| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.51 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 12.3211 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.43 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 102.1 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1481.1 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 243.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 70.5 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 167.2 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 77.5 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 370.1 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 447.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 169.5 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 767.3 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 307.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1202.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 245.9 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 242.2 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 400.3 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 297.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 215.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-(Methylthio)ethyl glucosinolate,1TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O | 3145.4 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O | 3117.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O | 3116.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C | 3121.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O)C1O | 3187.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O | 3112.1 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #10 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C | 3118.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O | 3110.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C | 3104.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O | 3117.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 3119.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #6 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3110.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #7 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O | 3117.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #8 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3113.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TMS,isomer #9 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O | 3115.4 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 3036.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #10 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3044.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3023.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O | 3034.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3029.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O | 3039.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #6 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C | 3032.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #7 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3046.4 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #8 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 3062.6 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TMS,isomer #9 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3054.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3007.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 3013.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3005.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3009.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2997.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,5TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2977.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,5TMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3385.1 | Standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TBDMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O | 3386.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TBDMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3378.1 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TBDMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3381.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TBDMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3382.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,1TBDMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O)C1O | 3420.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3511.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #10 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3548.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3553.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3506.5 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O | 3549.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3542.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #6 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3527.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #7 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3544.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #8 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3535.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,2TBDMS,isomer #9 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3548.8 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3681.6 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #10 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3665.6 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3656.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3668.3 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3667.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3685.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #6 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3661.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #7 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3659.7 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #8 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3678.4 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,3TBDMS,isomer #9 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3671.6 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TBDMS,isomer #1 | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3782.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TBDMS,isomer #2 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3833.2 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TBDMS,isomer #3 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3818.9 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TBDMS,isomer #4 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3814.0 | Semi standard non polar | 33892256 |
| 2-(Methylthio)ethyl glucosinolate,4TBDMS,isomer #5 | CSCC/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3788.6 | Semi standard non polar | 33892256 |