  
HETATM   34  C23 UNL     1      -4.168  -2.189   3.181  1.00  0.00           C  
HETATM   35  O12 UNL     1      -4.616  -3.516   3.348  1.00  0.00           O  
HETATM   36  C24 UNL     1      -3.051  -3.119   1.146  1.00  0.00           C  
HETATM   37  O13 UNL     1      -4.340  -3.657   1.189  1.00  0.00           O  
HETATM   38  C25 UNL     1      -2.975  -2.382  -0.176  1.00  0.00           C  
HETATM   39  O14 UNL     1      -3.692  -3.095  -1.169  1.00  0.00           O  
HETATM   40  C26 UNL     1      -3.569  -1.055  -0.057  1.00  0.00           C  
HETATM   41  O15 UNL     1      -4.965  -1.103   0.073  1.00  0.00           O  
HETATM   42  C27 UNL     1      -4.051   2.581   0.133  1.00  0.00           C  
HETATM   43  C28 UNL     1      -5.111   3.400  -0.249  1.00  0.00           C  
HETATM   44  H1  UNL     1      -6.890   4.799  -3.822  1.00  0.00           H  
HETATM   45  H2  UNL     1      -7.091   6.334  -2.813  1.00  0.00           H  
HETATM   46  H3  UNL     1      -5.462   5.858  -3.314  1.00  0.00           H  
HETATM   47  H4  UNL     1      -4.195   4.158  -3.335  1.00  0.00           H  
HETATM   48  H5  UNL     1      -2.311   2.708  -2.698  1.00  0.00           H  
HETATM   49  H6  UNL     1       1.555   2.701  -2.082  1.00  0.00           H  
HETATM   50  H7  UNL     1       4.868   1.324  -1.768  1.00  0.00           H  
HETATM   51  H8  UNL     1       3.882  -1.713   0.019  1.00  0.00           H  
HETATM   52  H9  UNL     1       6.603  -1.737  -2.171  1.00  0.00           H  
HETATM   53  H10 UNL     1       5.895  -2.556   0.704  1.00  0.00           H  
HETATM   54  H11 UNL     1       5.479  -3.555  -0.761  1.00  0.00           H  
HETATM   55  H12 UNL     1       7.686  -3.609   0.625  1.00  0.00           H  
HETATM   56  H13 UNL     1       7.219   0.368  -1.206  1.00  0.00           H  
HETATM   57  H14 UNL     1       8.850  -0.187   0.221  1.00  0.00           H  
HETATM   58  H15 UNL     1       6.979  -0.489   1.679  1.00  0.00           H  
HETATM   59  H16 UNL     1       6.603   1.677   1.860  1.00  0.00           H  
HETATM   60  H17 UNL     1       4.567   0.902   1.124  1.00  0.00           H  
HETATM   61  H18 UNL     1       4.267  -0.216   2.841  1.00  0.00           H  
HETATM   62  H19 UNL     1       1.473  -2.041   1.531  1.00  0.00           H  
HETATM   63  H20 UNL     1      -3.669   0.495   1.351  1.00  0.00           H  
HETATM   64  H21 UNL     1      -2.140  -2.649   2.976  1.00  0.00           H  
HETATM   65  H22 UNL     1      -3.923  -1.838   4.231  1.00  0.00           H  
HETATM   66  H23 UNL     1      -4.956  -1.502   2.844  1.00  0.00           H  
HETATM   67  H24 UNL     1      -5.467  -3.493   3.820  1.00  0.00           H  
HETATM   68  H25 UNL     1      -2.338  -3.942   1.220  1.00  0.00           H  
HETATM   69  H26 UNL     1      -4.355  -4.624   1.192  1.00  0.00           H  
HETATM   70  H27 UNL     1      -1.939  -2.380  -0.540  1.00  0.00           H  
HETATM   71  H28 UNL     1      -3.691  -2.555  -2.012  1.00  0.00           H  
HETATM   72  H29 UNL     1      -3.424  -0.489  -1.033  1.00  0.00           H  
HETATM   73  H30 UNL     1      -5.247  -0.261   0.508  1.00  0.00           H  
HETATM   74  H31 UNL     1      -4.086   2.260   1.158  1.00  0.00           H  
HETATM   75  H32 UNL     1      -5.906   3.571   0.488  1.00  0.00           H  
CONECT    1    2   44   45   46
CONECT    2    3
CONECT    3    4    4   43
CONECT    4    5   47
CONECT    5    6    6   48
CONECT    6    7   42
CONECT    7    8   30   30
CONECT    8    9
CONECT    9   10   10   27
CONECT   10   11   49
CONECT   11   12   13   13
CONECT   12   50
CONECT   13   14   25
CONECT   14   15   23   51
CONECT   15   16
CONECT   16   17   19   52
CONECT   17   18   53   54
CONECT   18   55
CONECT   19   20   21   56
CONECT   20   57
CONECT   21   22   23   58
CONECT   22   59
CONECT   23   24   60
CONECT   24   61
CONECT   25   26   27   27
CONECT   26   62
CONECT   27   28
CONECT   28   29   29   30
CONECT   30   31
CONECT   31   32   40   63
CONECT   32   33
CONECT   33   34   36   64
CONECT   34   35   65   66
CONECT   35   67
CONECT   36   37   38   68
CONECT   37   69
CONECT   38   39   40   70
CONECT   39   71
CONECT   40   41   72
CONECT   41   73
CONECT   42   43   43   74
CONECT   43   75
END

HMDB0037413
     RDKit          3D
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone
 75 79  0  0  0  0  0  0  0  0999 V2000
   -6.4488    5.4254   -3.0201 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2530    4.7734   -1.8048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1766    3.9697   -1.4797 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1238    3.6990   -2.3637 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0916    2.8858   -1.9649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0200    2.2887   -0.6866 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8116    1.5451   -0.4200 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6687    1.9700   -1.0025 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4660    1.3807   -0.8260 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6229    1.8284   -1.4379 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8518    1.2051   -1.2508 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9759    1.7203   -1.9102 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0006    0.1069   -0.4456 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2620   -0.6262   -0.2742 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9780   -0.8566   -1.3673 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1900   -1.4930   -1.1532 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1406   -2.7869   -0.3770 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4339   -3.3570   -0.2747 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0579   -0.4603   -0.4428 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3531   -0.9657   -0.1922 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4326   -0.0079    0.8259 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8084    1.3768    0.9366 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9665   -0.1764    0.9859 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5758   -0.8309    2.1005 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8103   -0.3550    0.1771 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9568   -1.4494    0.9739 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5963    0.2588   -0.0142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5340   -0.2245    0.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5191   -1.2126    1.3318 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7511    0.4404    0.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9476   -0.1781    1.0048 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5060   -0.9166    2.1018 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9272   -2.1609    2.2981 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1677   -2.1892    3.1809 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6162   -3.5156    3.3478 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0513   -3.1190    1.1463 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3398   -3.6571    1.1892 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9750   -2.3822   -0.1755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6915   -3.0953   -1.1691 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5687   -1.0553   -0.0570 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9654   -1.1033    0.0730 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0508    2.5806    0.1332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1111    3.4003   -0.2489 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8896    4.7992   -3.8224 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0914    6.3342   -2.8126 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4620    5.8578   -3.3140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1947    4.1581   -3.3349 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3110    2.7081   -2.6975 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5549    2.7013   -2.0822 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8676    1.3235   -1.7678 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8822   -1.7130    0.0191 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034   -1.7371   -2.1709 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953   -2.5560    0.7035 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4788   -3.5548   -0.7613 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6863   -3.6094    0.6251 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2193    0.3679   -1.2060 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8504   -0.1868    0.2211 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9793   -0.4891    1.6785 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6034    1.6771    1.8604 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.5670    0.9019    1.1239 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2671   -0.2159    2.8411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4729   -2.0406    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6688    0.4946    1.3509 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402   -2.6493    2.9763 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9231   -1.8382    4.2306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9564   -1.5017    2.8436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4674   -3.4925    3.8201 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -3.9423    1.2196 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3551   -4.6240    1.1922 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9386   -2.3797   -0.5404 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6911   -2.5551   -2.0121 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4235   -0.4889   -1.0335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2469   -0.2611    0.5077 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0865    2.2599    1.1584 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9059    3.5713    0.4884 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 13 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
  6 42  1  0
 42 43  2  0
 43  3  1  0
 30  7  2  0
 40 31  1  0
 27  9  1  0
 23 14  1  0
  1 44  1  0
  1 45  1  0
  1 46  1  0
  4 47  1  0
  5 48  1  0
 10 49  1  0
 12 50  1  0
 14 51  1  0
 16 52  1  0
 17 53  1  0
 17 54  1  0
 18 55  1  0
 19 56  1  0
 20 57  1  0
 21 58  1  0
 22 59  1  0
 23 60  1  0
 24 61  1  0
 26 62  1  0
 31 63  1  0
 33 64  1  0
 34 65  1  0
 34 66  1  0
 35 67  1  0
 36 68  1  0
 37 69  1  0
 38 70  1  0
 39 71  1  0
 40 72  1  0
 41 73  1  0
 42 74  1  0
 43 75  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
3,6-Di-C-glucopyranosylacacetin	HMDB
3,6-Diglucopyranosylacacetin	HMDB
3,6-Diglucosylacacetin	HMDB

Chemical Formula

C₂₈H₃₂O₁₅

Average Molecular Weight

608.5447

Monoisotopic Molecular Weight

608.174120354

IUPAC Name

5,7-dihydroxy-2-(4-methoxyphenyl)-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one

Traditional Name

5,7-dihydroxy-2-(4-methoxyphenyl)-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one

CAS Registry Number

98891-91-9

SMILES

COC1=CC=C(C=C1)C1=C(C2OC(CO)C(O)C(O)C2O)C(=O)C2=C(O1)C=C(O)C(C1OC(CO)C(O)C(O)C1O)=C2O

InChI Identifier

InChI=1S/C28H32O15/c1-40-10-4-2-9(3-5-10)26-17(28-25(39)23(37)19(33)14(8-30)43-28)21(35)16-12(41-26)6-11(31)15(20(16)34)27-24(38)22(36)18(32)13(7-29)42-27/h2-6,13-14,18-19,22-25,27-34,36-39H,7-8H2,1H3

InChI Key

RRYBNEMBSQZZBH-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid C-glycosides

Alternative Parents

Substituents

Flavonoid c-glycoside
4p-methoxyflavonoid-skeleton
Hydroxyflavonoid
Flavone
5-hydroxyflavonoid
7-hydroxyflavonoid
Phenolic glycoside
Hexose monosaccharide
C-glycosyl compound
Chromone
Glycosyl compound
Benzopyran
1-benzopyran
Anisole
Methoxybenzene
Phenol ether
Phenoxy compound
Alkyl aryl ether
1-hydroxy-2-unsubstituted benzenoid
1-hydroxy-4-unsubstituted benzenoid
Pyranone
Monocyclic benzene moiety
Benzenoid
Pyran
Oxane
Monosaccharide
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Ether
Dialkyl ether
Organoheterocyclic compound
Oxacycle
Polyol
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Primary alcohol
Alcohol
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0037413)
Cytoplasm (HMDB: HMDB0037413)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0037413)

Source

Exogenous

Food

Food (HMDB: HMDB0037413)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0037413)

Not Available

Nutrient (HMDB: HMDB0037413)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	210 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	30560 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	5.65 g/L	ALOGPS
logP	-0.79	ALOGPS
logP	-2.8	ChemAxon
logS	-2	ALOGPS
pKa (Strongest Acidic)	6.14	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	256.29 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	142.95 m³·mol⁻¹	ChemAxon
Polarizability	59.68 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	231.307	30932474
DeepCCS	[M-H]-	228.911	30932474
DeepCCS	[M-2H]-	262.075	30932474
DeepCCS	[M+Na]+	237.085	30932474
AllCCS	[M+H]+	237.7	32859911
AllCCS	[M+H-H2O]+	236.3	32859911
AllCCS	[M+NH4]+	238.9	32859911
AllCCS	[M+Na]+	239.3	32859911
AllCCS	[M-H]-	238.5	32859911
AllCCS	[M+Na-2H]-	241.1	32859911
AllCCS	[M+HCOO]-	244.2	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone	COC1=CC=C(C=C1)C1=C(C2OC(CO)C(O)C(O)C2O)C(=O)C2=C(O1)C=C(O)C(C1OC(CO)C(O)C(O)C1O)=C2O	5190.0	Standard polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone	COC1=CC=C(C=C1)C1=C(C2OC(CO)C(O)C(O)C2O)C(=O)C2=C(O1)C=C(O)C(C1OC(CO)C(O)C(O)C1O)=C2O	4835.7	Standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone	COC1=CC=C(C=C1)C1=C(C2OC(CO)C(O)C(O)C2O)C(=O)C2=C(O1)C=C(O)C(C1OC(CO)C(O)C(O)C1O)=C2O	5710.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5528.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5556.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5576.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5577.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5558.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5578.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5529.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5571.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5572.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5555.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5452.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5467.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #11	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5419.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #12	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5430.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #13	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5414.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #14	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5435.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #15	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5449.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #16	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5462.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #17	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5448.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #18	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5454.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #19	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5413.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5411.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #20	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5414.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #21	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5406.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #22	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5423.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #23	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5438.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #24	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5457.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #25	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5470.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #26	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5419.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #27	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5435.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #28	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5421.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #29	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5439.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5411.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #30	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5452.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #31	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5455.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #32	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5467.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #33	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5451.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #34	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5468.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #35	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5520.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #36	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5437.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #37	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5427.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #38	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5434.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #39	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5441.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5406.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #40	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5455.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #41	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5445.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #42	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5452.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #43	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5457.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #44	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5436.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #45	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5453.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5417.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5437.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5441.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5431.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5433.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5293.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5246.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #100	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5283.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #101	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5329.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #102	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5303.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #103	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5327.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #104	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5327.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #105	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5345.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #106	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5347.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #107	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5342.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #108	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5346.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #109	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5305.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #11	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5268.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #110	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5350.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #111	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5313.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #112	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5319.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #113	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5282.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #114	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5307.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #115	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5256.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #116	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5276.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #117	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5376.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #118	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5295.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #119	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5293.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #12	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5251.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #120	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5293.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #13	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5279.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #14	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5249.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #15	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5272.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #16	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5295.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #17	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5292.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #18	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5259.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #19	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5295.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5308.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #20	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5276.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #21	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5296.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #22	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5297.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #23	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5230.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #24	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5278.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #25	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5257.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #26	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5279.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #27	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5256.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #28	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5301.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #29	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5282.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5276.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #30	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5302.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #31	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5280.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #32	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5257.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #33	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5282.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #34	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5320.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #35	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5323.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #36	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5310.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #37	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5308.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #38	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5322.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #39	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5295.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5308.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #40	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5329.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #41	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5338.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #42	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5349.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #43	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5351.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #44	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5296.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #45	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5274.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #46	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5297.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #47	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5259.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #48	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5299.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #49	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5293.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5323.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #50	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5321.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #51	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5322.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #52	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5270.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #53	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5322.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #54	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5321.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #55	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5328.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #56	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5241.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #57	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5306.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #58	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5306.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #59	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5273.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5328.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #60	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5331.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #61	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5332.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #62	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5296.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #63	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5299.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #64	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5379.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #65	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5279.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #66	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5299.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #67	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5272.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #68	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5309.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #69	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5304.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5304.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #70	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5348.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #71	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5278.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #72	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5256.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #73	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5280.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #74	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5233.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #75	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5297.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #76	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5306.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #77	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5306.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #78	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5246.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #79	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5323.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5330.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #80	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5312.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #81	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5215.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #82	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5308.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #83	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5252.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #84	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5333.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #85	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5298.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #86	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5311.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #87	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5333.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #88	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5311.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #89	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5342.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5275.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #90	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5348.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #91	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5300.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #92	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5277.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #93	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5300.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #94	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5264.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #95	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5326.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #96	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5328.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #97	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5282.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #98	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5335.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,3TMS,isomer #99	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5256.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5141.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5124.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #100	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5135.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #101	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5163.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #102	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5166.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #103	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5149.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #104	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5161.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #105	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5231.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #106	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5161.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #107	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5169.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #108	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5099.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #109	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5146.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #11	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5147.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #110	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5149.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #111	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5156.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #112	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5071.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #113	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5124.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #114	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5129.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #115	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5103.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #116	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5157.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #117	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5164.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #118	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5099.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #119	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5111.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #12	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5124.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #120	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5176.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #121	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5205.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #122	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5101.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #123	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5172.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #124	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5173.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #125	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5099.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #126	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5167.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #127	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5174.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #128	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5106.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #129	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5111.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #13	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5160.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #130	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5199.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #131	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5096.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #132	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5175.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #133	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5179.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #134	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5085.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #135	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5090.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #136	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5184.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #137	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5105.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #138	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5116.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #139	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5209.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #14	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5141.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #140	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5173.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #141	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5123.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #142	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5102.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #143	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5124.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #144	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5087.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #145	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5151.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #146	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5144.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #147	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5129.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #148	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5105.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #149	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5164.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #15	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5081.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #150	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5139.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #151	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5080.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #152	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5145.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #153	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5107.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #154	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5168.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #155	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5156.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #156	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5139.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #157	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5142.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #158	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5074.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #159	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5148.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #16	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5119.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #160	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5132.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #161	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5049.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #162	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5129.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #163	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5076.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #164	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5161.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #165	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5104.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #166	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5184.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #167	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5085.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #168	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5177.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #169	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5080.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #17	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5101.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #170	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5174.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #171	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5108.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #172	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5079.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #173	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5183.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #174	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5089.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #175	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5112.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #176	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5157.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #177	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5135.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #178	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5162.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #179	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5139.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #18	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5133.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #180	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5171.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #181	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5167.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #182	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5150.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #183	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5170.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #184	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5118.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #185	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5153.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #186	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5166.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #187	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5173.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #188	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5111.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #189	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5161.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #19	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5124.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #190	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5086.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #191	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5117.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #192	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5213.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #193	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5115.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #194	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5119.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #195	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5115.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #196	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5181.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #197	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5187.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #198	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5161.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #199	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5173.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5106.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #20	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5144.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #200	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5126.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #201	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5162.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #202	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5222.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #203	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5152.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #204	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5156.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #205	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5153.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #206	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5213.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #207	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5136.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #208	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5144.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #209	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5126.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #21	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5125.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #210	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5166.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #22	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5161.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #23	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5147.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #24	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5118.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #25	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5162.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #26	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5182.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #27	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5195.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #28	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5180.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #29	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5141.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5141.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #30	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5152.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #31	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5099.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #32	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5136.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #33	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5106.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #34	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5141.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #35	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5136.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #36	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5063.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #37	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5107.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #38	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5087.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #39	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5116.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5123.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #40	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5098.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #41	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5143.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #42	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5114.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #43	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5151.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #44	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5097.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #45	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5065.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #46	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5109.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #47	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5141.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #48	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5152.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #49	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5134.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5140.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #50	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5181.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #51	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5095.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #52	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5154.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #53	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5127.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #54	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5164.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #55	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5098.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #56	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5153.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #57	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5128.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #58	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5165.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #59	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5098.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5109.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #60	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5075.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #61	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5115.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #62	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5155.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #63	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5164.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #64	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5151.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #65	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5091.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #66	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5156.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #67	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5130.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #68	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5166.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #69	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5067.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5152.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #70	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5048.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #71	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5085.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #72	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5137.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #73	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5144.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #74	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O)C=C3O2)C=C1	5134.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #75	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5095.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #76	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5072.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #77	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5114.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #78	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5159.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #79	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5171.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5143.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #80	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C(O)C=C3O2)C=C1	5156.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #81	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5136.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #82	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5152.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #83	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5132.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #84	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5215.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #85	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5147.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #86	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5119.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #87	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5149.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #88	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5125.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #89	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5148.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5142.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #90	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5155.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #91	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5158.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #92	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5146.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #93	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5130.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #94	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5163.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #95	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5159.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #96	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C=C3O2)C=C1	5154.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #97	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5100.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #98	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5145.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,4TMS,isomer #99	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C=C3O2)C=C1	5138.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5735.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5774.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5809.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5817.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5802.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5774.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5735.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5802.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5812.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,1TBDMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5802.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #1	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5847.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #10	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5862.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #11	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5812.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #12	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5821.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #13	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5829.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #14	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5847.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #15	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5849.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #16	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5857.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #17	COC1=CC=C(C2=C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5862.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #18	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5873.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #19	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5817.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #2	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5806.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #20	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5827.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #21	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5840.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #22	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5853.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #23	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5859.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #24	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5864.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #25	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5878.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #26	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5822.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #27	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5841.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #28	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5850.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #29	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5862.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #3	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5806.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #30	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5867.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #31	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5849.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #32	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5861.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #33	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5870.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #34	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5875.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #35	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C=C3O2)C=C1	5915.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #36	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5827.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #37	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5844.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #38	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5847.9	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #39	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5838.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #4	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5816.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #40	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5855.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #41	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5861.6	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #42	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C=C3O2)C=C1	5849.1	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #43	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5866.7	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #44	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C=C3O2)C=C1	5857.3	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #45	COC1=CC=C(C2=C(C3OC(CO)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5861.4	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #5	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C=C3O2)C=C1	5825.2	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #6	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O)C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5837.8	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #7	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5834.0	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #8	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5846.5	Semi standard non polar	33892256
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone,2TBDMS,isomer #9	COC1=CC=C(C2=C(C3OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C(=O)C3=C(O)C(C4OC(CO)C(O)C(O)C4O)=C(O)C=C3O2)C=C1	5843.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (Non-derivatized) - 70eV, Positive	splash10-016v-1000290000-6e9f3a9a9358c80633d0	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 10V, Positive-QTOF	splash10-0a4l-0000296000-b17820264184210eade0	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 20V, Positive-QTOF	splash10-0596-1200391000-203fddd834b27da8d626	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 40V, Positive-QTOF	splash10-007a-1007940000-0968c6615160dc18f29b	2016-06-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 10V, Negative-QTOF	splash10-0a4i-1000489000-74a0fc99bf3bdaf587d8	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 20V, Negative-QTOF	splash10-052r-3001591000-0a3a8560b0c5b41aa931	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 40V, Negative-QTOF	splash10-0uxr-6205690000-aeeb7e7eb3ae844a72ec	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 10V, Negative-QTOF	splash10-0a4i-0000009000-34014b8d94ae6b50f899	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 20V, Negative-QTOF	splash10-0a4i-0000009000-34014b8d94ae6b50f899	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 40V, Negative-QTOF	splash10-01p9-0019001000-7d12a48175388c570c83	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 10V, Positive-QTOF	splash10-0a4i-0000009000-5173fa625817f68f2d64	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 20V, Positive-QTOF	splash10-0a4i-0000009000-5173fa625817f68f2d64	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone 40V, Positive-QTOF	splash10-066r-0029005000-de6b4907ff90dc6fa91d	2021-09-22	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016459

KNApSAcK ID

C00006286

Chemspider ID

35014417

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74977543

PDB ID

Not Available

ChEBI ID

176216

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1860681

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Sulfotransferase family cytosolic 2B member 1

General function:: Involved in sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of many hormones, neurotransmitters, drugs and xenobiotic compounds. Sulfonation increases the water solubility of most compounds, and therefore their renal excretion, but it can also result in bioactivation to form active metabolites. Sulfates hydroxysteroids like DHEA. Isoform 1 preferentially sulfonates cholesterol, and isoform 2 avidly sulfonates pregnenolone but not cholesterol.
Gene Name:: SULT2B1
Uniprot ID:: O00204
Molecular weight:: 39598.595

Reactions

3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → ({6-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → ({6-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-3-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {2-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {2-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {6-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {2-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-3-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {2-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-3-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → {6-[5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-3-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details

Enzyme Details

2. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → 3,4,5-trihydroxy-6-{[7-hydroxy-2-(4-methoxyphenyl)-4-oxo-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-5-yl]oxy}oxane-2-carboxylic acid	details
3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone → 3,4,5-trihydroxy-6-{[5-hydroxy-2-(4-methoxyphenyl)-4-oxo-3,6-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-7-yl]oxy}oxane-2-carboxylic acid	details

Showing metabocard for 3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone (HMDB0037413)

MOL for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

3D MOL for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

3D SDF for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

3D-SDF for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

PDB for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

3D PDB for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

SMILES for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

INCHI for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

Structure for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

3D Structure for HMDB0037413 (3,6-Diglucopyranosyl-5,7-dihydroxy-4'-methoxyflavone)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions