| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2012-09-12 03:38:11 UTC |
|---|
| Update Date | 2022-03-07 02:57:10 UTC |
|---|
| HMDB ID | HMDB0041717 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Daidzein 4'-O-glucuronide |
|---|
| Description | Daidzein 4'-O-glucuronide belongs to the class of organic compounds known as isoflavonoid o-glycosides. These are o-glycosylated derivatives of isoflavonoids, which are natural products derived from 3-phenylchromen-4-one. Based on a literature review very few articles have been published on Daidzein 4'-O-glucuronide. |
|---|
| Structure | O[C@@H]1[C@@H](O)[C@H](OC2=CC=C(C=C2)C2=COC3=CC(O)=CC=C3C2=O)O[C@@H]([C@H]1O)C(O)=O InChI=1S/C21H18O10/c22-10-3-6-12-14(7-10)29-8-13(15(12)23)9-1-4-11(5-2-9)30-21-18(26)16(24)17(25)19(31-21)20(27)28/h1-8,16-19,21-22,24-26H,(H,27,28)/t16-,17-,18+,19-,21+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-[4-(7-hydroxy-4-oxo-4H-chromen-3-yl)phenoxy]oxane-2-carboxylate | HMDB |
|
|---|
| Chemical Formula | C21H18O10 |
|---|
| Average Molecular Weight | 430.3616 |
|---|
| Monoisotopic Molecular Weight | 430.089996796 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(7-hydroxy-4-oxo-4H-chromen-3-yl)phenoxy]oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]oxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | O[C@@H]1[C@@H](O)[C@H](OC2=CC=C(C=C2)C2=COC3=CC(O)=CC=C3C2=O)O[C@@H]([C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C21H18O10/c22-10-3-6-12-14(7-10)29-8-13(15(12)23)9-1-4-11(5-2-9)30-21-18(26)16(24)17(25)19(31-21)20(27)28/h1-8,16-19,21-22,24-26H,(H,27,28)/t16-,17-,18+,19-,21+/m0/s1 |
|---|
| InChI Key | ATUYSKUVHUPXBV-ZFORQUDYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as isoflavonoid o-glycosides. These are o-glycosylated derivatives of isoflavonoids, which are natural products derived from 3-phenylchromen-4-one. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Isoflavonoids |
|---|
| Sub Class | Isoflavonoid O-glycosides |
|---|
| Direct Parent | Isoflavonoid O-glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Isoflavonoid o-glycoside
- Isoflavonoid-4p-o-glycoside
- Isoflavone
- Hydroxyisoflavonoid
- Phenolic glycoside
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Chromone
- Glycosyl compound
- O-glycosyl compound
- 1-benzopyran
- Benzopyran
- Phenoxy compound
- Phenol ether
- Beta-hydroxy acid
- Pyranone
- 1-hydroxy-2-unsubstituted benzenoid
- Pyran
- Hydroxy acid
- Oxane
- Monocyclic benzene moiety
- Monosaccharide
- Benzenoid
- Heteroaromatic compound
- Secondary alcohol
- Acetal
- Polyol
- Monocarboxylic acid or derivatives
- Carboxylic acid derivative
- Carboxylic acid
- Organoheterocyclic compound
- Oxacycle
- Organooxygen compound
- Carbonyl group
- Alcohol
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.29 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.8387 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.69 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1590.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 220.3 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 129.2 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 184.7 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 108.8 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 334.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 384.5 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 408.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 697.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 362.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1172.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 262.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 270.8 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 453.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 316.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 166.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Daidzein 4'-O-glucuronide,1TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@H]1O | 3975.0 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O | 3988.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TMS,isomer #3 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=COC2=C1 | 4036.1 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TMS,isomer #4 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@H]1O | 3984.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TMS,isomer #5 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O | 3987.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@@H]1O[Si](C)(C)C | 3893.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #10 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3931.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #2 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)C=C3)=COC2=C1 | 3924.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3904.6 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #4 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@H]1O[Si](C)(C)C | 3898.5 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #5 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)C=C3)=COC2=C1 | 3935.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #6 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O | 3915.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #7 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@H]1O | 3915.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #8 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O | 3975.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TMS,isomer #9 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)C=C3)=COC2=C1 | 3936.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C | 3877.6 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #10 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3930.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3869.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #3 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)C=C3)=COC2=C1 | 3879.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3903.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #5 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)C=C3)=COC2=C1 | 3882.5 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #6 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3881.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #7 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O | 3925.0 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #8 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)C=C3)=COC2=C1 | 3896.6 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TMS,isomer #9 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3892.5 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TMS,isomer #1 | C[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)C=C3)=COC2=C1 | 3911.1 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3894.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3901.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3905.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TMS,isomer #5 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3920.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3938.1 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@H]1O | 4244.4 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O | 4263.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=COC2=C1 | 4314.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@H]1O | 4241.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O | 4300.0 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@@H]1O[Si](C)(C)C(C)(C)C | 4367.3 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4444.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)C=C3)=COC2=C1 | 4471.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4413.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4355.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)C=C3)=COC2=C1 | 4489.1 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4440.6 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4380.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O | 4514.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)C=C3)=COC2=C1 | 4476.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C(C)(C)C | 4508.5 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4651.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4547.9 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O[Si](C)(C)C(C)(C)C)C=C3)=COC2=C1 | 4637.6 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4642.4 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)C=C3)=COC2=C1 | 4616.5 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4542.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4660.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)C=C3)=COC2=C1 | 4652.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4579.7 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C2C(=O)C(C3=CC=C(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O[Si](C)(C)C(C)(C)C)C=C3)=COC2=C1 | 4767.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4692.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4754.2 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4749.8 | Semi standard non polar | 33892256 | | Daidzein 4'-O-glucuronide,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C(C3=COC4=CC(O[Si](C)(C)C(C)(C)C)=CC=C4C3=O)C=C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4788.6 | Semi standard non polar | 33892256 |
|
|---|