Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 02:17:30 UTC

Update Date

2022-03-07 02:56:42 UTC

HMDB ID

HMDB0040715

Secondary Accession Numbers

HMDB40715

Metabolite Identification

Common Name

Rheinoside A

Description

Rheinoside A belongs to the class of organic compounds known as anthracenecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an anthracene ring system. Rheinoside A has been detected, but not quantified in, green vegetables. This could make rheinoside a a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on Rheinoside A.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061312042D          

 43 47  0  0  0  0            999 V2000
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9947    1.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1702    1.4857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2670    2.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0915    2.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4788    1.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0416    0.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3820    2.2429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1203    2.9137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5287    2.8561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3033    1.3993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8163    0.7284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171    0.7572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  1  1  0  0  0  0
  8  4  2  0  0  0  0
  8  5  1  0  0  0  0
  9  2  1  0  0  0  0
 10  4  1  0  0  0  0
 11  5  2  0  0  0  0
 12  3  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15 10  2  0  0  0  0
 15 11  1  0  0  0  0
 16  9  2  0  0  0  0
 16 12  1  0  0  0  0
 17 13  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25  8  1  0  0  0  0
 26 23  1  0  0  0  0
 27  9  1  0  0  0  0
 27 10  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30 11  1  0  0  0  0
 31 17  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  2  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 25  2  0  0  0  0
 39 25  1  0  0  0  0
 40 27  1  0  0  0  0
 41 13  1  0  0  0  0
 41 24  1  0  0  0  0
 42 12  1  0  0  0  0
 42 26  1  0  0  0  0
 43 14  1  0  0  0  0
 43 26  1  0  0  0  0
M  END

HMDB0040715
     RDKit          3D
Rheinoside A
 73 77  0  0  0  0  0  0  0  0999 V2000
    4.7828    4.6151    0.3769 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7088    4.8329    0.9573 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5693    5.9283    1.7921 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5970    3.9139    0.7436 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4015    4.1483    1.3840 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3719    3.2853    1.1770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8412    3.5389    1.8378 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5137    2.1951    0.3445 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6978    1.9175   -0.3207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7260    2.8068   -0.0953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9030    0.7658   -1.2010 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675    1.2392   -2.4592 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0212   -0.1415   -0.7312 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2457    0.4689   -0.6273 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0798   -0.1507    0.2685 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5235    0.2027   -0.1124 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4149   -0.4113    0.7798 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9821   -1.6435    0.2436 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8823   -2.1808    1.1430 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5904   -2.0547    0.6729 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6014   -2.5960    1.9465 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7171   -0.8022    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3883   -1.1857    0.7175 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6820   -0.0590   -1.3948 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7786   -1.1334   -2.2633 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3298   -1.9611   -2.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5249   -1.7217   -1.8356 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6400   -0.6663   -0.9755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7570   -0.3240   -0.2827 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0126   -0.9248   -0.2658 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9433    0.0483   -0.5864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2435   -0.2789   -0.3722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8685   -1.0785   -1.5007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2423   -2.2747   -1.7525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5683   -0.8541    0.9813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8979   -1.2794    0.9436 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6130   -1.9279    1.3772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8694   -3.1222    0.7064 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2188   -1.4441    1.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9745   -0.3679    2.0122 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5126    0.1437   -0.7813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6095    1.2956    0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6866    1.5558    0.7248 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    6.7946    1.5515 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2557    5.0030    2.0505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9596    4.3293    2.4475 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7115    2.6938   -0.5744 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4865    1.7795   -2.7837 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1370   -0.9680   -1.4626 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9703    0.2405    1.3208 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6925    1.2828   -0.1101 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7685   -0.1800   -1.1153 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3163   -0.3267    0.4285 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2200   -1.9818   -0.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5206   -2.8171    0.7249 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2313   -2.7948   -0.0904 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4710   -2.9856    2.1782 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9739   -0.1584    1.4345 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3439   -2.0940    1.0866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6940   -1.3672   -2.8003 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2640   -2.8042   -3.1563 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3898   -2.3527   -1.9919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0197   -1.7865   -0.9291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8112    0.7044   -0.3971 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9064   -0.4964   -2.4427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9513   -1.2450   -1.2257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7149   -2.2084   -2.5727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4641   -0.0163    1.7214 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2554   -1.2689    1.8602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7266   -2.0651    2.4904 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9911   -3.4754    0.4058 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4667   -2.2607    1.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1094    0.5077    1.5589 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 11 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  2  0
 10  4  1  0
 22 13  1  0
 41 24  1  0
 42  8  1  0
 39 30  1  0
  3 44  1  0
  5 45  1  0
  7 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 19 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 33 66  1  0
 34 67  1  0
 35 68  1  0
 36 69  1  0
 37 70  1  0
 38 71  1  0
 39 72  1  0
 40 73  1  0
M  END


  Mrv0541 05061312042D          

 43 47  0  0  0  0            999 V2000
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9947    1.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1702    1.4857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2670    2.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0915    2.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4788    1.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0416    0.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3820    2.2429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1203    2.9137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5287    2.8561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3033    1.3993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0013   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8163    0.7284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2171    0.7572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  1  1  0  0  0  0
  8  4  2  0  0  0  0
  8  5  1  0  0  0  0
  9  2  1  0  0  0  0
 10  4  1  0  0  0  0
 11  5  2  0  0  0  0
 12  3  2  0  0  0  0
 13  6  1  0  0  0  0
 14  7  1  0  0  0  0
 15 10  2  0  0  0  0
 15 11  1  0  0  0  0
 16  9  2  0  0  0  0
 16 12  1  0  0  0  0
 17 13  1  0  0  0  0
 18 14  1  0  0  0  0
 19 15  1  0  0  0  0
 19 16  1  0  0  0  0
 20 17  1  0  0  0  0
 21 18  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  1  0  0  0  0
 24 22  1  0  0  0  0
 25  8  1  0  0  0  0
 26 23  1  0  0  0  0
 27  9  1  0  0  0  0
 27 10  1  0  0  0  0
 27 24  1  0  0  0  0
 28  6  1  0  0  0  0
 29  7  1  0  0  0  0
 30 11  1  0  0  0  0
 31 17  1  0  0  0  0
 32 18  1  0  0  0  0
 33 19  2  0  0  0  0
 34 20  1  0  0  0  0
 35 21  1  0  0  0  0
 36 22  1  0  0  0  0
 37 23  1  0  0  0  0
 38 25  2  0  0  0  0
 39 25  1  0  0  0  0
 40 27  1  0  0  0  0
 41 13  1  0  0  0  0
 41 24  1  0  0  0  0
 42 12  1  0  0  0  0
 42 26  1  0  0  0  0
 43 14  1  0  0  0  0
 43 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0040715

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(C=C(C=C2O)C(O)=O)C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C27H30O16/c28-6-13-17(31)20(34)22(36)24(41-13)27(40)9-2-1-3-12(42-26-23(37)21(35)18(32)14(7-29)43-26)16(9)19(33)15-10(27)4-8(25(38)39)5-11(15)30/h1-5,13-14,17-18,20-24,26,28-32,34-37,40H,6-7H2,(H,38,39)

> <INCHI_KEY>
OJZWDOKDQBCANR-UHFFFAOYSA-N

> <FORMULA>
C27H30O16

> <MOLECULAR_WEIGHT>
610.5175

> <EXACT_MASS>
610.153384912

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
57.01693690410418

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
4,9-dihydroxy-10-oxo-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-9,10-dihydroanthracene-2-carboxylic acid

> <ALOGPS_LOGP>
-1.82

> <JCHEM_LOGP>
-2.986396412666667

> <ALOGPS_LOGS>
-1.71

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
9.739225547225592

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.4882794489431035

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6466655100548433

> <JCHEM_POLAR_SURFACE_AREA>
284.36

> <JCHEM_REFRACTIVITY>
137.72189999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.20e+01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
4,9-dihydroxy-10-oxo-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}anthracene-2-carboxylic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0040715
     RDKit          3D
Rheinoside A
 73 77  0  0  0  0  0  0  0  0999 V2000
    4.7828    4.6151    0.3769 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7088    4.8329    0.9573 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5693    5.9283    1.7921 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5970    3.9139    0.7436 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4015    4.1483    1.3840 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3719    3.2853    1.1770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8412    3.5389    1.8378 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5137    2.1951    0.3445 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6978    1.9175   -0.3207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7260    2.8068   -0.0953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9030    0.7658   -1.2010 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675    1.2392   -2.4592 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0212   -0.1415   -0.7312 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2457    0.4689   -0.6273 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0798   -0.1507    0.2685 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5235    0.2027   -0.1124 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4149   -0.4113    0.7798 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9821   -1.6435    0.2436 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8823   -2.1808    1.1430 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5904   -2.0547    0.6729 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6014   -2.5960    1.9465 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7171   -0.8022    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3883   -1.1857    0.7175 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6820   -0.0590   -1.3948 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7786   -1.1334   -2.2633 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3298   -1.9611   -2.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5249   -1.7217   -1.8356 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6400   -0.6663   -0.9755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7570   -0.3240   -0.2827 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0126   -0.9248   -0.2658 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9433    0.0483   -0.5864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2435   -0.2789   -0.3722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8685   -1.0785   -1.5007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2423   -2.2747   -1.7525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5683   -0.8541    0.9813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8979   -1.2794    0.9436 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6130   -1.9279    1.3772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8694   -3.1222    0.7064 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2188   -1.4441    1.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9745   -0.3679    2.0122 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5126    0.1437   -0.7813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6095    1.2956    0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6866    1.5558    0.7248 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    6.7946    1.5515 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2557    5.0030    2.0505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9596    4.3293    2.4475 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7115    2.6938   -0.5744 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4865    1.7795   -2.7837 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1370   -0.9680   -1.4626 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9703    0.2405    1.3208 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6925    1.2828   -0.1101 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7685   -0.1800   -1.1153 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3163   -0.3267    0.4285 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2200   -1.9818   -0.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5206   -2.8171    0.7249 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2313   -2.7948   -0.0904 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4710   -2.9856    2.1782 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9739   -0.1584    1.4345 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3439   -2.0940    1.0866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6940   -1.3672   -2.8003 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2640   -2.8042   -3.1563 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3898   -2.3527   -1.9919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0197   -1.7865   -0.9291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8112    0.7044   -0.3971 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9064   -0.4964   -2.4427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9513   -1.2450   -1.2257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7149   -2.2084   -2.5727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4641   -0.0163    1.7214 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2554   -1.2689    1.8602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7266   -2.0651    2.4904 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9911   -3.4754    0.4058 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4667   -2.2607    1.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1094    0.5077    1.5589 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 11 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  2  0
 10  4  1  0
 22 13  1  0
 41 24  1  0
 42  8  1  0
 39 30  1  0
  3 44  1  0
  5 45  1  0
  7 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 19 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 33 66  1  0
 34 67  1  0
 35 68  1  0
 36 69  1  0
 37 70  1  0
 38 71  1  0
 39 72  1  0
 40 73  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -1.334  -2.310   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -1.857   2.827   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -5.335  -4.620   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       0.000  -3.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -0.318   2.773   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -4.001  -5.390   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       4.001  -2.310   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334  -2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       0.498   4.079   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -4.001  -6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       2.667  -3.080   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.037   4.025   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -2.667  -7.700   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       2.760   2.666   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -1.334  -6.930   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       1.944   1.360   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       8.002   0.000   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -1.334  -5.390   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   28  O   UNK     0      -2.580   4.187   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -6.668  -5.390   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       5.335  -4.620   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -0.225   5.439   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -5.335  -7.700   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       2.667  -4.620   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       2.854   5.331   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0      -2.667  -9.240   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       4.299   2.612   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       0.000  -7.700   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0       9.336  -0.770   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       8.002   1.540   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0       3.390   1.360   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       0.405   1.413   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0       0.000  -4.620   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0      -2.667  -4.620   0.000  0.00  0.00           O+0
CONECT    1    2    3                                                       
CONECT    2    1    9                                                       
CONECT    3    1   12                                                       
CONECT    4    8   10                                                       
CONECT    5    8   11                                                       
CONECT    6   13   28                                                       
CONECT    7   14   29                                                       
CONECT    8    4    5   25                                                  
CONECT    9    2   16   27                                                  
CONECT   10    4   15   27                                                  
CONECT   11    5   15   30                                                  
CONECT   12    3   16   42                                                  
CONECT   13    6   17   41                                                  
CONECT   14    7   18   43                                                  
CONECT   15   10   11   19                                                  
CONECT   16    9   12   19                                                  
CONECT   17   13   20   31                                                  
CONECT   18   14   21   32                                                  
CONECT   19   15   16   33                                                  
CONECT   20   17   22   34                                                  
CONECT   21   18   23   35                                                  
CONECT   22   20   24   36                                                  
CONECT   23   21   26   37                                                  
CONECT   24   22   27   41                                                  
CONECT   25    8   38   39                                                  
CONECT   26   23   42   43                                                  
CONECT   27    9   10   24   40                                             
CONECT   28    6                                                            
CONECT   29    7                                                            
CONECT   30   11                                                            
CONECT   31   17                                                            
CONECT   32   18                                                            
CONECT   33   19                                                            
CONECT   34   20                                                            
CONECT   35   21                                                            
CONECT   36   22                                                            
CONECT   37   23                                                            
CONECT   38   25                                                            
CONECT   39   25                                                            
CONECT   40   27                                                            
CONECT   41   13   24                                                       
CONECT   42   12   26                                                       
CONECT   43   14   26                                                       
MASTER        0    0    0    0    0    0    0    0   43    0   94    0
END

COMPND    HMDB0040715
HETATM    1  O1  UNL     1       4.783   4.615   0.377  1.00  0.00           O  
HETATM    2  C1  UNL     1       3.709   4.833   0.957  1.00  0.00           C  
HETATM    3  O2  UNL     1       3.569   5.928   1.792  1.00  0.00           O  
HETATM    4  C2  UNL     1       2.597   3.914   0.744  1.00  0.00           C  
HETATM    5  C3  UNL     1       1.401   4.148   1.384  1.00  0.00           C  
HETATM    6  C4  UNL     1       0.372   3.285   1.177  1.00  0.00           C  
HETATM    7  O3  UNL     1      -0.841   3.539   1.838  1.00  0.00           O  
HETATM    8  C5  UNL     1       0.514   2.195   0.345  1.00  0.00           C  
HETATM    9  C6  UNL     1       1.698   1.917  -0.321  1.00  0.00           C  
HETATM   10  C7  UNL     1       2.726   2.807  -0.095  1.00  0.00           C  
HETATM   11  C8  UNL     1       1.903   0.766  -1.201  1.00  0.00           C  
HETATM   12  O4  UNL     1       2.267   1.239  -2.459  1.00  0.00           O  
HETATM   13  C9  UNL     1       3.021  -0.141  -0.731  1.00  0.00           C  
HETATM   14  O5  UNL     1       4.246   0.469  -0.627  1.00  0.00           O  
HETATM   15  C10 UNL     1       5.080  -0.151   0.268  1.00  0.00           C  
HETATM   16  C11 UNL     1       6.524   0.203  -0.112  1.00  0.00           C  
HETATM   17  O6  UNL     1       7.415  -0.411   0.780  1.00  0.00           O  
HETATM   18  C12 UNL     1       4.982  -1.644   0.244  1.00  0.00           C  
HETATM   19  O7  UNL     1       5.882  -2.181   1.143  1.00  0.00           O  
HETATM   20  C13 UNL     1       3.590  -2.055   0.673  1.00  0.00           C  
HETATM   21  O8  UNL     1       3.601  -2.596   1.947  1.00  0.00           O  
HETATM   22  C14 UNL     1       2.717  -0.802   0.593  1.00  0.00           C  
HETATM   23  O9  UNL     1       1.388  -1.186   0.718  1.00  0.00           O  
HETATM   24  C15 UNL     1       0.682  -0.059  -1.395  1.00  0.00           C  
HETATM   25  C16 UNL     1       0.779  -1.133  -2.263  1.00  0.00           C  
HETATM   26  C17 UNL     1      -0.330  -1.961  -2.479  1.00  0.00           C  
HETATM   27  C18 UNL     1      -1.525  -1.722  -1.836  1.00  0.00           C  
HETATM   28  C19 UNL     1      -1.640  -0.666  -0.976  1.00  0.00           C  
HETATM   29  O10 UNL     1      -2.757  -0.324  -0.283  1.00  0.00           O  
HETATM   30  C20 UNL     1      -4.013  -0.925  -0.266  1.00  0.00           C  
HETATM   31  O11 UNL     1      -4.943   0.048  -0.586  1.00  0.00           O  
HETATM   32  C21 UNL     1      -6.244  -0.279  -0.372  1.00  0.00           C  
HETATM   33  C22 UNL     1      -6.868  -1.079  -1.501  1.00  0.00           C  
HETATM   34  O12 UNL     1      -6.242  -2.275  -1.752  1.00  0.00           O  
HETATM   35  C23 UNL     1      -6.568  -0.854   0.981  1.00  0.00           C  
HETATM   36  O13 UNL     1      -7.898  -1.279   0.944  1.00  0.00           O  
HETATM   37  C24 UNL     1      -5.613  -1.928   1.377  1.00  0.00           C  
HETATM   38  O14 UNL     1      -5.869  -3.122   0.706  1.00  0.00           O  
HETATM   39  C25 UNL     1      -4.219  -1.444   1.161  1.00  0.00           C  
HETATM   40  O15 UNL     1      -3.975  -0.368   2.012  1.00  0.00           O  
HETATM   41  C26 UNL     1      -0.513   0.144  -0.781  1.00  0.00           C  
HETATM   42  C27 UNL     1      -0.609   1.296   0.113  1.00  0.00           C  
HETATM   43  O16 UNL     1      -1.687   1.556   0.725  1.00  0.00           O  
HETATM   44  H1  UNL     1       3.144   6.795   1.551  1.00  0.00           H  
HETATM   45  H2  UNL     1       1.256   5.003   2.050  1.00  0.00           H  
HETATM   46  H3  UNL     1      -0.960   4.329   2.447  1.00  0.00           H  
HETATM   47  H4  UNL     1       3.712   2.694  -0.574  1.00  0.00           H  
HETATM   48  H5  UNL     1       1.486   1.780  -2.784  1.00  0.00           H  
HETATM   49  H6  UNL     1       3.137  -0.968  -1.463  1.00  0.00           H  
HETATM   50  H7  UNL     1       4.970   0.240   1.321  1.00  0.00           H  
HETATM   51  H8  UNL     1       6.692   1.283  -0.110  1.00  0.00           H  
HETATM   52  H9  UNL     1       6.768  -0.180  -1.115  1.00  0.00           H  
HETATM   53  H10 UNL     1       8.316  -0.327   0.429  1.00  0.00           H  
HETATM   54  H11 UNL     1       5.220  -1.982  -0.785  1.00  0.00           H  
HETATM   55  H12 UNL     1       6.521  -2.817   0.725  1.00  0.00           H  
HETATM   56  H13 UNL     1       3.231  -2.795  -0.090  1.00  0.00           H  
HETATM   57  H14 UNL     1       4.471  -2.986   2.178  1.00  0.00           H  
HETATM   58  H15 UNL     1       2.974  -0.158   1.435  1.00  0.00           H  
HETATM   59  H16 UNL     1       1.344  -2.094   1.087  1.00  0.00           H  
HETATM   60  H17 UNL     1       1.694  -1.367  -2.800  1.00  0.00           H  
HETATM   61  H18 UNL     1      -0.264  -2.804  -3.156  1.00  0.00           H  
HETATM   62  H19 UNL     1      -2.390  -2.353  -1.992  1.00  0.00           H  
HETATM   63  H20 UNL     1      -4.020  -1.786  -0.929  1.00  0.00           H  
HETATM   64  H21 UNL     1      -6.811   0.704  -0.397  1.00  0.00           H  
HETATM   65  H22 UNL     1      -6.906  -0.496  -2.443  1.00  0.00           H  
HETATM   66  H23 UNL     1      -7.951  -1.245  -1.226  1.00  0.00           H  
HETATM   67  H24 UNL     1      -5.715  -2.208  -2.573  1.00  0.00           H  
HETATM   68  H25 UNL     1      -6.464  -0.016   1.721  1.00  0.00           H  
HETATM   69  H26 UNL     1      -8.255  -1.269   1.860  1.00  0.00           H  
HETATM   70  H27 UNL     1      -5.727  -2.065   2.490  1.00  0.00           H  
HETATM   71  H28 UNL     1      -4.991  -3.475   0.406  1.00  0.00           H  
HETATM   72  H29 UNL     1      -3.467  -2.261   1.287  1.00  0.00           H  
HETATM   73  H30 UNL     1      -4.109   0.508   1.559  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3    4
CONECT    3   44
CONECT    4    5    5   10
CONECT    5    6   45
CONECT    6    7    8    8
CONECT    7   46
CONECT    8    9   42
CONECT    9   10   10   11
CONECT   10   47
CONECT   11   12   13   24
CONECT   12   48
CONECT   13   14   22   49
CONECT   14   15
CONECT   15   16   18   50
CONECT   16   17   51   52
CONECT   17   53
CONECT   18   19   20   54
CONECT   19   55
CONECT   20   21   22   56
CONECT   21   57
CONECT   22   23   58
CONECT   23   59
CONECT   24   25   25   41
CONECT   25   26   60
CONECT   26   27   27   61
CONECT   27   28   62
CONECT   28   29   41   41
CONECT   29   30
CONECT   30   31   39   63
CONECT   31   32
CONECT   32   33   35   64
CONECT   33   34   65   66
CONECT   34   67
CONECT   35   36   37   68
CONECT   36   69
CONECT   37   38   39   70
CONECT   38   71
CONECT   39   40   72
CONECT   40   73
CONECT   41   42
CONECT   42   43   43
END

HMDB0040715
     RDKit          3D
Rheinoside A
 73 77  0  0  0  0  0  0  0  0999 V2000
    4.7828    4.6151    0.3769 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7088    4.8329    0.9573 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5693    5.9283    1.7921 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5970    3.9139    0.7436 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4015    4.1483    1.3840 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3719    3.2853    1.1770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8412    3.5389    1.8378 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5137    2.1951    0.3445 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6978    1.9175   -0.3207 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7260    2.8068   -0.0953 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9030    0.7658   -1.2010 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675    1.2392   -2.4592 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0212   -0.1415   -0.7312 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2457    0.4689   -0.6273 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0798   -0.1507    0.2685 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5235    0.2027   -0.1124 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4149   -0.4113    0.7798 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9821   -1.6435    0.2436 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8823   -2.1808    1.1430 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5904   -2.0547    0.6729 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6014   -2.5960    1.9465 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7171   -0.8022    0.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3883   -1.1857    0.7175 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6820   -0.0590   -1.3948 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7786   -1.1334   -2.2633 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3298   -1.9611   -2.4789 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5249   -1.7217   -1.8356 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6400   -0.6663   -0.9755 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7570   -0.3240   -0.2827 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0126   -0.9248   -0.2658 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9433    0.0483   -0.5864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2435   -0.2789   -0.3722 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8685   -1.0785   -1.5007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2423   -2.2747   -1.7525 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5683   -0.8541    0.9813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8979   -1.2794    0.9436 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6130   -1.9279    1.3772 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8694   -3.1222    0.7064 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2188   -1.4441    1.1606 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9745   -0.3679    2.0122 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5126    0.1437   -0.7813 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6095    1.2956    0.1126 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6866    1.5558    0.7248 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439    6.7946    1.5515 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2557    5.0030    2.0505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9596    4.3293    2.4475 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7115    2.6938   -0.5744 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4865    1.7795   -2.7837 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1370   -0.9680   -1.4626 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9703    0.2405    1.3208 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6925    1.2828   -0.1101 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7685   -0.1800   -1.1153 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3163   -0.3267    0.4285 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2200   -1.9818   -0.7854 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5206   -2.8171    0.7249 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2313   -2.7948   -0.0904 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4710   -2.9856    2.1782 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9739   -0.1584    1.4345 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3439   -2.0940    1.0866 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6940   -1.3672   -2.8003 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2640   -2.8042   -3.1563 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3898   -2.3527   -1.9919 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0197   -1.7865   -0.9291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8112    0.7044   -0.3971 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9064   -0.4964   -2.4427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9513   -1.2450   -1.2257 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7149   -2.2084   -2.5727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4641   -0.0163    1.7214 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2554   -1.2689    1.8602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7266   -2.0651    2.4904 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9911   -3.4754    0.4058 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4667   -2.2607    1.2871 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1094    0.5077    1.5589 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 11 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 28 41  2  0
 41 42  1  0
 42 43  2  0
 10  4  1  0
 22 13  1  0
 41 24  1  0
 42  8  1  0
 39 30  1  0
  3 44  1  0
  5 45  1  0
  7 46  1  0
 10 47  1  0
 12 48  1  0
 13 49  1  0
 15 50  1  0
 16 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 19 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 25 60  1  0
 26 61  1  0
 27 62  1  0
 30 63  1  0
 32 64  1  0
 33 65  1  0
 33 66  1  0
 34 67  1  0
 35 68  1  0
 36 69  1  0
 37 70  1  0
 38 71  1  0
 39 72  1  0
 40 73  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
4,9-Dihydroxy-10-oxo-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-9,10-dihydroanthracene-2-carboxylate	HMDB

Chemical Formula

C₂₇H₃₀O₁₆

Average Molecular Weight

610.5175

Monoisotopic Molecular Weight

610.153384912

IUPAC Name

4,9-dihydroxy-10-oxo-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-9,10-dihydroanthracene-2-carboxylic acid

Traditional Name

4,9-dihydroxy-10-oxo-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}anthracene-2-carboxylic acid

CAS Registry Number

111545-28-9

SMILES

OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(C=C(C=C2O)C(O)=O)C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O

InChI Identifier

InChI=1S/C27H30O16/c28-6-13-17(31)20(34)22(36)24(41-13)27(40)9-2-1-3-12(42-26-23(37)21(35)18(32)14(7-29)43-26)16(9)19(33)15-10(27)4-8(25(38)39)5-11(15)30/h1-5,13-14,17-18,20-24,26,28-32,34-37,40H,6-7H2,(H,38,39)

InChI Key

OJZWDOKDQBCANR-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as anthracenecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an anthracene ring system.

Kingdom

Organic compounds

Super Class

Benzenoids

Class

Anthracenes

Sub Class

Anthracenecarboxylic acids and derivatives

Direct Parent

Anthracenecarboxylic acids

Alternative Parents

Substituents

Anthracene carboxylic acid
Phenolic glycoside
2-naphthalenecarboxylic acid
2-naphthalenecarboxylic acid or derivatives
C-glycosyl compound
Glycosyl compound
O-glycosyl compound
Hydroxybenzoic acid
Aryl ketone
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Monosaccharide
Oxane
Vinylogous acid
Tertiary alcohol
Secondary alcohol
Ketone
Polyol
Carboxylic acid derivative
Acetal
Organoheterocyclic compound
Monocarboxylic acid or derivatives
Oxacycle
Carboxylic acid
Ether
Dialkyl ether
Organooxygen compound
Hydrocarbon derivative
Alcohol
Organic oxide
Organic oxygen compound
Primary alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0040715)
Cytoplasm (HMDB: HMDB0040715)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0040715)

Source

Exogenous

Food

Food (HMDB: HMDB0040715)

Vegetable

Leaf vegetable

Green vegetables (FooDB: FOOD00872)

Endogenous

Plant

Plant (HMDB: HMDB0040715)

Not Available

Nutrient (HMDB: HMDB0040715)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	12 g/L	ALOGPS
logP	-1.8	ALOGPS
logP	-3	ChemAxon
logS	-1.7	ALOGPS
pKa (Strongest Acidic)	3.49	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	284.36 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	137.72 m³·mol⁻¹	ChemAxon
Polarizability	57.02 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	233.385	31661259
DarkChem	[M-H]-	225.745	31661259
DeepCCS	[M+H]+	226.933	30932474
DeepCCS	[M-H]-	224.892	30932474
DeepCCS	[M-2H]-	258.131	30932474
DeepCCS	[M+Na]+	232.726	30932474
AllCCS	[M+H]+	231.0	32859911
AllCCS	[M+H-H2O]+	229.9	32859911
AllCCS	[M+NH4]+	232.1	32859911
AllCCS	[M+Na]+	232.4	32859911
AllCCS	[M-H]-	229.5	32859911
AllCCS	[M+Na-2H]-	231.3	32859911
AllCCS	[M+HCOO]-	233.3	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Rheinoside A	OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(C=C(C=C2O)C(O)=O)C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	4827.1	Standard polar	33892256
Rheinoside A	OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(C=C(C=C2O)C(O)=O)C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	4766.8	Standard non polar	33892256
Rheinoside A	OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(C=C(C=C2O)C(O)=O)C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5383.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Rheinoside A,1TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5340.3	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #10	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C1O	5355.6	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #11	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C1O	5381.0	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #2	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5418.6	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #3	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5321.9	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #4	C[Si](C)(C)OC1(C2OC(CO)C(O)C(O)C2O)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5358.3	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #5	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5336.3	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #6	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O	5360.9	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #7	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O	5342.0	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #8	C[Si](C)(C)OC1C(O)C(O)C(CO)OC1C1(O)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5352.4	Semi standard non polar	33892256
Rheinoside A,1TMS,isomer #9	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O	5375.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5240.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5230.4	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #11	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5233.6	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #12	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5284.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #13	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5251.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #14	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5286.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #15	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5261.4	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #16	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5242.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #17	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5256.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #18	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5236.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #19	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5256.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5175.5	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #20	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5189.2	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #21	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5165.0	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #22	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5180.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #23	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	5156.4	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #24	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5179.2	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #25	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5200.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #26	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5172.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #27	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5202.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #28	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5205.5	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #29	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O	5225.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5203.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #30	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O	5214.5	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #31	C[Si](C)(C)OC1C(O)C(O)C(CO)OC1C1(O[Si](C)(C)C)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5239.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #32	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C1O	5237.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #33	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C1O	5210.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #34	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O	5239.2	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #35	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5216.6	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #36	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	5186.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #37	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5217.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #38	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5203.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #39	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	5192.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	5191.7	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #40	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5212.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #41	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5227.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #42	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C1O	5198.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #43	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	5231.6	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #44	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O	5213.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #45	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O[Si](C)(C)C	5228.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #46	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5207.9	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #47	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O	5178.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #48	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(CO)C(O)C1O	5212.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #49	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O[Si](C)(C)C	5225.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5200.5	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #50	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5227.0	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #51	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O	5199.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #52	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5228.4	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #53	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5249.2	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #54	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C	5266.4	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #55	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5236.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5180.8	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5196.3	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5242.1	Semi standard non polar	33892256
Rheinoside A,2TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5210.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5033.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5022.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #100	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	5032.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #101	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	5023.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #102	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4979.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #103	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	5024.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #104	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5054.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #105	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5008.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #106	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5054.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #107	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5044.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #108	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5068.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #109	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5079.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	4986.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #110	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5077.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #111	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	5039.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #112	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5080.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #113	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5080.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #114	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	5072.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #115	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5067.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #116	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O	5111.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #117	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C1O	5066.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #118	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	5114.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #119	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O	5107.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5005.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #120	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O[Si](C)(C)C	5116.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #121	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O	5096.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #122	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O	5052.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #123	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)OC(CO)C(O)C1O	5098.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #124	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O[Si](C)(C)C	5112.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #125	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O	5124.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #126	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O	5087.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #127	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5127.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #128	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O	5124.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #129	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C	5105.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4980.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #130	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C	5139.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #131	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	5073.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #132	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5092.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #133	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5088.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #134	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	5077.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #135	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5092.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #136	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5110.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #137	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5045.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #138	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	5032.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #139	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5051.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5009.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #140	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5087.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #141	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	5077.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #142	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5092.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #143	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5073.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #144	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5073.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #145	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5085.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #146	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	5119.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #147	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	5103.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #148	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	5114.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #149	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C1O	5092.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5065.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #150	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	5138.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #151	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O	5065.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #152	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O	5073.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #153	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C1O	5101.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #154	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(CO)C(O)C1O	5119.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #155	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5129.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #156	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5115.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #157	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	5092.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #158	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C1O	5067.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #159	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	5070.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5020.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #160	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C1O	5107.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #161	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5114.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #162	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5116.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #163	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5091.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #164	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	5132.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #165	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5183.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5047.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	5037.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #19	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5064.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5100.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #20	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5054.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #21	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5076.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5111.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5074.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5095.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5046.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5034.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5042.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5087.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #29	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	5046.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	5069.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #30	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5071.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5068.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5051.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5109.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5060.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5091.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	5064.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	5082.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	5034.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	5068.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	5082.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	5105.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	5064.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	5088.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5132.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5145.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5105.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #46	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5077.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #47	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O	5037.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #48	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5055.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #49	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	5023.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	5056.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #50	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5058.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #51	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5088.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #52	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5037.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #53	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5091.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #54	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5141.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #55	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5163.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #56	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5154.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #57	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5126.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #58	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5146.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #59	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5117.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	5082.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #60	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5150.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #61	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5185.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #62	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5111.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #63	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5074.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #64	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5092.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #65	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5061.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #66	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5095.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #67	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5156.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #68	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5125.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #69	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5152.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5149.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #70	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5122.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #71	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5152.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #72	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5097.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #73	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5125.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #74	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5114.2	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #75	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5138.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #76	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O	5100.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #77	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O	5091.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #78	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O[Si](C)(C)C	5104.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #79	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5132.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	5103.5	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #80	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5117.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #81	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5127.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #82	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5010.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #83	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5043.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #84	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	5027.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #85	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	5065.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #86	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5066.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #87	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5031.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #88	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5068.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #89	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5026.4	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5127.1	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #90	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4983.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #91	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5028.6	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #92	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	5013.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #93	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4997.0	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #94	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	5015.8	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #95	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	5034.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #96	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	5028.9	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #97	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5052.7	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #98	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5005.3	Semi standard non polar	33892256
Rheinoside A,3TMS,isomer #99	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	5054.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #1	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	4893.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #10	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4947.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #100	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4968.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #101	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	4956.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #102	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	4974.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #103	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4924.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #104	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	4957.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #105	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4967.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #106	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4918.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #107	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4949.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #108	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4996.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #109	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5016.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #11	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4936.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #110	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4971.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #111	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4973.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #112	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4920.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #113	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4954.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #114	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4968.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #115	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4991.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #116	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4944.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #117	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5002.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #118	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5022.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #119	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4978.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #12	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4964.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #120	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5085.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #121	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O	4877.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #122	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4920.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #123	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4900.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #124	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4940.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #125	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4956.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #126	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4905.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #127	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4962.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #128	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O	4904.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #129	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O	4855.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #13	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	5023.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #130	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O	4910.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #131	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O[Si](C)(C)C)C(O)C1O	4888.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #132	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O[Si](C)(C)C)C1O	4874.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #133	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C32)C(O)C(O)C1O[Si](C)(C)C	4890.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #134	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	4916.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #135	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	4914.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #136	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4931.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #137	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4878.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #138	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4933.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #139	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4910.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #14	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4970.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #140	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4898.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #141	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4847.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #142	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4906.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #143	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4938.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #144	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4884.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #145	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4942.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #146	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	4939.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #147	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	4965.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #148	C[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	4967.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #149	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5079.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #15	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	5001.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #150	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5011.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #151	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4973.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #152	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4982.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #153	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4952.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #154	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4989.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #155	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5036.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #156	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4996.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #157	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5007.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #158	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4979.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #159	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5016.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #16	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4932.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #160	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4969.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #161	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4994.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #162	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4984.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #163	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5014.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #164	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O	4978.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #165	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O	4963.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #166	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O[Si](C)(C)C	4977.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #167	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4993.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #168	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4989.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #169	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4992.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #17	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4917.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #170	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O	5041.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #171	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5003.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #172	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5015.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #173	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4982.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #174	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5021.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #175	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4920.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #176	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4944.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #177	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4925.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #178	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4965.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #179	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O	4928.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #18	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4938.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #180	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O	4908.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #181	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O[Si](C)(C)C	4928.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #182	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4947.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #183	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4941.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #184	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4943.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #185	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4981.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #186	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5006.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #187	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4994.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #188	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5023.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #189	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O	4992.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4989.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #190	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O	4970.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #191	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O[Si](C)(C)C	4989.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #192	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5004.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #193	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4998.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #194	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5002.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #195	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O	4968.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #196	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O	4960.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #197	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O[Si](C)(C)C	4959.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #198	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5007.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #199	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4998.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #2	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	4847.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4932.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #200	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C)C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4994.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #201	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4974.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #202	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4976.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #203	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4981.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #204	C[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5017.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #205	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	4875.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #206	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4824.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #207	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4882.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #208	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4869.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #209	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4862.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	4965.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #210	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4862.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #211	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	4911.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #212	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	4909.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #213	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4915.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #214	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4862.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #215	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4921.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #216	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4904.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #217	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4898.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #218	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4842.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #219	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4906.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #22	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4950.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #220	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4935.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #221	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4882.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #222	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4941.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #223	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4925.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #224	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4954.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #225	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O[Si](C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	4954.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #226	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4880.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #227	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4904.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #228	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4885.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #229	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4872.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #23	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4941.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #230	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4889.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #231	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4904.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #232	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4833.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #233	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4823.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #234	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4841.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #235	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4892.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #236	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4881.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #237	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4894.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #238	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4877.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #239	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4885.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #24	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4993.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #240	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4885.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #241	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4928.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #242	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	4910.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #243	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	4861.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #244	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)C2=C1	4916.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #245	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	4910.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #246	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	4856.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #247	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)C2=C1	4914.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #248	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4899.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #249	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4927.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #25	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4944.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #250	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)C2=C1	4928.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #251	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4910.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #252	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4858.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #253	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)C2=C1	4916.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #254	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4872.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #255	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4898.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #256	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)C2=C1	4898.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #257	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4904.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #258	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4934.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #259	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)C2=C1	4934.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #26	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4972.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #260	C[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	4985.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #261	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4938.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #262	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4959.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #263	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4957.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #264	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4951.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #265	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4949.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #266	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4964.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #267	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4906.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #268	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4895.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #269	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4899.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #27	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	4946.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #270	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4967.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #271	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4958.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #272	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4957.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #273	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4953.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #274	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4960.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #275	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4967.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #276	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O	4994.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #277	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O	4984.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #278	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	4983.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #279	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C1O	4962.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #28	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	4967.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #280	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	4988.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #281	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O	4930.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #282	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O	4937.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #283	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C1O	4990.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #284	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)OC(CO)C(O)C1O	5001.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #285	C[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5007.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #286	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	4984.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #287	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4973.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #288	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C1O	4947.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #289	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	4927.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #29	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4915.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #290	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C1O	4973.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #291	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	4992.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #292	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5003.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #293	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4981.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #294	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	5008.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #295	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5050.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #296	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5012.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #297	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4946.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #298	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4928.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #299	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4946.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #3	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4870.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #30	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	4950.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #300	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4966.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #301	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4951.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #302	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4965.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #303	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4964.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #304	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4963.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #305	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4966.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #306	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4974.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #307	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4953.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #308	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C	4974.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #309	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4913.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #31	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4997.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #310	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4914.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #311	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4917.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #312	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4972.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #313	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4970.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #314	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4974.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #315	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4982.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #316	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O	5000.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #317	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O	4974.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #318	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C	4951.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #319	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4967.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #32	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4953.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #320	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C1O	4945.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #321	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O	5019.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #322	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O[Si](C)(C)C)C1O	4975.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #323	C[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C1O[Si](C)(C)C	4979.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #324	C[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O	4950.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #325	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O	5005.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #326	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4975.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #327	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4950.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #328	C[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C1O	4989.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #329	C[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C	4981.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #33	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4977.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #330	C[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5025.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #34	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5042.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #35	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5055.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #36	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5012.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #37	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	4821.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #38	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4859.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #39	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4846.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #4	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4848.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #40	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4880.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #41	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4940.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #42	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4887.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #43	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4919.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #44	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4840.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #45	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4828.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #46	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4836.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4897.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4844.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	4877.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #5	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4879.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #50	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4859.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #51	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4858.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #52	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4908.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #53	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4859.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #54	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4892.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #55	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	4858.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #56	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	4887.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #57	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4833.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #58	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	4871.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #59	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4920.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #6	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4942.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #60	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4867.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #61	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4903.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #62	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4957.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #63	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4982.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #64	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4929.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #65	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O	4901.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #66	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4903.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #67	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4911.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #68	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4953.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #69	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	4897.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #7	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4894.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #70	C[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	4931.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #71	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4945.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #72	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4937.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #73	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4977.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #74	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4920.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #75	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4956.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #76	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	4936.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #77	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	4965.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #78	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4904.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #79	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C	4945.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #8	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O[Si](C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4924.2	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #80	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4993.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #81	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4942.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #82	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4971.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #83	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5024.5	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #84	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5039.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #85	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4996.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #86	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O	4928.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #87	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O	4921.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #88	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O	4967.7	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #89	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O	4914.3	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #9	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	4915.9	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #90	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C	4945.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #91	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O	4924.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #92	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O	4952.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #93	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O	4897.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #94	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C)C1O	4935.1	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #95	C[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4970.8	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #96	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4912.0	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #97	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C)C(O)C1O	4947.6	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #98	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	5017.4	Semi standard non polar	33892256
Rheinoside A,4TMS,isomer #99	C[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)C=CC=C32)C(O)C(O)C1O	4995.5	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5525.9	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C1O	5582.4	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C1O	5601.1	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5582.1	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5576.7	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1(C2OC(CO)C(O)C(O)C2O)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5536.4	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5517.3	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O	5572.3	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O	5564.9	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O)C(O)C(CO)OC1C1(O)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5557.6	Semi standard non polar	33892256
Rheinoside A,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O	5595.6	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O[Si](C)(C)C(C)(C)C)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5600.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5587.6	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O[Si](C)(C)C(C)(C)C)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5626.9	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5646.4	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5617.6	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O	5646.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O[Si](C)(C)C(C)(C)C)C1OC(CO)C(O)C(O)C1O	5620.3	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC=CC(OC4OC(CO)C(O)C(O)C4O)=C3C(=O)C3=C(O[Si](C)(C)C(C)(C)C)C=C(C(=O)O)C=C32)C(O)C(O)C1O	5592.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5598.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5592.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(C(=O)O)=CC2=C1C(=O)C1=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C1C2(O)C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5601.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O[Si](C)(C)C(C)(C)C)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5577.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O[Si](C)(C)C(C)(C)C)(C3OC(CO)C(O)C(O)C3O)C2=C1	5599.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5559.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)C2=C1	5566.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)C2=C1	5567.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)C2=C1	5574.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5621.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5595.6	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC(=O)C1=CC(O)=C2C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=CC=C3C(O)(C3OC(CO)C(O)C(O)C3O)C2=C1	5616.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OCC1OC(C2(O[Si](C)(C)C(C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5536.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O[Si](C)(C)C(C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O	5569.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C(C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O	5558.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2(O[Si](C)(C)C(C)(C)C)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O	5579.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1C(O)C(O)C(CO)OC1C1(O[Si](C)(C)C(C)(C)C)C2=CC(C(=O)O)=CC(O)=C2C(=O)C2=C(OC3OC(CO)C(O)C(O)C3O)C=CC=C21	5592.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C(C)(C)C)C2OC(CO)C(O)C(O)C2O)C(O)C1O	5607.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C(C)(C)C)C2OC(CO)C(O)C(O)C2O)C1O	5582.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O[Si](C)(C)C(C)(C)C)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O	5606.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)C=CC=C32)C(O)C(O)C1O	5570.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=CC=C32)C(O)C(O)C1O	5540.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=CC=C32)C(O)C(O)C1O	5564.3	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5541.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5558.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C(O)C1O	5529.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OCC1OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5548.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O	5584.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)C=CC=C32)C(O)C1O	5553.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)C=CC=C32)C(O)C1O	5579.9	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O[Si](C)(C)C(C)(C)C)C1O	5561.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C(O)C1O[Si](C)(C)C(C)(C)C	5572.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O	5578.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O	5549.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1O	5570.9	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2(O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C3=C(OC4OC(CO)C(O)C(O)C4O)C=CC=C32)C1O[Si](C)(C)C(C)(C)C	5568.1	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O	5534.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O	5584.8	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O	5557.6	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O	5579.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5634.0	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5643.5	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5613.7	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O	5530.4	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	5533.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5605.2	Semi standard non polar	33892256
Rheinoside A,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(OC2=CC=CC3=C2C(=O)C2=C(O)C=C(C(=O)O)C=C2C3(O)C2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5588.8	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (Non-derivatized) - 70eV, Positive	splash10-0kcm-2230390000-cfd77a9f9865ab0b486f	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (1 TMS) - 70eV, Positive	splash10-07br-7862049000-eff2f834b97b40a69472	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Rheinoside A GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 10V, Positive-QTOF	splash10-01pp-0000962000-b056bc7338e3e2ec0d4a	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 20V, Positive-QTOF	splash10-001i-0100910000-9133eca55e3449c3c33f	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 40V, Positive-QTOF	splash10-0f89-1223910000-998c88cf5920630dad00	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 10V, Negative-QTOF	splash10-0a6s-0101975000-ffd8f63dde9e2fb30e23	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 20V, Negative-QTOF	splash10-002e-1102940000-9a63c08d6d8b089f1ba7	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 40V, Negative-QTOF	splash10-002e-4203900000-c5a088fd7117170b6232	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 10V, Negative-QTOF	splash10-0a6s-0020904000-0b2eb3b2c4bb46acdd12	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 20V, Negative-QTOF	splash10-0a6r-3010961000-3d707c2026fab84b971c	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 40V, Negative-QTOF	splash10-0007-9141810000-fe30ccf5429f1933c413	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 10V, Positive-QTOF	splash10-03di-0100559000-40b7242e43b2e0e877ec	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 20V, Positive-QTOF	splash10-01pw-1220891000-9d585613874db85eeab9	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Rheinoside A 40V, Positive-QTOF	splash10-052b-9500420000-6a30604ce7594dcbf833	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB020521

KNApSAcK ID

C00056857

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

13888123

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Rheinoside A (HMDB0040715)

MOL for HMDB0040715 (Rheinoside A)

3D MOL for HMDB0040715 (Rheinoside A)

3D SDF for HMDB0040715 (Rheinoside A)

3D-SDF for HMDB0040715 (Rheinoside A)

PDB for HMDB0040715 (Rheinoside A)

3D PDB for HMDB0040715 (Rheinoside A)

SMILES for HMDB0040715 (Rheinoside A)

INCHI for HMDB0040715 (Rheinoside A)

Structure for HMDB0040715 (Rheinoside A)

3D Structure for HMDB0040715 (Rheinoside A)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra