| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2014-04-16 20:10:16 UTC |
|---|
| Update Date | 2021-09-14 15:42:55 UTC |
|---|
| HMDB ID | HMDB0061689 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 4-Ketoretinoic acid glucuronide |
|---|
| Description | 4-Ketoretinoic acid glucuronide belongs to the class of organic compounds known as diterpene glycosides. These are diterpenoids in which an isoprene unit is glycosylated. 4-Ketoretinoic acid glucuronide is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | C\C(\C=C\C1=C(C)C(=O)CCC1(C)C)=C/C=C/C(/C)=C/C(=O)OC1OC(C(O)C(O)C1O)C(O)=O InChI=1S/C26H34O9/c1-14(9-10-17-16(3)18(27)11-12-26(17,4)5)7-6-8-15(2)13-19(28)34-25-22(31)20(29)21(30)23(35-25)24(32)33/h6-10,13,20-23,25,29-31H,11-12H2,1-5H3,(H,32,33)/b8-6+,10-9+,14-7+,15-13+ |
|---|
| Synonyms | | Value | Source |
|---|
| 4-Ketoretinoate glucuronide | Generator |
|
|---|
| Chemical Formula | C26H34O9 |
|---|
| Average Molecular Weight | 490.5428 |
|---|
| Monoisotopic Molecular Weight | 490.220282686 |
|---|
| IUPAC Name | 6-{[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoyl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | 6-{[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoyl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | C\C(\C=C\C1=C(C)C(=O)CCC1(C)C)=C/C=C/C(/C)=C/C(=O)OC1OC(C(O)C(O)C1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C26H34O9/c1-14(9-10-17-16(3)18(27)11-12-26(17,4)5)7-6-8-15(2)13-19(28)34-25-22(31)20(29)21(30)23(35-25)24(32)33/h6-10,13,20-23,25,29-31H,11-12H2,1-5H3,(H,32,33)/b8-6+,10-9+,14-7+,15-13+ |
|---|
| InChI Key | SIKFAVWPHMSCBL-FRCNGJHJSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as diterpene glycosides. These are diterpenoids in which an isoprene unit is glycosylated. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Terpene glycosides |
|---|
| Direct Parent | Diterpene glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Diterpene glycoside
- Retinoid ester
- Diterpenoid
- Retinoid skeleton
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Hexose monosaccharide
- Beta-hydroxy acid
- Fatty acid ester
- Cyclohexenone
- Fatty acyl
- Dicarboxylic acid or derivatives
- Pyran
- Oxane
- Hydroxy acid
- Monosaccharide
- Alpha,beta-unsaturated carboxylic ester
- Enoate ester
- Cyclic ketone
- Carboxylic acid ester
- Secondary alcohol
- Ketone
- Polyol
- Carboxylic acid
- Organoheterocyclic compound
- Carboxylic acid derivative
- Oxacycle
- Acetal
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Organooxygen compound
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 6.33 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 16.5858 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.21 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3304.0 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 233.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 166.0 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 177.0 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 124.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 637.4 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 628.1 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 83.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1337.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 619.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1609.7 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 446.4 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 484.3 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 216.3 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 197.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.8 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 4-Ketoretinoic acid glucuronide,1TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O)C2O)C(C)(C)CCC1=O | 3919.1 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C)C2O)C(C)(C)CCC1=O | 3948.4 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3945.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O)C2O)C(C)(C)CCC1=O | 3898.9 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3952.6 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(C)(C)CCC1=O | 3872.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #10 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3851.7 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)(C)CCC1=O | 3918.5 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3918.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3895.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(C)(C)CCC1=O | 3887.2 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #6 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3933.7 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #7 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3911.4 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #8 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3887.6 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TMS,isomer #9 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3923.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)(C)CCC1=O | 3876.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #10 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3833.7 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3874.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3815.1 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3906.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3855.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #6 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3862.5 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #7 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3879.2 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #8 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3823.1 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TMS,isomer #9 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3862.6 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,4TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CCC1=O | 3858.7 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,4TMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C | 3813.9 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,4TMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3821.6 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,4TMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3844.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,4TMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3812.2 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,5TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3796.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,5TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 3635.3 | Standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,5TMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C | 4096.5 | Standard polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TBDMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)(C)CCC1=O | 4150.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TBDMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CCC1=O | 4180.4 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TBDMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4179.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TBDMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(C)(C)CCC1=O | 4120.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,1TBDMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4173.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)(C)CCC1=O | 4323.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #10 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4290.4 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CCC1=O | 4374.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4369.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4326.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CCC1=O | 4343.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #6 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4390.2 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #7 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4344.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #8 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4338.2 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,2TBDMS,isomer #9 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4349.9 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #1 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CCC1=O | 4562.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #10 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4480.8 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #2 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4560.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #3 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4464.0 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #4 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4588.7 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #5 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4518.3 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #6 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4519.6 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #7 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CCC1=O | 4565.1 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #8 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4480.1 | Semi standard non polar | 33892256 | | 4-Ketoretinoic acid glucuronide,3TBDMS,isomer #9 | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC2OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(C)(C)CC=C1O[Si](C)(C)C(C)(C)C | 4530.8 | Semi standard non polar | 33892256 |
|
|---|