Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 00:14:47 UTC

Update Date

2022-03-07 02:55:59 UTC

HMDB ID

HMDB0038898

Secondary Accession Numbers

HMDB38898

Metabolite Identification

Common Name

6-C-Fucosylluteolin

Description

6-C-Fucosylluteolin belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. 6-C-Fucosylluteolin has been detected, but not quantified in, fruits and passion fruits (Passiflora edulis). This could make 6-C-fucosylluteolin a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on 6-C-Fucosylluteolin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061311262D          

 31 34  0  0  0  0            999 V2000
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  7  1  1  0  0  0  0
  8  2  1  0  0  0  0
  8  4  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  1  0  0  0  0
 10  9  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  5  2  0  0  0  0
 13  8  1  0  0  0  0
 14  6  1  0  0  0  0
 15 11  1  0  0  0  0
 15 14  2  0  0  0  0
 16 12  1  0  0  0  0
 17  7  1  0  0  0  0
 18 15  1  0  0  0  0
 18 16  2  0  0  0  0
 19 17  1  0  0  0  0
 20 19  1  0  0  0  0
 21 16  1  0  0  0  0
 21 20  1  0  0  0  0
 22  9  1  0  0  0  0
 23 10  1  0  0  0  0
 24 11  2  0  0  0  0
 25 12  1  0  0  0  0
 26 17  1  0  0  0  0
 27 18  1  0  0  0  0
 28 19  1  0  0  0  0
 29 20  1  0  0  0  0
 30  7  1  0  0  0  0
 30 21  1  0  0  0  0
 31 13  1  0  0  0  0
 31 14  1  0  0  0  0
M  END

HMDB0038898
     RDKit          3D
6-C-Fucosylluteolin
 51 54  0  0  0  0  0  0  0  0999 V2000
   -5.0477    2.1410   -1.2634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4081    0.7825   -1.0635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5259    0.8832   -0.0316 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9714   -0.3238    0.3999 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5113   -0.1806    0.4108 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9778    0.8841    1.1634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8624    1.7061    1.8333 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3500    1.1128    1.2416 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2030    0.2655    0.5550 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4806    0.5323    0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4011   -0.1677    0.0828 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7949    0.2089    0.2661 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1298    1.3073    1.0583 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4436    1.6431    1.2164 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4825    0.9469    0.6273 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7878    1.3382    0.8271 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1661   -0.1350   -0.1539 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1749   -0.8699   -0.7696 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8256   -0.4888   -0.3235 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0084   -1.2350   -0.6814 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6668   -1.5563   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3426   -2.5268   -1.5246 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7240   -0.7873   -0.1925 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6555   -1.0381   -0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1187   -2.0670   -1.0155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5105   -1.5057   -0.2919 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1389   -2.6671    0.4215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -1.4503   -0.1267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2880   -1.3049    1.2301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5233   -0.2069   -0.8241 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5821    0.3977   -0.1411 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1579    2.6000   -0.2573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3588    2.8309   -1.8268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0353    2.0784   -1.7636 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9177    0.5061   -2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3242   -0.3991    1.4819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5009    2.4710    2.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7376    1.9399    1.8280 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3395    1.8726    1.5328 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7012    2.5016    1.8360 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5421    0.8189    0.3894 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9264   -1.6623   -1.3405 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6584   -1.3435   -0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7289   -1.8376   -1.1777 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7592   -2.7569   -1.5504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2739   -1.6456   -1.3417 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8230   -2.4267    1.3306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4887   -2.3789   -0.4722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5378   -0.3811    1.4528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9170   -0.5050   -1.8165 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3580   -0.2266   -0.2022 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  2  0
 11 20  2  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
  4 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30  2  1  0
 24  5  1  0
 23  9  1  0
 19 12  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  4 36  1  0
  7 37  1  0
  8 38  1  0
 13 39  1  0
 14 40  1  0
 16 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 28 48  1  0
 29 49  1  0
 30 50  1  0
 31 51  1  0
M  END

  Mrv0541 05061311262D          

 31 34  0  0  0  0            999 V2000
    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0  0  0  0
  7  1  1  0  0  0  0
  8  2  1  0  0  0  0
  8  4  2  0  0  0  0
  9  3  1  0  0  0  0
 10  4  1  0  0  0  0
 10  9  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 13  5  2  0  0  0  0
 13  8  1  0  0  0  0
 14  6  1  0  0  0  0
 15 11  1  0  0  0  0
 15 14  2  0  0  0  0
 16 12  1  0  0  0  0
 17  7  1  0  0  0  0
 18 15  1  0  0  0  0
 18 16  2  0  0  0  0
 19 17  1  0  0  0  0
 20 19  1  0  0  0  0
 21 16  1  0  0  0  0
 21 20  1  0  0  0  0
 22  9  1  0  0  0  0
 23 10  1  0  0  0  0
 24 11  2  0  0  0  0
 25 12  1  0  0  0  0
 26 17  1  0  0  0  0
 27 18  1  0  0  0  0
 28 19  1  0  0  0  0
 29 20  1  0  0  0  0
 30  7  1  0  0  0  0
 30 21  1  0  0  0  0
 31 13  1  0  0  0  0
 31 14  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0038898

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC(O)=C(O)C=C2)C=C1O

> <INCHI_IDENTIFIER>
InChI=1S/C21H20O10/c1-7-17(26)19(28)20(29)21(30-7)16-12(25)6-14-15(18(16)27)11(24)5-13(31-14)8-2-3-9(22)10(23)4-8/h2-7,17,19-23,25-29H,1H3

> <INCHI_KEY>
ROQHTXBYBLROKW-UHFFFAOYSA-N

> <FORMULA>
C21H20O10

> <MOLECULAR_WEIGHT>
432.3775

> <EXACT_MASS>
432.10564686

> <JCHEM_ACCEPTOR_COUNT>
10

> <JCHEM_AVERAGE_POLARIZABILITY>
42.61425068461187

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
7

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)-4H-chromen-4-one

> <ALOGPS_LOGP>
1.12

> <JCHEM_LOGP>
0.692712873666667

> <ALOGPS_LOGS>
-2.43

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.489548156917554

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.196627616525169

> <JCHEM_PKA_STRONGEST_BASIC>
-3.608542600863829

> <JCHEM_POLAR_SURFACE_AREA>
177.14

> <JCHEM_REFRACTIVITY>
106.46939999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
2

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.59e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0038898
     RDKit          3D
6-C-Fucosylluteolin
 51 54  0  0  0  0  0  0  0  0999 V2000
   -5.0477    2.1410   -1.2634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4081    0.7825   -1.0635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5259    0.8832   -0.0316 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9714   -0.3238    0.3999 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5113   -0.1806    0.4108 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9778    0.8841    1.1634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8624    1.7061    1.8333 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3500    1.1128    1.2416 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2030    0.2655    0.5550 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4806    0.5323    0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4011   -0.1677    0.0828 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7949    0.2089    0.2661 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1298    1.3073    1.0583 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4436    1.6431    1.2164 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4825    0.9469    0.6273 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7878    1.3382    0.8271 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1661   -0.1350   -0.1539 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1749   -0.8699   -0.7696 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8256   -0.4888   -0.3235 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0084   -1.2350   -0.6814 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6668   -1.5563   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3426   -2.5268   -1.5246 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7240   -0.7873   -0.1925 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6555   -1.0381   -0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1187   -2.0670   -1.0155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5105   -1.5057   -0.2919 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1389   -2.6671    0.4215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -1.4503   -0.1267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2880   -1.3049    1.2301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5233   -0.2069   -0.8241 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5821    0.3977   -0.1411 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1579    2.6000   -0.2573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3588    2.8309   -1.8268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0353    2.0784   -1.7636 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9177    0.5061   -2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3242   -0.3991    1.4819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5009    2.4710    2.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7376    1.9399    1.8280 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3395    1.8726    1.5328 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7012    2.5016    1.8360 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5421    0.8189    0.3894 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9264   -1.6623   -1.3405 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6584   -1.3435   -0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7289   -1.8376   -1.1777 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7592   -2.7569   -1.5504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2739   -1.6456   -1.3417 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8230   -2.4267    1.3306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4887   -2.3789   -0.4722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5378   -0.3811    1.4528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9170   -0.5050   -1.8165 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3580   -0.2266   -0.2022 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  2  0
 11 20  2  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
  4 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30  2  1  0
 24  5  1  0
 23  9  1  0
 19 12  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  4 36  1  0
  7 37  1  0
  8 38  1  0
 13 39  1  0
 14 40  1  0
 16 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 28 48  1  0
 29 49  1  0
 30 50  1  0
 31 51  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       9.336   3.850   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.334   3.850   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       8.002   4.620   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -5.335   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       4.001   2.310   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -1.334   2.310   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       8.002   6.160   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       2.667   4.620   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       6.668   6.930   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0      -6.668  -0.770   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0      -4.001  -2.310   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       0.000   6.160   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0       9.336   6.930   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       2.667   6.160   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       6.668   8.470   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       4.001   6.930   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000   1.540   0.000  0.00  0.00           O+0
CONECT    1    7                                                            
CONECT    2    3    8                                                       
CONECT    3    2    9                                                       
CONECT    4    8   10                                                       
CONECT    5   11   13                                                       
CONECT    6   12   14                                                       
CONECT    7    1   17   30                                                  
CONECT    8    2    4   13                                                  
CONECT    9    3   10   22                                                  
CONECT   10    4    9   23                                                  
CONECT   11    5   15   24                                                  
CONECT   12    6   16   25                                                  
CONECT   13    5    8   31                                                  
CONECT   14    6   15   31                                                  
CONECT   15   11   14   18                                                  
CONECT   16   12   18   21                                                  
CONECT   17    7   19   26                                                  
CONECT   18   15   16   27                                                  
CONECT   19   17   20   28                                                  
CONECT   20   19   21   29                                                  
CONECT   21   16   20   30                                                  
CONECT   22    9                                                            
CONECT   23   10                                                            
CONECT   24   11                                                            
CONECT   25   12                                                            
CONECT   26   17                                                            
CONECT   27   18                                                            
CONECT   28   19                                                            
CONECT   29   20                                                            
CONECT   30    7   21                                                       
CONECT   31   13   14                                                       
MASTER        0    0    0    0    0    0    0    0   31    0   68    0
END

COMPND    HMDB0038898
HETATM    1  C1  UNL     1      -5.048   2.141  -1.263  1.00  0.00           C  
HETATM    2  C2  UNL     1      -4.408   0.783  -1.063  1.00  0.00           C  
HETATM    3  O1  UNL     1      -3.526   0.883  -0.032  1.00  0.00           O  
HETATM    4  C3  UNL     1      -2.971  -0.324   0.400  1.00  0.00           C  
HETATM    5  C4  UNL     1      -1.511  -0.181   0.411  1.00  0.00           C  
HETATM    6  C5  UNL     1      -0.978   0.884   1.163  1.00  0.00           C  
HETATM    7  O2  UNL     1      -1.862   1.706   1.833  1.00  0.00           O  
HETATM    8  C6  UNL     1       0.350   1.113   1.242  1.00  0.00           C  
HETATM    9  C7  UNL     1       1.203   0.266   0.555  1.00  0.00           C  
HETATM   10  O3  UNL     1       2.481   0.532   0.665  1.00  0.00           O  
HETATM   11  C8  UNL     1       3.401  -0.168   0.083  1.00  0.00           C  
HETATM   12  C9  UNL     1       4.795   0.209   0.266  1.00  0.00           C  
HETATM   13  C10 UNL     1       5.130   1.307   1.058  1.00  0.00           C  
HETATM   14  C11 UNL     1       6.444   1.643   1.216  1.00  0.00           C  
HETATM   15  C12 UNL     1       7.482   0.947   0.627  1.00  0.00           C  
HETATM   16  O4  UNL     1       8.788   1.338   0.827  1.00  0.00           O  
HETATM   17  C13 UNL     1       7.166  -0.135  -0.154  1.00  0.00           C  
HETATM   18  O5  UNL     1       8.175  -0.870  -0.770  1.00  0.00           O  
HETATM   19  C14 UNL     1       5.826  -0.489  -0.323  1.00  0.00           C  
HETATM   20  C15 UNL     1       3.008  -1.235  -0.681  1.00  0.00           C  
HETATM   21  C16 UNL     1       1.667  -1.556  -0.827  1.00  0.00           C  
HETATM   22  O6  UNL     1       1.343  -2.527  -1.525  1.00  0.00           O  
HETATM   23  C17 UNL     1       0.724  -0.787  -0.192  1.00  0.00           C  
HETATM   24  C18 UNL     1      -0.656  -1.038  -0.284  1.00  0.00           C  
HETATM   25  O7  UNL     1      -1.119  -2.067  -1.015  1.00  0.00           O  
HETATM   26  C19 UNL     1      -3.511  -1.506  -0.292  1.00  0.00           C  
HETATM   27  O8  UNL     1      -3.139  -2.667   0.422  1.00  0.00           O  
HETATM   28  C20 UNL     1      -5.042  -1.450  -0.127  1.00  0.00           C  
HETATM   29  O9  UNL     1      -5.288  -1.305   1.230  1.00  0.00           O  
HETATM   30  C21 UNL     1      -5.523  -0.207  -0.824  1.00  0.00           C  
HETATM   31  O10 UNL     1      -6.582   0.398  -0.141  1.00  0.00           O  
HETATM   32  H1  UNL     1      -5.158   2.600  -0.257  1.00  0.00           H  
HETATM   33  H2  UNL     1      -4.359   2.831  -1.827  1.00  0.00           H  
HETATM   34  H3  UNL     1      -6.035   2.078  -1.764  1.00  0.00           H  
HETATM   35  H4  UNL     1      -3.918   0.506  -2.016  1.00  0.00           H  
HETATM   36  H5  UNL     1      -3.324  -0.399   1.482  1.00  0.00           H  
HETATM   37  H6  UNL     1      -1.501   2.471   2.375  1.00  0.00           H  
HETATM   38  H7  UNL     1       0.738   1.940   1.828  1.00  0.00           H  
HETATM   39  H8  UNL     1       4.339   1.873   1.533  1.00  0.00           H  
HETATM   40  H9  UNL     1       6.701   2.502   1.836  1.00  0.00           H  
HETATM   41  H10 UNL     1       9.542   0.819   0.389  1.00  0.00           H  
HETATM   42  H11 UNL     1       7.926  -1.662  -1.341  1.00  0.00           H  
HETATM   43  H12 UNL     1       5.658  -1.344  -0.946  1.00  0.00           H  
HETATM   44  H13 UNL     1       3.729  -1.838  -1.178  1.00  0.00           H  
HETATM   45  H14 UNL     1      -0.759  -2.757  -1.550  1.00  0.00           H  
HETATM   46  H15 UNL     1      -3.274  -1.646  -1.342  1.00  0.00           H  
HETATM   47  H16 UNL     1      -2.823  -2.427   1.331  1.00  0.00           H  
HETATM   48  H17 UNL     1      -5.489  -2.379  -0.472  1.00  0.00           H  
HETATM   49  H18 UNL     1      -5.538  -0.381   1.453  1.00  0.00           H  
HETATM   50  H19 UNL     1      -5.917  -0.505  -1.816  1.00  0.00           H  
HETATM   51  H20 UNL     1      -7.358  -0.227  -0.202  1.00  0.00           H  
CONECT    1    2   32   33   34
CONECT    2    3   30   35
CONECT    3    4
CONECT    4    5   26   36
CONECT    5    6    6   24
CONECT    6    7    8
CONECT    7   37
CONECT    8    9    9   38
CONECT    9   10   23
CONECT   10   11
CONECT   11   12   20   20
CONECT   12   13   13   19
CONECT   13   14   39
CONECT   14   15   15   40
CONECT   15   16   17
CONECT   16   41
CONECT   17   18   19   19
CONECT   18   42
CONECT   19   43
CONECT   20   21   44
CONECT   21   22   22   23
CONECT   23   24   24
CONECT   24   25
CONECT   25   45
CONECT   26   27   28   46
CONECT   27   47
CONECT   28   29   30   48
CONECT   29   49
CONECT   30   31   50
CONECT   31   51
END

HMDB0038898
     RDKit          3D
6-C-Fucosylluteolin
 51 54  0  0  0  0  0  0  0  0999 V2000
   -5.0477    2.1410   -1.2634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4081    0.7825   -1.0635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5259    0.8832   -0.0316 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9714   -0.3238    0.3999 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5113   -0.1806    0.4108 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9778    0.8841    1.1634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8624    1.7061    1.8333 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3500    1.1128    1.2416 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2030    0.2655    0.5550 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4806    0.5323    0.6650 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4011   -0.1677    0.0828 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7949    0.2089    0.2661 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1298    1.3073    1.0583 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4436    1.6431    1.2164 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4825    0.9469    0.6273 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7878    1.3382    0.8271 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1661   -0.1350   -0.1539 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1749   -0.8699   -0.7696 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8256   -0.4888   -0.3235 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0084   -1.2350   -0.6814 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6668   -1.5563   -0.8274 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3426   -2.5268   -1.5246 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7240   -0.7873   -0.1925 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6555   -1.0381   -0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1187   -2.0670   -1.0155 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5105   -1.5057   -0.2919 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1389   -2.6671    0.4215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -1.4503   -0.1267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2880   -1.3049    1.2301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5233   -0.2069   -0.8241 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5821    0.3977   -0.1411 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1579    2.6000   -0.2573 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3588    2.8309   -1.8268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0353    2.0784   -1.7636 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9177    0.5061   -2.0162 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3242   -0.3991    1.4819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5009    2.4710    2.3753 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7376    1.9399    1.8280 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3395    1.8726    1.5328 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7012    2.5016    1.8360 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5421    0.8189    0.3894 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9264   -1.6623   -1.3405 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6584   -1.3435   -0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7289   -1.8376   -1.1777 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7592   -2.7569   -1.5504 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2739   -1.6456   -1.3417 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8230   -2.4267    1.3306 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4887   -2.3789   -0.4722 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5378   -0.3811    1.4528 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9170   -0.5050   -1.8165 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3580   -0.2266   -0.2022 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  2  0
 11 20  2  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
  4 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30  2  1  0
 24  5  1  0
 23  9  1  0
 19 12  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  4 36  1  0
  7 37  1  0
  8 38  1  0
 13 39  1  0
 14 40  1  0
 16 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 25 45  1  0
 26 46  1  0
 27 47  1  0
 28 48  1  0
 29 49  1  0
 30 50  1  0
 31 51  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Not Available

Chemical Formula

C₂₁H₂₀O₁₀

Average Molecular Weight

432.3775

Monoisotopic Molecular Weight

432.10564686

IUPAC Name

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)-4H-chromen-4-one

Traditional Name

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)chromen-4-one

CAS Registry Number

Not Available

SMILES

CC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC(O)=C(O)C=C2)C=C1O

InChI Identifier

InChI=1S/C21H20O10/c1-7-17(26)19(28)20(29)21(30-7)16-12(25)6-14-15(18(16)27)11(24)5-13(31-14)8-2-3-9(22)10(23)4-8/h2-7,17,19-23,25-29H,1H3

InChI Key

ROQHTXBYBLROKW-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid c-glycosides. Flavonoid C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid C-glycosides

Alternative Parents

Substituents

Flavonoid c-glycoside
3'-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Hydroxyflavonoid
Phenolic glycoside
Chromone
Benzopyran
1-benzopyran
Catechol
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Pyranone
Oxane
Pyran
Benzenoid
Monocyclic benzene moiety
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Polyol
Organoheterocyclic compound
Ether
Oxacycle
Dialkyl ether
Organooxygen compound
Hydrocarbon derivative
Organic oxide
Organic oxygen compound
Alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0038898)
Cytoplasm (HMDB: HMDB0038898)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0038898)

Source

Exogenous

Exogenous (HMDB: HMDB0038898)

Food

Food (HMDB: HMDB0038898)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0038898)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0038898)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.59 g/L	ALOGPS
logP	1.12	ALOGPS
logP	0.69	ChemAxon
logS	-2.4	ALOGPS
pKa (Strongest Acidic)	6.2	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	10	ChemAxon
Hydrogen Donor Count	7	ChemAxon
Polar Surface Area	177.14 Å²	ChemAxon
Rotatable Bond Count	2	ChemAxon
Refractivity	106.47 m³·mol⁻¹	ChemAxon
Polarizability	42.61 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	192.608	30932474
DeepCCS	[M-H]-	190.213	30932474
DeepCCS	[M-2H]-	223.2	30932474
DeepCCS	[M+Na]+	198.521	30932474
AllCCS	[M+H]+	204.4	32859911
AllCCS	[M+H-H2O]+	201.7	32859911
AllCCS	[M+NH4]+	206.9	32859911
AllCCS	[M+Na]+	207.6	32859911
AllCCS	[M-H]-	201.9	32859911
AllCCS	[M+Na-2H]-	202.6	32859911
AllCCS	[M+HCOO]-	203.4	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
6-C-Fucosylluteolin	CC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC(O)=C(O)C=C2)C=C1O	5746.2	Standard polar	33892256
6-C-Fucosylluteolin	CC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC(O)=C(O)C=C2)C=C1O	3637.0	Standard non polar	33892256
6-C-Fucosylluteolin	CC1OC(C(O)C(O)C1O)C1=C(O)C2=C(OC(=CC2=O)C2=CC(O)=C(O)C=C2)C=C1O	4339.0	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
6-C-Fucosylluteolin,1TMS,isomer #1	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4266.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #2	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4297.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #3	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4295.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #4	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4244.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #5	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4298.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4302.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4274.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4210.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #10	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4171.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4216.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #12	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4216.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4226.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4194.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4180.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #16	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4248.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #17	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4251.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #18	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4229.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #19	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4251.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #2	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4211.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4224.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #21	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4268.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #3	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4185.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #4	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4165.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #5	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4200.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4218.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4213.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #8	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4211.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TMS,isomer #9	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4180.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4056.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #10	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4002.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4037.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #12	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4062.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4033.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4057.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4115.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #16	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4064.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #17	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4042.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #18	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4058.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #19	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4089.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4040.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	4063.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #21	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4020.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #22	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4089.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #23	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3991.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #24	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4064.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #25	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4051.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #26	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4076.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #27	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4058.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #28	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4091.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #29	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	4094.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4088.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #30	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4040.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #31	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4015.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #32	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4141.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #33	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4124.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #34	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4084.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #35	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4123.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4069.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4091.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	4078.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #7	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4026.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #8	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4061.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TMS,isomer #9	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4087.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O	3964.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #10	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4017.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3926.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #12	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3971.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3988.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3880.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3893.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #16	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3989.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #17	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3858.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #18	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3866.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #19	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3969.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3954.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3983.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #21	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O	3952.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #22	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4001.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #23	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3941.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #24	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3974.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #25	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3918.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #26	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3975.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #27	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3910.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #28	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3996.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #29	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3910.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3920.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #30	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3889.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #31	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C	3971.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #32	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3966.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #33	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3946.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #34	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3938.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #35	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O	4028.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3938.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3935.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #6	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3897.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3912.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #8	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3953.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TMS,isomer #9	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3983.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3912.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #10	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3900.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3850.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #12	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3853.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3960.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3857.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3839.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #16	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3951.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #17	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3904.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #18	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3913.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #19	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3886.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3886.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3877.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #21	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3916.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3893.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3891.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3902.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #6	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3892.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3862.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #8	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3873.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,5TMS,isomer #9	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3872.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3850.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3876.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3893.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3857.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3838.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3860.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,6TMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3873.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #1	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4554.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #2	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4572.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #3	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4562.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #4	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4507.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #5	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4530.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4539.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,1TBDMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4509.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4719.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #10	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4697.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4740.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #12	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4729.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4731.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4697.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4713.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #16	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4721.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #17	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4721.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #18	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4695.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #19	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4711.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #2	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4727.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4690.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #21	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4734.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #3	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4696.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #4	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4703.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #5	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4739.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4758.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4719.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #8	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4723.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,2TBDMS,isomer #9	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4689.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4815.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #10	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4725.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4740.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #12	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4765.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4733.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4765.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4802.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #16	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4832.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #17	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4791.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #18	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4774.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #19	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4777.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4777.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4769.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #21	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4775.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #22	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4770.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #23	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4733.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #24	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4742.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #25	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4744.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #26	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4816.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #27	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4781.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #28	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4782.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #29	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4783.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4789.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #30	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4771.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #31	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4732.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #32	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4868.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #33	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4830.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #34	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4797.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #35	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O	4854.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4773.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4803.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #6	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4791.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #7	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4770.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #8	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4771.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,3TBDMS,isomer #9	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4800.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #1	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4878.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #10	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4852.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #11	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4795.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #12	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4826.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #13	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4849.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #14	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4795.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #15	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4808.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #16	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4838.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #17	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4751.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #18	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4764.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #19	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4809.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #2	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4890.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #20	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4797.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #21	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4887.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #22	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4939.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #23	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4886.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #24	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4885.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #25	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4848.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #26	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4802.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #27	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4807.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #28	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4825.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #29	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4815.9	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #3	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4872.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #30	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4773.5	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #31	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4876.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #32	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4892.1	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #33	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4842.7	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #34	CC1OC(C2=C(O)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4802.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #35	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4921.6	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #4	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4885.0	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #5	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4840.8	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #6	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4833.2	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #7	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4843.4	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #8	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4793.3	Semi standard non polar	33892256
6-C-Fucosylluteolin,4TBDMS,isomer #9	CC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4820.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 6-C-Fucosylluteolin GC-MS (Non-derivatized) - 70eV, Positive	splash10-0002-8079400000-78a0a95ffbcce34d042b	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 6-C-Fucosylluteolin GC-MS (3 TMS) - 70eV, Positive	splash10-0540-9000378000-e3acdf68540c77d8d202	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 6-C-Fucosylluteolin GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 10V, Positive-QTOF	splash10-001i-0001900000-f164eeac500d20f77224	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 20V, Positive-QTOF	splash10-00l2-2523900000-535bc5b12b061ea6d660	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 40V, Positive-QTOF	splash10-05mt-6397300000-5488ecec62497839b333	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 10V, Negative-QTOF	splash10-001i-1013900000-4830861a29f752787e5c	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 20V, Negative-QTOF	splash10-01sr-3139700000-811f87744329c358d468	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 40V, Negative-QTOF	splash10-052o-9473000000-e16cf8f0d4a88efb528a	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 10V, Positive-QTOF	splash10-001i-0000900000-509ee28ef47ce2bd195a	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 20V, Positive-QTOF	splash10-001i-0000900000-509ee28ef47ce2bd195a	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 40V, Positive-QTOF	splash10-0012-0595700000-176802353fbbaee0485c	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 10V, Negative-QTOF	splash10-001i-0000900000-96b50b9840c4a64e416b	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 20V, Negative-QTOF	splash10-001i-0000900000-9eea965addbce350e503	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 6-C-Fucosylluteolin 40V, Negative-QTOF	splash10-0fba-0791200000-90969861491664a032fb	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB019512

KNApSAcK ID

C00006106

Chemspider ID

35014688

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74977561

PDB ID

Not Available

ChEBI ID

176089

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for 6-C-Fucosylluteolin (HMDB0038898)

MOL for HMDB0038898 (6-C-Fucosylluteolin)

3D MOL for HMDB0038898 (6-C-Fucosylluteolin)

3D SDF for HMDB0038898 (6-C-Fucosylluteolin)

3D-SDF for HMDB0038898 (6-C-Fucosylluteolin)

PDB for HMDB0038898 (6-C-Fucosylluteolin)

3D PDB for HMDB0038898 (6-C-Fucosylluteolin)

SMILES for HMDB0038898 (6-C-Fucosylluteolin)

INCHI for HMDB0038898 (6-C-Fucosylluteolin)

Structure for HMDB0038898 (6-C-Fucosylluteolin)

3D Structure for HMDB0038898 (6-C-Fucosylluteolin)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra