Showing metabocard for Mabioside A (HMDB0038886)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 00:14:06 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:55:58 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0038886 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Mabioside A | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Mabioside A is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, mabioside a has been detected, but not quantified in, beverages. This could make mabioside a a potential biomarker for the consumption of these foods. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0038886 (Mabioside A)Mrv0541 02011302472D 69 76 0 0 0 0 999 V2000 -3.3020 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0164 -10.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0164 -11.7941 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3020 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -11.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -10.9691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8730 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8730 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -11.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -10.9691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1586 -9.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8730 -9.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -10.5566 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4441 -9.7316 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2704 -10.9691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9848 -10.5566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2624 -8.4259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4419 -8.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -9.3191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9848 -9.7316 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5979 -9.1796 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8853 -12.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7186 -12.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -11.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -8.9066 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -10.1441 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7385 -10.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4049 -9.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9569 -8.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7639 -8.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3159 -8.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0188 -9.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1101 -7.8991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2703 -13.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6829 -13.9375 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5079 -13.9375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9204 -13.2231 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5079 -12.5086 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6829 -12.5086 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2704 -11.7941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9204 -11.7941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7454 -13.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9204 -14.6520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -14.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6829 -15.3665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1599 -12.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8743 -12.6191 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8743 -13.4441 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1598 -13.8567 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4454 -13.4442 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4454 -12.6191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7309 -12.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7309 -13.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1599 -14.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 -13.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0177 -11.3816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -10.9691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4467 -11.3816 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4467 -12.2066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7322 -12.6191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0177 -12.2066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3033 -12.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -13.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1612 -12.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1612 -10.9691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 1 6 1 0 0 0 0 7 6 1 0 0 0 0 6 5 1 0 0 0 0 5 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 13 1 0 0 0 0 7 10 1 0 0 0 0 12 7 1 0 0 0 0 11 12 1 0 0 0 0 11 14 1 0 0 0 0 19 14 1 0 0 0 0 14 13 1 0 0 0 0 13 15 1 0 0 0 0 15 16 1 0 0 0 0 16 20 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 20 21 1 0 0 0 0 17 21 1 0 0 0 0 19 20 1 0 0 0 0 3 54 1 1 0 0 0 4 22 1 0 0 0 0 4 23 1 0 0 0 0 6 24 1 1 0 0 0 10 25 1 1 0 0 0 13 26 1 6 0 0 0 14 27 1 1 0 0 0 15 42 1 6 0 0 0 19 28 1 1 0 0 0 20 29 1 1 0 0 0 21 30 1 6 0 0 0 30 31 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 18 35 2 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 36 41 1 0 0 0 0 41 42 1 1 0 0 0 40 43 1 6 0 0 0 39 44 1 1 0 0 0 38 45 1 6 0 0 0 37 46 1 1 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 48 53 1 0 0 0 0 53 54 1 1 0 0 0 52 55 1 6 0 0 0 51 56 1 1 0 0 0 50 57 1 6 0 0 0 49 58 1 1 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 59 64 1 0 0 0 0 64 65 1 1 0 0 0 63 66 1 6 0 0 0 62 67 1 6 0 0 0 61 68 1 1 0 0 0 60 69 1 6 0 0 0 M END 3D MOL for HMDB0038886 (Mabioside A)HMDB0038886 RDKit 3D Mabioside A 145152 0 0 0 0 0 0 0 0999 V2000 -10.1706 4.6701 -0.8283 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2173 3.5672 -0.5042 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7092 3.3503 0.8778 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7817 2.7351 -1.4514 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8358 1.6193 -1.1973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6031 1.8945 -2.0319 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9990 3.1167 -1.6857 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6208 3.0298 -1.7616 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8461 3.9898 -1.5843 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2866 1.6586 -2.0748 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1051 1.0513 -1.4262 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8600 1.8199 -1.6261 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6994 0.9730 -1.1924 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0761 -0.2574 -0.3953 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2341 -0.8653 0.1354 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1312 -2.3472 0.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2686 -0.9400 -0.9492 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2920 0.0907 -1.0141 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7361 0.7513 0.2476 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1402 0.7480 0.3686 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7310 1.9735 0.3379 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5019 2.0564 -0.8079 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7340 1.4313 -0.7632 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6782 -0.0346 -0.4318 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9488 -0.5738 -0.4596 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5950 -0.5726 -1.6651 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8632 -1.8877 -2.1082 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5311 -2.6213 -1.1336 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8240 -3.9823 -1.7119 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8471 -1.9758 -0.7506 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8197 -1.4778 0.5435 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0814 -0.8462 -1.7362 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2623 -1.2973 -3.0230 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9337 0.1450 -1.6605 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0388 1.0316 -2.7250 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6874 2.1072 0.1981 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5407 2.9288 -0.5388 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8703 3.0336 1.0753 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5737 3.5204 2.1563 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6082 2.3177 1.5101 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8800 3.2003 2.3408 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2001 0.0615 1.4363 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4707 0.9770 2.6479 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0189 -1.1836 1.7359 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7097 -0.2436 1.3989 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0225 0.9465 1.8719 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3903 1.2342 1.4542 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0603 0.1106 0.6316 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3776 -0.8862 1.6957 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3436 0.5558 0.0087 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9514 1.7138 0.8332 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4333 -0.4055 -0.1978 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9675 -1.1826 0.7523 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2825 -2.4305 0.2627 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6832 -2.4305 0.1361 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3638 -2.8306 1.2417 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1902 -1.9630 2.4645 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9503 -2.4841 3.5226 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1466 -4.2792 1.4938 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9373 -4.9817 0.5531 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7345 -4.6682 1.2993 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2995 -5.3167 2.4784 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7630 -3.5401 1.0630 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6849 -4.1298 0.3584 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5673 0.4552 -0.5243 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5229 0.8657 -1.8207 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7005 -0.2736 -2.8057 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7772 4.8499 0.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8227 4.3885 -1.6818 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6302 5.5955 -1.1534 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9774 4.1800 1.5588 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1142 2.3790 1.2276 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 3.2978 0.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1349 2.8801 -2.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3372 0.6872 -1.5277 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6147 1.5058 -0.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8332 1.9258 -3.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1046 1.5918 -3.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9297 0.0880 -2.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8456 2.0042 -2.7564 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8497 2.8618 -1.2582 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2494 0.6060 -2.1411 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0053 1.6536 -0.6623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4687 -1.0129 -1.1137 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7330 -3.0205 0.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2096 -2.5536 1.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9479 -2.6913 -0.2440 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7711 -1.0534 -1.9601 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7890 -1.9503 -0.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2345 -0.3623 -1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0940 0.9123 -1.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4831 1.8508 0.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9832 2.8141 0.2364 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1631 1.5354 -1.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0273 -0.5721 -1.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1778 -0.2391 0.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9698 -0.1231 -2.4361 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9323 -2.7258 -0.1961 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8524 -4.4420 -1.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3643 -4.5981 -0.9803 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4913 -3.8689 -2.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7086 -2.6645 -0.8314 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7051 -1.5519 0.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9867 -0.2976 -1.4022 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6197 -0.9006 -3.6753 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0356 0.6396 -0.6764 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8791 1.5508 -2.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3017 1.4115 0.7658 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4587 2.9615 -0.1918 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5841 3.9015 0.4354 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3312 4.4914 2.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8461 1.4610 2.1529 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4963 3.9410 1.8023 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4053 2.0347 2.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9530 0.6314 3.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5699 0.8143 2.8939 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0592 -1.0864 1.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6006 -2.0958 1.2781 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1419 -1.3155 2.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6673 -1.0460 2.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0506 0.9381 3.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6015 1.8620 1.6267 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0260 1.3902 2.3814 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4741 2.2172 0.9483 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3068 -0.4889 2.2139 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6735 -0.8559 2.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4684 -1.9057 1.3816 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9861 1.3955 1.8870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3915 2.6394 0.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0420 1.8490 0.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2773 -1.0173 -1.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9518 -2.5154 -0.8162 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4630 -2.7268 0.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1546 -1.9273 2.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5923 -0.9456 2.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4083 -3.1795 3.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5439 -4.5738 2.4914 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8118 -5.1765 0.9251 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6446 -5.4388 0.5037 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4636 -5.8007 2.2123 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3296 -3.2051 2.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6544 -5.1017 0.4720 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7029 -0.4858 -3.2169 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3530 0.0940 -3.6500 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2135 -1.1385 -2.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 23 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 19 42 1 0 42 43 1 0 42 44 1 0 42 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 1 48 50 1 0 50 51 1 1 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 52 65 1 0 65 66 1 0 66 67 1 6 66 6 1 0 66 10 1 0 50 11 1 0 63 54 1 0 48 14 1 0 45 15 1 0 40 21 1 0 34 26 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 6 77 1 6 10 78 1 6 11 79 1 6 12 80 1 0 12 81 1 0 13 82 1 0 13 83 1 0 14 84 1 0 16 85 1 0 16 86 1 0 16 87 1 0 17 88 1 0 17 89 1 0 18 90 1 0 18 91 1 0 19 92 1 6 21 93 1 6 23 94 1 6 24 95 1 0 24 96 1 0 26 97 1 6 28 98 1 1 29 99 1 0 29100 1 0 29101 1 0 30102 1 1 31103 1 0 32104 1 1 33105 1 0 34106 1 1 35107 1 0 36108 1 1 37109 1 0 38110 1 6 39111 1 0 40112 1 1 41113 1 0 43114 1 0 43115 1 0 43116 1 0 44117 1 0 44118 1 0 44119 1 0 45120 1 0 46121 1 0 46122 1 0 47123 1 0 47124 1 0 49125 1 0 49126 1 0 49127 1 0 51128 1 0 51129 1 0 51130 1 0 52131 1 6 54132 1 6 56133 1 6 57134 1 0 57135 1 0 58136 1 0 59137 1 1 60138 1 0 61139 1 6 62140 1 0 63141 1 1 64142 1 0 67143 1 0 67144 1 0 67145 1 0 M END 3D SDF for HMDB0038886 (Mabioside A)Mrv0541 02011302472D 69 76 0 0 0 0 999 V2000 -3.3020 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0164 -10.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0164 -11.7941 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3020 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -11.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -10.9691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8730 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8730 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -11.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -10.9691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1586 -9.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8730 -9.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -10.5566 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4441 -9.7316 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2704 -10.9691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9848 -10.5566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2624 -8.4259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4419 -8.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -9.3191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9848 -9.7316 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5979 -9.1796 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8853 -12.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7186 -12.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5875 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1586 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -11.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4441 -8.9066 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -10.1441 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7385 -10.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4049 -9.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9569 -8.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7639 -8.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3159 -8.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0188 -9.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1101 -7.8991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2703 -13.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6829 -13.9375 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5079 -13.9375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9204 -13.2231 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5079 -12.5086 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6829 -12.5086 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2704 -11.7941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9204 -11.7941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7454 -13.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9204 -14.6520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2704 -14.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6829 -15.3665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1599 -12.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8743 -12.6191 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8743 -13.4441 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1598 -13.8567 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4454 -13.4442 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4454 -12.6191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7309 -12.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7309 -13.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1599 -14.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 -13.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 -12.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0177 -11.3816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -10.9691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4467 -11.3816 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4467 -12.2066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7322 -12.6191 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0177 -12.2066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3033 -12.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -13.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1612 -12.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1612 -10.9691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7322 -10.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 1 6 1 0 0 0 0 7 6 1 0 0 0 0 6 5 1 0 0 0 0 5 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 13 1 0 0 0 0 7 10 1 0 0 0 0 12 7 1 0 0 0 0 11 12 1 0 0 0 0 11 14 1 0 0 0 0 19 14 1 0 0 0 0 14 13 1 0 0 0 0 13 15 1 0 0 0 0 15 16 1 0 0 0 0 16 20 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 20 21 1 0 0 0 0 17 21 1 0 0 0 0 19 20 1 0 0 0 0 3 54 1 1 0 0 0 4 22 1 0 0 0 0 4 23 1 0 0 0 0 6 24 1 1 0 0 0 10 25 1 1 0 0 0 13 26 1 6 0 0 0 14 27 1 1 0 0 0 15 42 1 6 0 0 0 19 28 1 1 0 0 0 20 29 1 1 0 0 0 21 30 1 6 0 0 0 30 31 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 18 35 2 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 36 41 1 0 0 0 0 41 42 1 1 0 0 0 40 43 1 6 0 0 0 39 44 1 1 0 0 0 38 45 1 6 0 0 0 37 46 1 1 0 0 0 46 47 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 48 53 1 0 0 0 0 53 54 1 1 0 0 0 52 55 1 6 0 0 0 51 56 1 1 0 0 0 50 57 1 6 0 0 0 49 58 1 1 0 0 0 58 65 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 59 64 1 0 0 0 0 64 65 1 1 0 0 0 63 66 1 6 0 0 0 62 67 1 6 0 0 0 61 68 1 1 0 0 0 60 69 1 6 0 0 0 M END > <DATABASE_ID> HMDB0038886 > <DATABASE_NAME> hmdb > <SMILES> [H][C@@]12C(=O)O[C@H](CC=C(C)C)[C@]1(C)O[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]1(C)[C@]2([H])CCC2[C@@]3(C)CC[C@H](O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)C(C)(C)C3CC[C@@]12C > <INCHI_IDENTIFIER> InChI=1S/C48H78O19/c1-20(2)10-13-28-48(9)29(39(59)64-28)22-11-12-26-45(6)16-15-27(65-41-37(57)35(55)32(52)24(63-41)19-60-40-36(56)33(53)30(50)21(3)61-40)44(4,5)25(45)14-17-46(26,7)47(22,8)43(67-48)66-42-38(58)34(54)31(51)23(18-49)62-42/h10,21-38,40-43,49-58H,11-19H2,1-9H3/t21-,22+,23+,24+,25?,26?,27-,28+,29+,30-,31+,32+,33+,34-,35-,36+,37+,38+,40+,41-,42-,43-,45-,46+,47-,48-/m0/s1 > <INCHI_KEY> JDYBTMHCHWARHS-UZTDFSENSA-N > <FORMULA> C48H78O19 > <MOLECULAR_WEIGHT> 959.1215 > <EXACT_MASS> 958.513730314 > <JCHEM_ACCEPTOR_COUNT> 18 > <JCHEM_AVERAGE_POLARIZABILITY> 102.09333477840306 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (1R,2R,3R,5R,6R,9S,10R,14R,17S)-1,2,5,14,18,18-hexamethyl-6-(3-methylbut-2-en-1-yl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-17-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4,7-dioxapentacyclo[11.8.0.0²,¹⁰.0⁵,⁹.0¹⁴,¹⁹]henicosan-8-one > <ALOGPS_LOGP> 1.81 > <JCHEM_LOGP> 1.1587866729999998 > <ALOGPS_LOGS> -3.30 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.200714864273083 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.755650031315525 > <JCHEM_PKA_STRONGEST_BASIC> -3.6483797256474935 > <JCHEM_POLAR_SURFACE_AREA> 293.21 > <JCHEM_REFRACTIVITY> 231.91990000000007 > <JCHEM_ROTATABLE_BOND_COUNT> 10 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 4.85e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> (1R,2R,3R,5R,6R,9S,10R,14R,17S)-1,2,5,14,18,18-hexamethyl-6-(3-methylbut-2-en-1-yl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-17-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4,7-dioxapentacyclo[11.8.0.0²,¹⁰.0⁵,⁹.0¹⁴,¹⁹]henicosan-8-one > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0038886 (Mabioside A)HMDB0038886 RDKit 3D Mabioside A 145152 0 0 0 0 0 0 0 0999 V2000 -10.1706 4.6701 -0.8283 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2173 3.5672 -0.5042 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7092 3.3503 0.8778 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7817 2.7351 -1.4514 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8358 1.6193 -1.1973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6031 1.8945 -2.0319 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9990 3.1167 -1.6857 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6208 3.0298 -1.7616 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8461 3.9898 -1.5843 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2866 1.6586 -2.0748 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1051 1.0513 -1.4262 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8600 1.8199 -1.6261 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6994 0.9730 -1.1924 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0761 -0.2574 -0.3953 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2341 -0.8653 0.1354 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1312 -2.3472 0.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2686 -0.9400 -0.9492 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2920 0.0907 -1.0141 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7361 0.7513 0.2476 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1402 0.7480 0.3686 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7310 1.9735 0.3379 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5019 2.0564 -0.8079 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7340 1.4313 -0.7632 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6782 -0.0346 -0.4318 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9488 -0.5738 -0.4596 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5950 -0.5726 -1.6651 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8632 -1.8877 -2.1082 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5311 -2.6213 -1.1336 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8240 -3.9823 -1.7119 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8471 -1.9758 -0.7506 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8197 -1.4778 0.5435 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0814 -0.8462 -1.7362 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2623 -1.2973 -3.0230 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9337 0.1450 -1.6605 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0388 1.0316 -2.7250 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6874 2.1072 0.1981 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5407 2.9288 -0.5388 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8703 3.0336 1.0753 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5737 3.5204 2.1563 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6082 2.3177 1.5101 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8800 3.2003 2.3408 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2001 0.0615 1.4363 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4707 0.9770 2.6479 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0189 -1.1836 1.7359 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7097 -0.2436 1.3989 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0225 0.9465 1.8719 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3903 1.2342 1.4542 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0603 0.1106 0.6316 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3776 -0.8862 1.6957 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3436 0.5558 0.0087 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9514 1.7138 0.8332 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4333 -0.4055 -0.1978 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9675 -1.1826 0.7523 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2825 -2.4305 0.2627 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6832 -2.4305 0.1361 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3638 -2.8306 1.2417 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1902 -1.9630 2.4645 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9503 -2.4841 3.5226 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1466 -4.2792 1.4938 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9373 -4.9817 0.5531 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7345 -4.6682 1.2993 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2995 -5.3167 2.4784 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7630 -3.5401 1.0630 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6849 -4.1298 0.3584 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5673 0.4552 -0.5243 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5229 0.8657 -1.8207 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7005 -0.2736 -2.8057 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7772 4.8499 0.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8227 4.3885 -1.6818 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6302 5.5955 -1.1534 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9774 4.1800 1.5588 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1142 2.3790 1.2276 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5888 3.2978 0.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1349 2.8801 -2.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3372 0.6872 -1.5277 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6147 1.5058 -0.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8332 1.9258 -3.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1046 1.5918 -3.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9297 0.0880 -2.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8456 2.0042 -2.7564 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8497 2.8618 -1.2582 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2494 0.6060 -2.1411 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0053 1.6536 -0.6623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4687 -1.0129 -1.1137 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7330 -3.0205 0.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2096 -2.5536 1.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9479 -2.6913 -0.2440 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7711 -1.0534 -1.9601 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7890 -1.9503 -0.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2345 -0.3623 -1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0940 0.9123 -1.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4831 1.8508 0.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9832 2.8141 0.2364 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1631 1.5354 -1.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0273 -0.5721 -1.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1778 -0.2391 0.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9698 -0.1231 -2.4361 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9323 -2.7258 -0.1961 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8524 -4.4420 -1.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3643 -4.5981 -0.9803 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4913 -3.8689 -2.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7086 -2.6645 -0.8314 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7051 -1.5519 0.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9867 -0.2976 -1.4022 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6197 -0.9006 -3.6753 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0356 0.6396 -0.6764 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8791 1.5508 -2.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3017 1.4115 0.7658 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4587 2.9615 -0.1918 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5841 3.9015 0.4354 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3312 4.4914 2.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8461 1.4610 2.1529 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4963 3.9410 1.8023 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4053 2.0347 2.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9530 0.6314 3.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5699 0.8143 2.8939 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0592 -1.0864 1.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6006 -2.0958 1.2781 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1419 -1.3155 2.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6673 -1.0460 2.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0506 0.9381 3.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6015 1.8620 1.6267 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0260 1.3902 2.3814 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4741 2.2172 0.9483 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3068 -0.4889 2.2139 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6735 -0.8559 2.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4684 -1.9057 1.3816 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9861 1.3955 1.8870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3915 2.6394 0.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0420 1.8490 0.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2773 -1.0173 -1.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9518 -2.5154 -0.8162 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4630 -2.7268 0.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1546 -1.9273 2.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5923 -0.9456 2.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4083 -3.1795 3.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5439 -4.5738 2.4914 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8118 -5.1765 0.9251 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6446 -5.4388 0.5037 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4636 -5.8007 2.2123 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3296 -3.2051 2.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6544 -5.1017 0.4720 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7029 -0.4858 -3.2169 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3530 0.0940 -3.6500 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2135 -1.1385 -2.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 23 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 19 42 1 0 42 43 1 0 42 44 1 0 42 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 1 48 50 1 0 50 51 1 1 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 52 65 1 0 65 66 1 0 66 67 1 6 66 6 1 0 66 10 1 0 50 11 1 0 63 54 1 0 48 14 1 0 45 15 1 0 40 21 1 0 34 26 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 6 77 1 6 10 78 1 6 11 79 1 6 12 80 1 0 12 81 1 0 13 82 1 0 13 83 1 0 14 84 1 0 16 85 1 0 16 86 1 0 16 87 1 0 17 88 1 0 17 89 1 0 18 90 1 0 18 91 1 0 19 92 1 6 21 93 1 6 23 94 1 6 24 95 1 0 24 96 1 0 26 97 1 6 28 98 1 1 29 99 1 0 29100 1 0 29101 1 0 30102 1 1 31103 1 0 32104 1 1 33105 1 0 34106 1 1 35107 1 0 36108 1 1 37109 1 0 38110 1 6 39111 1 0 40112 1 1 41113 1 0 43114 1 0 43115 1 0 43116 1 0 44117 1 0 44118 1 0 44119 1 0 45120 1 0 46121 1 0 46122 1 0 47123 1 0 47124 1 0 49125 1 0 49126 1 0 49127 1 0 51128 1 0 51129 1 0 51130 1 0 52131 1 6 54132 1 6 56133 1 6 57134 1 0 57135 1 0 58136 1 0 59137 1 1 60138 1 0 61139 1 6 62140 1 0 63141 1 1 64142 1 0 67143 1 0 67144 1 0 67145 1 0 M END PDB for HMDB0038886 (Mabioside A)HEADER PROTEIN 01-FEB-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 01-FEB-13 0 HETATM 1 C UNK 0 -6.164 -19.706 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -7.497 -20.476 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -7.497 -22.016 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -6.164 -22.786 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -4.830 -22.016 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -4.830 -20.476 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -3.496 -19.706 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -3.496 -22.786 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -2.163 -22.016 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -2.163 -20.476 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -2.163 -17.396 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -3.496 -18.166 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -0.829 -19.706 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -0.829 -18.166 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 0.505 -20.476 0.000 0.00 0.00 C+0 HETATM 16 O UNK 0 1.838 -19.706 0.000 0.00 0.00 O+0 HETATM 17 O UNK 0 2.356 -15.728 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 0.825 -15.889 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 0.505 -17.396 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.838 -18.166 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 2.983 -17.135 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -7.253 -23.875 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -5.075 -23.875 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -4.830 -18.936 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -2.163 -18.936 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -0.829 -21.246 0.000 0.00 0.00 C+0 HETATM 27 H UNK 0 -0.829 -16.626 0.000 0.00 0.00 H+0 HETATM 28 H UNK 0 0.505 -18.936 0.000 0.00 0.00 H+0 HETATM 29 C UNK 0 3.245 -18.792 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 4.489 -17.455 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 5.520 -16.311 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 7.026 -16.631 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 8.056 -15.487 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 7.502 -18.096 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -0.206 -14.745 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 0.505 -24.683 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 1.275 -26.017 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 2.815 -26.017 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 3.585 -24.683 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 2.815 -23.349 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 1.275 -23.349 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 0.505 -22.016 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 3.585 -22.016 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 5.125 -24.683 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 3.585 -27.350 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 0.505 -27.350 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 1.275 -28.684 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 -11.498 -22.786 0.000 0.00 0.00 O+0 HETATM 49 C UNK 0 -12.832 -23.556 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -12.832 -25.096 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -11.498 -25.866 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -10.165 -25.096 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 -10.165 -23.556 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 -8.831 -22.786 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -8.831 -25.866 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -11.498 -27.406 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 -14.166 -25.866 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 -14.166 -22.786 0.000 0.00 0.00 C+0 HETATM 59 O UNK 0 -16.833 -21.246 0.000 0.00 0.00 O+0 HETATM 60 C UNK 0 -18.167 -20.476 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -19.501 -21.246 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -19.501 -22.786 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 -18.167 -23.556 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 -16.833 -22.786 0.000 0.00 0.00 C+0 HETATM 65 O UNK 0 -15.499 -23.556 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 -18.167 -25.096 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 -20.834 -23.556 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 -20.834 -20.476 0.000 0.00 0.00 O+0 HETATM 69 C UNK 0 -18.167 -18.936 0.000 0.00 0.00 C+0 CONECT 1 2 6 CONECT 2 1 3 CONECT 3 2 4 54 CONECT 4 3 5 22 23 CONECT 5 4 6 8 CONECT 6 1 7 5 24 CONECT 7 6 10 12 CONECT 8 5 9 CONECT 9 8 10 CONECT 10 9 13 7 25 CONECT 11 12 14 CONECT 12 7 11 CONECT 13 10 14 15 26 CONECT 14 11 19 13 27 CONECT 15 13 16 42 CONECT 16 15 20 CONECT 17 18 21 CONECT 18 17 19 35 CONECT 19 14 18 20 28 CONECT 20 16 21 19 29 CONECT 21 20 17 30 CONECT 22 4 CONECT 23 4 CONECT 24 6 CONECT 25 10 CONECT 26 13 CONECT 27 14 CONECT 28 19 CONECT 29 20 CONECT 30 21 31 CONECT 31 30 32 CONECT 32 31 33 34 CONECT 33 32 CONECT 34 32 CONECT 35 18 CONECT 36 37 41 CONECT 37 36 38 46 CONECT 38 37 39 45 CONECT 39 38 40 44 CONECT 40 39 41 43 CONECT 41 40 36 42 CONECT 42 15 41 CONECT 43 40 CONECT 44 39 CONECT 45 38 CONECT 46 37 47 CONECT 47 46 CONECT 48 49 53 CONECT 49 48 50 58 CONECT 50 49 51 57 CONECT 51 50 52 56 CONECT 52 51 53 55 CONECT 53 52 48 54 CONECT 54 3 53 CONECT 55 52 CONECT 56 51 CONECT 57 50 CONECT 58 49 65 CONECT 59 60 64 CONECT 60 59 61 69 CONECT 61 60 62 68 CONECT 62 61 63 67 CONECT 63 62 64 66 CONECT 64 63 59 65 CONECT 65 58 64 CONECT 66 63 CONECT 67 62 CONECT 68 61 CONECT 69 60 MASTER 0 0 0 0 0 0 0 0 69 0 152 0 END 3D PDB for HMDB0038886 (Mabioside A)COMPND HMDB0038886 HETATM 1 C1 UNL 1 -10.171 4.670 -0.828 1.00 0.00 C HETATM 2 C2 UNL 1 -9.217 3.567 -0.504 1.00 0.00 C HETATM 3 C3 UNL 1 -8.709 3.350 0.878 1.00 0.00 C HETATM 4 C4 UNL 1 -8.782 2.735 -1.451 1.00 0.00 C HETATM 5 C5 UNL 1 -7.836 1.619 -1.197 1.00 0.00 C HETATM 6 C6 UNL 1 -6.603 1.895 -2.032 1.00 0.00 C HETATM 7 O1 UNL 1 -5.999 3.117 -1.686 1.00 0.00 O HETATM 8 C7 UNL 1 -4.621 3.030 -1.762 1.00 0.00 C HETATM 9 O2 UNL 1 -3.846 3.990 -1.584 1.00 0.00 O HETATM 10 C8 UNL 1 -4.287 1.659 -2.075 1.00 0.00 C HETATM 11 C9 UNL 1 -3.105 1.051 -1.426 1.00 0.00 C HETATM 12 C10 UNL 1 -1.860 1.820 -1.626 1.00 0.00 C HETATM 13 C11 UNL 1 -0.699 0.973 -1.192 1.00 0.00 C HETATM 14 C12 UNL 1 -1.076 -0.257 -0.395 1.00 0.00 C HETATM 15 C13 UNL 1 0.234 -0.865 0.135 1.00 0.00 C HETATM 16 C14 UNL 1 -0.131 -2.347 0.402 1.00 0.00 C HETATM 17 C15 UNL 1 1.269 -0.940 -0.949 1.00 0.00 C HETATM 18 C16 UNL 1 2.292 0.091 -1.014 1.00 0.00 C HETATM 19 C17 UNL 1 2.736 0.751 0.248 1.00 0.00 C HETATM 20 O3 UNL 1 4.140 0.748 0.369 1.00 0.00 O HETATM 21 C18 UNL 1 4.731 1.973 0.338 1.00 0.00 C HETATM 22 O4 UNL 1 5.502 2.056 -0.808 1.00 0.00 O HETATM 23 C19 UNL 1 6.734 1.431 -0.763 1.00 0.00 C HETATM 24 C20 UNL 1 6.678 -0.035 -0.432 1.00 0.00 C HETATM 25 O5 UNL 1 7.949 -0.574 -0.460 1.00 0.00 O HETATM 26 C21 UNL 1 8.595 -0.573 -1.665 1.00 0.00 C HETATM 27 O6 UNL 1 8.863 -1.888 -2.108 1.00 0.00 O HETATM 28 C22 UNL 1 9.531 -2.621 -1.134 1.00 0.00 C HETATM 29 C23 UNL 1 9.824 -3.982 -1.712 1.00 0.00 C HETATM 30 C24 UNL 1 10.847 -1.976 -0.751 1.00 0.00 C HETATM 31 O7 UNL 1 10.820 -1.478 0.544 1.00 0.00 O HETATM 32 C25 UNL 1 11.081 -0.846 -1.736 1.00 0.00 C HETATM 33 O8 UNL 1 11.262 -1.297 -3.023 1.00 0.00 O HETATM 34 C26 UNL 1 9.934 0.145 -1.661 1.00 0.00 C HETATM 35 O9 UNL 1 10.039 1.032 -2.725 1.00 0.00 O HETATM 36 C27 UNL 1 7.687 2.107 0.198 1.00 0.00 C HETATM 37 O10 UNL 1 8.541 2.929 -0.539 1.00 0.00 O HETATM 38 C28 UNL 1 6.870 3.034 1.075 1.00 0.00 C HETATM 39 O11 UNL 1 7.574 3.520 2.156 1.00 0.00 O HETATM 40 C29 UNL 1 5.608 2.318 1.510 1.00 0.00 C HETATM 41 O12 UNL 1 4.880 3.200 2.341 1.00 0.00 O HETATM 42 C30 UNL 1 2.200 0.062 1.436 1.00 0.00 C HETATM 43 C31 UNL 1 2.471 0.977 2.648 1.00 0.00 C HETATM 44 C32 UNL 1 3.019 -1.184 1.736 1.00 0.00 C HETATM 45 C33 UNL 1 0.710 -0.244 1.399 1.00 0.00 C HETATM 46 C34 UNL 1 -0.023 0.947 1.872 1.00 0.00 C HETATM 47 C35 UNL 1 -1.390 1.234 1.454 1.00 0.00 C HETATM 48 C36 UNL 1 -2.060 0.111 0.632 1.00 0.00 C HETATM 49 C37 UNL 1 -2.378 -0.886 1.696 1.00 0.00 C HETATM 50 C38 UNL 1 -3.344 0.556 0.009 1.00 0.00 C HETATM 51 C39 UNL 1 -3.951 1.714 0.833 1.00 0.00 C HETATM 52 C40 UNL 1 -4.433 -0.405 -0.198 1.00 0.00 C HETATM 53 O13 UNL 1 -4.968 -1.183 0.752 1.00 0.00 O HETATM 54 C41 UNL 1 -5.283 -2.431 0.263 1.00 0.00 C HETATM 55 O14 UNL 1 -6.683 -2.431 0.136 1.00 0.00 O HETATM 56 C42 UNL 1 -7.364 -2.831 1.242 1.00 0.00 C HETATM 57 C43 UNL 1 -7.190 -1.963 2.465 1.00 0.00 C HETATM 58 O15 UNL 1 -7.950 -2.484 3.523 1.00 0.00 O HETATM 59 C44 UNL 1 -7.147 -4.279 1.494 1.00 0.00 C HETATM 60 O16 UNL 1 -7.937 -4.982 0.553 1.00 0.00 O HETATM 61 C45 UNL 1 -5.735 -4.668 1.299 1.00 0.00 C HETATM 62 O17 UNL 1 -5.299 -5.317 2.478 1.00 0.00 O HETATM 63 C46 UNL 1 -4.763 -3.540 1.063 1.00 0.00 C HETATM 64 O18 UNL 1 -3.685 -4.130 0.358 1.00 0.00 O HETATM 65 O19 UNL 1 -5.567 0.455 -0.524 1.00 0.00 O HETATM 66 C47 UNL 1 -5.523 0.866 -1.821 1.00 0.00 C HETATM 67 C48 UNL 1 -5.701 -0.274 -2.806 1.00 0.00 C HETATM 68 H1 UNL 1 -10.777 4.850 0.088 1.00 0.00 H HETATM 69 H2 UNL 1 -10.823 4.388 -1.682 1.00 0.00 H HETATM 70 H3 UNL 1 -9.630 5.596 -1.153 1.00 0.00 H HETATM 71 H4 UNL 1 -8.977 4.180 1.559 1.00 0.00 H HETATM 72 H5 UNL 1 -9.114 2.379 1.228 1.00 0.00 H HETATM 73 H6 UNL 1 -7.589 3.298 0.840 1.00 0.00 H HETATM 74 H7 UNL 1 -9.135 2.880 -2.462 1.00 0.00 H HETATM 75 H8 UNL 1 -8.337 0.687 -1.528 1.00 0.00 H HETATM 76 H9 UNL 1 -7.615 1.506 -0.137 1.00 0.00 H HETATM 77 H10 UNL 1 -6.833 1.926 -3.113 1.00 0.00 H HETATM 78 H11 UNL 1 -4.105 1.592 -3.184 1.00 0.00 H HETATM 79 H12 UNL 1 -2.930 0.088 -2.011 1.00 0.00 H HETATM 80 H13 UNL 1 -1.846 2.004 -2.756 1.00 0.00 H HETATM 81 H14 UNL 1 -1.850 2.862 -1.258 1.00 0.00 H HETATM 82 H15 UNL 1 -0.249 0.606 -2.141 1.00 0.00 H HETATM 83 H16 UNL 1 -0.005 1.654 -0.662 1.00 0.00 H HETATM 84 H17 UNL 1 -1.469 -1.013 -1.114 1.00 0.00 H HETATM 85 H18 UNL 1 0.733 -3.020 0.090 1.00 0.00 H HETATM 86 H19 UNL 1 -0.210 -2.554 1.466 1.00 0.00 H HETATM 87 H20 UNL 1 -0.948 -2.691 -0.244 1.00 0.00 H HETATM 88 H21 UNL 1 0.771 -1.053 -1.960 1.00 0.00 H HETATM 89 H22 UNL 1 1.789 -1.950 -0.895 1.00 0.00 H HETATM 90 H23 UNL 1 3.234 -0.362 -1.464 1.00 0.00 H HETATM 91 H24 UNL 1 2.094 0.912 -1.769 1.00 0.00 H HETATM 92 H25 UNL 1 2.483 1.851 0.196 1.00 0.00 H HETATM 93 H26 UNL 1 3.983 2.814 0.236 1.00 0.00 H HETATM 94 H27 UNL 1 7.163 1.535 -1.780 1.00 0.00 H HETATM 95 H28 UNL 1 6.027 -0.572 -1.175 1.00 0.00 H HETATM 96 H29 UNL 1 6.178 -0.239 0.547 1.00 0.00 H HETATM 97 H30 UNL 1 7.970 -0.123 -2.436 1.00 0.00 H HETATM 98 H31 UNL 1 8.932 -2.726 -0.196 1.00 0.00 H HETATM 99 H32 UNL 1 8.852 -4.442 -1.992 1.00 0.00 H HETATM 100 H33 UNL 1 10.364 -4.598 -0.980 1.00 0.00 H HETATM 101 H34 UNL 1 10.491 -3.869 -2.590 1.00 0.00 H HETATM 102 H35 UNL 1 11.709 -2.664 -0.831 1.00 0.00 H HETATM 103 H36 UNL 1 11.705 -1.552 0.990 1.00 0.00 H HETATM 104 H37 UNL 1 11.987 -0.298 -1.402 1.00 0.00 H HETATM 105 H38 UNL 1 10.620 -0.901 -3.675 1.00 0.00 H HETATM 106 H39 UNL 1 10.036 0.640 -0.676 1.00 0.00 H HETATM 107 H40 UNL 1 10.879 1.551 -2.586 1.00 0.00 H HETATM 108 H41 UNL 1 8.302 1.412 0.766 1.00 0.00 H HETATM 109 H42 UNL 1 9.459 2.962 -0.192 1.00 0.00 H HETATM 110 H43 UNL 1 6.584 3.902 0.435 1.00 0.00 H HETATM 111 H44 UNL 1 7.331 4.491 2.303 1.00 0.00 H HETATM 112 H45 UNL 1 5.846 1.461 2.153 1.00 0.00 H HETATM 113 H46 UNL 1 4.496 3.941 1.802 1.00 0.00 H HETATM 114 H47 UNL 1 2.405 2.035 2.413 1.00 0.00 H HETATM 115 H48 UNL 1 1.953 0.631 3.553 1.00 0.00 H HETATM 116 H49 UNL 1 3.570 0.814 2.894 1.00 0.00 H HETATM 117 H50 UNL 1 4.059 -1.086 1.364 1.00 0.00 H HETATM 118 H51 UNL 1 2.601 -2.096 1.278 1.00 0.00 H HETATM 119 H52 UNL 1 3.142 -1.315 2.855 1.00 0.00 H HETATM 120 H53 UNL 1 0.667 -1.046 2.210 1.00 0.00 H HETATM 121 H54 UNL 1 0.051 0.938 3.006 1.00 0.00 H HETATM 122 H55 UNL 1 0.601 1.862 1.627 1.00 0.00 H HETATM 123 H56 UNL 1 -2.026 1.390 2.381 1.00 0.00 H HETATM 124 H57 UNL 1 -1.474 2.217 0.948 1.00 0.00 H HETATM 125 H58 UNL 1 -3.307 -0.489 2.214 1.00 0.00 H HETATM 126 H59 UNL 1 -1.674 -0.856 2.582 1.00 0.00 H HETATM 127 H60 UNL 1 -2.468 -1.906 1.382 1.00 0.00 H HETATM 128 H61 UNL 1 -3.986 1.396 1.887 1.00 0.00 H HETATM 129 H62 UNL 1 -3.392 2.639 0.744 1.00 0.00 H HETATM 130 H63 UNL 1 -5.042 1.849 0.575 1.00 0.00 H HETATM 131 H64 UNL 1 -4.277 -1.017 -1.141 1.00 0.00 H HETATM 132 H65 UNL 1 -4.952 -2.515 -0.816 1.00 0.00 H HETATM 133 H66 UNL 1 -8.463 -2.727 0.977 1.00 0.00 H HETATM 134 H67 UNL 1 -6.155 -1.927 2.852 1.00 0.00 H HETATM 135 H68 UNL 1 -7.592 -0.946 2.285 1.00 0.00 H HETATM 136 H69 UNL 1 -7.408 -3.179 3.974 1.00 0.00 H HETATM 137 H70 UNL 1 -7.544 -4.574 2.491 1.00 0.00 H HETATM 138 H71 UNL 1 -8.812 -5.177 0.925 1.00 0.00 H HETATM 139 H72 UNL 1 -5.645 -5.439 0.504 1.00 0.00 H HETATM 140 H73 UNL 1 -4.464 -5.801 2.212 1.00 0.00 H HETATM 141 H74 UNL 1 -4.330 -3.205 2.026 1.00 0.00 H HETATM 142 H75 UNL 1 -3.654 -5.102 0.472 1.00 0.00 H HETATM 143 H76 UNL 1 -4.703 -0.486 -3.217 1.00 0.00 H HETATM 144 H77 UNL 1 -6.353 0.094 -3.650 1.00 0.00 H HETATM 145 H78 UNL 1 -6.213 -1.139 -2.368 1.00 0.00 H CONECT 1 2 68 69 70 CONECT 2 3 4 4 CONECT 3 71 72 73 CONECT 4 5 74 CONECT 5 6 75 76 CONECT 6 7 66 77 CONECT 7 8 CONECT 8 9 9 10 CONECT 10 11 66 78 CONECT 11 12 50 79 CONECT 12 13 80 81 CONECT 13 14 82 83 CONECT 14 15 48 84 CONECT 15 16 17 45 CONECT 16 85 86 87 CONECT 17 18 88 89 CONECT 18 19 90 91 CONECT 19 20 42 92 CONECT 20 21 CONECT 21 22 40 93 CONECT 22 23 CONECT 23 24 36 94 CONECT 24 25 95 96 CONECT 25 26 CONECT 26 27 34 97 CONECT 27 28 CONECT 28 29 30 98 CONECT 29 99 100 101 CONECT 30 31 32 102 CONECT 31 103 CONECT 32 33 34 104 CONECT 33 105 CONECT 34 35 106 CONECT 35 107 CONECT 36 37 38 108 CONECT 37 109 CONECT 38 39 40 110 CONECT 39 111 CONECT 40 41 112 CONECT 41 113 CONECT 42 43 44 45 CONECT 43 114 115 116 CONECT 44 117 118 119 CONECT 45 46 120 CONECT 46 47 121 122 CONECT 47 48 123 124 CONECT 48 49 50 CONECT 49 125 126 127 CONECT 50 51 52 CONECT 51 128 129 130 CONECT 52 53 65 131 CONECT 53 54 CONECT 54 55 63 132 CONECT 55 56 CONECT 56 57 59 133 CONECT 57 58 134 135 CONECT 58 136 CONECT 59 60 61 137 CONECT 60 138 CONECT 61 62 63 139 CONECT 62 140 CONECT 63 64 141 CONECT 64 142 CONECT 65 66 CONECT 66 67 CONECT 67 143 144 145 END SMILES for HMDB0038886 (Mabioside A)[H][C@@]12C(=O)O[C@H](CC=C(C)C)[C@]1(C)O[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]1(C)[C@]2([H])CCC2[C@@]3(C)CC[C@H](O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)C(C)(C)C3CC[C@@]12C INCHI for HMDB0038886 (Mabioside A)InChI=1S/C48H78O19/c1-20(2)10-13-28-48(9)29(39(59)64-28)22-11-12-26-45(6)16-15-27(65-41-37(57)35(55)32(52)24(63-41)19-60-40-36(56)33(53)30(50)21(3)61-40)44(4,5)25(45)14-17-46(26,7)47(22,8)43(67-48)66-42-38(58)34(54)31(51)23(18-49)62-42/h10,21-38,40-43,49-58H,11-19H2,1-9H3/t21-,22+,23+,24+,25?,26?,27-,28+,29+,30-,31+,32+,33+,34-,35-,36+,37+,38+,40+,41-,42-,43-,45-,46+,47-,48-/m0/s1 3D Structure for HMDB0038886 (Mabioside A) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C48H78O19 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 959.1215 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 958.513730314 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (1R,2R,3R,5R,6R,9S,10R,14R,17S)-1,2,5,14,18,18-hexamethyl-6-(3-methylbut-2-en-1-yl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-17-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4,7-dioxapentacyclo[11.8.0.0²,¹⁰.0⁵,⁹.0¹⁴,¹⁹]henicosan-8-one | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (1R,2R,3R,5R,6R,9S,10R,14R,17S)-1,2,5,14,18,18-hexamethyl-6-(3-methylbut-2-en-1-yl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-17-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxan-2-yl]oxy}-4,7-dioxapentacyclo[11.8.0.0²,¹⁰.0⁵,⁹.0¹⁴,¹⁹]henicosan-8-one | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 143672-61-1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H][C@@]12C(=O)O[C@H](CC=C(C)C)[C@]1(C)O[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]1(C)[C@]2([H])CCC2[C@@]3(C)CC[C@H](O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)C(C)(C)C3CC[C@@]12C | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C48H78O19/c1-20(2)10-13-28-48(9)29(39(59)64-28)22-11-12-26-45(6)16-15-27(65-41-37(57)35(55)32(52)24(63-41)19-60-40-36(56)33(53)30(50)21(3)61-40)44(4,5)25(45)14-17-46(26,7)47(22,8)43(67-48)66-42-38(58)34(54)31(51)23(18-49)62-42/h10,21-38,40-43,49-58H,11-19H2,1-9H3/t21-,22+,23+,24+,25?,26?,27-,28+,29+,30-,31+,32+,33+,34-,35-,36+,37+,38+,40+,41-,42-,43-,45-,46+,47-,48-/m0/s1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | JDYBTMHCHWARHS-UZTDFSENSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | This compound belongs to the class of organic compounds known as diterpene glycosides. These are diterpenoids in which an isoprene unit is glycosylated. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Prenol lipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Terpene glycosides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Diterpene glycosides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB018345 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131752489 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|