Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 02:01:21 UTC

Update Date

2022-03-07 02:56:36 UTC

HMDB ID

HMDB0040475

Secondary Accession Numbers

HMDB40475

Metabolite Identification

Common Name

Kaempferol 3-O-glucosyl-(1->2)-rhamnoside

Description

Kaempferol 3-O-glucosyl-(1->2)-rhamnoside belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Kaempferol 3-O-glucosyl-(1->2)-rhamnoside has been detected, but not quantified in, fats and oils and ginkgo nuts (Ginkgo biloba). This could make kaempferol 3-O-glucosyl-(1->2)-rhamnoside a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Kaempferol 3-O-glucosyl-(1->2)-rhamnoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061311522D          

 42 46  0  0  0  0            999 V2000
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  1  1  0  0  0  0
 10  2  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 12  7  1  0  0  0  0
 13  6  1  0  0  0  0
 14  7  2  0  0  0  0
 15  8  1  0  0  0  0
 16 13  2  0  0  0  0
 16 14  1  0  0  0  0
 17  9  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 18  1  0  0  0  0
 21 17  1  0  0  0  0
 22 20  1  0  0  0  0
 23 10  1  0  0  0  0
 24 19  1  0  0  0  0
 24 23  2  0  0  0  0
 25 21  1  0  0  0  0
 26 22  1  0  0  0  0
 27 25  1  0  0  0  0
 28  8  1  0  0  0  0
 29 11  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38  9  1  0  0  0  0
 38 27  1  0  0  0  0
 39 14  1  0  0  0  0
 39 23  1  0  0  0  0
 40 15  1  0  0  0  0
 40 26  1  0  0  0  0
 41 24  1  0  0  0  0
 41 27  1  0  0  0  0
 42 25  1  0  0  0  0
 42 26  1  0  0  0  0
M  END

HMDB0040475
     RDKit          3D
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside
 72 76  0  0  0  0  0  0  0  0999 V2000
   -1.6284   -3.5501    1.3298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0086   -3.6219   -0.0229 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171   -3.0947   -0.1995 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -1.6848    0.0762 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4047   -1.1697   -0.3222 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5309   -0.6692   -0.7018 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0268    0.5735   -0.4141 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3744    1.5848    0.4069 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223    2.9046    0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3520    3.9310    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3910    3.7060    2.0062 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9189    4.7574    2.7811 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9291    2.4239    2.1552 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4256    1.3870    1.3564 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2172    0.9054   -0.9263 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9646    0.1720   -1.6708 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1852    0.5756   -2.1668 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9401   -0.2626   -2.9617 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1558    0.2342   -3.4120 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212   -1.5326   -3.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3102   -1.9428   -2.8108 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8033   -3.2160   -3.0999 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5289   -1.1155   -2.0067 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3360   -1.5255   -1.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8789   -2.6939   -1.8013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9154   -0.9651   -0.4993 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9036   -0.8260    0.4308 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4704    0.4027    0.5898 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8038    0.4422    0.1535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3076    1.7026    0.4434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5936    1.9810   -0.3078 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4210    1.9271   -1.6763 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5182    1.8787    1.9426 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0320    3.1213    2.3391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6989    0.8315    2.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5131    1.3048    3.9882 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3343    0.8461    2.0163 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4476    0.0523    2.7338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266   -1.8408   -1.6728 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3287   -2.1296   -2.4538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0239   -3.1159   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2190   -4.0050   -2.0824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7019   -3.2424    1.3380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0187   -3.0070    2.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6736   -4.6050    1.7467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9264   -4.7281   -0.2714 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1645   -1.6881    1.2041 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5828    3.1416   -0.4601 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7396    4.9188    0.9027 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3451    5.0252    3.6745 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1787    2.2360    2.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0504    0.4184    1.5312 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5266    1.5771   -1.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9700    0.0693   -2.8239 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339   -2.1811   -3.9288 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3825   -3.7863   -3.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6231    0.0085   -0.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9426    1.1102   -0.0815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5679    2.4450    0.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0327    2.9556   -0.0218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3517    1.2072   -0.0096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2935    1.9613   -2.1327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5874    1.8530    2.2210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6673    3.8077    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1567   -0.1570    2.6779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2745    1.8486    4.3364 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9892    1.9113    2.0869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8073   -0.1734    3.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2091   -1.3759   -2.2467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5505   -2.5707   -3.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9817   -2.8070   -0.5899 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6168   -4.8568   -1.7951 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
  4 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 26 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41  2  1  0
 24  6  1  0
 37 28  1  0
 14  8  1  0
 23 16  1  0
  1 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  0
  4 47  1  0
  9 48  1  0
 10 49  1  0
 12 50  1  0
 13 51  1  0
 14 52  1  0
 17 53  1  0
 19 54  1  0
 20 55  1  0
 22 56  1  0
 26 57  1  0
 28 58  1  0
 30 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
M  END


  Mrv0541 05061311522D          

 42 46  0  0  0  0            999 V2000
    1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4302   -5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1447   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0  0  0  0
  5  3  2  0  0  0  0
  9  1  1  0  0  0  0
 10  2  2  0  0  0  0
 10  3  1  0  0  0  0
 11  4  2  0  0  0  0
 11  5  1  0  0  0  0
 12  6  2  0  0  0  0
 12  7  1  0  0  0  0
 13  6  1  0  0  0  0
 14  7  2  0  0  0  0
 15  8  1  0  0  0  0
 16 13  2  0  0  0  0
 16 14  1  0  0  0  0
 17  9  1  0  0  0  0
 18 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 18  1  0  0  0  0
 21 17  1  0  0  0  0
 22 20  1  0  0  0  0
 23 10  1  0  0  0  0
 24 19  1  0  0  0  0
 24 23  2  0  0  0  0
 25 21  1  0  0  0  0
 26 22  1  0  0  0  0
 27 25  1  0  0  0  0
 28  8  1  0  0  0  0
 29 11  1  0  0  0  0
 30 12  1  0  0  0  0
 31 13  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  2  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38  9  1  0  0  0  0
 38 27  1  0  0  0  0
 39 14  1  0  0  0  0
 39 23  1  0  0  0  0
 40 15  1  0  0  0  0
 40 26  1  0  0  0  0
 41 24  1  0  0  0  0
 41 27  1  0  0  0  0
 42 25  1  0  0  0  0
 42 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0040475

> <DATABASE_NAME>
hmdb

> <SMILES>
CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O15/c1-9-17(32)21(36)25(42-26-22(37)20(35)18(33)15(8-28)40-26)27(38-9)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3

> <INCHI_KEY>
BCNBWICEIXAVQF-UHFFFAOYSA-N

> <FORMULA>
C27H30O15

> <MOLECULAR_WEIGHT>
594.5181

> <EXACT_MASS>
594.15847029

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
56.88648214644997

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

> <ALOGPS_LOGP>
0.08

> <JCHEM_LOGP>
-0.5651956533333328

> <ALOGPS_LOGS>
-2.21

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.440184756743612

> <JCHEM_PKA_STRONGEST_ACIDIC>
6.4338890525723125

> <JCHEM_PKA_STRONGEST_BASIC>
-3.612497264098989

> <JCHEM_POLAR_SURFACE_AREA>
245.28999999999994

> <JCHEM_REFRACTIVITY>
138.16419999999994

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.70e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0040475
     RDKit          3D
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside
 72 76  0  0  0  0  0  0  0  0999 V2000
   -1.6284   -3.5501    1.3298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0086   -3.6219   -0.0229 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171   -3.0947   -0.1995 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -1.6848    0.0762 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4047   -1.1697   -0.3222 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5309   -0.6692   -0.7018 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0268    0.5735   -0.4141 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3744    1.5848    0.4069 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223    2.9046    0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3520    3.9310    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3910    3.7060    2.0062 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9189    4.7574    2.7811 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9291    2.4239    2.1552 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4256    1.3870    1.3564 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2172    0.9054   -0.9263 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9646    0.1720   -1.6708 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1852    0.5756   -2.1668 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9401   -0.2626   -2.9617 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1558    0.2342   -3.4120 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212   -1.5326   -3.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3102   -1.9428   -2.8108 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8033   -3.2160   -3.0999 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5289   -1.1155   -2.0067 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3360   -1.5255   -1.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8789   -2.6939   -1.8013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9154   -0.9651   -0.4993 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9036   -0.8260    0.4308 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4704    0.4027    0.5898 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8038    0.4422    0.1535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3076    1.7026    0.4434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5936    1.9810   -0.3078 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4210    1.9271   -1.6763 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5182    1.8787    1.9426 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0320    3.1213    2.3391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6989    0.8315    2.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5131    1.3048    3.9882 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3343    0.8461    2.0163 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4476    0.0523    2.7338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266   -1.8408   -1.6728 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3287   -2.1296   -2.4538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0239   -3.1159   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2190   -4.0050   -2.0824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7019   -3.2424    1.3380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0187   -3.0070    2.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6736   -4.6050    1.7467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9264   -4.7281   -0.2714 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1645   -1.6881    1.2041 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5828    3.1416   -0.4601 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7396    4.9188    0.9027 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3451    5.0252    3.6745 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1787    2.2360    2.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0504    0.4184    1.5312 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5266    1.5771   -1.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9700    0.0693   -2.8239 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339   -2.1811   -3.9288 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3825   -3.7863   -3.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6231    0.0085   -0.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9426    1.1102   -0.0815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5679    2.4450    0.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0327    2.9556   -0.0218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3517    1.2072   -0.0096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2935    1.9613   -2.1327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5874    1.8530    2.2210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6673    3.8077    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1567   -0.1570    2.6779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2745    1.8486    4.3364 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9892    1.9113    2.0869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8073   -0.1734    3.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2091   -1.3759   -2.2467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5505   -2.5707   -3.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9817   -2.8070   -0.5899 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6168   -4.8568   -1.7951 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
  4 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 26 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41  2  1  0
 24  6  1  0
 37 28  1  0
 14  8  1  0
 23 16  1  0
  1 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  0
  4 47  1  0
  9 48  1  0
 10 49  1  0
 12 50  1  0
 13 51  1  0
 14 52  1  0
 17 53  1  0
 19 54  1  0
 20 55  1  0
 22 56  1  0
 26 57  1  0
 28 58  1  0
 30 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       2.667  -7.700   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668   2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      10.669  -9.240   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       4.001  -6.930   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       8.002   1.540   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      10.669  -7.700   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       5.335  -7.700   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      12.003  -6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      12.003  -5.390   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       6.668  -6.930   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      10.669  -4.620   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       6.668  -5.390   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       9.336  -5.390   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       5.335  -4.620   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      12.003 -10.010   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0       9.336   2.310   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -2.667   0.000   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       5.335  -9.240   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      13.337  -7.700   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      13.337  -4.620   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       8.002  -7.700   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      10.669  -3.080   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       4.001  -5.390   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       2.667   0.000   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       9.336  -6.930   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       5.335  -3.080   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       8.002  -4.620   0.000  0.00  0.00           O+0
CONECT    1    9                                                            
CONECT    2    4   10                                                       
CONECT    3    5   10                                                       
CONECT    4    2   11                                                       
CONECT    5    3   11                                                       
CONECT    6   12   13                                                       
CONECT    7   12   14                                                       
CONECT    8   15   28                                                       
CONECT    9    1   17   38                                                  
CONECT   10    2    3   23                                                  
CONECT   11    4    5   29                                                  
CONECT   12    6    7   30                                                  
CONECT   13    6   16   31                                                  
CONECT   14    7   16   39                                                  
CONECT   15    8   18   40                                                  
CONECT   16   13   14   19                                                  
CONECT   17    9   21   32                                                  
CONECT   18   15   20   33                                                  
CONECT   19   16   24   34                                                  
CONECT   20   18   22   35                                                  
CONECT   21   17   25   36                                                  
CONECT   22   20   26   37                                                  
CONECT   23   10   24   39                                                  
CONECT   24   19   23   41                                                  
CONECT   25   21   27   42                                                  
CONECT   26   22   40   42                                                  
CONECT   27   25   38   41                                                  
CONECT   28    8                                                            
CONECT   29   11                                                            
CONECT   30   12                                                            
CONECT   31   13                                                            
CONECT   32   17                                                            
CONECT   33   18                                                            
CONECT   34   19                                                            
CONECT   35   20                                                            
CONECT   36   21                                                            
CONECT   37   22                                                            
CONECT   38    9   27                                                       
CONECT   39   14   23                                                       
CONECT   40   15   26                                                       
CONECT   41   24   27                                                       
CONECT   42   25   26                                                       
MASTER        0    0    0    0    0    0    0    0   42    0   92    0
END

COMPND    HMDB0040475
HETATM    1  C1  UNL     1      -1.628  -3.550   1.330  1.00  0.00           C  
HETATM    2  C2  UNL     1      -1.009  -3.622  -0.023  1.00  0.00           C  
HETATM    3  O1  UNL     1       0.217  -3.095  -0.199  1.00  0.00           O  
HETATM    4  C3  UNL     1       0.259  -1.685   0.076  1.00  0.00           C  
HETATM    5  O2  UNL     1       1.405  -1.170  -0.322  1.00  0.00           O  
HETATM    6  C4  UNL     1       2.531  -0.669  -0.702  1.00  0.00           C  
HETATM    7  C5  UNL     1       3.027   0.574  -0.414  1.00  0.00           C  
HETATM    8  C6  UNL     1       2.374   1.585   0.407  1.00  0.00           C  
HETATM    9  C7  UNL     1       2.822   2.905   0.284  1.00  0.00           C  
HETATM   10  C8  UNL     1       2.352   3.931   1.051  1.00  0.00           C  
HETATM   11  C9  UNL     1       1.391   3.706   2.006  1.00  0.00           C  
HETATM   12  O3  UNL     1       0.919   4.757   2.781  1.00  0.00           O  
HETATM   13  C10 UNL     1       0.929   2.424   2.155  1.00  0.00           C  
HETATM   14  C11 UNL     1       1.426   1.387   1.356  1.00  0.00           C  
HETATM   15  O4  UNL     1       4.217   0.905  -0.926  1.00  0.00           O  
HETATM   16  C12 UNL     1       4.965   0.172  -1.671  1.00  0.00           C  
HETATM   17  C13 UNL     1       6.185   0.576  -2.167  1.00  0.00           C  
HETATM   18  C14 UNL     1       6.940  -0.263  -2.962  1.00  0.00           C  
HETATM   19  O5  UNL     1       8.156   0.234  -3.412  1.00  0.00           O  
HETATM   20  C15 UNL     1       6.521  -1.533  -3.299  1.00  0.00           C  
HETATM   21  C16 UNL     1       5.310  -1.943  -2.811  1.00  0.00           C  
HETATM   22  O6  UNL     1       4.803  -3.216  -3.100  1.00  0.00           O  
HETATM   23  C17 UNL     1       4.529  -1.115  -2.007  1.00  0.00           C  
HETATM   24  C18 UNL     1       3.336  -1.526  -1.531  1.00  0.00           C  
HETATM   25  O7  UNL     1       2.879  -2.694  -1.801  1.00  0.00           O  
HETATM   26  C19 UNL     1      -0.915  -0.965  -0.499  1.00  0.00           C  
HETATM   27  O8  UNL     1      -1.904  -0.826   0.431  1.00  0.00           O  
HETATM   28  C20 UNL     1      -2.470   0.403   0.590  1.00  0.00           C  
HETATM   29  O9  UNL     1      -3.804   0.442   0.154  1.00  0.00           O  
HETATM   30  C21 UNL     1      -4.308   1.703   0.443  1.00  0.00           C  
HETATM   31  C22 UNL     1      -5.594   1.981  -0.308  1.00  0.00           C  
HETATM   32  O10 UNL     1      -5.421   1.927  -1.676  1.00  0.00           O  
HETATM   33  C23 UNL     1      -4.518   1.879   1.943  1.00  0.00           C  
HETATM   34  O11 UNL     1      -4.032   3.121   2.339  1.00  0.00           O  
HETATM   35  C24 UNL     1      -3.699   0.831   2.703  1.00  0.00           C  
HETATM   36  O12 UNL     1      -3.513   1.305   3.988  1.00  0.00           O  
HETATM   37  C25 UNL     1      -2.334   0.846   2.016  1.00  0.00           C  
HETATM   38  O13 UNL     1      -1.448   0.052   2.734  1.00  0.00           O  
HETATM   39  C26 UNL     1      -1.427  -1.841  -1.673  1.00  0.00           C  
HETATM   40  O14 UNL     1      -0.329  -2.130  -2.454  1.00  0.00           O  
HETATM   41  C27 UNL     1      -2.024  -3.116  -1.046  1.00  0.00           C  
HETATM   42  O15 UNL     1      -2.219  -4.005  -2.082  1.00  0.00           O  
HETATM   43  H1  UNL     1      -2.702  -3.242   1.338  1.00  0.00           H  
HETATM   44  H2  UNL     1      -1.019  -3.007   2.086  1.00  0.00           H  
HETATM   45  H3  UNL     1      -1.674  -4.605   1.747  1.00  0.00           H  
HETATM   46  H4  UNL     1      -0.926  -4.728  -0.271  1.00  0.00           H  
HETATM   47  H5  UNL     1       0.165  -1.688   1.204  1.00  0.00           H  
HETATM   48  H6  UNL     1       3.583   3.142  -0.460  1.00  0.00           H  
HETATM   49  H7  UNL     1       2.740   4.919   0.903  1.00  0.00           H  
HETATM   50  H8  UNL     1       1.345   5.025   3.675  1.00  0.00           H  
HETATM   51  H9  UNL     1       0.179   2.236   2.918  1.00  0.00           H  
HETATM   52  H10 UNL     1       1.050   0.418   1.531  1.00  0.00           H  
HETATM   53  H11 UNL     1       6.527   1.577  -1.905  1.00  0.00           H  
HETATM   54  H12 UNL     1       8.970   0.069  -2.824  1.00  0.00           H  
HETATM   55  H13 UNL     1       7.134  -2.181  -3.929  1.00  0.00           H  
HETATM   56  H14 UNL     1       5.382  -3.786  -3.696  1.00  0.00           H  
HETATM   57  H15 UNL     1      -0.623   0.009  -0.905  1.00  0.00           H  
HETATM   58  H16 UNL     1      -1.943   1.110  -0.082  1.00  0.00           H  
HETATM   59  H17 UNL     1      -3.568   2.445   0.097  1.00  0.00           H  
HETATM   60  H18 UNL     1      -6.033   2.956  -0.022  1.00  0.00           H  
HETATM   61  H19 UNL     1      -6.352   1.207  -0.010  1.00  0.00           H  
HETATM   62  H20 UNL     1      -6.294   1.961  -2.133  1.00  0.00           H  
HETATM   63  H21 UNL     1      -5.587   1.853   2.221  1.00  0.00           H  
HETATM   64  H22 UNL     1      -4.667   3.808   2.021  1.00  0.00           H  
HETATM   65  H23 UNL     1      -4.157  -0.157   2.678  1.00  0.00           H  
HETATM   66  H24 UNL     1      -4.275   1.849   4.336  1.00  0.00           H  
HETATM   67  H25 UNL     1      -1.989   1.911   2.087  1.00  0.00           H  
HETATM   68  H26 UNL     1      -1.807  -0.173   3.629  1.00  0.00           H  
HETATM   69  H27 UNL     1      -2.209  -1.376  -2.247  1.00  0.00           H  
HETATM   70  H28 UNL     1      -0.550  -2.571  -3.305  1.00  0.00           H  
HETATM   71  H29 UNL     1      -2.982  -2.807  -0.590  1.00  0.00           H  
HETATM   72  H30 UNL     1      -2.617  -4.857  -1.795  1.00  0.00           H  
CONECT    1    2   43   44   45
CONECT    2    3   41   46
CONECT    3    4
CONECT    4    5   26   47
CONECT    5    6
CONECT    6    7    7   24
CONECT    7    8   15
CONECT    8    9    9   14
CONECT    9   10   48
CONECT   10   11   11   49
CONECT   11   12   13
CONECT   12   50
CONECT   13   14   14   51
CONECT   14   52
CONECT   15   16
CONECT   16   17   17   23
CONECT   17   18   53
CONECT   18   19   20   20
CONECT   19   54
CONECT   20   21   55
CONECT   21   22   23   23
CONECT   22   56
CONECT   23   24
CONECT   24   25   25
CONECT   26   27   39   57
CONECT   27   28
CONECT   28   29   37   58
CONECT   29   30
CONECT   30   31   33   59
CONECT   31   32   60   61
CONECT   32   62
CONECT   33   34   35   63
CONECT   34   64
CONECT   35   36   37   65
CONECT   36   66
CONECT   37   38   67
CONECT   38   68
CONECT   39   40   41   69
CONECT   40   70
CONECT   41   42   71
CONECT   42   72
END

HMDB0040475
     RDKit          3D
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside
 72 76  0  0  0  0  0  0  0  0999 V2000
   -1.6284   -3.5501    1.3298 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0086   -3.6219   -0.0229 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171   -3.0947   -0.1995 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2592   -1.6848    0.0762 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4047   -1.1697   -0.3222 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5309   -0.6692   -0.7018 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0268    0.5735   -0.4141 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3744    1.5848    0.4069 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8223    2.9046    0.2837 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3520    3.9310    1.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3910    3.7060    2.0062 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9189    4.7574    2.7811 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9291    2.4239    2.1552 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4256    1.3870    1.3564 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2172    0.9054   -0.9263 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9646    0.1720   -1.6708 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1852    0.5756   -2.1668 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9401   -0.2626   -2.9617 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1558    0.2342   -3.4120 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212   -1.5326   -3.2992 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3102   -1.9428   -2.8108 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8033   -3.2160   -3.0999 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5289   -1.1155   -2.0067 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3360   -1.5255   -1.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8789   -2.6939   -1.8013 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9154   -0.9651   -0.4993 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9036   -0.8260    0.4308 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4704    0.4027    0.5898 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8038    0.4422    0.1535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3076    1.7026    0.4434 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5936    1.9810   -0.3078 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4210    1.9271   -1.6763 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5182    1.8787    1.9426 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0320    3.1213    2.3391 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6989    0.8315    2.7033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5131    1.3048    3.9882 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3343    0.8461    2.0163 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4476    0.0523    2.7338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266   -1.8408   -1.6728 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3287   -2.1296   -2.4538 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0239   -3.1159   -1.0462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2190   -4.0050   -2.0824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7019   -3.2424    1.3380 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0187   -3.0070    2.0857 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6736   -4.6050    1.7467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9264   -4.7281   -0.2714 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1645   -1.6881    1.2041 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5828    3.1416   -0.4601 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7396    4.9188    0.9027 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3451    5.0252    3.6745 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1787    2.2360    2.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0504    0.4184    1.5312 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5266    1.5771   -1.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9700    0.0693   -2.8239 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339   -2.1811   -3.9288 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3825   -3.7863   -3.6957 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6231    0.0085   -0.9049 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9426    1.1102   -0.0815 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5679    2.4450    0.0973 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0327    2.9556   -0.0218 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3517    1.2072   -0.0096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2935    1.9613   -2.1327 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5874    1.8530    2.2210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6673    3.8077    2.0207 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1567   -0.1570    2.6779 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2745    1.8486    4.3364 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9892    1.9113    2.0869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8073   -0.1734    3.6290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2091   -1.3759   -2.2467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5505   -2.5707   -3.3050 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9817   -2.8070   -0.5899 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6168   -4.8568   -1.7951 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
  4 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 26 39  1  0
 39 40  1  0
 39 41  1  0
 41 42  1  0
 41  2  1  0
 24  6  1  0
 37 28  1  0
 14  8  1  0
 23 16  1  0
  1 43  1  0
  1 44  1  0
  1 45  1  0
  2 46  1  0
  4 47  1  0
  9 48  1  0
 10 49  1  0
 12 50  1  0
 13 51  1  0
 14 52  1  0
 17 53  1  0
 19 54  1  0
 20 55  1  0
 22 56  1  0
 26 57  1  0
 28 58  1  0
 30 59  1  0
 31 60  1  0
 31 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 39 69  1  0
 40 70  1  0
 41 71  1  0
 42 72  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
3-[(6-Deoxy-2-O-beta-D-glucopyranosyl-alpha-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one	HMDB
Kaempferol 3-glucosyl-(1->2)-rhamnoside	HMDB
Kaempferol-3-O-glucosyl(1-2)rhamnoside	HMDB, MeSH
Kemp-glu-rham	HMDB
Kempferol-3-O-glucosyl(1-2)rhamnoside	HMDB, MeSH

Chemical Formula

C₂₇H₃₀O₁₅

Average Molecular Weight

594.5181

Monoisotopic Molecular Weight

594.15847029

IUPAC Name

3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one

Traditional Name

3-[(4,5-dihydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

CAS Registry Number

142451-65-8

SMILES

CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O15/c1-9-17(32)21(36)25(42-26-22(37)20(35)18(33)15(8-28)40-26)27(38-9)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3

InChI Key

BCNBWICEIXAVQF-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid-3-O-glycosides

Alternative Parents

Substituents

Flavonoid-3-o-glycoside
Hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
O-glycosyl compound
Glycosyl compound
Chromone
Disaccharide
Benzopyran
1-benzopyran
1-hydroxy-4-unsubstituted benzenoid
Phenol
1-hydroxy-2-unsubstituted benzenoid
Pyranone
Monocyclic benzene moiety
Oxane
Pyran
Benzenoid
Heteroaromatic compound
Vinylogous acid
Secondary alcohol
Organoheterocyclic compound
Oxacycle
Acetal
Polyol
Primary alcohol
Organic oxide
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0040475)
Cytoplasm (HMDB: HMDB0040475)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0040475)

Source

Exogenous

Food

Food (HMDB: HMDB0040475)

Herb and spice

Other seed

Ginkgo nuts (FooDB: FOOD00367)

Fat and oil

Fats and oils (FooDB: FOOD00864)

Endogenous

Plant

Plant (HMDB: HMDB0040475)

Not Available

Nutrient (HMDB: HMDB0040475)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	3.7 g/L	ALOGPS
logP	0.08	ALOGPS
logP	-0.57	ChemAxon
logS	-2.2	ALOGPS
pKa (Strongest Acidic)	6.43	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	245.29 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	138.16 m³·mol⁻¹	ChemAxon
Polarizability	56.89 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	224.637	30932474
DeepCCS	[M-H]-	222.264	30932474
DeepCCS	[M-2H]-	255.504	30932474
DeepCCS	[M+Na]+	230.459	30932474
AllCCS	[M+H]+	230.4	32859911
AllCCS	[M+H-H2O]+	229.0	32859911
AllCCS	[M+NH4]+	231.6	32859911
AllCCS	[M+Na]+	231.9	32859911
AllCCS	[M-H]-	225.6	32859911
AllCCS	[M+Na-2H]-	227.6	32859911
AllCCS	[M+HCOO]-	229.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside	CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5813.9	Standard polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside	CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5118.4	Standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside	CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5550.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5376.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5362.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5369.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5324.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5335.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5336.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5333.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5343.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5331.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5284.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #10	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5245.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #11	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5248.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #12	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5228.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #13	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5247.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #14	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5259.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #15	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5260.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #16	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5255.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #17	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5254.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #18	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5238.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #19	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5252.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5246.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #20	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5268.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #21	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5265.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #22	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5230.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #23	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5219.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #24	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5222.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #25	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5240.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #26	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5236.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #27	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5242.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #28	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5229.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #29	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5240.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5255.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #30	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5235.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #31	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5242.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #32	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5232.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #33	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5230.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #34	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5246.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #35	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5236.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #36	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5274.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5255.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5238.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5254.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5270.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5268.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5269.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5136.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #10	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5055.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #11	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5096.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #12	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5085.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #13	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5093.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #14	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5113.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #15	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5084.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #16	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5101.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #17	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5097.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #18	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5102.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #19	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5105.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5144.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #20	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5103.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #21	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5110.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #22	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5117.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #23	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5107.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #24	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5081.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #25	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5089.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #26	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5110.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #27	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5114.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #28	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5137.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #29	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5113.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5160.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #30	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5128.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #31	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5079.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #32	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5122.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #33	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5117.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #34	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5123.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #35	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5088.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #36	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5052.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #37	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5070.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #38	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5068.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #39	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5076.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5117.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #40	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5073.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #41	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5075.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #42	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5080.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #43	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5090.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #44	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5071.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #45	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5042.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #46	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5055.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #47	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5076.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #48	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5084.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #49	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5114.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5158.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #50	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5126.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #51	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5096.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #52	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5120.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #53	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5112.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #54	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5111.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #55	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5120.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #56	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5112.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #57	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5127.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #58	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5129.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #59	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5124.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5144.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #60	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5091.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #61	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5096.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #62	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5128.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #63	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5124.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #64	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5144.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #65	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5090.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #66	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5090.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #67	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5086.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #68	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5089.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #69	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5076.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5151.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #70	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5064.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #71	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5071.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #72	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5076.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #73	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5077.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #74	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5096.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #75	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5096.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #76	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5079.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #77	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	5085.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #78	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5077.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #79	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5082.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	5088.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #80	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5108.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #81	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5082.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #82	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5085.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #83	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5090.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #84	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5103.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,3TMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5102.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O	4993.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #10	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	4998.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #100	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4991.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #101	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5003.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #102	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5005.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #103	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4969.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #104	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4989.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #105	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4963.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #106	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4981.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #107	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5012.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #108	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4962.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #109	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4978.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #11	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5014.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #110	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4964.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #111	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4995.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #112	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5004.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #113	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4969.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #114	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4981.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #115	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4961.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #116	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4975.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #117	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4992.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #118	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4947.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #119	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4959.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #12	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5005.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #120	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4955.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #121	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4967.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #122	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4958.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #123	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4972.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #124	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4972.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #125	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4956.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #126	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4961.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #13	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5002.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #14	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	5010.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #15	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5022.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #16	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5000.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #17	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4953.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #18	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4965.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #19	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4996.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5005.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #20	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5009.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #21	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5028.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #22	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	4973.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #23	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4917.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #24	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	4946.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #25	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	4927.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #26	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	4937.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #27	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4947.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #28	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4936.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #29	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4951.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4934.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #30	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	4962.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #31	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4936.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #32	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4883.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #33	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4896.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #34	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4925.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #35	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4935.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #36	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4964.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #37	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4996.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #38	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4991.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #39	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4985.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	4990.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #40	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	4998.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #41	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4979.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #42	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4936.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #43	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4949.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #44	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4959.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #45	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4971.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #46	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4986.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #47	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4990.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #48	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4964.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #49	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4980.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	4972.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #50	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4953.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #51	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4965.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #52	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5001.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #53	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4957.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #54	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4970.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #55	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4957.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #56	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4981.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #57	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5004.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #58	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4945.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #59	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	4981.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	4987.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #60	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	4959.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #61	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	4971.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #62	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4972.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #63	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4966.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #64	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4976.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #65	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	4989.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #66	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4965.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #67	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4917.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #68	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4929.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #69	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4958.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5039.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #70	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4972.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #71	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4996.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #72	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4958.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #73	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4951.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #74	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4944.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #75	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	4960.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #76	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4938.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #77	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4891.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #78	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4903.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #79	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4913.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	4983.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #80	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4925.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #81	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4945.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #82	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4955.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #83	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4925.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #84	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4939.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #85	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4912.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #86	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4923.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #87	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4967.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #88	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4915.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #89	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4926.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5024.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #90	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4916.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #91	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4938.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #92	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5005.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #93	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5005.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #94	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O	4997.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #95	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C	5011.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #96	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4986.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #97	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4947.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #98	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4961.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,4TMS,isomer #99	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4974.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5568.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5546.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5562.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C1O	5536.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5582.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5577.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5573.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5577.6	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TBDMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5574.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #1	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5653.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #10	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C1O	5588.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #11	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5603.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #12	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5574.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #13	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5578.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #14	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5610.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #15	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5612.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #16	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C1O	5628.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #17	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5625.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #18	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5593.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #19	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5599.5	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #2	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5600.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #20	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5637.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #21	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5640.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #22	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5592.8	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #23	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5587.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #24	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5581.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #25	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5608.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #26	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5610.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #27	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5591.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #28	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5582.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #29	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5613.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #3	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C1O	5618.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #30	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5617.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #31	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5582.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #32	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5586.2	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #33	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5591.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #34	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	5591.3	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #35	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	5589.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #36	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	5645.1	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #4	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5628.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #5	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5598.7	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #6	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5603.4	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #7	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5637.9	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #8	CC1OC(OC2=C(C3=CC=C(O)C=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5643.0	Semi standard non polar	33892256
Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,2TBDMS,isomer #9	CC1OC(OC2=C(C3=CC=C(O[Si](C)(C)C(C)(C)C)C=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O	5629.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-0729-8511290000-f59cb2ff298fd6a0aa25	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (1 TMS) - 70eV, Positive	splash10-0kms-9511118000-eb5e5c9c929e364a487a	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS ("Kaempferol 3-O-glucosyl-(1->2)-rhamnoside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 10V, Positive-QTOF	splash10-000i-0190850000-6e13ea0141c909a336f9	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 20V, Positive-QTOF	splash10-000i-0190200000-c11f4d8fedb0be15f37e	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 40V, Positive-QTOF	splash10-052r-1890100000-98e3f7604c4bef76d646	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 10V, Negative-QTOF	splash10-01rl-2562690000-6a7202655f5b598b4d78	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 20V, Negative-QTOF	splash10-01p9-2691410000-6eb428b35a371bb33cb2	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 40V, Negative-QTOF	splash10-002r-3970000000-a00a7733a18c3febbbad	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 10V, Negative-QTOF	splash10-0006-0000090000-f07625f0a220643693b5	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 20V, Negative-QTOF	splash10-0006-0300090000-3b659c88f74f107e60fc	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 40V, Negative-QTOF	splash10-0gvo-2910020000-2d25824bba76e92559d6	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 10V, Positive-QTOF	splash10-0002-0000090000-54e89fd530db4e77b6eb	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 20V, Positive-QTOF	splash10-0002-0000090000-487aa33a27922fbbaffa	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Kaempferol 3-O-glucosyl-(1->2)-rhamnoside 40V, Positive-QTOF	splash10-0uxs-1900140000-42ad989b838b43e079fa	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB020231

KNApSAcK ID

C00005171

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74978069

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Kaempferol 3-O-glucosyl-(1->2)-rhamnoside (HMDB0040475)

MOL for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

3D MOL for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

3D SDF for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

3D-SDF for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

PDB for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

3D PDB for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

SMILES for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

INCHI for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

Structure for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

3D Structure for HMDB0040475 (Kaempferol 3-O-glucosyl-(1->2)-rhamnoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra