| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2017-03-23 06:16:37 UTC |
|---|
| Update Date | 2021-09-14 15:40:03 UTC |
|---|
| HMDB ID | HMDB0062779 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Cortisol 21-sulfate |
|---|
| Description | Cortisol 21-sulfate, also known as SS441 compound or F(K)S CPD, belongs to the class of organic compounds known as sulfated steroids. These are sterol lipids containing a sulfate group attached to the steroid skeleton. Cortisol 21-sulfate is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| Structure | [H][C@@]12CC[C@](O)(C(=O)COS(O)(=O)=O)[C@@]1(C)C[C@]([H])(O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C InChI=1S/C21H30O8S/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25H,3-8,10-11H2,1-2H3,(H,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (11beta)-11,17-Dihydroxy-21-(sulfooxy)pregn-4-ene-3,20-dione | ChEBI | | 11,17-Dihydroxy-4-pregnene-3,20-dione-21-yl-sulfate | ChEBI | | Cortisol-21-sulfate | ChEBI | | (11b)-11,17-Dihydroxy-21-(sulfooxy)pregn-4-ene-3,20-dione | Generator | | (11b)-11,17-Dihydroxy-21-(sulphooxy)pregn-4-ene-3,20-dione | Generator | | (11beta)-11,17-Dihydroxy-21-(sulphooxy)pregn-4-ene-3,20-dione | Generator | | (11Β)-11,17-dihydroxy-21-(sulfooxy)pregn-4-ene-3,20-dione | Generator | | (11Β)-11,17-dihydroxy-21-(sulphooxy)pregn-4-ene-3,20-dione | Generator | | 11,17-Dihydroxy-4-pregnene-3,20-dione-21-yl-sulfuric acid | Generator | | 11,17-Dihydroxy-4-pregnene-3,20-dione-21-yl-sulphate | Generator | | 11,17-Dihydroxy-4-pregnene-3,20-dione-21-yl-sulphuric acid | Generator | | Cortisol-21-sulfuric acid | Generator | | Cortisol-21-sulphate | Generator | | Cortisol-21-sulphuric acid | Generator | | Cortisol 21-sulfuric acid | Generator | | Cortisol 21-sulphate | Generator | | Cortisol 21-sulphuric acid | Generator | | SS441 Compound | MeSH | | Cortisol 21-sulfate, 4-(14)C-labeled | MeSH | | 4-Pregnen-11,17,21-triol-3,20-dione 21-sulfate | MeSH | | Cortisol sulfate | MeSH | | F(K)S CPD | MeSH | | Cortisol 21-sulfate, 1,2-T2-labeled | MeSH |
|
|---|
| Chemical Formula | C21H30O8S |
|---|
| Average Molecular Weight | 442.52 |
|---|
| Monoisotopic Molecular Weight | 442.1661391 |
|---|
| IUPAC Name | {2-[(1S,2R,10S,11S,14R,15S,17S)-14,17-dihydroxy-2,15-dimethyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-14-yl]-2-oxoethoxy}sulfonic acid |
|---|
| Traditional Name | 2-[(1S,2R,10S,11S,14R,15S,17S)-14,17-dihydroxy-2,15-dimethyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-14-yl]-2-oxoethoxysulfonic acid |
|---|
| CAS Registry Number | 1253-43-6 |
|---|
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COS(O)(=O)=O)[C@@]1(C)C[C@]([H])(O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C21H30O8S/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25H,3-8,10-11H2,1-2H3,(H,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
|---|
| InChI Key | JOVLCJDINAUYJW-VWUMJDOOSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as sulfated steroids. These are sterol lipids containing a sulfate group attached to the steroid skeleton. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Sulfated steroids |
|---|
| Direct Parent | Sulfated steroids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- Sulfated steroid skeleton
- Pregnane-skeleton
- 20-oxosteroid
- 3-oxo-delta-4-steroid
- 3-oxosteroid
- Hydroxysteroid
- Oxosteroid
- 17-hydroxysteroid
- 11-hydroxysteroid
- 11-beta-hydroxysteroid
- Delta-4-steroid
- Cyclohexenone
- Sulfate-ester
- Sulfuric acid monoester
- Alkyl sulfate
- Sulfuric acid ester
- Tertiary alcohol
- Alpha-hydroxy ketone
- Cyclic alcohol
- Organic sulfuric acid or derivatives
- Secondary alcohol
- Cyclic ketone
- Ketone
- Organooxygen compound
- Carbonyl group
- Organic oxide
- Organic oxygen compound
- Alcohol
- Hydrocarbon derivative
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.34 g/l | ALOGPS | | LogP | -0.18 | ALOGPS |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.04 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 12.3439 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.14 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2469.8 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 189.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 171.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 165.9 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 158.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 496.0 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 561.9 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 116.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 966.9 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 412.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1427.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 285.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 389.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 314.5 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 213.0 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 105.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Cortisol 21-sulfate,1TMS,isomer #1 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 3798.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O | 3676.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TMS,isomer #3 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3814.7 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3772.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TMS,isomer #5 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O | 3719.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 3702.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #10 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3704.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #2 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3867.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #3 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 3767.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3793.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #5 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3733.8 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #6 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O | 3618.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #7 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3647.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #8 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3779.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TMS,isomer #9 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3780.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3772.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4036.7 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4356.4 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #10 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3685.1 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #10 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3962.6 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #10 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4498.5 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 3618.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 3947.1 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O | 4488.8 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3643.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3848.2 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 4488.7 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3793.9 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4034.7 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4414.9 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #5 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3786.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #5 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4039.2 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #5 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4379.3 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #6 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3721.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #6 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3857.8 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #6 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 4554.1 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #7 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3641.9 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #7 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3981.1 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #7 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4453.2 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #8 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3630.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #8 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3976.5 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #8 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4434.7 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #9 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3561.8 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #9 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3811.5 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TMS,isomer #9 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O)O[Si](C)(C)C | 4595.2 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 3678.1 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4094.6 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C | 4277.8 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3642.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4042.1 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #2 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4254.4 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3577.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 3859.8 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #3 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O)O[Si](C)(C)C | 4404.2 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3681.7 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4049.5 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #4 | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4334.2 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #5 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3542.8 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #5 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3992.2 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TMS,isomer #5 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4384.5 | Standard polar | 33892256 | | Cortisol 21-sulfate,5TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3556.9 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,5TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4053.3 | Standard non polar | 33892256 | | Cortisol 21-sulfate,5TMS,isomer #1 | C[C@]12C[C@H](O[Si](C)(C)C)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=COS(=O)(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4186.4 | Standard polar | 33892256 | | Cortisol 21-sulfate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@]1(C(=O)COS(=O)(=O)O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4042.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O)C(=O)COS(=O)(=O)O)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3919.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OS(=O)(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4026.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4013.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O)[C@@H]12 | 3977.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)COS(=O)(=O)O)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 4192.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4197.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@]1(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4324.5 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4269.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O)[C@@H]12 | 4257.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O)C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 4179.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4115.1 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4091.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4227.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4229.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 4422.3 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 4835.0 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 4479.8 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4382.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4693.5 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4679.0 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4343.1 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4631.9 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4614.7 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4313.9 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4706.3 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4623.3 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4459.8 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4795.6 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4527.6 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4459.1 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4803.5 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4562.4 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4441.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4603.2 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4706.2 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4288.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4736.0 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4590.4 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4279.8 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4762.9 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4608.7 | Standard polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4254.0 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4572.1 | Standard non polar | 33892256 | | Cortisol 21-sulfate,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4756.1 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4477.7 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 5021.8 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4390.9 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4493.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 5105.7 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)COS(=O)(=O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4423.5 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4417.2 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4857.0 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4545.1 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4569.6 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 5011.3 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O)[C@@H]12 | 4495.6 | Standard polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4388.4 | Semi standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4967.0 | Standard non polar | 33892256 | | Cortisol 21-sulfate,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=COS(=O)(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]12 | 4554.3 | Standard polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Cortisol 21-sulfate GC-MS (Non-derivatized) - 70eV, Positive | splash10-08g3-0961300000-e96bf3f1fb1363a19c2c | 2017-09-20 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisol 21-sulfate GC-MS (2 TMS) - 70eV, Positive | splash10-00di-2514790000-3c40ab2fd82fe64add1b | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisol 21-sulfate GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 10V, Positive-QTOF | splash10-004l-0014900000-12b201f815e4993e33f7 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 20V, Positive-QTOF | splash10-01t9-2657900000-5f2a106cbd5c0e5b9abb | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 40V, Positive-QTOF | splash10-0a4i-0491100000-5108e522c4fa3bbd16dc | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 10V, Negative-QTOF | splash10-0006-0003900000-c0b83607edf6173a75ca | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 20V, Negative-QTOF | splash10-0f77-3229200000-454e879cf26e0f5058ec | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 40V, Negative-QTOF | splash10-0un9-9157000000-31cd5073e4e4e45c7736 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 10V, Positive-QTOF | splash10-002f-0004900000-78f5679f5fa753327745 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 20V, Positive-QTOF | splash10-03fs-0945100000-756e74e898fb9583d809 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 40V, Positive-QTOF | splash10-03dl-5890000000-fac12eee8440adf675e1 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 10V, Negative-QTOF | splash10-0006-0001900000-47e8a557d08342f365e4 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 20V, Negative-QTOF | splash10-0002-9223100000-57fc20fa1f254701732e | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisol 21-sulfate 40V, Negative-QTOF | splash10-0002-9010000000-a3c8033e013a9d0e2437 | 2021-09-22 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Predicted 1D NMR | 13C NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum |
|
|---|