Showing metabocard for PIP(PGE2/16:2(9Z,12Z)) (HMDB0278648)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Predicted | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-13 10:29:35 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-11-30 20:01:50 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0278648 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | PIP(PGE2/16:2(9Z,12Z)) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | PIP(PGE2/16:2(9Z,12Z)) is an oxidized phosphatidylinositol phosphate (PIP). As other PIPs, oxidized phosphatidylinositol phosphates are acidic (anionic) phospholipids that consist of a phosphatidic acid backbone, linked via the phosphate group to a phosphorylated inositol (hexahydroxycyclohexane). Phosphatidylinositol phosphates are generated from phosphatidylinositols, which are phosphorylated by a number of different kinases that place the phosphate moiety on positions 4 and 5 of the inositol ring, although position 3 can also be phosphorylated. Phosphatidylinositol phosphates can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. PIP(PGE2/16:2(9Z,12Z)), in particular, consists of one chain of Prostaglandin E2 at the C-1 position and one chain of 9Z,12Z-hexadecenoyl at the C-2 position. The most important phosphatidylinositol phosphate in both quantitative and biological terms is phosphatidylinositol 4-phosphate. Phosphatidylinositol and the phosphatidylinositol phosphates are the main source of diacylglycerols that serve as signaling molecules, via the action of phospholipase C enzymes. Phosphatidylinositol phosphates are usually present at low levels only in tissues, typically at about 1 to 3% of the concentration of phosphatidylinositol. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))Mrv1652309132112292D 66 67 0 0 1 0 999 V2000 0.3000 0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5155 -0.0420 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7983 0.8552 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0160 1.1174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0848 1.6615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9090 1.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7272 2.4444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5662 3.2988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2172 3.6223 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 0.6099 4.3478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3349 4.2353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0533 3.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8076 3.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3808 2.4998 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6338 1.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0700 0.9837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5896 0.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3114 0.7394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8631 -0.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3491 -1.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5528 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8195 -1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9861 -1.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2159 -1.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5165 -0.8875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3097 -0.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0480 -0.9635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0644 0.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1704 0.5299 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3312 1.1850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6485 0.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2757 0.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0535 0.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6806 -0.0647 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5054 -0.0434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5301 -0.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7523 -1.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1251 -0.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3474 -0.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1968 -1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0953 2.9123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8097 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8097 1.6748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5242 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2387 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9532 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6676 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3821 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0966 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8110 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5255 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 3.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 4.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 4.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 5.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 6.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 6.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0723 2.1298 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5014 2.8345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3261 2.8153 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 1.3069 1.9905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1046 2.5421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7954 2.1367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7198 1.5631 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5428 1.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 6 0 0 0 2 3 1 0 0 0 0 3 4 1 1 0 0 0 3 5 1 0 0 0 0 5 6 1 1 0 0 0 5 7 1 0 0 0 0 7 8 1 6 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 2 0 0 0 0 9 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 2 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 2 25 1 0 0 0 0 25 26 1 1 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 1 0 0 0 29 31 1 0 0 0 0 31 32 1 1 0 0 0 32 33 2 0 0 0 0 33 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 14 41 1 6 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 42 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 7 59 1 0 0 0 0 59 60 1 6 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 63 1 0 0 0 0 61 64 2 0 0 0 0 59 65 1 0 0 0 0 31 65 1 0 0 0 0 65 66 1 6 0 0 0 M END 3D MOL for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))HMDB0278648 RDKit 3D PIP(PGE2/16:2(9Z,12Z)) 142143 0 0 0 0 0 0 0 0999 V2000 14.9890 -0.3421 3.5518 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7610 -1.3998 2.4996 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6158 -0.7302 1.1257 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4120 -1.7513 0.1018 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3775 -1.8682 -0.6714 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2260 -0.9379 -0.5995 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0344 -1.7949 -0.3084 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0337 -1.8267 -1.1697 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8907 -1.1269 -2.4243 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6770 -0.2772 -2.5415 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4513 0.8311 -1.6005 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2245 0.5200 -0.1595 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9722 1.7210 0.6760 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8578 2.6239 0.4565 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4457 2.3224 0.6137 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8293 1.3156 -0.2259 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3756 0.4733 -0.9355 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3950 1.2494 -0.2816 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7528 0.2612 -1.1037 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1527 0.9507 -2.3195 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4962 2.3226 -2.4012 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5974 3.3419 -2.5284 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9614 4.4279 -3.0310 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1894 3.2194 -2.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6299 4.4463 -2.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1241 4.1682 -2.2231 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6463 3.3159 -3.2966 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8998 2.8893 -3.2595 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7186 3.1209 -2.0799 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0586 1.9008 -1.2607 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2680 2.1611 -0.4198 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8953 3.1787 -0.6492 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6870 1.2394 0.6330 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6134 0.7509 1.5511 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8402 1.2215 2.8615 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7014 -0.7833 1.6785 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6422 -1.1195 2.7822 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7583 -1.8209 2.5927 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7285 -2.1858 3.6363 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6879 -1.2646 4.6735 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1133 -2.1879 2.9809 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4353 -0.8153 2.4243 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7967 -0.8010 1.7636 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8779 -1.1722 2.7695 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1947 -1.1312 2.0144 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3165 -1.3026 1.8555 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2532 -1.9543 3.0978 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8344 -2.1845 0.7526 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8658 -2.9105 0.1536 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6359 -4.5793 0.3116 P 0 0 0 0 0 5 0 0 0 0 0 0 -4.9268 -5.0746 1.6894 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5482 -5.3843 -0.8517 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9966 -4.9055 -0.0445 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0342 -1.4251 -0.3195 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7563 -1.9813 -0.4127 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6495 -0.8863 -1.0633 P 0 0 0 0 0 5 0 0 0 0 0 0 -0.9372 -0.8859 -2.5713 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7928 0.6344 -0.3931 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9538 -1.3755 -0.9103 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7768 -0.4848 -0.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7878 -1.4157 -1.6244 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2637 -2.3757 -2.5228 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8710 -0.0671 -2.2839 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7391 -0.2687 -3.6661 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2043 0.6348 -2.0542 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9195 0.8048 -3.2278 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2305 0.4460 3.4506 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9354 -0.8086 4.5506 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0153 0.0758 3.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8393 -1.9509 2.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6350 -2.0736 2.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9205 0.1106 1.1306 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6250 -0.2313 0.9065 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2116 -2.4964 -0.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3571 -2.6992 -1.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1569 -0.2964 -1.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3214 -0.2695 0.3062 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0396 -2.3670 0.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1867 -2.4902 -0.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7599 -0.4360 -2.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8830 -1.8654 -3.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7332 -0.9214 -2.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6503 0.1784 -3.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4090 1.4813 -1.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6116 1.4933 -1.9624 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5965 -0.3595 0.0273 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2636 0.1311 0.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0154 1.3347 1.7592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9652 2.3072 0.6501 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0487 3.5310 1.1755 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9550 3.1339 -0.5856 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8782 3.3182 0.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2912 2.0562 1.7272 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5132 -0.4303 -1.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5653 0.4750 -3.2263 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0873 0.7794 -2.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2137 3.1163 -0.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2841 2.2957 -2.4989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3453 5.3108 -1.8093 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4740 4.6790 -3.4884 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 3.7980 -1.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6146 5.1667 -2.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9657 3.0534 -4.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2745 2.3752 -4.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3374 3.9170 -1.4086 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7197 3.5227 -2.4252 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2134 1.7545 -0.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4957 1.7041 1.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1982 0.3408 0.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5913 1.0348 1.2949 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0296 1.0929 3.4180 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1840 -1.1205 0.7356 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4537 -0.7982 3.8198 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9583 -2.1462 1.5679 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5369 -3.2238 3.9708 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5137 -0.3729 4.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1248 -2.8791 2.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8345 -2.4907 3.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6706 -0.4429 1.7483 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4958 -0.1144 3.2982 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0400 0.2246 1.4105 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8814 -1.4907 0.9149 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7463 -2.2030 3.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9156 -0.4672 3.6101 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3402 -2.0723 1.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0425 -1.0819 2.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2973 -0.2597 1.3655 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5591 -0.4743 1.9457 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0479 -1.3146 3.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1395 -2.9302 1.1912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1685 -6.0010 -0.3697 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5151 -5.2608 0.7180 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9326 -0.3929 0.0599 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0934 0.6186 0.5503 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1746 0.2870 0.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3709 -0.9764 0.5560 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8595 -1.7412 -1.4814 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9657 -2.5604 -3.1863 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1175 0.5886 -1.8498 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9693 0.2691 -3.9646 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7967 -0.0635 -1.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1948 -0.0832 -3.5745 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 36 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 50 53 1 0 48 54 1 0 54 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 56 59 1 0 59 60 1 0 54 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 60 19 1 0 65 30 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 0 2 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 5 75 1 0 6 76 1 0 6 77 1 0 7 78 1 0 8 79 1 0 9 80 1 0 9 81 1 0 10 82 1 0 10 83 1 0 11 84 1 0 11 85 1 0 12 86 1 0 12 87 1 0 13 88 1 0 13 89 1 0 14 90 1 0 14 91 1 0 15 92 1 0 15 93 1 0 19 94 1 6 20 95 1 0 20 96 1 0 24 97 1 0 24 98 1 0 25 99 1 0 25100 1 0 26101 1 0 26102 1 0 27103 1 0 28104 1 0 29105 1 0 29106 1 0 30107 1 1 33108 1 0 33109 1 0 34110 1 6 35111 1 0 36112 1 6 37113 1 0 38114 1 0 39115 1 1 40116 1 0 41117 1 0 41118 1 0 42119 1 0 42120 1 0 43121 1 0 43122 1 0 44123 1 0 44124 1 0 45125 1 0 45126 1 0 45127 1 0 46128 1 1 47129 1 0 48130 1 1 52131 1 0 53132 1 0 54133 1 1 58134 1 0 60135 1 0 60136 1 0 61137 1 1 62138 1 0 63139 1 1 64140 1 0 65141 1 1 66142 1 0 M END 3D SDF for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))Mrv1652309132112292D 66 67 0 0 1 0 999 V2000 0.3000 0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5155 -0.0420 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7983 0.8552 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0160 1.1174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0848 1.6615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9090 1.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7272 2.4444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5662 3.2988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2172 3.6223 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 0.6099 4.3478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3349 4.2353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0533 3.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8076 3.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3808 2.4998 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6338 1.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0700 0.9837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5896 0.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3114 0.7394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8631 -0.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3491 -1.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5528 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8195 -1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9861 -1.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2159 -1.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5165 -0.8875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3097 -0.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0480 -0.9635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0644 0.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1704 0.5299 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3312 1.1850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6485 0.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2757 0.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0535 0.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6806 -0.0647 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5054 -0.0434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5301 -0.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7523 -1.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1251 -0.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3474 -0.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1968 -1.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0953 2.9123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8097 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8097 1.6748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5242 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2387 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9532 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6676 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3821 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0966 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8110 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5255 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 2.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 3.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 4.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 4.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 5.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2400 6.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9545 6.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0723 2.1298 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5014 2.8345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3261 2.8153 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 1.3069 1.9905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1046 2.5421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7954 2.1367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7198 1.5631 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5428 1.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 6 0 0 0 2 3 1 0 0 0 0 3 4 1 1 0 0 0 3 5 1 0 0 0 0 5 6 1 1 0 0 0 5 7 1 0 0 0 0 7 8 1 6 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 9 11 2 0 0 0 0 9 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 2 0 0 0 0 17 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 2 25 1 0 0 0 0 25 26 1 1 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 1 0 0 0 29 31 1 0 0 0 0 31 32 1 1 0 0 0 32 33 2 0 0 0 0 33 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 0 0 0 0 14 41 1 6 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 42 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 2 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 7 59 1 0 0 0 0 59 60 1 6 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 61 63 1 0 0 0 0 61 64 2 0 0 0 0 59 65 1 0 0 0 0 31 65 1 0 0 0 0 65 66 1 6 0 0 0 M END > <DATABASE_ID> HMDB0278648 > <DATABASE_NAME> hmdb > <SMILES> CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]2C\C=C/CCCC(=O)OC[C@H](COP(O)(=O)O[C@@H]([C@H](O)[C@@H](O)[C@@H]2O)[C@H](OP(O)(O)=O)[C@@H]1O)OC(=O)CCCCCCC\C=C/C\C=C/CCC > <INCHI_IDENTIFIER> InChI=1S/C45H76O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-22-26-39(50)62-33-30-60-38(49)25-21-18-17-20-24-34-36(47)29-37(48)35(28-27-32(46)23-19-6-4-2)41(52)44(63-65(55,56)57)45(43(54)42(53)40(34)51)64-66(58,59)61-31-33/h7-8,10-11,17,20,27-28,32-35,37,40-46,48,51-54H,3-6,9,12-16,18-19,21-26,29-31H2,1-2H3,(H,58,59)(H2,55,56,57)/b8-7-,11-10-,20-17-,28-27+/t32-,33+,34-,35-,37?,40+,41+,42-,43+,44+,45-/m0/s1 > <INCHI_KEY> IFXOOBRJSODCLR-APUGSBEWSA-N > <FORMULA> C45H76O19P2 > <MOLECULAR_WEIGHT> 983.032 > <EXACT_MASS> 982.445604223 > <JCHEM_ACCEPTOR_COUNT> 14 > <JCHEM_ATOM_COUNT> 142 > <JCHEM_AVERAGE_POLARIZABILITY> 100.62571609275767 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 9 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> {[(1S,6R,13Z,16R,19R,20S,21R,22R,23R,24S,25R)-6-[(9Z,12Z)-hexadeca-9,12-dienoyloxy]-3,19,21,23,24,25-hexahydroxy-20-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-3,9,17-trioxo-2,4,8-trioxa-3lambda5-phosphabicyclo[14.6.3]pentacos-13-en-22-yl]oxy}phosphonic acid > <ALOGPS_LOGP> 2.92 > <JCHEM_LOGP> 5.00098317166667 > <ALOGPS_LOGS> -3.44 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 2 > <JCHEM_PHYSIOLOGICAL_CHARGE> -3 > <JCHEM_PKA> 1.8950459059186695 > <JCHEM_PKA_STRONGEST_ACIDIC> 0.9561898376423494 > <JCHEM_PKA_STRONGEST_BASIC> -2.961664953146589 > <JCHEM_POLAR_SURFACE_AREA> 313.57 > <JCHEM_REFRACTIVITY> 246.0806000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 22 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 3.60e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> [(1S,6R,13Z,16R,19R,20S,21R,22R,23R,24S,25R)-6-[(9Z,12Z)-hexadeca-9,12-dienoyloxy]-3,19,21,23,24,25-hexahydroxy-20-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-3,9,17-trioxo-2,4,8-trioxa-3lambda5-phosphabicyclo[14.6.3]pentacos-13-en-22-yl]oxyphosphonic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))HMDB0278648 RDKit 3D PIP(PGE2/16:2(9Z,12Z)) 142143 0 0 0 0 0 0 0 0999 V2000 14.9890 -0.3421 3.5518 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7610 -1.3998 2.4996 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6158 -0.7302 1.1257 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4120 -1.7513 0.1018 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3775 -1.8682 -0.6714 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2260 -0.9379 -0.5995 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0344 -1.7949 -0.3084 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0337 -1.8267 -1.1697 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8907 -1.1269 -2.4243 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6770 -0.2772 -2.5415 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4513 0.8311 -1.6005 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2245 0.5200 -0.1595 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9722 1.7210 0.6760 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8578 2.6239 0.4565 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4457 2.3224 0.6137 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8293 1.3156 -0.2259 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3756 0.4733 -0.9355 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3950 1.2494 -0.2816 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7528 0.2612 -1.1037 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1527 0.9507 -2.3195 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4962 2.3226 -2.4012 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5974 3.3419 -2.5284 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9614 4.4279 -3.0310 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1894 3.2194 -2.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6299 4.4463 -2.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1241 4.1682 -2.2231 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6463 3.3159 -3.2966 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8998 2.8893 -3.2595 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7186 3.1209 -2.0799 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0586 1.9008 -1.2607 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2680 2.1611 -0.4198 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8953 3.1787 -0.6492 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6870 1.2394 0.6330 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6134 0.7509 1.5511 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8402 1.2215 2.8615 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7014 -0.7833 1.6785 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6422 -1.1195 2.7822 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7583 -1.8209 2.5927 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7285 -2.1858 3.6363 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6879 -1.2646 4.6735 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1133 -2.1879 2.9809 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4353 -0.8153 2.4243 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7967 -0.8010 1.7636 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8779 -1.1722 2.7695 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1947 -1.1312 2.0144 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3165 -1.3026 1.8555 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2532 -1.9543 3.0978 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8344 -2.1845 0.7526 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8658 -2.9105 0.1536 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6359 -4.5793 0.3116 P 0 0 0 0 0 5 0 0 0 0 0 0 -4.9268 -5.0746 1.6894 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5482 -5.3843 -0.8517 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9966 -4.9055 -0.0445 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0342 -1.4251 -0.3195 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7563 -1.9813 -0.4127 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6495 -0.8863 -1.0633 P 0 0 0 0 0 5 0 0 0 0 0 0 -0.9372 -0.8859 -2.5713 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7928 0.6344 -0.3931 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9538 -1.3755 -0.9103 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7768 -0.4848 -0.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7878 -1.4157 -1.6244 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2637 -2.3757 -2.5228 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8710 -0.0671 -2.2839 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7391 -0.2687 -3.6661 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2043 0.6348 -2.0542 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9195 0.8048 -3.2278 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2305 0.4460 3.4506 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9354 -0.8086 4.5506 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0153 0.0758 3.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8393 -1.9509 2.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6350 -2.0736 2.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9205 0.1106 1.1306 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6250 -0.2313 0.9065 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2116 -2.4964 -0.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3571 -2.6992 -1.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1569 -0.2964 -1.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3214 -0.2695 0.3062 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0396 -2.3670 0.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1867 -2.4902 -0.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7599 -0.4360 -2.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8830 -1.8654 -3.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7332 -0.9214 -2.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6503 0.1784 -3.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4090 1.4813 -1.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6116 1.4933 -1.9624 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5965 -0.3595 0.0273 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2636 0.1311 0.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0154 1.3347 1.7592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9652 2.3072 0.6501 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0487 3.5310 1.1755 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9550 3.1339 -0.5856 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8782 3.3182 0.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2912 2.0562 1.7272 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5132 -0.4303 -1.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5653 0.4750 -3.2263 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0873 0.7794 -2.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2137 3.1163 -0.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2841 2.2957 -2.4989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3453 5.3108 -1.8093 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4740 4.6790 -3.4884 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 3.7980 -1.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6146 5.1667 -2.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9657 3.0534 -4.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2745 2.3752 -4.1343 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3374 3.9170 -1.4086 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7197 3.5227 -2.4252 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2134 1.7545 -0.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4957 1.7041 1.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1982 0.3408 0.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5913 1.0348 1.2949 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0296 1.0929 3.4180 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1840 -1.1205 0.7356 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4537 -0.7982 3.8198 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9583 -2.1462 1.5679 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5369 -3.2238 3.9708 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5137 -0.3729 4.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1248 -2.8791 2.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8345 -2.4907 3.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6706 -0.4429 1.7483 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4958 -0.1144 3.2982 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0400 0.2246 1.4105 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8814 -1.4907 0.9149 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7463 -2.2030 3.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9156 -0.4672 3.6101 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3402 -2.0723 1.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0425 -1.0819 2.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2973 -0.2597 1.3655 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5591 -0.4743 1.9457 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0479 -1.3146 3.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1395 -2.9302 1.1912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1685 -6.0010 -0.3697 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5151 -5.2608 0.7180 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9326 -0.3929 0.0599 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0934 0.6186 0.5503 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1746 0.2870 0.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3709 -0.9764 0.5560 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8595 -1.7412 -1.4814 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9657 -2.5604 -3.1863 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1175 0.5886 -1.8498 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9693 0.2691 -3.9646 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7967 -0.0635 -1.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1948 -0.0832 -3.5745 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 36 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 50 53 1 0 48 54 1 0 54 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 56 59 1 0 59 60 1 0 54 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 60 19 1 0 65 30 1 0 1 67 1 0 1 68 1 0 1 69 1 0 2 70 1 0 2 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 5 75 1 0 6 76 1 0 6 77 1 0 7 78 1 0 8 79 1 0 9 80 1 0 9 81 1 0 10 82 1 0 10 83 1 0 11 84 1 0 11 85 1 0 12 86 1 0 12 87 1 0 13 88 1 0 13 89 1 0 14 90 1 0 14 91 1 0 15 92 1 0 15 93 1 0 19 94 1 6 20 95 1 0 20 96 1 0 24 97 1 0 24 98 1 0 25 99 1 0 25100 1 0 26101 1 0 26102 1 0 27103 1 0 28104 1 0 29105 1 0 29106 1 0 30107 1 1 33108 1 0 33109 1 0 34110 1 6 35111 1 0 36112 1 6 37113 1 0 38114 1 0 39115 1 1 40116 1 0 41117 1 0 41118 1 0 42119 1 0 42120 1 0 43121 1 0 43122 1 0 44123 1 0 44124 1 0 45125 1 0 45126 1 0 45127 1 0 46128 1 1 47129 1 0 48130 1 1 52131 1 0 53132 1 0 54133 1 1 58134 1 0 60135 1 0 60136 1 0 61137 1 1 62138 1 0 63139 1 1 64140 1 0 65141 1 1 66142 1 0 M END PDB for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))HEADER PROTEIN 13-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 13-SEP-21 0 HETATM 1 O UNK 0 0.560 0.155 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 -0.962 -0.078 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -1.490 1.596 0.000 0.00 0.00 C+0 HETATM 4 O UNK 0 -0.030 2.086 0.000 0.00 0.00 O+0 HETATM 5 C UNK 0 -2.025 3.101 0.000 0.00 0.00 C+0 HETATM 6 O UNK 0 -3.564 3.168 0.000 0.00 0.00 O+0 HETATM 7 C UNK 0 -1.358 4.563 0.000 0.00 0.00 C+0 HETATM 8 O UNK 0 -1.057 6.158 0.000 0.00 0.00 O+0 HETATM 9 P UNK 0 0.405 6.762 0.000 0.00 0.00 P+0 HETATM 10 O UNK 0 1.139 8.116 0.000 0.00 0.00 O+0 HETATM 11 O UNK 0 -0.625 7.906 0.000 0.00 0.00 O+0 HETATM 12 O UNK 0 1.966 6.518 0.000 0.00 0.00 O+0 HETATM 13 C UNK 0 3.374 5.839 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 4.444 4.666 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 4.916 3.180 0.000 0.00 0.00 C+0 HETATM 16 O UNK 0 5.731 1.836 0.000 0.00 0.00 O+0 HETATM 17 C UNK 0 6.701 0.634 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 8.048 1.380 0.000 0.00 0.00 O+0 HETATM 19 C UNK 0 7.211 -0.846 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 6.252 -2.067 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 4.765 -2.505 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 3.396 -3.227 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 1.841 -3.117 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 0.403 -2.481 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -0.964 -1.657 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -2.445 -1.111 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 -3.823 -1.799 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -1.987 0.406 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -0.318 0.989 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 0.618 2.212 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 1.211 1.367 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 2.381 0.366 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 3.833 0.880 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 5.004 -0.121 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 6.543 -0.081 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 4.723 -1.635 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 3.271 -2.149 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 2.100 -1.148 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 0.648 -1.662 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 0.367 -3.176 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 5.778 5.436 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 7.112 4.666 0.000 0.00 0.00 C+0 HETATM 43 O UNK 0 7.112 3.126 0.000 0.00 0.00 O+0 HETATM 44 C UNK 0 8.445 5.436 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 9.779 4.666 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 11.113 5.436 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 12.446 4.666 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 13.780 5.436 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 15.114 4.666 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 16.447 5.436 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 17.781 4.666 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 19.115 5.436 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 19.115 6.976 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 20.448 7.746 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 20.448 9.286 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 19.115 10.056 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 19.115 11.596 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 20.448 12.366 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 0.135 3.976 0.000 0.00 0.00 C+0 HETATM 60 O UNK 0 0.936 5.291 0.000 0.00 0.00 O+0 HETATM 61 P UNK 0 2.475 5.255 0.000 0.00 0.00 P+0 HETATM 62 O UNK 0 2.440 3.716 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 3.929 4.745 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 3.351 3.989 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 1.344 2.918 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 2.880 3.024 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 25 CONECT 3 2 4 5 CONECT 4 3 CONECT 5 3 6 7 CONECT 6 5 CONECT 7 5 8 59 CONECT 8 7 9 CONECT 9 8 10 11 12 CONECT 10 9 CONECT 11 9 CONECT 12 9 13 CONECT 13 12 14 CONECT 14 13 15 41 CONECT 15 14 16 CONECT 16 15 17 CONECT 17 16 18 19 CONECT 18 17 CONECT 19 17 20 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 23 CONECT 23 22 24 CONECT 24 23 25 CONECT 25 24 2 26 CONECT 26 25 27 28 CONECT 27 26 CONECT 28 26 29 CONECT 29 28 30 31 CONECT 30 29 CONECT 31 29 32 65 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 35 36 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 CONECT 41 14 42 CONECT 42 41 43 44 CONECT 43 42 CONECT 44 42 45 CONECT 45 44 46 CONECT 46 45 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 51 CONECT 51 50 52 CONECT 52 51 53 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 58 CONECT 58 57 CONECT 59 7 60 65 CONECT 60 59 61 CONECT 61 60 62 63 64 CONECT 62 61 CONECT 63 61 CONECT 64 61 CONECT 65 59 31 66 CONECT 66 65 MASTER 0 0 0 0 0 0 0 0 66 0 134 0 END 3D PDB for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))COMPND HMDB0278648 HETATM 1 C1 UNL 1 14.989 -0.342 3.552 1.00 0.00 C HETATM 2 C2 UNL 1 14.761 -1.400 2.500 1.00 0.00 C HETATM 3 C3 UNL 1 14.616 -0.730 1.126 1.00 0.00 C HETATM 4 C4 UNL 1 14.412 -1.751 0.102 1.00 0.00 C HETATM 5 C5 UNL 1 13.377 -1.868 -0.671 1.00 0.00 C HETATM 6 C6 UNL 1 12.226 -0.938 -0.599 1.00 0.00 C HETATM 7 C7 UNL 1 11.034 -1.795 -0.308 1.00 0.00 C HETATM 8 C8 UNL 1 10.034 -1.827 -1.170 1.00 0.00 C HETATM 9 C9 UNL 1 9.891 -1.127 -2.424 1.00 0.00 C HETATM 10 C10 UNL 1 8.677 -0.277 -2.541 1.00 0.00 C HETATM 11 C11 UNL 1 8.451 0.831 -1.601 1.00 0.00 C HETATM 12 C12 UNL 1 8.224 0.520 -0.160 1.00 0.00 C HETATM 13 C13 UNL 1 7.972 1.721 0.676 1.00 0.00 C HETATM 14 C14 UNL 1 6.858 2.624 0.457 1.00 0.00 C HETATM 15 C15 UNL 1 5.446 2.322 0.614 1.00 0.00 C HETATM 16 C16 UNL 1 4.829 1.316 -0.226 1.00 0.00 C HETATM 17 O1 UNL 1 5.376 0.473 -0.936 1.00 0.00 O HETATM 18 O2 UNL 1 3.395 1.249 -0.282 1.00 0.00 O HETATM 19 C17 UNL 1 2.753 0.261 -1.104 1.00 0.00 C HETATM 20 C18 UNL 1 2.153 0.951 -2.320 1.00 0.00 C HETATM 21 O3 UNL 1 2.496 2.323 -2.401 1.00 0.00 O HETATM 22 C19 UNL 1 1.597 3.342 -2.528 1.00 0.00 C HETATM 23 O4 UNL 1 1.961 4.428 -3.031 1.00 0.00 O HETATM 24 C20 UNL 1 0.189 3.219 -2.092 1.00 0.00 C HETATM 25 C21 UNL 1 -0.630 4.446 -2.419 1.00 0.00 C HETATM 26 C22 UNL 1 -2.124 4.168 -2.223 1.00 0.00 C HETATM 27 C23 UNL 1 -2.646 3.316 -3.297 1.00 0.00 C HETATM 28 C24 UNL 1 -3.900 2.889 -3.259 1.00 0.00 C HETATM 29 C25 UNL 1 -4.719 3.121 -2.080 1.00 0.00 C HETATM 30 C26 UNL 1 -5.059 1.901 -1.261 1.00 0.00 C HETATM 31 C27 UNL 1 -6.268 2.161 -0.420 1.00 0.00 C HETATM 32 O5 UNL 1 -6.895 3.179 -0.649 1.00 0.00 O HETATM 33 C28 UNL 1 -6.687 1.239 0.633 1.00 0.00 C HETATM 34 C29 UNL 1 -5.613 0.751 1.551 1.00 0.00 C HETATM 35 O6 UNL 1 -5.840 1.222 2.861 1.00 0.00 O HETATM 36 C30 UNL 1 -5.701 -0.783 1.678 1.00 0.00 C HETATM 37 C31 UNL 1 -6.642 -1.120 2.782 1.00 0.00 C HETATM 38 C32 UNL 1 -7.758 -1.821 2.593 1.00 0.00 C HETATM 39 C33 UNL 1 -8.729 -2.186 3.636 1.00 0.00 C HETATM 40 O7 UNL 1 -8.688 -1.265 4.673 1.00 0.00 O HETATM 41 C34 UNL 1 -10.113 -2.188 2.981 1.00 0.00 C HETATM 42 C35 UNL 1 -10.435 -0.815 2.424 1.00 0.00 C HETATM 43 C36 UNL 1 -11.797 -0.801 1.764 1.00 0.00 C HETATM 44 C37 UNL 1 -12.878 -1.172 2.769 1.00 0.00 C HETATM 45 C38 UNL 1 -14.195 -1.131 2.014 1.00 0.00 C HETATM 46 C39 UNL 1 -4.316 -1.303 1.856 1.00 0.00 C HETATM 47 O8 UNL 1 -4.253 -1.954 3.098 1.00 0.00 O HETATM 48 C40 UNL 1 -3.834 -2.184 0.753 1.00 0.00 C HETATM 49 O9 UNL 1 -4.866 -2.910 0.154 1.00 0.00 O HETATM 50 P1 UNL 1 -4.636 -4.579 0.312 1.00 0.00 P HETATM 51 O10 UNL 1 -4.927 -5.075 1.689 1.00 0.00 O HETATM 52 O11 UNL 1 -5.548 -5.384 -0.852 1.00 0.00 O HETATM 53 O12 UNL 1 -2.997 -4.906 -0.044 1.00 0.00 O HETATM 54 C41 UNL 1 -3.034 -1.425 -0.320 1.00 0.00 C HETATM 55 O13 UNL 1 -1.756 -1.981 -0.413 1.00 0.00 O HETATM 56 P2 UNL 1 -0.650 -0.886 -1.063 1.00 0.00 P HETATM 57 O14 UNL 1 -0.937 -0.886 -2.571 1.00 0.00 O HETATM 58 O15 UNL 1 -0.793 0.634 -0.393 1.00 0.00 O HETATM 59 O16 UNL 1 0.954 -1.375 -0.910 1.00 0.00 O HETATM 60 C42 UNL 1 1.777 -0.485 -0.274 1.00 0.00 C HETATM 61 C43 UNL 1 -3.788 -1.416 -1.624 1.00 0.00 C HETATM 62 O17 UNL 1 -3.264 -2.376 -2.523 1.00 0.00 O HETATM 63 C44 UNL 1 -3.871 -0.067 -2.284 1.00 0.00 C HETATM 64 O18 UNL 1 -3.739 -0.269 -3.666 1.00 0.00 O HETATM 65 C45 UNL 1 -5.204 0.635 -2.054 1.00 0.00 C HETATM 66 O19 UNL 1 -5.920 0.805 -3.228 1.00 0.00 O HETATM 67 H1 UNL 1 14.231 0.446 3.451 1.00 0.00 H HETATM 68 H2 UNL 1 14.935 -0.809 4.551 1.00 0.00 H HETATM 69 H3 UNL 1 16.015 0.076 3.449 1.00 0.00 H HETATM 70 H4 UNL 1 13.839 -1.951 2.759 1.00 0.00 H HETATM 71 H5 UNL 1 15.635 -2.074 2.454 1.00 0.00 H HETATM 72 H6 UNL 1 13.921 0.111 1.131 1.00 0.00 H HETATM 73 H7 UNL 1 15.625 -0.231 0.907 1.00 0.00 H HETATM 74 H8 UNL 1 15.212 -2.496 -0.032 1.00 0.00 H HETATM 75 H9 UNL 1 13.357 -2.699 -1.417 1.00 0.00 H HETATM 76 H10 UNL 1 12.157 -0.296 -1.462 1.00 0.00 H HETATM 77 H11 UNL 1 12.321 -0.270 0.306 1.00 0.00 H HETATM 78 H12 UNL 1 11.040 -2.367 0.612 1.00 0.00 H HETATM 79 H13 UNL 1 9.187 -2.490 -0.875 1.00 0.00 H HETATM 80 H14 UNL 1 10.760 -0.436 -2.639 1.00 0.00 H HETATM 81 H15 UNL 1 9.883 -1.865 -3.302 1.00 0.00 H HETATM 82 H16 UNL 1 7.733 -0.921 -2.537 1.00 0.00 H HETATM 83 H17 UNL 1 8.650 0.178 -3.596 1.00 0.00 H HETATM 84 H18 UNL 1 9.409 1.481 -1.669 1.00 0.00 H HETATM 85 H19 UNL 1 7.612 1.493 -1.962 1.00 0.00 H HETATM 86 H20 UNL 1 7.596 -0.360 0.027 1.00 0.00 H HETATM 87 H21 UNL 1 9.264 0.131 0.196 1.00 0.00 H HETATM 88 H22 UNL 1 8.015 1.335 1.759 1.00 0.00 H HETATM 89 H23 UNL 1 8.965 2.307 0.650 1.00 0.00 H HETATM 90 H24 UNL 1 7.049 3.531 1.176 1.00 0.00 H HETATM 91 H25 UNL 1 6.955 3.134 -0.586 1.00 0.00 H HETATM 92 H26 UNL 1 4.878 3.318 0.533 1.00 0.00 H HETATM 93 H27 UNL 1 5.291 2.056 1.727 1.00 0.00 H HETATM 94 H28 UNL 1 3.513 -0.430 -1.513 1.00 0.00 H HETATM 95 H29 UNL 1 2.565 0.475 -3.226 1.00 0.00 H HETATM 96 H30 UNL 1 1.087 0.779 -2.315 1.00 0.00 H HETATM 97 H31 UNL 1 0.214 3.116 -0.992 1.00 0.00 H HETATM 98 H32 UNL 1 -0.284 2.296 -2.499 1.00 0.00 H HETATM 99 H33 UNL 1 -0.345 5.311 -1.809 1.00 0.00 H HETATM 100 H34 UNL 1 -0.474 4.679 -3.488 1.00 0.00 H HETATM 101 H35 UNL 1 -2.320 3.798 -1.198 1.00 0.00 H HETATM 102 H36 UNL 1 -2.615 5.167 -2.296 1.00 0.00 H HETATM 103 H37 UNL 1 -1.966 3.053 -4.116 1.00 0.00 H HETATM 104 H38 UNL 1 -4.275 2.375 -4.134 1.00 0.00 H HETATM 105 H39 UNL 1 -4.337 3.917 -1.409 1.00 0.00 H HETATM 106 H40 UNL 1 -5.720 3.523 -2.425 1.00 0.00 H HETATM 107 H41 UNL 1 -4.213 1.754 -0.557 1.00 0.00 H HETATM 108 H42 UNL 1 -7.496 1.704 1.246 1.00 0.00 H HETATM 109 H43 UNL 1 -7.198 0.341 0.174 1.00 0.00 H HETATM 110 H44 UNL 1 -4.591 1.035 1.295 1.00 0.00 H HETATM 111 H45 UNL 1 -5.030 1.093 3.418 1.00 0.00 H HETATM 112 H46 UNL 1 -6.184 -1.121 0.736 1.00 0.00 H HETATM 113 H47 UNL 1 -6.454 -0.798 3.820 1.00 0.00 H HETATM 114 H48 UNL 1 -7.958 -2.146 1.568 1.00 0.00 H HETATM 115 H49 UNL 1 -8.537 -3.224 3.971 1.00 0.00 H HETATM 116 H50 UNL 1 -8.514 -0.373 4.254 1.00 0.00 H HETATM 117 H51 UNL 1 -10.125 -2.879 2.121 1.00 0.00 H HETATM 118 H52 UNL 1 -10.834 -2.491 3.756 1.00 0.00 H HETATM 119 H53 UNL 1 -9.671 -0.443 1.748 1.00 0.00 H HETATM 120 H54 UNL 1 -10.496 -0.114 3.298 1.00 0.00 H HETATM 121 H55 UNL 1 -12.040 0.225 1.411 1.00 0.00 H HETATM 122 H56 UNL 1 -11.881 -1.491 0.915 1.00 0.00 H HETATM 123 H57 UNL 1 -12.746 -2.203 3.141 1.00 0.00 H HETATM 124 H58 UNL 1 -12.916 -0.467 3.610 1.00 0.00 H HETATM 125 H59 UNL 1 -14.340 -2.072 1.443 1.00 0.00 H HETATM 126 H60 UNL 1 -15.043 -1.082 2.753 1.00 0.00 H HETATM 127 H61 UNL 1 -14.297 -0.260 1.366 1.00 0.00 H HETATM 128 H62 UNL 1 -3.559 -0.474 1.946 1.00 0.00 H HETATM 129 H63 UNL 1 -4.048 -1.315 3.829 1.00 0.00 H HETATM 130 H64 UNL 1 -3.139 -2.930 1.191 1.00 0.00 H HETATM 131 H65 UNL 1 -6.168 -6.001 -0.370 1.00 0.00 H HETATM 132 H66 UNL 1 -2.515 -5.261 0.718 1.00 0.00 H HETATM 133 H67 UNL 1 -2.933 -0.393 0.060 1.00 0.00 H HETATM 134 H68 UNL 1 -1.093 0.619 0.550 1.00 0.00 H HETATM 135 H69 UNL 1 1.175 0.287 0.291 1.00 0.00 H HETATM 136 H70 UNL 1 2.371 -0.976 0.556 1.00 0.00 H HETATM 137 H71 UNL 1 -4.859 -1.741 -1.481 1.00 0.00 H HETATM 138 H72 UNL 1 -3.966 -2.560 -3.186 1.00 0.00 H HETATM 139 H73 UNL 1 -3.117 0.589 -1.850 1.00 0.00 H HETATM 140 H74 UNL 1 -2.969 0.269 -3.965 1.00 0.00 H HETATM 141 H75 UNL 1 -5.797 -0.063 -1.415 1.00 0.00 H HETATM 142 H76 UNL 1 -6.195 -0.083 -3.575 1.00 0.00 H CONECT 1 2 67 68 69 CONECT 2 3 70 71 CONECT 3 4 72 73 CONECT 4 5 5 74 CONECT 5 6 75 CONECT 6 7 76 77 CONECT 7 8 8 78 CONECT 8 9 79 CONECT 9 10 80 81 CONECT 10 11 82 83 CONECT 11 12 84 85 CONECT 12 13 86 87 CONECT 13 14 88 89 CONECT 14 15 90 91 CONECT 15 16 92 93 CONECT 16 17 17 18 CONECT 18 19 CONECT 19 20 60 94 CONECT 20 21 95 96 CONECT 21 22 CONECT 22 23 23 24 CONECT 24 25 97 98 CONECT 25 26 99 100 CONECT 26 27 101 102 CONECT 27 28 28 103 CONECT 28 29 104 CONECT 29 30 105 106 CONECT 30 31 65 107 CONECT 31 32 32 33 CONECT 33 34 108 109 CONECT 34 35 36 110 CONECT 35 111 CONECT 36 37 46 112 CONECT 37 38 38 113 CONECT 38 39 114 CONECT 39 40 41 115 CONECT 40 116 CONECT 41 42 117 118 CONECT 42 43 119 120 CONECT 43 44 121 122 CONECT 44 45 123 124 CONECT 45 125 126 127 CONECT 46 47 48 128 CONECT 47 129 CONECT 48 49 54 130 CONECT 49 50 CONECT 50 51 51 52 53 CONECT 52 131 CONECT 53 132 CONECT 54 55 61 133 CONECT 55 56 CONECT 56 57 57 58 59 CONECT 58 134 CONECT 59 60 CONECT 60 135 136 CONECT 61 62 63 137 CONECT 62 138 CONECT 63 64 65 139 CONECT 64 140 CONECT 65 66 141 CONECT 66 142 END SMILES for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]2C\C=C/CCCC(=O)OC[C@H](COP(O)(=O)O[C@@H]([C@H](O)[C@@H](O)[C@@H]2O)[C@H](OP(O)(O)=O)[C@@H]1O)OC(=O)CCCCCCC\C=C/C\C=C/CCC INCHI for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z)))InChI=1S/C45H76O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-22-26-39(50)62-33-30-60-38(49)25-21-18-17-20-24-34-36(47)29-37(48)35(28-27-32(46)23-19-6-4-2)41(52)44(63-65(55,56)57)45(43(54)42(53)40(34)51)64-66(58,59)61-31-33/h7-8,10-11,17,20,27-28,32-35,37,40-46,48,51-54H,3-6,9,12-16,18-19,21-26,29-31H2,1-2H3,(H,58,59)(H2,55,56,57)/b8-7-,11-10-,20-17-,28-27+/t32-,33+,34-,35-,37?,40+,41+,42-,43+,44+,45-/m0/s1 3D Structure for HMDB0278648 (PIP(PGE2/16:2(9Z,12Z))) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C45H76O19P2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 983.032 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 982.445604223 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | {[(1S,6R,13Z,16R,19R,20S,21R,22R,23R,24S,25R)-6-[(9Z,12Z)-hexadeca-9,12-dienoyloxy]-3,19,21,23,24,25-hexahydroxy-20-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-3,9,17-trioxo-2,4,8-trioxa-3lambda5-phosphabicyclo[14.6.3]pentacos-13-en-22-yl]oxy}phosphonic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | [(1S,6R,13Z,16R,19R,20S,21R,22R,23R,24S,25R)-6-[(9Z,12Z)-hexadeca-9,12-dienoyloxy]-3,19,21,23,24,25-hexahydroxy-20-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-3,9,17-trioxo-2,4,8-trioxa-3lambda5-phosphabicyclo[14.6.3]pentacos-13-en-22-yl]oxyphosphonic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]2C\C=C/CCCC(=O)OC[C@H](COP(O)(=O)O[C@@H]([C@H](O)[C@@H](O)[C@@H]2O)[C@H](OP(O)(O)=O)[C@@H]1O)OC(=O)CCCCCCC\C=C/C\C=C/CCC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C45H76O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-22-26-39(50)62-33-30-60-38(49)25-21-18-17-20-24-34-36(47)29-37(48)35(28-27-32(46)23-19-6-4-2)41(52)44(63-65(55,56)57)45(43(54)42(53)40(34)51)64-66(58,59)61-31-33/h7-8,10-11,17,20,27-28,32-35,37,40-46,48,51-54H,3-6,9,12-16,18-19,21-26,29-31H2,1-2H3,(H,58,59)(H2,55,56,57)/b8-7-,11-10-,20-17-,28-27+/t32-,33+,34-,35-,37?,40+,41+,42-,43+,44+,45-/m0/s1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | IFXOOBRJSODCLR-APUGSBEWSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Health effect
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Naturally occurring process
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |