| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.57 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.0545 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.18 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 462.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 305.1 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 20.6 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 180.9 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 82.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 328.6 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 235.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 904.2 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 579.7 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 49.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 763.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 206.0 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 315.5 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 877.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 593.0 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 371.4 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Meglumine,1TMS,isomer #1 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO | 1745.8 | Semi standard non polar | 33892256 |
| Meglumine,1TMS,isomer #2 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO | 1739.5 | Semi standard non polar | 33892256 |
| Meglumine,1TMS,isomer #3 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO | 1747.5 | Semi standard non polar | 33892256 |
| Meglumine,1TMS,isomer #4 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C | 1774.8 | Semi standard non polar | 33892256 |
| Meglumine,1TMS,isomer #5 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C | 1813.8 | Semi standard non polar | 33892256 |
| Meglumine,1TMS,isomer #6 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[Si](C)(C)C | 1920.2 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #1 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO | 1778.7 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #10 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C | 1829.8 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #11 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C | 1836.7 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #12 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C | 1939.5 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #13 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1854.1 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #14 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1948.0 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #15 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 1972.5 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #2 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO | 1779.9 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #3 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C | 1806.4 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #4 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C | 1826.9 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO)[Si](C)(C)C | 1942.8 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #6 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO | 1809.5 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #7 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C | 1828.0 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #8 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C | 1841.7 | Semi standard non polar | 33892256 |
| Meglumine,2TMS,isomer #9 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO)[Si](C)(C)C | 1949.6 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #1 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO | 1816.9 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #10 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 1993.6 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #11 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C | 1843.8 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #12 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C | 1859.4 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #13 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C | 1985.0 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #14 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1859.9 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #15 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1977.1 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #16 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 2007.0 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #17 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1843.3 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #18 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1981.2 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #19 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 1989.3 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #2 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C | 1833.0 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #20 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2000.8 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #3 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C | 1842.3 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #4 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO)[Si](C)(C)C | 1962.0 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #5 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C | 1839.6 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #6 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C | 1849.1 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #7 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C | 1962.2 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #8 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1850.6 | Semi standard non polar | 33892256 |
| Meglumine,3TMS,isomer #9 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1975.8 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #1 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C | 1876.2 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #10 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2021.9 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #11 | CNC[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1884.0 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #12 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 2008.9 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #13 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 2015.7 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #14 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2022.1 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #15 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2029.9 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #2 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C | 1867.7 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #3 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C | 2000.9 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #4 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1871.5 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1986.7 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #6 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 2016.6 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #7 | CNC[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1863.5 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #8 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 1991.9 | Semi standard non polar | 33892256 |
| Meglumine,4TMS,isomer #9 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 1995.3 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #1 | CNC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C | 1951.1 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #2 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C | 2034.0 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #3 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C | 2017.5 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #4 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2023.2 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2031.6 | Semi standard non polar | 33892256 |
| Meglumine,5TMS,isomer #6 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2037.5 | Semi standard non polar | 33892256 |
| Meglumine,6TMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2090.7 | Semi standard non polar | 33892256 |
| Meglumine,6TMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2117.2 | Standard non polar | 33892256 |
| Meglumine,6TMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2005.9 | Standard polar | 33892256 |
| Meglumine,1TBDMS,isomer #1 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO | 1996.7 | Semi standard non polar | 33892256 |
| Meglumine,1TBDMS,isomer #2 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO | 2003.1 | Semi standard non polar | 33892256 |
| Meglumine,1TBDMS,isomer #3 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO | 2012.6 | Semi standard non polar | 33892256 |
| Meglumine,1TBDMS,isomer #4 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2035.6 | Semi standard non polar | 33892256 |
| Meglumine,1TBDMS,isomer #5 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2067.9 | Semi standard non polar | 33892256 |
| Meglumine,1TBDMS,isomer #6 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2185.2 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #1 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO | 2255.8 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #10 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2299.4 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #11 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2299.8 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #12 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2386.4 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #13 | CNC[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2303.9 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #14 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2404.9 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #15 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2428.8 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #2 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO | 2262.5 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #3 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2275.0 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #4 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2290.7 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2407.8 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #6 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO | 2286.2 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #7 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2294.4 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #8 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2309.1 | Semi standard non polar | 33892256 |
| Meglumine,2TBDMS,isomer #9 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2404.5 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #1 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO | 2509.7 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #10 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2659.8 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #11 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2555.1 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #12 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2557.8 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #13 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2656.4 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #14 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2559.2 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #15 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2668.2 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #16 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2662.2 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #17 | CNC[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2540.5 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #18 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2649.7 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #19 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2653.3 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #2 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2525.4 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #20 | CN(C[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2647.3 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #3 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2539.9 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #4 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2643.5 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #5 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2520.4 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #6 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2541.6 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #7 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2654.6 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #8 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2537.9 | Semi standard non polar | 33892256 |
| Meglumine,3TBDMS,isomer #9 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2651.5 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #1 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C | 2738.8 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #10 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2887.4 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #11 | CNC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2777.4 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #12 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2905.3 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #13 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2911.8 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #14 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2913.1 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #15 | CN(C[C@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2892.3 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #2 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C | 2743.0 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #3 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C | 2881.4 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #4 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2737.6 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2893.0 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #6 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2884.0 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #7 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2737.0 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #8 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2897.0 | Semi standard non polar | 33892256 |
| Meglumine,4TBDMS,isomer #9 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2910.5 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #1 | CNC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2975.6 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #2 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3109.0 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #3 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3111.6 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #4 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3108.1 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #5 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3113.2 | Semi standard non polar | 33892256 |
| Meglumine,5TBDMS,isomer #6 | CN(C[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3128.7 | Semi standard non polar | 33892256 |
| Meglumine,6TBDMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3341.6 | Semi standard non polar | 33892256 |
| Meglumine,6TBDMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3154.5 | Standard non polar | 33892256 |
| Meglumine,6TBDMS,isomer #1 | CN(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2665.4 | Standard polar | 33892256 |