Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-12 00:40:36 UTC |
---|
Update Date | 2022-03-07 02:56:08 UTC |
---|
HMDB ID | HMDB0039278 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | [12]-Gingerdione |
---|
Description | [12]-Gingerdione belongs to the class of organic compounds known as gingerdiones. Gingerdiones are compounds containing a gingerdione moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-dione. [12]-Gingerdione has been detected, but not quantified in, herbs and spices. This could make [12]-gingerdione a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on [12]-Gingerdione. |
---|
Structure | CCCCCCCCCCCC(=O)CC(=O)CCC1=CC(OC)=C(O)C=C1 InChI=1S/C23H36O4/c1-3-4-5-6-7-8-9-10-11-12-20(24)18-21(25)15-13-19-14-16-22(26)23(17-19)27-2/h14,16-17,26H,3-13,15,18H2,1-2H3 |
---|
Synonyms | Value | Source |
---|
1-(4-Hydroxy-3-methoxyphenyl)-3,5-hexadecanedione, 9ci | HMDB |
|
---|
Chemical Formula | C23H36O4 |
---|
Average Molecular Weight | 376.5295 |
---|
Monoisotopic Molecular Weight | 376.26135964 |
---|
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)hexadecane-3,5-dione |
---|
Traditional Name | 1-(4-hydroxy-3-methoxyphenyl)hexadecane-3,5-dione |
---|
CAS Registry Number | 91815-31-5 |
---|
SMILES | CCCCCCCCCCCC(=O)CC(=O)CCC1=CC(OC)=C(O)C=C1 |
---|
InChI Identifier | InChI=1S/C23H36O4/c1-3-4-5-6-7-8-9-10-11-12-20(24)18-21(25)15-13-19-14-16-22(26)23(17-19)27-2/h14,16-17,26H,3-13,15,18H2,1-2H3 |
---|
InChI Key | SRGFWRMSKPVJOD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as gingerdiones. Gingerdiones are compounds containing a gingerdione moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-dione. |
---|
Kingdom | Organic compounds |
---|
Super Class | Benzenoids |
---|
Class | Phenols |
---|
Sub Class | Methoxyphenols |
---|
Direct Parent | Gingerdiones |
---|
Alternative Parents | |
---|
Substituents | - Gingerdione
- Phenoxy compound
- Anisole
- Methoxybenzene
- Phenol ether
- 1-hydroxy-2-unsubstituted benzenoid
- Alkyl aryl ether
- 1,3-diketone
- Monocyclic benzene moiety
- 1,3-dicarbonyl compound
- Ketone
- Ether
- Organic oxygen compound
- Organooxygen compound
- Carbonyl group
- Hydrocarbon derivative
- Organic oxide
- Aromatic homomonocyclic compound
|
---|
Molecular Framework | Aromatic homomonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | |
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | | Show more...
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
[12]-Gingerdione,1TMS,isomer #1 | CCCCCCCCCCCC(=O)CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1 | 2991.2 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TMS,isomer #2 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 3083.6 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TMS,isomer #3 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 3063.1 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TMS,isomer #4 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 3079.6 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TMS,isomer #5 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C | 3078.5 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #1 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 3089.7 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #1 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2951.1 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #2 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 3095.2 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #2 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2944.0 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #3 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 3123.6 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #3 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2978.9 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #4 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 3075.8 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #4 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C | 2942.7 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #5 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3210.6 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #5 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3086.3 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #6 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3145.9 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #6 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3118.0 | Standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #7 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3181.5 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TMS,isomer #7 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3045.9 | Standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #1 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3217.9 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #1 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3002.2 | Standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #2 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3165.7 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #2 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3031.0 | Standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #3 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 3181.6 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TMS,isomer #3 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C)C(OC)=C1)O[Si](C)(C)C)O[Si](C)(C)C | 2968.7 | Standard non polar | 33892256 | [12]-Gingerdione,1TBDMS,isomer #1 | CCCCCCCCCCCC(=O)CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1 | 3257.4 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TBDMS,isomer #2 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3337.9 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TBDMS,isomer #3 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3305.0 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TBDMS,isomer #4 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3324.8 | Semi standard non polar | 33892256 | [12]-Gingerdione,1TBDMS,isomer #5 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3328.9 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #1 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3589.8 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #1 | CCCCCCCCCCCC(=CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3291.2 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #2 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3556.3 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #2 | CCCCCCCCCCC=C(CC(=O)CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3283.4 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #3 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3600.1 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #3 | CCCCCCCCCCCC(=O)CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3327.9 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #4 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3586.4 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #4 | CCCCCCCCCCCC(=O)C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C | 3282.9 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #5 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3712.9 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #5 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3443.0 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #6 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3630.8 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #6 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3469.4 | Standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #7 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3695.0 | Semi standard non polar | 33892256 | [12]-Gingerdione,2TBDMS,isomer #7 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3385.0 | Standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #1 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3923.5 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #1 | CCCCCCCCCCCC(=CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3478.9 | Standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #2 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3843.7 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #2 | CCCCCCCCCCC=C(CC(=CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3497.9 | Standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #3 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3901.7 | Semi standard non polar | 33892256 | [12]-Gingerdione,3TBDMS,isomer #3 | CCCCCCCCCCC=C(C=C(CCC1=CC=C(O[Si](C)(C)C(C)(C)C)C(OC)=C1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3437.4 | Standard non polar | 33892256 |
| Show more...
---|