Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-11 23:14:53 UTC
Update Date2021-09-14 15:44:45 UTC
HMDB IDHMDB0037977
Secondary Accession Numbers
  • HMDB37977
Metabolite Identification
Common NameCyanidin 3-galactoside
DescriptionCyanidin 3-galactoside, also known as idaein, belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Cyanidin 3-galactoside is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, cyanidin 3-galactoside is found, on average, in the highest concentration in a few different foods, such as black chokeberries, lingonberries, and bilberries and in a lower concentration in american cranberries, highbush blueberries, and gooseberries. cyanidin 3-galactoside has also been detected, but not quantified in, several different foods, such as sweet cherries, sparkleberries, summer grapes, nuts, and red raspberries. This could make cyanidin 3-galactoside a potential biomarker for the consumption of these foods. An anthocyanin cation that is cyanidin(1+) carrying a single beta-D-galactosyl substituent at position 3.
Structure
Data?1563863119
Synonyms
ValueSource
Cyanidin 3-O-galactosideChEBI
Cyanidin 3-O-beta-D-galactosideKegg
Cyanidin 3-O-b-D-galactosideGenerator
Cyanidin 3-O-β-D-galactosideGenerator
Cyanidin 3-O-beta-D-galactopyranosideHMDB
IdaeinHMDB
IdeinHMDB
Cy3-galMeSH
2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-galactopyranoside chlorideMeSH
Cyanidin 3-galactosideMeSH
Chemical FormulaC21H21O11
Average Molecular Weight449.3848
Monoisotopic Molecular Weight449.108386514
IUPAC Name2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-{[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium
Traditional Namecyanidin 3-O-β-D-galactoside
CAS Registry Number27661-36-5
SMILES
OC[C@H]1O[C@@H](OC2=CC3=C(C=C(O)C=C3O)[O+]=C2C2=CC(O)=C(O)C=C2)[C@H](O)[C@@H](O)[C@H]1O
InChI Identifier
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17+,18+,19-,21-/m1/s1
InChI KeyRKWHWFONKJEUEF-WVXKDWSHSA-O
Chemical Taxonomy
Description Belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position.
KingdomOrganic compounds
Super ClassPhenylpropanoids and polyketides
ClassFlavonoids
Sub ClassFlavonoid glycosides
Direct ParentAnthocyanidin-3-O-glycosides
Alternative Parents
Substituents
  • Anthocyanidin-3-o-glycoside
  • Flavonoid-3-o-glycoside
  • Hydroxyflavonoid
  • 3'-hydroxyflavonoid
  • 4'-hydroxyflavonoid
  • 7-hydroxyflavonoid
  • 5-hydroxyflavonoid
  • Anthocyanidin
  • Hexose monosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Benzopyran
  • 1-benzopyran
  • Catechol
  • 1-hydroxy-4-unsubstituted benzenoid
  • Phenol
  • 1-hydroxy-2-unsubstituted benzenoid
  • Monocyclic benzene moiety
  • Benzenoid
  • Oxane
  • Monosaccharide
  • Heteroaromatic compound
  • Secondary alcohol
  • Organoheterocyclic compound
  • Oxacycle
  • Polyol
  • Acetal
  • Primary alcohol
  • Hydrocarbon derivative
  • Organic oxygen compound
  • Alcohol
  • Organooxygen compound
  • Organic cation
  • Aromatic heteropolycyclic compound
Molecular FrameworkAromatic heteropolycyclic compounds
External Descriptors
Ontology
Disposition

Biological location

Source

Route of exposure

Physical Properties
StateNot Available
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Spectral PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility0.6 g/LALOGPS
logP10(0.98) g/LALOGPS
logP10(0.39) g/LChemAxon
logS10(-2.9) g/LALOGPS
pKa (Strongest Acidic)6.39ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count10ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area193.44 ŲChemAxon
Rotatable Bond Count4ChemAxon
Refractivity116.26 m³·mol⁻¹ChemAxon
Polarizability43.04 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterYesChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Spectral Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+200.56531661259
DarkChem[M-H]-196.8931661259

Predicted Kovats Retention Indices

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Cyanidin 3-galactoside,1TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4248.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#2C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14341.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#3C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C=C124288.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#4C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=CC=C1O4288.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#5C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O4276.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#6C[Si](C)(C)O[C@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@H](CO)[C@H](O)[C@@H]1O4294.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#7C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@@H]1O4274.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TMS,#8C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@H]1O4272.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4129.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4141.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4112.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4113.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O4177.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O4163.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#7C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C4170.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#8C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14138.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#9C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14144.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#10C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14148.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#11C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14170.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#12C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C14131.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#13C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C14143.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#14C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O4142.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#15C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=CC=C1O4149.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#16C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C=C124136.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#17C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C=C124142.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#18C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C=C124162.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#19C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=CC=C1O4130.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#20C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=CC=C1O4133.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#21C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=CC=C1O4159.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#22C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C4159.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#23C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)C=C1O4121.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#24C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O4125.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#25C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O4151.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#26C[Si](C)(C)O[C@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@H](CO)[C@H](O[Si](C)(C)C)[C@@H]1O4154.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@@H]1O[Si](C)(C)C4178.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TMS,#28C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@H]1O[Si](C)(C)C4156.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O3975.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O3953.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3948.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O4036.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O4011.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C4034.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#7C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O3944.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#8C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3945.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#9C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O4034.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#10C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O4009.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C4035.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4022.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O4019.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3990.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C4017.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O4016.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3984.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#18C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C4016.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#19C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O4072.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#20C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C4100.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#21C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4066.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#22C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13983.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#23C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13966.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#24C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13991.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#25C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13968.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#26C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13982.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#27C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14031.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#28C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14027.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#29C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13941.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#30C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13947.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#31C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14038.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#32C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13924.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#33C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13929.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#34C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13951.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#35C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13958.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#36C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13999.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#37C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)C=C1O3946.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#38C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O3932.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#39C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O3956.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#40C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C3998.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#41C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=CC=C1O3947.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#42C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=CC=C1O3931.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#43C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=CC=C1O3957.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#44C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C=C124026.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#45C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C=C124025.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#46C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C124035.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#47C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=CC=C1O4006.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#48C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=CC=C1O4005.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#49C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C4031.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#51C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O[Si](C)(C)C4022.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#52C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C4043.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#53C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O4006.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#54C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O4007.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#55C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O4022.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#56C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@@H]1CO4072.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O3876.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3879.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3907.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3876.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3916.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3889.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#7C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3855.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#8C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3827.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#9C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3868.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#10C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3849.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3822.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3863.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3957.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3986.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3961.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3910.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3867.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#18C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3843.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#19C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3882.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#20C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3860.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#21C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3836.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#22C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3874.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#23C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3967.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#24C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3993.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#25C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3973.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#26C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3956.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#27C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3923.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#28C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3964.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#29C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3931.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#30C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3960.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#31C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3935.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#32C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3925.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#33C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3950.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#34C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3930.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#35C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4065.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#36C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13896.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#37C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13896.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#38C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13881.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#39C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13891.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#40C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13904.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#41C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13867.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#42C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13872.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#43C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13880.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#44C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13890.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#45C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13933.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#46C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13999.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#47C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13868.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#48C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13865.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#49C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13868.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#50C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13863.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#51C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13919.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#52C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13870.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#53C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13867.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#54C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13892.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#55C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13915.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#56C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O3854.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#57C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O3856.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#58C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C3904.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#59C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O3859.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#60C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O[Si](C)(C)C3882.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#61C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3902.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#62C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=CC=C1O3853.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#63C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=CC=C1O3852.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#65C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C=C123987.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#67C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O[Si](C)(C)C3957.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#68C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3959.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#69C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3965.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,4TMS,#70C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O3960.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O3881.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3846.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3833.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3852.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3851.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3838.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#7C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3856.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#8C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3849.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#9C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3867.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#10C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3863.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3875.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3850.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3887.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3833.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3849.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3845.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3830.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#18C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3843.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#19C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3843.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#20C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3965.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#21C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3890.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#22C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3866.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#23C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3905.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#24C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3848.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#25C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3866.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#26C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3863.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#27C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3844.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#28C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3860.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#29C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3859.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#30C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3985.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#31C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3913.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#32C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3931.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#33C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3923.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#34C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3931.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#35C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3923.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#36C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C13873.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#37C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13865.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#38C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13870.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#39C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13859.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#40C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13863.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#41C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13891.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#42C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13854.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#43C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13858.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#44C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13880.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#45C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13892.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#46C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13879.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#47C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13875.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#48C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13893.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#49C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13889.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#50C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13891.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#51C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O3867.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#52C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)C=C1O[Si](C)(C)C3881.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#53C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3877.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#54C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3878.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,5TMS,#56C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3952.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3875.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3859.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3877.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3843.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3848.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3855.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#7C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3850.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#8C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3856.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#9C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3863.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#10C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3874.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3873.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3881.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3881.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3875.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3876.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3887.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3897.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#18C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3899.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#19C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3891.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#20C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3889.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#21C[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3943.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#22C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13869.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#23C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13874.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#24C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13888.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#25C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13877.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#26C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13875.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#27C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)C(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13905.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,6TMS,#28C[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C3897.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4530.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#2CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14584.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#3CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C=C124560.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#4CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=CC=C1O4567.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#5CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O4572.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#6CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@H](CO)[C@H](O)[C@@H]1O4555.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#7CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@@H]1O4538.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,1TBDMS,#8CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@H]1O4540.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4612.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4621.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4626.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4615.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O4665.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4638.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4643.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#8CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14623.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#9CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14633.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#10CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14637.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#11CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14652.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#12CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14637.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#13CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14626.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#14CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O4621.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#15CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=CC=C1O4608.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#16CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C=C124625.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#17CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C124631.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#18CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C124645.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#19CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=CC=C1O4616.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#20CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=CC=C1O4620.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#21CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O4642.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#22CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C4661.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#23CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C=C1O4622.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#24CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C=C1O4626.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#25CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O4651.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#26CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4666.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#27CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@@H]1O[Si](C)(C)C(C)(C)C4681.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,2TBDMS,#28CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4648.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4682.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4686.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4673.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O4687.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4654.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4677.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O4709.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4698.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O4696.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4669.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4692.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O4705.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O4681.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4647.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4667.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O4664.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4633.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4652.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4712.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4745.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4715.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#22CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14708.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#23CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14700.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#24CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14713.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#25CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14780.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#26CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14763.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#27CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14687.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#28CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14700.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#29CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14718.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#30CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14708.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#31CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O)=C3)=[O+]C2=C14713.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#32CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14712.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#33CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14701.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#34CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14728.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#35CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14716.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#36CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14751.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#37CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C=C1O4697.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#38CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C=C1O4694.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#39CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O4710.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#40CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C4728.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#41CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=CC=C1O4686.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#42CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=CC=C1O4682.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#43CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O4696.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#44CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C124671.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#45CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)C=C124687.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#46CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC=C(O)C(O)=C3)=C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)C=C124698.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#47CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=CC=C1O4655.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#48CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O4667.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#49CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C4715.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#50CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O4683.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#51CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C4710.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#52CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C4730.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#53CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C=C1O4663.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#54CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O4677.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#55CC(C)(C)[Si](C)(C)OC1=CC=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O4694.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TBDMS,#56CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC=C(O)C(O)=C2)O[C@@H]1CO4726.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Cyanidin 3-galactoside,3TMS,#50C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=CC=C1O4022.7Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Cyanidin 3-galactoside,4TMS,#64C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=CC=C1O3857.4Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Cyanidin 3-galactoside,4TMS,#66C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=CC=C1O3957.6Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Cyanidin 3-galactoside,5TMS,#55C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=CC=C1O3864.8Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (Non-derivatized) - 70eV, Positivesplash10-001r-9613500000-4ecd805029dccd975fed2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (3 TMS) - 70eV, Positivesplash10-0002-6620019000-8d5ae8efad054c2ab4aa2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (TMS_3_50) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (TMS_4_64) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (TMS_4_66) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (TMS_5_55) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Cyanidin 3-galactoside GC-MS ("Cyanidin 3-galactoside,3TMS,#50" TMS) - 70eV, PositiveNot Available2021-10-14Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , negative-QTOFsplash10-001j-0190300000-066e4efe2ad20a1bf6182017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , negative-QTOFsplash10-0170-0982400000-096c82f5e6fc50eb3a1f2017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , negative-QTOFsplash10-001i-0090000000-a98c476e0842377a0be62017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , negative-QTOFsplash10-014m-0950000000-b95724097dd0841523e62017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , negative-QTOFsplash10-001j-0090300000-4118b3f51610a89ec6bd2017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , positive-QTOFsplash10-000i-0090100000-34fecd8af8ace7f092c02017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , positive-QTOFsplash10-000i-0090000000-fc644549112cedb4265f2017-09-14HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - Cyanidin 3-galactoside LC-ESI-QTOF , positive-QTOFsplash10-000i-0090100000-0407b88d0009c9229fdf2017-09-14HMDB team, MONAView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 10V, Positive-QTOFsplash10-0udi-0100900000-66702edb3ac17b9bcd2f2016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 20V, Positive-QTOFsplash10-0002-1300900000-733c7273cc2b516ea7fd2016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 40V, Positive-QTOFsplash10-01ot-6910000000-5dad4cb81406b2f0a2412016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 10V, Negative-QTOFsplash10-0002-2300900000-5d1238580ea9280c81902016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 20V, Negative-QTOFsplash10-0002-6800900000-f91084c3d800ee4ef8942016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 40V, Negative-QTOFsplash10-0596-9300000000-1ee778ebb732d2be0d872016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 10V, Positive-QTOFsplash10-000j-0061900000-b3d22fc8233274bb4ac22021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 20V, Positive-QTOFsplash10-000i-0091200000-218723bb02667d2114f52021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Cyanidin 3-galactoside 40V, Positive-QTOFsplash10-009i-2091100000-e8b2df5780fffa75ac4a2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
  • Extracellular
Biospecimen Locations
  • Blood
  • Urine
Tissue LocationsNot Available
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 8 details
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound ID8
FooDB IDFDB017159
KNApSAcK IDC00006652
Chemspider ID390306
KEGG Compound IDC08647
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound441699
PDB IDNot Available
ChEBI ID27475
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .