Showing metabocard for Foeniculoside II (HMDB0040127)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-09-12 01:40:00 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-03-07 02:56:28 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0040127 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Foeniculoside II | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Foeniculoside II belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. Foeniculoside II has been detected, but not quantified in, fennels (Foeniculum vulgare) and herbs and spices. This could make foeniculoside II a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Foeniculoside II. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0040127 (Foeniculoside II)Mrv0541 05061311382D 62 70 0 0 0 0 999 V2000 5.1741 0.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2360 1.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8770 1.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3672 0.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5837 2.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5837 0.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5081 -1.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5122 -2.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4910 2.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1320 2.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4087 2.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4087 0.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0789 -1.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9251 -2.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6643 -1.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3970 -0.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2491 0.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0299 -0.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6023 -2.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 2.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 4.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4291 1.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1712 1.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3036 -1.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1122 -0.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 0.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9390 2.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8212 1.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1296 -2.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3389 -0.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9850 0.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4093 -1.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 0.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0503 -1.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9233 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 4.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3053 -0.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1387 0.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9233 1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 -0.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 4.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7812 4.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7812 3.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6538 1.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9704 -0.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 3.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 5.6479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1939 3.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6462 1.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4574 -3.0095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5605 -1.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7814 0.5111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9614 -2.4513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 5.6479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4957 4.8229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4957 3.1729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 2.3479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2253 -1.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1387 2.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 3.5854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4 1 2 0 0 0 0 9 2 1 0 0 0 0 10 3 2 0 0 0 0 11 5 1 0 0 0 0 12 6 2 0 0 0 0 13 7 1 0 0 0 0 14 8 2 0 0 0 0 23 1 1 0 0 0 0 23 2 2 0 0 0 0 23 3 1 0 0 0 0 24 5 2 0 0 0 0 24 6 1 0 0 0 0 25 7 2 0 0 0 0 25 8 1 0 0 0 0 26 4 1 0 0 0 0 26 15 2 0 0 0 0 27 16 2 0 0 0 0 27 17 1 0 0 0 0 28 9 2 0 0 0 0 28 10 1 0 0 0 0 29 11 2 0 0 0 0 29 12 1 0 0 0 0 30 13 2 0 0 0 0 30 14 1 0 0 0 0 31 16 1 0 0 0 0 31 18 2 0 0 0 0 32 17 2 0 0 0 0 32 18 1 0 0 0 0 33 15 1 0 0 0 0 33 19 2 0 0 0 0 34 20 2 0 0 0 0 34 21 1 0 0 0 0 35 20 1 0 0 0 0 36 19 1 0 0 0 0 37 21 2 0 0 0 0 38 22 1 0 0 0 0 39 26 1 0 0 0 0 39 36 2 0 0 0 0 40 27 1 0 0 0 0 41 35 2 0 0 0 0 41 37 1 0 0 0 0 41 40 1 0 0 0 0 42 35 1 0 0 0 0 42 39 1 0 0 0 0 43 38 1 0 0 0 0 44 43 1 0 0 0 0 45 44 1 0 0 0 0 46 24 1 0 0 0 0 46 40 1 0 0 0 0 47 25 1 0 0 0 0 47 42 1 0 0 0 0 48 45 1 0 0 0 0 49 22 1 0 0 0 0 50 28 1 0 0 0 0 51 29 1 0 0 0 0 52 30 1 0 0 0 0 53 31 1 0 0 0 0 54 32 1 0 0 0 0 55 33 1 0 0 0 0 56 43 1 0 0 0 0 57 44 1 0 0 0 0 58 45 1 0 0 0 0 59 34 1 0 0 0 0 59 48 1 0 0 0 0 60 36 1 0 0 0 0 60 47 1 0 0 0 0 61 37 1 0 0 0 0 61 46 1 0 0 0 0 62 38 1 0 0 0 0 62 48 1 0 0 0 0 M END 3D MOL for HMDB0040127 (Foeniculoside II)HMDB0040127 RDKit 3D Foeniculoside II 104112 0 0 0 0 0 0 0 0999 V2000 6.9071 -3.5860 -1.3008 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8719 -2.6051 -0.3171 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6297 -2.7158 0.5409 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4559 -2.5833 -0.1817 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4450 -2.2722 0.7329 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2660 -2.0911 0.0299 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4501 -0.9947 -0.0263 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6654 0.1802 0.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7347 1.2267 0.4836 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3853 1.1275 -0.3028 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6187 -0.0580 -0.9834 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7455 -0.2729 -1.8630 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1016 -0.0380 -1.3529 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8373 -0.4783 -0.2881 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -1.3868 0.7109 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8289 -1.8665 1.7512 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2266 -2.7691 2.7469 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9707 -3.2262 3.8226 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4530 -4.0681 4.7796 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1476 -4.5066 4.7165 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6060 -5.3546 5.6696 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4002 -4.0583 3.6519 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9191 -3.2015 2.6736 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1374 -0.0515 -0.1708 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7207 0.8014 -1.0854 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0364 1.2114 -0.9347 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9800 1.2459 -2.1571 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6786 0.8126 -2.2657 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7545 1.1474 -3.2802 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7098 0.1585 -3.2710 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4776 0.5378 -3.8931 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0060 1.8236 -3.8121 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1573 2.2565 -4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9477 1.3732 -5.0520 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1579 1.7975 -5.6272 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5207 0.0679 -5.1645 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3325 -0.3568 -4.6010 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3317 -1.0751 -0.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1115 2.4076 -0.1822 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2192 2.3793 0.8121 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4645 2.8456 0.4652 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5376 2.8679 1.3335 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7700 3.3522 0.9223 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3309 2.3939 2.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0887 1.9197 2.9815 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9111 1.4500 4.2689 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0312 1.9116 2.0837 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0805 3.3334 0.4018 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5914 4.2422 -0.5409 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1209 4.7498 -1.6999 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8995 5.5880 -2.4820 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1737 5.9357 -2.1129 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0020 6.7671 -2.8481 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6758 5.4306 -0.9340 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8957 4.6038 -0.1718 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7798 2.4837 1.0730 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2078 -3.4020 1.7103 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3602 -4.3367 1.1281 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4417 -4.0437 2.2242 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8990 -3.4605 3.4287 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5756 -4.0670 1.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7734 -4.2604 1.9200 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1271 -3.2125 -2.1902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7388 -2.7787 0.3654 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9343 -1.6141 -0.8094 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6522 -1.9046 1.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6995 -1.3375 1.2705 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5214 0.2948 1.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7759 -1.4457 -1.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1779 -1.6729 0.5517 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8560 -1.5982 1.9237 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9976 -2.9018 3.9004 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0557 -4.4200 5.6246 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6353 -6.3613 5.5969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3649 -4.3752 3.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2930 -2.8737 1.8531 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7607 -0.3716 0.6531 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4526 1.8368 -1.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4110 1.9229 -2.9006 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1772 -0.6457 -3.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6282 2.5233 -3.2823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4462 3.3007 -4.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1782 2.1602 -6.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1510 -0.6348 -5.7169 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0168 -1.3713 -4.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1583 -2.0259 -1.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4850 2.8118 -1.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6478 3.2299 -0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9079 3.6972 -0.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1332 2.3822 3.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6151 2.1072 4.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0526 1.5373 2.3789 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6202 3.9974 1.1560 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8929 4.4849 -1.9906 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5038 5.9810 -3.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6051 6.3103 -3.5433 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6874 5.6863 -0.6085 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3492 4.2338 0.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6490 -2.9785 2.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5945 -5.2221 1.5436 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2197 -5.0997 2.4876 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3832 -2.6285 3.2016 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4623 -4.8311 0.4561 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1393 -3.4358 2.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 20 22 1 0 22 23 2 0 14 24 2 0 24 25 1 0 25 26 1 0 25 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 11 38 2 0 10 39 1 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 1 0 42 44 2 0 44 45 1 0 45 46 1 0 45 47 2 0 39 48 1 0 48 49 1 0 49 50 2 0 50 51 1 0 51 52 2 0 52 53 1 0 52 54 1 0 54 55 2 0 48 56 1 0 5 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 3 1 0 38 7 1 0 47 40 1 0 55 49 1 0 56 9 1 0 30 12 1 0 37 31 1 0 28 13 2 0 23 17 1 0 1 63 1 0 2 64 1 0 2 65 1 0 3 66 1 0 5 67 1 0 8 68 1 0 12 69 1 0 15 70 1 0 16 71 1 0 18 72 1 0 19 73 1 0 21 74 1 0 22 75 1 0 23 76 1 0 24 77 1 0 26 78 1 0 27 79 1 0 30 80 1 0 32 81 1 0 33 82 1 0 35 83 1 0 36 84 1 0 37 85 1 0 38 86 1 0 39 87 1 0 41 88 1 0 43 89 1 0 44 90 1 0 46 91 1 0 47 92 1 0 48 93 1 0 50 94 1 0 51 95 1 0 53 96 1 0 54 97 1 0 55 98 1 0 57 99 1 0 58100 1 0 59101 1 0 60102 1 0 61103 1 0 62104 1 0 M END 3D SDF for HMDB0040127 (Foeniculoside II)Mrv0541 05061311382D 62 70 0 0 0 0 999 V2000 5.1741 0.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2360 1.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8770 1.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3672 0.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5837 2.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5837 0.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5081 -1.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5122 -2.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4910 2.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1320 2.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4087 2.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4087 0.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0789 -1.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9251 -2.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6643 -1.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3970 -0.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2491 0.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0299 -0.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6023 -2.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 2.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 4.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4291 1.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1712 1.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3036 -1.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1122 -0.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 0.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9390 2.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8212 1.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1296 -2.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3389 -0.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9850 0.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4093 -1.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 0.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0503 -1.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9233 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 4.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3053 -0.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1387 0.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9233 1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 -0.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 4.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7812 4.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7812 3.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6538 1.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9704 -0.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 3.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 5.6479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1939 3.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6462 1.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4574 -3.0095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5605 -1.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7814 0.5111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9614 -2.4513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 5.6479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4957 4.8229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4957 3.1729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0668 2.3479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2253 -1.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1387 2.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3523 3.5854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4 1 2 0 0 0 0 9 2 1 0 0 0 0 10 3 2 0 0 0 0 11 5 1 0 0 0 0 12 6 2 0 0 0 0 13 7 1 0 0 0 0 14 8 2 0 0 0 0 23 1 1 0 0 0 0 23 2 2 0 0 0 0 23 3 1 0 0 0 0 24 5 2 0 0 0 0 24 6 1 0 0 0 0 25 7 2 0 0 0 0 25 8 1 0 0 0 0 26 4 1 0 0 0 0 26 15 2 0 0 0 0 27 16 2 0 0 0 0 27 17 1 0 0 0 0 28 9 2 0 0 0 0 28 10 1 0 0 0 0 29 11 2 0 0 0 0 29 12 1 0 0 0 0 30 13 2 0 0 0 0 30 14 1 0 0 0 0 31 16 1 0 0 0 0 31 18 2 0 0 0 0 32 17 2 0 0 0 0 32 18 1 0 0 0 0 33 15 1 0 0 0 0 33 19 2 0 0 0 0 34 20 2 0 0 0 0 34 21 1 0 0 0 0 35 20 1 0 0 0 0 36 19 1 0 0 0 0 37 21 2 0 0 0 0 38 22 1 0 0 0 0 39 26 1 0 0 0 0 39 36 2 0 0 0 0 40 27 1 0 0 0 0 41 35 2 0 0 0 0 41 37 1 0 0 0 0 41 40 1 0 0 0 0 42 35 1 0 0 0 0 42 39 1 0 0 0 0 43 38 1 0 0 0 0 44 43 1 0 0 0 0 45 44 1 0 0 0 0 46 24 1 0 0 0 0 46 40 1 0 0 0 0 47 25 1 0 0 0 0 47 42 1 0 0 0 0 48 45 1 0 0 0 0 49 22 1 0 0 0 0 50 28 1 0 0 0 0 51 29 1 0 0 0 0 52 30 1 0 0 0 0 53 31 1 0 0 0 0 54 32 1 0 0 0 0 55 33 1 0 0 0 0 56 43 1 0 0 0 0 57 44 1 0 0 0 0 58 45 1 0 0 0 0 59 34 1 0 0 0 0 59 48 1 0 0 0 0 60 36 1 0 0 0 0 60 47 1 0 0 0 0 61 37 1 0 0 0 0 61 46 1 0 0 0 0 62 38 1 0 0 0 0 62 48 1 0 0 0 0 M END > <DATABASE_ID> HMDB0040127 > <DATABASE_NAME> hmdb > <SMILES> OCC1OC(OC2=CC(C3C(OC4=C3C(\C=C\C3=CC=C(O)C=C3)=CC(O)=C4)C3=CC=C(O)C=C3)=C3C(C(OC3=C2)C2=CC=C(O)C=C2)C2=CC(O)=CC(O)=C2)C(O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1S/C48H42O14/c49-22-38-43(56)44(57)45(58)48(62-38)59-34-20-35(41-37(21-34)61-46(24-5-11-29(51)12-6-24)40(41)27-16-31(53)18-32(54)17-27)42-39-26(4-1-23-2-9-28(50)10-3-23)15-33(55)19-36(39)60-47(42)25-7-13-30(52)14-8-25/h1-21,38,40,42-58H,22H2/b4-1+ > <INCHI_KEY> LIMXEMROHIJDBW-DAFODLJHSA-N > <FORMULA> C48H42O14 > <MOLECULAR_WEIGHT> 842.8387 > <EXACT_MASS> 842.257456052 > <JCHEM_ACCEPTOR_COUNT> 14 > <JCHEM_AVERAGE_POLARIZABILITY> 85.5849018371309 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[3-(3,5-dihydroxyphenyl)-4-[6-hydroxy-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol > <ALOGPS_LOGP> 4.94 > <JCHEM_LOGP> 6.250529960333332 > <ALOGPS_LOGS> -4.93 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 9 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 9.104410137507738 > <JCHEM_PKA_STRONGEST_ACIDIC> 8.700324206537507 > <JCHEM_PKA_STRONGEST_BASIC> -3.6789465892609448 > <JCHEM_POLAR_SURFACE_AREA> 239.21999999999994 > <JCHEM_REFRACTIVITY> 224.7679000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 9 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 9.88e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-{[3-(3,5-dihydroxyphenyl)-4-[6-hydroxy-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0040127 (Foeniculoside II)HMDB0040127 RDKit 3D Foeniculoside II 104112 0 0 0 0 0 0 0 0999 V2000 6.9071 -3.5860 -1.3008 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8719 -2.6051 -0.3171 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6297 -2.7158 0.5409 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4559 -2.5833 -0.1817 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4450 -2.2722 0.7329 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2660 -2.0911 0.0299 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4501 -0.9947 -0.0263 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6654 0.1802 0.6366 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7347 1.2267 0.4836 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3853 1.1275 -0.3028 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6187 -0.0580 -0.9834 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7455 -0.2729 -1.8630 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1016 -0.0380 -1.3529 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8373 -0.4783 -0.2881 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2267 -1.3868 0.7109 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8289 -1.8665 1.7512 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2266 -2.7691 2.7469 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9707 -3.2262 3.8226 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4530 -4.0681 4.7796 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1476 -4.5066 4.7165 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6060 -5.3546 5.6696 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4002 -4.0583 3.6519 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9191 -3.2015 2.6736 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1374 -0.0515 -0.1708 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7207 0.8014 -1.0854 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0364 1.2114 -0.9347 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9800 1.2459 -2.1571 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6786 0.8126 -2.2657 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7545 1.1474 -3.2802 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7098 0.1585 -3.2710 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4776 0.5378 -3.8931 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0060 1.8236 -3.8121 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1573 2.2565 -4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9477 1.3732 -5.0520 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1579 1.7975 -5.6272 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5207 0.0679 -5.1645 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3325 -0.3568 -4.6010 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3317 -1.0751 -0.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1115 2.4076 -0.1822 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2192 2.3793 0.8121 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4645 2.8456 0.4652 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5376 2.8679 1.3335 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7700 3.3522 0.9223 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3309 2.3939 2.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0887 1.9197 2.9815 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9111 1.4500 4.2689 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0312 1.9116 2.0837 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0805 3.3334 0.4018 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5914 4.2422 -0.5409 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1209 4.7498 -1.6999 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8995 5.5880 -2.4820 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1737 5.9357 -2.1129 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0020 6.7671 -2.8481 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6758 5.4306 -0.9340 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8957 4.6038 -0.1718 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7798 2.4837 1.0730 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2078 -3.4020 1.7103 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3602 -4.3367 1.1281 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4417 -4.0437 2.2242 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8990 -3.4605 3.4287 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5756 -4.0670 1.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7734 -4.2604 1.9200 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1271 -3.2125 -2.1902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7388 -2.7787 0.3654 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9343 -1.6141 -0.8094 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6522 -1.9046 1.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6995 -1.3375 1.2705 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5214 0.2948 1.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7759 -1.4457 -1.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1779 -1.6729 0.5517 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8560 -1.5982 1.9237 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9976 -2.9018 3.9004 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0557 -4.4200 5.6246 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6353 -6.3613 5.5969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3649 -4.3752 3.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2930 -2.8737 1.8531 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7607 -0.3716 0.6531 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4526 1.8368 -1.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4110 1.9229 -2.9006 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1772 -0.6457 -3.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6282 2.5233 -3.2823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4462 3.3007 -4.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1782 2.1602 -6.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1510 -0.6348 -5.7169 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0168 -1.3713 -4.6792 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1583 -2.0259 -1.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4850 2.8118 -1.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6478 3.2299 -0.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9079 3.6972 -0.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1332 2.3822 3.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6151 2.1072 4.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0526 1.5373 2.3789 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6202 3.9974 1.1560 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8929 4.4849 -1.9906 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5038 5.9810 -3.4032 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6051 6.3103 -3.5433 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6874 5.6863 -0.6085 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3492 4.2338 0.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6490 -2.9785 2.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5945 -5.2221 1.5436 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2197 -5.0997 2.4876 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3832 -2.6285 3.2016 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4623 -4.8311 0.4561 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1393 -3.4358 2.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 20 22 1 0 22 23 2 0 14 24 2 0 24 25 1 0 25 26 1 0 25 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 11 38 2 0 10 39 1 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 1 0 42 44 2 0 44 45 1 0 45 46 1 0 45 47 2 0 39 48 1 0 48 49 1 0 49 50 2 0 50 51 1 0 51 52 2 0 52 53 1 0 52 54 1 0 54 55 2 0 48 56 1 0 5 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 3 1 0 38 7 1 0 47 40 1 0 55 49 1 0 56 9 1 0 30 12 1 0 37 31 1 0 28 13 2 0 23 17 1 0 1 63 1 0 2 64 1 0 2 65 1 0 3 66 1 0 5 67 1 0 8 68 1 0 12 69 1 0 15 70 1 0 16 71 1 0 18 72 1 0 19 73 1 0 21 74 1 0 22 75 1 0 23 76 1 0 24 77 1 0 26 78 1 0 27 79 1 0 30 80 1 0 32 81 1 0 33 82 1 0 35 83 1 0 36 84 1 0 37 85 1 0 38 86 1 0 39 87 1 0 41 88 1 0 43 89 1 0 44 90 1 0 46 91 1 0 47 92 1 0 48 93 1 0 50 94 1 0 51 95 1 0 53 96 1 0 54 97 1 0 55 98 1 0 57 99 1 0 58100 1 0 59101 1 0 60102 1 0 61103 1 0 62104 1 0 M END PDB for HMDB0040127 (Foeniculoside II)HEADER PROTEIN 06-MAY-13 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 06-MAY-13 0 HETATM 1 C UNK 0 9.658 0.963 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 11.641 2.747 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 9.104 3.572 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 8.152 0.643 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -1.090 4.176 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -1.090 1.509 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 0.948 -1.964 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 2.823 -3.862 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 12.117 4.212 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 9.580 5.036 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -2.630 4.176 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -2.630 1.509 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -0.147 -3.046 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 1.727 -4.943 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 8.707 -1.967 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 0.741 -1.130 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -0.465 1.249 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -1.922 -0.985 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 6.724 -3.751 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 6.258 2.073 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 4.924 4.383 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 4.924 9.003 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 10.134 2.427 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -0.320 2.843 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 2.433 -2.371 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 7.676 -0.822 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 0.825 0.407 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 11.086 5.357 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -3.400 2.843 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 0.242 -4.536 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -0.633 -1.827 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -1.839 0.552 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 8.231 -3.431 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 6.258 3.613 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 4.924 1.303 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 5.694 -2.607 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 3.590 3.613 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 6.258 8.233 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 6.170 -1.142 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 2.126 1.597 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 3.590 2.073 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 4.924 -0.237 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 7.591 9.003 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 8.925 8.233 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 8.925 6.693 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 1.220 2.843 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 3.678 -1.142 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 7.591 5.923 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 4.924 10.543 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 11.562 6.821 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 -4.940 2.843 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 -0.854 -5.618 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -1.046 -3.254 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -3.325 0.954 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 9.261 -4.576 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 7.591 10.543 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 10.259 9.003 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 10.259 5.923 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 7.591 4.383 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 4.154 -2.607 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 2.126 4.089 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 6.258 6.693 0.000 0.00 0.00 O+0 CONECT 1 4 23 CONECT 2 9 23 CONECT 3 10 23 CONECT 4 1 26 CONECT 5 11 24 CONECT 6 12 24 CONECT 7 13 25 CONECT 8 14 25 CONECT 9 2 28 CONECT 10 3 28 CONECT 11 5 29 CONECT 12 6 29 CONECT 13 7 30 CONECT 14 8 30 CONECT 15 26 33 CONECT 16 27 31 CONECT 17 27 32 CONECT 18 31 32 CONECT 19 33 36 CONECT 20 34 35 CONECT 21 34 37 CONECT 22 38 49 CONECT 23 1 2 3 CONECT 24 5 6 46 CONECT 25 7 8 47 CONECT 26 4 15 39 CONECT 27 16 17 40 CONECT 28 9 10 50 CONECT 29 11 12 51 CONECT 30 13 14 52 CONECT 31 16 18 53 CONECT 32 17 18 54 CONECT 33 15 19 55 CONECT 34 20 21 59 CONECT 35 20 41 42 CONECT 36 19 39 60 CONECT 37 21 41 61 CONECT 38 22 43 62 CONECT 39 26 36 42 CONECT 40 27 41 46 CONECT 41 35 37 40 CONECT 42 35 39 47 CONECT 43 38 44 56 CONECT 44 43 45 57 CONECT 45 44 48 58 CONECT 46 24 40 61 CONECT 47 25 42 60 CONECT 48 45 59 62 CONECT 49 22 CONECT 50 28 CONECT 51 29 CONECT 52 30 CONECT 53 31 CONECT 54 32 CONECT 55 33 CONECT 56 43 CONECT 57 44 CONECT 58 45 CONECT 59 34 48 CONECT 60 36 47 CONECT 61 37 46 CONECT 62 38 48 MASTER 0 0 0 0 0 0 0 0 62 0 140 0 END 3D PDB for HMDB0040127 (Foeniculoside II)COMPND HMDB0040127 HETATM 1 O1 UNL 1 6.907 -3.586 -1.301 1.00 0.00 O HETATM 2 C1 UNL 1 6.872 -2.605 -0.317 1.00 0.00 C HETATM 3 C2 UNL 1 5.630 -2.716 0.541 1.00 0.00 C HETATM 4 O2 UNL 1 4.456 -2.583 -0.182 1.00 0.00 O HETATM 5 C3 UNL 1 3.445 -2.272 0.733 1.00 0.00 C HETATM 6 O3 UNL 1 2.266 -2.091 0.030 1.00 0.00 O HETATM 7 C4 UNL 1 1.450 -0.995 -0.026 1.00 0.00 C HETATM 8 C5 UNL 1 1.665 0.180 0.637 1.00 0.00 C HETATM 9 C6 UNL 1 0.735 1.227 0.484 1.00 0.00 C HETATM 10 C7 UNL 1 -0.385 1.127 -0.303 1.00 0.00 C HETATM 11 C8 UNL 1 -0.619 -0.058 -0.983 1.00 0.00 C HETATM 12 C9 UNL 1 -1.745 -0.273 -1.863 1.00 0.00 C HETATM 13 C10 UNL 1 -3.102 -0.038 -1.353 1.00 0.00 C HETATM 14 C11 UNL 1 -3.837 -0.478 -0.288 1.00 0.00 C HETATM 15 C12 UNL 1 -3.227 -1.387 0.711 1.00 0.00 C HETATM 16 C13 UNL 1 -3.829 -1.867 1.751 1.00 0.00 C HETATM 17 C14 UNL 1 -3.227 -2.769 2.747 1.00 0.00 C HETATM 18 C15 UNL 1 -3.971 -3.226 3.823 1.00 0.00 C HETATM 19 C16 UNL 1 -3.453 -4.068 4.780 1.00 0.00 C HETATM 20 C17 UNL 1 -2.148 -4.507 4.717 1.00 0.00 C HETATM 21 O4 UNL 1 -1.606 -5.355 5.670 1.00 0.00 O HETATM 22 C18 UNL 1 -1.400 -4.058 3.652 1.00 0.00 C HETATM 23 C19 UNL 1 -1.919 -3.201 2.674 1.00 0.00 C HETATM 24 C20 UNL 1 -5.137 -0.051 -0.171 1.00 0.00 C HETATM 25 C21 UNL 1 -5.721 0.801 -1.085 1.00 0.00 C HETATM 26 O5 UNL 1 -7.036 1.211 -0.935 1.00 0.00 O HETATM 27 C22 UNL 1 -4.980 1.246 -2.157 1.00 0.00 C HETATM 28 C23 UNL 1 -3.679 0.813 -2.266 1.00 0.00 C HETATM 29 O6 UNL 1 -2.754 1.147 -3.280 1.00 0.00 O HETATM 30 C24 UNL 1 -1.710 0.158 -3.271 1.00 0.00 C HETATM 31 C25 UNL 1 -0.478 0.538 -3.893 1.00 0.00 C HETATM 32 C26 UNL 1 -0.006 1.824 -3.812 1.00 0.00 C HETATM 33 C27 UNL 1 1.157 2.256 -4.359 1.00 0.00 C HETATM 34 C28 UNL 1 1.948 1.373 -5.052 1.00 0.00 C HETATM 35 O7 UNL 1 3.158 1.797 -5.627 1.00 0.00 O HETATM 36 C29 UNL 1 1.521 0.068 -5.164 1.00 0.00 C HETATM 37 C30 UNL 1 0.332 -0.357 -4.601 1.00 0.00 C HETATM 38 C31 UNL 1 0.332 -1.075 -0.804 1.00 0.00 C HETATM 39 C32 UNL 1 -1.111 2.408 -0.182 1.00 0.00 C HETATM 40 C33 UNL 1 -2.219 2.379 0.812 1.00 0.00 C HETATM 41 C34 UNL 1 -3.464 2.846 0.465 1.00 0.00 C HETATM 42 C35 UNL 1 -4.538 2.868 1.333 1.00 0.00 C HETATM 43 O8 UNL 1 -5.770 3.352 0.922 1.00 0.00 O HETATM 44 C36 UNL 1 -4.331 2.394 2.609 1.00 0.00 C HETATM 45 C37 UNL 1 -3.089 1.920 2.982 1.00 0.00 C HETATM 46 O9 UNL 1 -2.911 1.450 4.269 1.00 0.00 O HETATM 47 C38 UNL 1 -2.031 1.912 2.084 1.00 0.00 C HETATM 48 C39 UNL 1 -0.081 3.333 0.402 1.00 0.00 C HETATM 49 C40 UNL 1 0.591 4.242 -0.541 1.00 0.00 C HETATM 50 C41 UNL 1 0.121 4.750 -1.700 1.00 0.00 C HETATM 51 C42 UNL 1 0.900 5.588 -2.482 1.00 0.00 C HETATM 52 C43 UNL 1 2.174 5.936 -2.113 1.00 0.00 C HETATM 53 O10 UNL 1 3.002 6.767 -2.848 1.00 0.00 O HETATM 54 C44 UNL 1 2.676 5.431 -0.934 1.00 0.00 C HETATM 55 C45 UNL 1 1.896 4.604 -0.172 1.00 0.00 C HETATM 56 O11 UNL 1 0.780 2.484 1.073 1.00 0.00 O HETATM 57 C46 UNL 1 3.208 -3.402 1.710 1.00 0.00 C HETATM 58 O12 UNL 1 2.360 -4.337 1.128 1.00 0.00 O HETATM 59 C47 UNL 1 4.442 -4.044 2.224 1.00 0.00 C HETATM 60 O13 UNL 1 4.899 -3.460 3.429 1.00 0.00 O HETATM 61 C48 UNL 1 5.576 -4.067 1.227 1.00 0.00 C HETATM 62 O14 UNL 1 6.773 -4.260 1.920 1.00 0.00 O HETATM 63 H1 UNL 1 7.127 -3.213 -2.190 1.00 0.00 H HETATM 64 H2 UNL 1 7.739 -2.779 0.365 1.00 0.00 H HETATM 65 H3 UNL 1 6.934 -1.614 -0.809 1.00 0.00 H HETATM 66 H4 UNL 1 5.652 -1.905 1.296 1.00 0.00 H HETATM 67 H5 UNL 1 3.700 -1.337 1.271 1.00 0.00 H HETATM 68 H6 UNL 1 2.521 0.295 1.255 1.00 0.00 H HETATM 69 H7 UNL 1 -1.776 -1.446 -1.985 1.00 0.00 H HETATM 70 H8 UNL 1 -2.178 -1.673 0.552 1.00 0.00 H HETATM 71 H9 UNL 1 -4.856 -1.598 1.924 1.00 0.00 H HETATM 72 H10 UNL 1 -4.998 -2.902 3.900 1.00 0.00 H HETATM 73 H11 UNL 1 -4.056 -4.420 5.625 1.00 0.00 H HETATM 74 H12 UNL 1 -1.635 -6.361 5.597 1.00 0.00 H HETATM 75 H13 UNL 1 -0.365 -4.375 3.558 1.00 0.00 H HETATM 76 H14 UNL 1 -1.293 -2.874 1.853 1.00 0.00 H HETATM 77 H15 UNL 1 -5.761 -0.372 0.653 1.00 0.00 H HETATM 78 H16 UNL 1 -7.453 1.837 -1.612 1.00 0.00 H HETATM 79 H17 UNL 1 -5.411 1.923 -2.901 1.00 0.00 H HETATM 80 H18 UNL 1 -2.177 -0.646 -3.966 1.00 0.00 H HETATM 81 H19 UNL 1 -0.628 2.523 -3.282 1.00 0.00 H HETATM 82 H20 UNL 1 1.446 3.301 -4.238 1.00 0.00 H HETATM 83 H21 UNL 1 3.178 2.160 -6.590 1.00 0.00 H HETATM 84 H22 UNL 1 2.151 -0.635 -5.717 1.00 0.00 H HETATM 85 H23 UNL 1 -0.017 -1.371 -4.679 1.00 0.00 H HETATM 86 H24 UNL 1 0.158 -2.026 -1.343 1.00 0.00 H HETATM 87 H25 UNL 1 -1.485 2.812 -1.108 1.00 0.00 H HETATM 88 H26 UNL 1 -3.648 3.230 -0.545 1.00 0.00 H HETATM 89 H27 UNL 1 -5.908 3.697 -0.018 1.00 0.00 H HETATM 90 H28 UNL 1 -5.133 2.382 3.347 1.00 0.00 H HETATM 91 H29 UNL 1 -2.615 2.107 4.987 1.00 0.00 H HETATM 92 H30 UNL 1 -1.053 1.537 2.379 1.00 0.00 H HETATM 93 H31 UNL 1 -0.620 3.997 1.156 1.00 0.00 H HETATM 94 H32 UNL 1 -0.893 4.485 -1.991 1.00 0.00 H HETATM 95 H33 UNL 1 0.504 5.981 -3.403 1.00 0.00 H HETATM 96 H34 UNL 1 3.605 6.310 -3.543 1.00 0.00 H HETATM 97 H35 UNL 1 3.687 5.686 -0.608 1.00 0.00 H HETATM 98 H36 UNL 1 2.349 4.234 0.755 1.00 0.00 H HETATM 99 H37 UNL 1 2.649 -2.978 2.587 1.00 0.00 H HETATM 100 H38 UNL 1 2.595 -5.222 1.544 1.00 0.00 H HETATM 101 H39 UNL 1 4.220 -5.100 2.488 1.00 0.00 H HETATM 102 H40 UNL 1 5.383 -2.629 3.202 1.00 0.00 H HETATM 103 H41 UNL 1 5.462 -4.831 0.456 1.00 0.00 H HETATM 104 H42 UNL 1 7.139 -3.436 2.311 1.00 0.00 H CONECT 1 2 63 CONECT 2 3 64 65 CONECT 3 4 61 66 CONECT 4 5 CONECT 5 6 57 67 CONECT 6 7 CONECT 7 8 8 38 CONECT 8 9 68 CONECT 9 10 10 56 CONECT 10 11 39 CONECT 11 12 38 38 CONECT 12 13 30 69 CONECT 13 14 28 28 CONECT 14 15 24 24 CONECT 15 16 16 70 CONECT 16 17 71 CONECT 17 18 18 23 CONECT 18 19 72 CONECT 19 20 20 73 CONECT 20 21 22 CONECT 21 74 CONECT 22 23 23 75 CONECT 23 76 CONECT 24 25 77 CONECT 25 26 27 27 CONECT 26 78 CONECT 27 28 79 CONECT 28 29 CONECT 29 30 CONECT 30 31 80 CONECT 31 32 32 37 CONECT 32 33 81 CONECT 33 34 34 82 CONECT 34 35 36 CONECT 35 83 CONECT 36 37 37 84 CONECT 37 85 CONECT 38 86 CONECT 39 40 48 87 CONECT 40 41 41 47 CONECT 41 42 88 CONECT 42 43 44 44 CONECT 43 89 CONECT 44 45 90 CONECT 45 46 47 47 CONECT 46 91 CONECT 47 92 CONECT 48 49 56 93 CONECT 49 50 50 55 CONECT 50 51 94 CONECT 51 52 52 95 CONECT 52 53 54 CONECT 53 96 CONECT 54 55 55 97 CONECT 55 98 CONECT 57 58 59 99 CONECT 58 100 CONECT 59 60 61 101 CONECT 60 102 CONECT 61 62 103 CONECT 62 104 END SMILES for HMDB0040127 (Foeniculoside II)OCC1OC(OC2=CC(C3C(OC4=C3C(\C=C\C3=CC=C(O)C=C3)=CC(O)=C4)C3=CC=C(O)C=C3)=C3C(C(OC3=C2)C2=CC=C(O)C=C2)C2=CC(O)=CC(O)=C2)C(O)C(O)C1O INCHI for HMDB0040127 (Foeniculoside II)InChI=1S/C48H42O14/c49-22-38-43(56)44(57)45(58)48(62-38)59-34-20-35(41-37(21-34)61-46(24-5-11-29(51)12-6-24)40(41)27-16-31(53)18-32(54)17-27)42-39-26(4-1-23-2-9-28(50)10-3-23)15-33(55)19-36(39)60-47(42)25-7-13-30(52)14-8-25/h1-21,38,40,42-58H,22H2/b4-1+ 3D Structure for HMDB0040127 (Foeniculoside II) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C48H42O14 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 842.8387 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 842.257456052 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[3-(3,5-dihydroxyphenyl)-4-[6-hydroxy-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[3-(3,5-dihydroxyphenyl)-4-[6-hydroxy-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | 168010-11-5 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OCC1OC(OC2=CC(C3C(OC4=C3C(\C=C\C3=CC=C(O)C=C3)=CC(O)=C4)C3=CC=C(O)C=C3)=C3C(C(OC3=C2)C2=CC=C(O)C=C2)C2=CC(O)=CC(O)=C2)C(O)C(O)C1O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C48H42O14/c49-22-38-43(56)44(57)45(58)48(62-38)59-34-20-35(41-37(21-34)61-46(24-5-11-29(51)12-6-24)40(41)27-16-31(53)18-32(54)17-27)42-39-26(4-1-23-2-9-28(50)10-3-23)15-33(55)19-36(39)60-47(42)25-7-13-30(52)14-8-25/h1-21,38,40,42-58H,22H2/b4-1+ | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | LIMXEMROHIJDBW-DAFODLJHSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB019820 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131752777 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|