| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.4 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.0084 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.8 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 554.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 316.2 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 39.3 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 184.8 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 69.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 294.1 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 230.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 744.1 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 610.0 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 43.5 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 815.0 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 194.0 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 260.7 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 687.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 320.1 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 479.6 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| N-carbamoylglutamic Acid,1TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC(NC(=N)O)C(=O)O | 2059.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TMS,isomer #2 | C[Si](C)(C)OC(=N)NC(CCC(=O)O)C(=O)O | 2004.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CCC(=O)O)NC(=N)O | 2038.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TMS,isomer #4 | C[Si](C)(C)N(C(=N)O)C(CCC(=O)O)C(=O)O | 2040.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TMS,isomer #5 | C[Si](C)(C)N=C(O)NC(CCC(=O)O)C(=O)O | 1979.6 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #1 | C[Si](C)(C)OC(=N)NC(CCC(=O)O[Si](C)(C)C)C(=O)O | 2031.3 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #10 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C | 2124.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)CCC(NC(=N)O)C(=O)O[Si](C)(C)C | 2128.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CCC(C(=O)O)N(C(=N)O)[Si](C)(C)C | 2084.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #4 | C[Si](C)(C)N=C(O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O | 2074.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #5 | C[Si](C)(C)OC(=N)NC(CCC(=O)O)C(=O)O[Si](C)(C)C | 2054.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #6 | C[Si](C)(C)N=C(NC(CCC(=O)O)C(=O)O)O[Si](C)(C)C | 1959.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #7 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C | 2051.3 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #8 | C[Si](C)(C)OC(=O)C(CCC(=O)O)N(C(=N)O)[Si](C)(C)C | 2086.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TMS,isomer #9 | C[Si](C)(C)N=C(O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C | 2078.4 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #1 | C[Si](C)(C)OC(=N)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2052.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #10 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2105.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #2 | C[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C)C(=O)O)O[Si](C)(C)C | 2005.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #3 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2031.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #4 | C[Si](C)(C)OC(=O)CCC(C(=O)O[Si](C)(C)C)N(C(=N)O)[Si](C)(C)C | 2066.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #5 | C[Si](C)(C)N=C(O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2091.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #6 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2107.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #7 | C[Si](C)(C)N=C(NC(CCC(=O)O)C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 1998.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #8 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2036.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TMS,isomer #9 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C | 2004.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #1 | C[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2024.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #1 | C[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 1814.2 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #1 | C[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C | 2649.7 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #2 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2039.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #2 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2010.0 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #2 | C[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2522.7 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #3 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2028.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #3 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 1974.0 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #3 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2468.1 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #4 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2126.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #4 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1911.7 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #4 | C[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2526.9 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #5 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2025.3 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #5 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1949.4 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TMS,isomer #5 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2429.5 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,5TMS,isomer #1 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2025.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,5TMS,isomer #1 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 1971.9 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,5TMS,isomer #1 | C[Si](C)(C)N=C(O[Si](C)(C)C)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2179.2 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC(NC(=N)O)C(=O)O | 2306.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=N)NC(CCC(=O)O)C(=O)O | 2255.4 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CCC(=O)O)NC(=N)O | 2297.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(=N)O)C(CCC(=O)O)C(=O)O | 2288.7 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C(O)NC(CCC(=O)O)C(=O)O | 2231.7 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=N)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2529.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2514.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCC(NC(=N)O)C(=O)O[Si](C)(C)C(C)(C)C | 2600.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CCC(C(=O)O)N(C(=N)O)[Si](C)(C)C(C)(C)C | 2544.4 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C(O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2489.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=N)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2555.7 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O)C(=O)O)O[Si](C)(C)C(C)(C)C | 2419.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2477.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)C(CCC(=O)O)N(C(=N)O)[Si](C)(C)C(C)(C)C | 2545.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N=C(O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2494.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=N)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2718.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2707.9 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)O[Si](C)(C)C(C)(C)C | 2656.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2699.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CCC(C(=O)O[Si](C)(C)C(C)(C)C)N(C(=N)O)[Si](C)(C)C(C)(C)C | 2721.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C(O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2695.0 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2712.4 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2649.7 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2701.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2641.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2825.8 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2454.2 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2865.2 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2885.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2742.1 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=N)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2827.6 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2850.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2613.0 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2772.0 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2901.1 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2608.2 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N=C(O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2858.9 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2862.2 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2606.9 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2750.2 | Standard polar | 33892256 |
| N-carbamoylglutamic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3026.5 | Semi standard non polar | 33892256 |
| N-carbamoylglutamic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2791.1 | Standard non polar | 33892256 |
| N-carbamoylglutamic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N=C(O[Si](C)(C)C(C)(C)C)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2697.3 | Standard polar | 33892256 |