Showing metabocard for PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) (HMDB0280770)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Predicted | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-13 15:16:28 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-11-30 20:02:50 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0280770 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) is an oxidized phosphatidylinositol phosphate (PIP). As other PIPs, oxidized phosphatidylinositol phosphates are acidic (anionic) phospholipids that consist of a phosphatidic acid backbone, linked via the phosphate group to a phosphorylated inositol (hexahydroxycyclohexane). Phosphatidylinositol phosphates are generated from phosphatidylinositols, which are phosphorylated by a number of different kinases that place the phosphate moiety on positions 4 and 5 of the inositol ring, although position 3 can also be phosphorylated. Phosphatidylinositol phosphates can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)), in particular, consists of one chain of Lipoxin A5 at the C-1 position and one chain of 7Z,10Z,13Z,16Z,19Z-docosapentaenoyl at the C-2 position. The most important phosphatidylinositol phosphate in both quantitative and biological terms is phosphatidylinositol 4-phosphate. Phosphatidylinositol and the phosphatidylinositol phosphates are the main source of diacylglycerols that serve as signaling molecules, via the action of phospholipase C enzymes. Phosphatidylinositol phosphates are usually present at low levels only in tissues, typically at about 1 to 3% of the concentration of phosphatidylinositol. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) Mrv1652309132117162D 73 73 0 0 1 0 999 V2000 -3.3659 0.3605 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0760 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7861 0.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9557 -0.3495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7764 -0.3495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6557 0.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9457 0.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0085 0.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7560 0.6437 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 -1.1177 0.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7560 1.3914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7517 0.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4486 1.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7717 -0.1685 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0764 0.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3830 -0.1685 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0566 1.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6564 0.7973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0725 1.2225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2300 1.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2911 0.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7412 0.8366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4140 0.4301 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 5.4140 1.2502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0039 -0.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2060 0.2178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4962 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4962 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2104 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9245 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6387 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3528 0.7694 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3528 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0669 0.3563 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0669 -0.4152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7811 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6061 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3202 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1453 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8594 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5735 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2877 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.0018 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.7159 0.7694 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.7159 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.4301 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.1442 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.9693 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.6834 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.3975 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5202 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5202 -1.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2343 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9485 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6626 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3768 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0909 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8051 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6301 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3442 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0583 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8833 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5975 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3116 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1367 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.8508 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.5649 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.3899 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.1041 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.8182 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.6433 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.3574 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -20.0715 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 5 1 0 0 0 0 1 4 1 1 0 0 0 2 3 1 0 0 0 0 3 27 1 0 0 0 0 6 1 1 0 0 0 0 7 6 1 0 0 0 0 7 9 1 0 0 0 0 9 8 1 0 0 0 0 9 10 1 0 0 0 0 9 11 2 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 12 20 1 0 0 0 0 13 14 1 0 0 0 0 13 18 1 0 0 0 0 14 15 1 0 0 0 0 14 8 1 1 0 0 0 15 19 1 0 0 0 0 16 17 1 0 0 0 0 16 15 1 0 0 0 0 16 21 1 1 0 0 0 17 22 1 0 0 0 0 21 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 23 26 1 0 0 0 0 27 28 2 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 0 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 2 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 43 44 1 0 0 0 0 44 45 1 1 0 0 0 44 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 51 5 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 2 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 2 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 2 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 2 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 M END 3D MOL for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))HMDB0280770 RDKit 3D PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) 152152 0 0 0 0 0 0 0 0999 V2000 10.7348 -6.5952 0.0309 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6116 -5.7555 -0.6075 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3503 -6.4966 -0.5078 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2507 -6.1966 0.1055 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9532 -5.0063 0.8959 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9637 -4.0106 1.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8696 -2.7696 0.7023 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7237 -2.2460 -0.0908 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1894 -1.7181 -1.3778 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1138 -0.4998 -1.8156 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5545 0.6742 -1.1493 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0377 0.6181 0.1951 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8398 0.8586 0.6554 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6264 1.2665 -0.0154 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5681 1.5618 -1.4126 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8566 0.9098 -2.2923 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9664 -0.2556 -2.0564 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4262 -1.4393 -2.8428 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5962 -2.6848 -2.7114 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2034 -2.4013 -3.1395 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7475 -3.5324 -3.1831 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0369 -4.2979 -2.0045 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3717 -5.3776 -1.8113 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9792 -3.9941 -1.0419 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1985 -4.8587 0.0435 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6221 -5.3905 0.0152 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6296 -4.4872 0.2222 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9740 -3.3283 -0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2621 -2.9107 -1.3161 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1430 -2.4644 -0.0014 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9730 -1.0608 -0.5648 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1795 -0.2805 -0.2158 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1654 1.1765 -0.6184 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9691 1.3421 -1.9670 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2108 1.9421 0.2284 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9120 1.5439 -0.0436 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4137 3.3669 0.3456 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7332 4.3013 -0.2491 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6441 4.0252 -1.1454 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9614 4.9992 -1.7068 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2478 6.3916 -1.4711 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4804 7.3205 -2.0931 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7032 8.7465 -1.9101 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9276 9.6121 -2.5328 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1068 11.0884 -2.3875 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9932 11.6741 -3.6469 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9427 11.6081 -1.5373 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6334 11.3392 -2.1489 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3064 10.6254 -1.5739 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2019 9.9965 -0.2578 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2979 10.5445 0.6755 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9050 -4.2214 1.3988 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1689 -5.1727 2.3589 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9674 -4.7651 3.9388 P 0 0 0 0 0 5 0 0 0 0 0 0 -3.3605 -4.5301 4.5503 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2866 -6.0463 4.8530 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1000 -3.3609 4.2461 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8156 -2.1934 4.1112 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1323 -1.5639 5.4635 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 -2.4254 6.3135 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8813 -0.2899 5.2179 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1944 0.8309 5.7218 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2672 -0.0916 3.7711 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8925 1.1505 3.6666 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1215 -0.1475 2.8330 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5406 1.0770 2.5190 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3616 1.2666 0.8423 P 0 0 0 0 0 5 0 0 0 0 0 0 0.1006 1.1970 0.4315 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0202 2.7057 0.2768 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1875 -0.0146 0.0724 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0652 -1.1324 3.3405 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2072 -0.5148 4.2468 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7015 -6.1658 -0.2717 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5976 -7.6563 -0.2356 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6335 -6.4100 1.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6898 -4.7608 -0.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8364 -5.7382 -1.7493 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3404 -7.4876 -1.0565 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4066 -6.9535 0.0187 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7399 -5.4575 1.9746 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9214 -4.6319 0.6689 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8752 -4.2223 1.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6648 -2.0351 0.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0863 -1.6489 0.5319 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1462 -3.1962 -0.4017 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6733 -2.5076 -2.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5473 -0.3367 -2.8621 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8542 1.1895 -1.8894 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4374 1.4523 -1.1913 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8128 0.3681 0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7181 0.7210 1.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2541 2.1826 0.6064 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8116 0.5168 0.2682 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1190 2.4454 -1.8066 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8857 1.2255 -3.3653 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9447 0.0355 -2.4636 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8117 -0.4917 -1.0082 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4694 -1.1654 -3.9360 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4995 -1.6647 -2.5704 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6531 -3.0142 -1.6497 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0916 -3.4565 -3.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2700 -1.9950 -4.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1775 -1.5517 -2.5098 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7385 -3.1231 -3.5654 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4364 -4.2223 -4.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5226 -5.7218 -0.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7085 -5.9727 -0.9331 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6971 -6.1731 0.8219 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0255 -2.9096 -0.5071 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3363 -2.4762 1.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9995 -0.6420 -0.3427 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9933 -1.2080 -1.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4022 -0.3936 0.8728 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0445 -0.7366 -0.7827 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2303 1.5940 -0.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8287 0.4923 -2.4536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4590 1.5440 1.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4418 1.5941 0.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2399 3.7182 1.0094 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0210 5.3574 -0.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3533 2.9858 -1.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1400 4.6858 -2.3804 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0177 6.7908 -0.8435 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6999 6.9258 -2.7251 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4865 9.1160 -1.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1294 9.2711 -3.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0397 11.3574 -1.8701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9213 12.6469 -3.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0130 12.7333 -1.4655 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0594 11.2660 -0.4969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4251 11.7501 -3.1363 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2644 10.4730 -2.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5144 8.9160 -0.4069 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7712 9.9621 0.2135 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9902 11.4768 1.1628 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5337 9.7449 1.4058 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2133 10.6698 0.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6501 -3.4069 1.5035 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8852 -3.8394 1.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3156 -5.8646 4.8822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7839 -2.4110 3.6461 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1456 -1.2900 5.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7804 -2.3972 6.2446 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8301 -0.3451 5.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9056 1.5268 5.8836 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0542 -0.8599 3.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6046 1.1485 4.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4648 -0.6002 1.8691 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6721 2.9367 -0.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4356 0.2192 -0.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4865 -1.5806 2.5264 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0744 0.3946 3.9694 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 1 0 25 52 1 0 52 53 1 0 53 54 1 0 54 55 2 0 54 56 1 0 54 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 67 70 1 0 65 71 1 0 71 72 1 0 71 58 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 4 79 1 0 5 80 1 0 5 81 1 0 6 82 1 0 7 83 1 0 8 84 1 0 8 85 1 0 9 86 1 0 10 87 1 0 11 88 1 0 11 89 1 0 12 90 1 0 13 91 1 0 14 92 1 0 14 93 1 0 15 94 1 0 16 95 1 0 17 96 1 0 17 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 19101 1 0 20102 1 0 20103 1 0 21104 1 0 21105 1 0 25106 1 6 26107 1 0 26108 1 0 30109 1 0 30110 1 0 31111 1 0 31112 1 0 32113 1 0 32114 1 0 33115 1 1 34116 1 0 35117 1 1 36118 1 0 37119 1 0 38120 1 0 39121 1 0 40122 1 0 41123 1 0 42124 1 0 43125 1 0 44126 1 0 45127 1 1 46128 1 0 47129 1 0 47130 1 0 48131 1 0 49132 1 0 50133 1 0 50134 1 0 51135 1 0 51136 1 0 51137 1 0 52138 1 0 52139 1 0 56140 1 0 58141 1 6 59142 1 0 60143 1 0 61144 1 0 62145 1 0 63146 1 0 64147 1 0 65148 1 6 69149 1 0 70150 1 0 71151 1 0 72152 1 0 M END 3D SDF for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) Mrv1652309132117162D 73 73 0 0 1 0 999 V2000 -3.3659 0.3605 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0760 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7861 0.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9557 -0.3495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7764 -0.3495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6557 0.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9457 0.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0085 0.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7560 0.6437 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 -1.1177 0.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7560 1.3914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7517 0.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4486 1.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7717 -0.1685 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0764 0.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3830 -0.1685 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0566 1.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6564 0.7973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0725 1.2225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2300 1.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2911 0.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7412 0.8366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4140 0.4301 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 5.4140 1.2502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0039 -0.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2060 0.2178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4962 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4962 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2104 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9245 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6387 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3528 0.7694 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3528 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0669 0.3563 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0669 -0.4152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7811 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6061 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3202 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1453 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8594 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5735 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2877 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.0018 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.7159 0.7694 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.7159 1.5408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.4301 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.1442 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.9693 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.6834 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.3975 0.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5202 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5202 -1.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2343 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9485 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6626 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3768 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0909 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8051 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6301 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3442 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0583 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8833 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5975 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3116 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.1367 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.8508 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.5649 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.3899 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.1041 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.8182 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.6433 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.3574 -0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -20.0715 -0.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 5 1 0 0 0 0 1 4 1 1 0 0 0 2 3 1 0 0 0 0 3 27 1 0 0 0 0 6 1 1 0 0 0 0 7 6 1 0 0 0 0 7 9 1 0 0 0 0 9 8 1 0 0 0 0 9 10 1 0 0 0 0 9 11 2 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 12 20 1 0 0 0 0 13 14 1 0 0 0 0 13 18 1 0 0 0 0 14 15 1 0 0 0 0 14 8 1 1 0 0 0 15 19 1 0 0 0 0 16 17 1 0 0 0 0 16 15 1 0 0 0 0 16 21 1 1 0 0 0 17 22 1 0 0 0 0 21 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 23 26 1 0 0 0 0 27 28 2 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 0 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 2 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 43 44 1 0 0 0 0 44 45 1 1 0 0 0 44 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 51 5 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 2 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 2 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 2 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 2 0 0 0 0 71 72 1 0 0 0 0 72 73 1 0 0 0 0 M END > <DATABASE_ID> HMDB0280770 > <DATABASE_NAME> hmdb > <SMILES> [H][C@@](COC(=O)CCC[C@H](O)[C@@H](O)\C=C/C=C\C=C\C=C\[C@H](O)C\C=C/CC)(COP(O)(=O)O[C@H]1C(O)C(O)C(O)[C@@H](OP(O)(O)=O)C1O)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC > <INCHI_IDENTIFIER> InChI=1S/C51H80O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-30-36-45(56)68-41(39-67-72(64,65)70-51-48(59)46(57)47(58)50(49(51)60)69-71(61,62)63)38-66-44(55)37-31-35-43(54)42(53)34-29-25-23-22-24-28-33-40(52)32-27-6-4-2/h5-7,9-10,12-13,15-16,18-19,22-25,27-29,33-34,40-43,46-54,57-60H,3-4,8,11,14,17,20-21,26,30-32,35-39H2,1-2H3,(H,64,65)(H2,61,62,63)/b7-5-,10-9-,13-12-,16-15-,19-18-,24-22+,25-23-,27-6-,33-28+,34-29-/t40-,41-,42+,43+,46?,47?,48?,49?,50-,51+/m1/s1 > <INCHI_KEY> CNIKIMNSVXYEHG-LGOADCTCSA-N > <FORMULA> C51H80O19P2 > <MOLECULAR_WEIGHT> 1059.13 > <EXACT_MASS> 1058.476904352 > <JCHEM_ACCEPTOR_COUNT> 14 > <JCHEM_ATOM_COUNT> 152 > <JCHEM_AVERAGE_POLARIZABILITY> 111.83673919059943 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> {[(1R,3S)-3-({[(2R)-2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]-3-{[(5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoyl]oxy}propoxy](hydroxy)phosphoryl}oxy)-2,4,5,6-tetrahydroxycyclohexyl]oxy}phosphonic acid > <ALOGPS_LOGP> 5.20 > <JCHEM_LOGP> 6.160434200999999 > <ALOGPS_LOGS> -4.92 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 1 > <JCHEM_PHYSIOLOGICAL_CHARGE> -3 > <JCHEM_PKA> 1.9166523977719692 > <JCHEM_PKA_STRONGEST_ACIDIC> 1.0756803469745693 > <JCHEM_PKA_STRONGEST_BASIC> -3.311846593928304 > <JCHEM_POLAR_SURFACE_AREA> 316.72999999999996 > <JCHEM_REFRACTIVITY> 283.00919999999996 > <JCHEM_ROTATABLE_BOND_COUNT> 40 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.26e-02 g/l > <JCHEM_TRADITIONAL_IUPAC> [(1R,3S)-3-{[(2R)-2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]-3-{[(5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoyl]oxy}propoxy(hydroxy)phosphoryl]oxy}-2,4,5,6-tetrahydroxycyclohexyl]oxyphosphonic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))HMDB0280770 RDKit 3D PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)) 152152 0 0 0 0 0 0 0 0999 V2000 10.7348 -6.5952 0.0309 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6116 -5.7555 -0.6075 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3503 -6.4966 -0.5078 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2507 -6.1966 0.1055 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9532 -5.0063 0.8959 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9637 -4.0106 1.1385 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8696 -2.7696 0.7023 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7237 -2.2460 -0.0908 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1894 -1.7181 -1.3778 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1138 -0.4998 -1.8156 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5545 0.6742 -1.1493 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0377 0.6181 0.1951 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8398 0.8586 0.6554 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6264 1.2665 -0.0154 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5681 1.5618 -1.4126 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8566 0.9098 -2.2923 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9664 -0.2556 -2.0564 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4262 -1.4393 -2.8428 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5962 -2.6848 -2.7114 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2034 -2.4013 -3.1395 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7475 -3.5324 -3.1831 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0369 -4.2979 -2.0045 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3717 -5.3776 -1.8113 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9792 -3.9941 -1.0419 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1985 -4.8587 0.0435 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6221 -5.3905 0.0152 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6296 -4.4872 0.2222 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9740 -3.3283 -0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2621 -2.9107 -1.3161 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1430 -2.4644 -0.0014 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9730 -1.0608 -0.5648 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1795 -0.2805 -0.2158 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1654 1.1765 -0.6184 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9691 1.3421 -1.9670 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2108 1.9421 0.2284 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9120 1.5439 -0.0436 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4137 3.3669 0.3456 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7332 4.3013 -0.2491 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6441 4.0252 -1.1454 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9614 4.9992 -1.7068 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2478 6.3916 -1.4711 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4804 7.3205 -2.0931 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7032 8.7465 -1.9101 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9276 9.6121 -2.5328 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1068 11.0884 -2.3875 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9932 11.6741 -3.6469 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9427 11.6081 -1.5373 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6334 11.3392 -2.1489 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3064 10.6254 -1.5739 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2019 9.9965 -0.2578 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2979 10.5445 0.6755 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9050 -4.2214 1.3988 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1689 -5.1727 2.3589 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9674 -4.7651 3.9388 P 0 0 0 0 0 5 0 0 0 0 0 0 -3.3605 -4.5301 4.5503 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2866 -6.0463 4.8530 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1000 -3.3609 4.2461 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8156 -2.1934 4.1112 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1323 -1.5639 5.4635 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7939 -2.4254 6.3135 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8813 -0.2899 5.2179 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1944 0.8309 5.7218 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2672 -0.0916 3.7711 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8925 1.1505 3.6666 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1215 -0.1475 2.8330 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5406 1.0770 2.5190 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3616 1.2666 0.8423 P 0 0 0 0 0 5 0 0 0 0 0 0 0.1006 1.1970 0.4315 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0202 2.7057 0.2768 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1875 -0.0146 0.0724 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0652 -1.1324 3.3405 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2072 -0.5148 4.2468 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7015 -6.1658 -0.2717 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5976 -7.6563 -0.2356 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6335 -6.4100 1.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6898 -4.7608 -0.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8364 -5.7382 -1.7493 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3404 -7.4876 -1.0565 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4066 -6.9535 0.0187 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7399 -5.4575 1.9746 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9214 -4.6319 0.6689 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8752 -4.2223 1.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6648 -2.0351 0.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0863 -1.6489 0.5319 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1462 -3.1962 -0.4017 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6733 -2.5076 -2.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5473 -0.3367 -2.8621 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8542 1.1895 -1.8894 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4374 1.4523 -1.1913 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8128 0.3681 0.9919 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7181 0.7210 1.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2541 2.1826 0.6064 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8116 0.5168 0.2682 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1190 2.4454 -1.8066 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8857 1.2255 -3.3653 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9447 0.0355 -2.4636 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8117 -0.4917 -1.0082 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4694 -1.1654 -3.9360 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4995 -1.6647 -2.5704 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6531 -3.0142 -1.6497 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0916 -3.4565 -3.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2700 -1.9950 -4.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1775 -1.5517 -2.5098 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7385 -3.1231 -3.5654 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4364 -4.2223 -4.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5226 -5.7218 -0.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7085 -5.9727 -0.9331 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6971 -6.1731 0.8219 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0255 -2.9096 -0.5071 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3363 -2.4762 1.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9995 -0.6420 -0.3427 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9933 -1.2080 -1.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4022 -0.3936 0.8728 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0445 -0.7366 -0.7827 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2303 1.5940 -0.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8287 0.4923 -2.4536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4590 1.5440 1.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4418 1.5941 0.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2399 3.7182 1.0094 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0210 5.3574 -0.0473 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3533 2.9858 -1.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1400 4.6858 -2.3804 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0177 6.7908 -0.8435 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6999 6.9258 -2.7251 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4865 9.1160 -1.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1294 9.2711 -3.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0397 11.3574 -1.8701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9213 12.6469 -3.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0130 12.7333 -1.4655 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0594 11.2660 -0.4969 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4251 11.7501 -3.1363 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2644 10.4730 -2.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5144 8.9160 -0.4069 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7712 9.9621 0.2135 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9902 11.4768 1.1628 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5337 9.7449 1.4058 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2133 10.6698 0.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6501 -3.4069 1.5035 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8852 -3.8394 1.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3156 -5.8646 4.8822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7839 -2.4110 3.6461 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1456 -1.2900 5.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7804 -2.3972 6.2446 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8301 -0.3451 5.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9056 1.5268 5.8836 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0542 -0.8599 3.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6046 1.1485 4.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4648 -0.6002 1.8691 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6721 2.9367 -0.6062 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4356 0.2192 -0.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4865 -1.5806 2.5264 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0744 0.3946 3.9694 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 1 0 25 52 1 0 52 53 1 0 53 54 1 0 54 55 2 0 54 56 1 0 54 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 67 70 1 0 65 71 1 0 71 72 1 0 71 58 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 4 79 1 0 5 80 1 0 5 81 1 0 6 82 1 0 7 83 1 0 8 84 1 0 8 85 1 0 9 86 1 0 10 87 1 0 11 88 1 0 11 89 1 0 12 90 1 0 13 91 1 0 14 92 1 0 14 93 1 0 15 94 1 0 16 95 1 0 17 96 1 0 17 97 1 0 18 98 1 0 18 99 1 0 19100 1 0 19101 1 0 20102 1 0 20103 1 0 21104 1 0 21105 1 0 25106 1 6 26107 1 0 26108 1 0 30109 1 0 30110 1 0 31111 1 0 31112 1 0 32113 1 0 32114 1 0 33115 1 1 34116 1 0 35117 1 1 36118 1 0 37119 1 0 38120 1 0 39121 1 0 40122 1 0 41123 1 0 42124 1 0 43125 1 0 44126 1 0 45127 1 1 46128 1 0 47129 1 0 47130 1 0 48131 1 0 49132 1 0 50133 1 0 50134 1 0 51135 1 0 51136 1 0 51137 1 0 52138 1 0 52139 1 0 56140 1 0 58141 1 6 59142 1 0 60143 1 0 61144 1 0 62145 1 0 63146 1 0 64147 1 0 65148 1 6 69149 1 0 70150 1 0 71151 1 0 72152 1 0 M END PDB for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))HEADER PROTEIN 13-SEP-21 NONE TITLE NULL COMPND MOLECULE: PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10 SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 13-SEP-21 0 HETATM 1 C UNK 0 -6.283 0.673 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -7.609 1.436 0.000 0.00 0.00 C+0 HETATM 3 O UNK 0 -8.934 0.673 0.000 0.00 0.00 O+0 HETATM 4 H UNK 0 -5.517 -0.652 0.000 0.00 0.00 H+0 HETATM 5 O UNK 0 -7.049 -0.652 0.000 0.00 0.00 O+0 HETATM 6 C UNK 0 -4.957 1.439 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 -3.632 0.673 0.000 0.00 0.00 O+0 HETATM 8 O UNK 0 -0.016 0.633 0.000 0.00 0.00 O+0 HETATM 9 P UNK 0 -1.411 1.202 0.000 0.00 0.00 P+0 HETATM 10 O UNK 0 -2.086 0.031 0.000 0.00 0.00 O+0 HETATM 11 O UNK 0 -1.411 2.597 0.000 0.00 0.00 O+0 HETATM 12 C UNK 0 5.136 1.235 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 2.704 1.884 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 1.440 -0.315 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 3.876 0.342 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 6.315 -0.315 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 7.572 1.884 0.000 0.00 0.00 C+0 HETATM 18 O UNK 0 1.225 1.488 0.000 0.00 0.00 O+0 HETATM 19 O UNK 0 3.869 2.282 0.000 0.00 0.00 O+0 HETATM 20 O UNK 0 6.029 2.342 0.000 0.00 0.00 O+0 HETATM 21 O UNK 0 8.010 0.241 0.000 0.00 0.00 O+0 HETATM 22 O UNK 0 8.850 1.562 0.000 0.00 0.00 O+0 HETATM 23 P UNK 0 10.106 0.803 0.000 0.00 0.00 P+0 HETATM 24 O UNK 0 10.106 2.334 0.000 0.00 0.00 O+0 HETATM 25 O UNK 0 9.341 -0.523 0.000 0.00 0.00 O+0 HETATM 26 O UNK 0 11.585 0.407 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 -10.260 1.436 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 -10.260 2.876 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 -11.593 0.665 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -12.926 1.436 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -14.259 0.665 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 -15.592 1.436 0.000 0.00 0.00 C+0 HETATM 33 O UNK 0 -15.592 2.876 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 -16.925 0.665 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -16.925 -0.775 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 -18.258 1.436 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -19.798 1.436 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -21.131 0.665 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -22.671 0.665 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -24.004 1.436 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -25.337 0.665 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -26.670 1.436 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 -28.003 0.665 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -29.336 1.436 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -29.336 2.876 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -30.669 0.665 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -32.003 1.436 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -33.543 1.436 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -34.876 0.665 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -36.209 1.436 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -8.438 -1.436 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 -8.438 -2.876 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 -9.771 -0.665 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 -11.104 -1.436 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -12.437 -0.665 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -13.770 -1.436 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 -15.103 -0.665 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -16.436 -1.436 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -17.976 -1.436 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -19.309 -0.665 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -20.642 -1.436 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -22.182 -1.436 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 -23.515 -0.665 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 -24.848 -1.436 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 -26.388 -1.436 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 -27.721 -0.665 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 -29.055 -1.436 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 -30.595 -1.436 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 -31.928 -0.665 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 -33.261 -1.436 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 -34.801 -1.436 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 -36.134 -0.665 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -37.467 -1.436 0.000 0.00 0.00 C+0 CONECT 1 2 5 4 6 CONECT 2 1 3 CONECT 3 2 27 CONECT 4 1 CONECT 5 1 51 CONECT 6 1 7 CONECT 7 6 9 CONECT 8 9 14 CONECT 9 7 8 10 11 CONECT 10 9 CONECT 11 9 CONECT 12 13 17 20 CONECT 13 12 14 18 CONECT 14 13 15 8 CONECT 15 14 19 16 CONECT 16 17 15 21 CONECT 17 12 16 22 CONECT 18 13 CONECT 19 15 CONECT 20 12 CONECT 21 16 23 CONECT 22 17 CONECT 23 21 24 25 26 CONECT 24 23 CONECT 25 23 CONECT 26 23 CONECT 27 3 28 29 CONECT 28 27 CONECT 29 27 30 CONECT 30 29 31 CONECT 31 30 32 CONECT 32 31 33 34 CONECT 33 32 CONECT 34 32 35 36 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 41 CONECT 41 40 42 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 45 46 CONECT 45 44 CONECT 46 44 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 CONECT 51 5 52 53 CONECT 52 51 CONECT 53 51 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 58 CONECT 58 57 59 CONECT 59 58 60 CONECT 60 59 61 CONECT 61 60 62 CONECT 62 61 63 CONECT 63 62 64 CONECT 64 63 65 CONECT 65 64 66 CONECT 66 65 67 CONECT 67 66 68 CONECT 68 67 69 CONECT 69 68 70 CONECT 70 69 71 CONECT 71 70 72 CONECT 72 71 73 CONECT 73 72 MASTER 0 0 0 0 0 0 0 0 73 0 146 0 END 3D PDB for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))COMPND HMDB0280770 HETATM 1 C1 UNL 1 10.735 -6.595 0.031 1.00 0.00 C HETATM 2 C2 UNL 1 9.612 -5.756 -0.607 1.00 0.00 C HETATM 3 C3 UNL 1 8.350 -6.497 -0.508 1.00 0.00 C HETATM 4 C4 UNL 1 7.251 -6.197 0.106 1.00 0.00 C HETATM 5 C5 UNL 1 6.953 -5.006 0.896 1.00 0.00 C HETATM 6 C6 UNL 1 7.964 -4.011 1.138 1.00 0.00 C HETATM 7 C7 UNL 1 7.870 -2.770 0.702 1.00 0.00 C HETATM 8 C8 UNL 1 6.724 -2.246 -0.091 1.00 0.00 C HETATM 9 C9 UNL 1 7.189 -1.718 -1.378 1.00 0.00 C HETATM 10 C10 UNL 1 7.114 -0.500 -1.816 1.00 0.00 C HETATM 11 C11 UNL 1 6.554 0.674 -1.149 1.00 0.00 C HETATM 12 C12 UNL 1 6.038 0.618 0.195 1.00 0.00 C HETATM 13 C13 UNL 1 4.840 0.859 0.655 1.00 0.00 C HETATM 14 C14 UNL 1 3.626 1.267 -0.015 1.00 0.00 C HETATM 15 C15 UNL 1 3.568 1.562 -1.413 1.00 0.00 C HETATM 16 C16 UNL 1 2.857 0.910 -2.292 1.00 0.00 C HETATM 17 C17 UNL 1 1.966 -0.256 -2.056 1.00 0.00 C HETATM 18 C18 UNL 1 2.426 -1.439 -2.843 1.00 0.00 C HETATM 19 C19 UNL 1 1.596 -2.685 -2.711 1.00 0.00 C HETATM 20 C20 UNL 1 0.203 -2.401 -3.139 1.00 0.00 C HETATM 21 C21 UNL 1 -0.747 -3.532 -3.183 1.00 0.00 C HETATM 22 C22 UNL 1 -1.037 -4.298 -2.005 1.00 0.00 C HETATM 23 O1 UNL 1 -0.372 -5.378 -1.811 1.00 0.00 O HETATM 24 O2 UNL 1 -1.979 -3.994 -1.042 1.00 0.00 O HETATM 25 C23 UNL 1 -2.199 -4.859 0.043 1.00 0.00 C HETATM 26 C24 UNL 1 -3.622 -5.390 0.015 1.00 0.00 C HETATM 27 O3 UNL 1 -4.630 -4.487 0.222 1.00 0.00 O HETATM 28 C25 UNL 1 -4.974 -3.328 -0.369 1.00 0.00 C HETATM 29 O4 UNL 1 -4.262 -2.911 -1.316 1.00 0.00 O HETATM 30 C26 UNL 1 -6.143 -2.464 -0.001 1.00 0.00 C HETATM 31 C27 UNL 1 -5.973 -1.061 -0.565 1.00 0.00 C HETATM 32 C28 UNL 1 -7.180 -0.281 -0.216 1.00 0.00 C HETATM 33 C29 UNL 1 -7.165 1.177 -0.618 1.00 0.00 C HETATM 34 O5 UNL 1 -6.969 1.342 -1.967 1.00 0.00 O HETATM 35 C30 UNL 1 -6.211 1.942 0.228 1.00 0.00 C HETATM 36 O6 UNL 1 -4.912 1.544 -0.044 1.00 0.00 O HETATM 37 C31 UNL 1 -6.414 3.367 0.346 1.00 0.00 C HETATM 38 C32 UNL 1 -5.733 4.301 -0.249 1.00 0.00 C HETATM 39 C33 UNL 1 -4.644 4.025 -1.145 1.00 0.00 C HETATM 40 C34 UNL 1 -3.961 4.999 -1.707 1.00 0.00 C HETATM 41 C35 UNL 1 -4.248 6.392 -1.471 1.00 0.00 C HETATM 42 C36 UNL 1 -3.480 7.321 -2.093 1.00 0.00 C HETATM 43 C37 UNL 1 -3.703 8.747 -1.910 1.00 0.00 C HETATM 44 C38 UNL 1 -2.928 9.612 -2.533 1.00 0.00 C HETATM 45 C39 UNL 1 -3.107 11.088 -2.387 1.00 0.00 C HETATM 46 O7 UNL 1 -2.993 11.674 -3.647 1.00 0.00 O HETATM 47 C40 UNL 1 -1.943 11.608 -1.537 1.00 0.00 C HETATM 48 C41 UNL 1 -0.633 11.339 -2.149 1.00 0.00 C HETATM 49 C42 UNL 1 0.306 10.625 -1.574 1.00 0.00 C HETATM 50 C43 UNL 1 0.202 9.996 -0.258 1.00 0.00 C HETATM 51 C44 UNL 1 1.298 10.544 0.675 1.00 0.00 C HETATM 52 C45 UNL 1 -1.905 -4.221 1.399 1.00 0.00 C HETATM 53 O8 UNL 1 -2.169 -5.173 2.359 1.00 0.00 O HETATM 54 P1 UNL 1 -1.967 -4.765 3.939 1.00 0.00 P HETATM 55 O9 UNL 1 -3.360 -4.530 4.550 1.00 0.00 O HETATM 56 O10 UNL 1 -1.287 -6.046 4.853 1.00 0.00 O HETATM 57 O11 UNL 1 -1.100 -3.361 4.246 1.00 0.00 O HETATM 58 C46 UNL 1 -1.816 -2.193 4.111 1.00 0.00 C HETATM 59 C47 UNL 1 -2.132 -1.564 5.464 1.00 0.00 C HETATM 60 O12 UNL 1 -2.794 -2.425 6.313 1.00 0.00 O HETATM 61 C48 UNL 1 -2.881 -0.290 5.218 1.00 0.00 C HETATM 62 O13 UNL 1 -2.194 0.831 5.722 1.00 0.00 O HETATM 63 C49 UNL 1 -3.267 -0.092 3.771 1.00 0.00 C HETATM 64 O14 UNL 1 -3.892 1.151 3.667 1.00 0.00 O HETATM 65 C50 UNL 1 -2.122 -0.148 2.833 1.00 0.00 C HETATM 66 O15 UNL 1 -1.541 1.077 2.519 1.00 0.00 O HETATM 67 P2 UNL 1 -1.362 1.267 0.842 1.00 0.00 P HETATM 68 O16 UNL 1 0.101 1.197 0.431 1.00 0.00 O HETATM 69 O17 UNL 1 -2.020 2.706 0.277 1.00 0.00 O HETATM 70 O18 UNL 1 -2.187 -0.015 0.072 1.00 0.00 O HETATM 71 C51 UNL 1 -1.065 -1.132 3.340 1.00 0.00 C HETATM 72 O19 UNL 1 -0.207 -0.515 4.247 1.00 0.00 O HETATM 73 H1 UNL 1 11.702 -6.166 -0.272 1.00 0.00 H HETATM 74 H2 UNL 1 10.598 -7.656 -0.236 1.00 0.00 H HETATM 75 H3 UNL 1 10.634 -6.410 1.124 1.00 0.00 H HETATM 76 H4 UNL 1 9.690 -4.761 -0.261 1.00 0.00 H HETATM 77 H5 UNL 1 9.836 -5.738 -1.749 1.00 0.00 H HETATM 78 H6 UNL 1 8.340 -7.488 -1.057 1.00 0.00 H HETATM 79 H7 UNL 1 6.407 -6.953 0.019 1.00 0.00 H HETATM 80 H8 UNL 1 6.740 -5.458 1.975 1.00 0.00 H HETATM 81 H9 UNL 1 5.921 -4.632 0.669 1.00 0.00 H HETATM 82 H10 UNL 1 8.875 -4.222 1.746 1.00 0.00 H HETATM 83 H11 UNL 1 8.665 -2.035 0.913 1.00 0.00 H HETATM 84 H12 UNL 1 6.086 -1.649 0.532 1.00 0.00 H HETATM 85 H13 UNL 1 6.146 -3.196 -0.402 1.00 0.00 H HETATM 86 H14 UNL 1 7.673 -2.508 -2.032 1.00 0.00 H HETATM 87 H15 UNL 1 7.547 -0.337 -2.862 1.00 0.00 H HETATM 88 H16 UNL 1 5.854 1.190 -1.889 1.00 0.00 H HETATM 89 H17 UNL 1 7.437 1.452 -1.191 1.00 0.00 H HETATM 90 H18 UNL 1 6.813 0.368 0.992 1.00 0.00 H HETATM 91 H19 UNL 1 4.718 0.721 1.774 1.00 0.00 H HETATM 92 H20 UNL 1 3.254 2.183 0.606 1.00 0.00 H HETATM 93 H21 UNL 1 2.812 0.517 0.268 1.00 0.00 H HETATM 94 H22 UNL 1 4.119 2.445 -1.807 1.00 0.00 H HETATM 95 H23 UNL 1 2.886 1.225 -3.365 1.00 0.00 H HETATM 96 H24 UNL 1 0.945 0.035 -2.464 1.00 0.00 H HETATM 97 H25 UNL 1 1.812 -0.492 -1.008 1.00 0.00 H HETATM 98 H26 UNL 1 2.469 -1.165 -3.936 1.00 0.00 H HETATM 99 H27 UNL 1 3.500 -1.665 -2.570 1.00 0.00 H HETATM 100 H28 UNL 1 1.653 -3.014 -1.650 1.00 0.00 H HETATM 101 H29 UNL 1 2.092 -3.457 -3.371 1.00 0.00 H HETATM 102 H30 UNL 1 0.270 -1.995 -4.197 1.00 0.00 H HETATM 103 H31 UNL 1 -0.177 -1.552 -2.510 1.00 0.00 H HETATM 104 H32 UNL 1 -1.739 -3.123 -3.565 1.00 0.00 H HETATM 105 H33 UNL 1 -0.436 -4.222 -4.046 1.00 0.00 H HETATM 106 H34 UNL 1 -1.523 -5.722 -0.051 1.00 0.00 H HETATM 107 H35 UNL 1 -3.708 -5.973 -0.933 1.00 0.00 H HETATM 108 H36 UNL 1 -3.697 -6.173 0.822 1.00 0.00 H HETATM 109 H37 UNL 1 -7.026 -2.910 -0.507 1.00 0.00 H HETATM 110 H38 UNL 1 -6.336 -2.476 1.076 1.00 0.00 H HETATM 111 H39 UNL 1 -5.000 -0.642 -0.343 1.00 0.00 H HETATM 112 H40 UNL 1 -5.993 -1.208 -1.688 1.00 0.00 H HETATM 113 H41 UNL 1 -7.402 -0.394 0.873 1.00 0.00 H HETATM 114 H42 UNL 1 -8.044 -0.737 -0.783 1.00 0.00 H HETATM 115 H43 UNL 1 -8.230 1.594 -0.458 1.00 0.00 H HETATM 116 H44 UNL 1 -6.829 0.492 -2.454 1.00 0.00 H HETATM 117 H45 UNL 1 -6.459 1.544 1.309 1.00 0.00 H HETATM 118 H46 UNL 1 -4.442 1.594 0.845 1.00 0.00 H HETATM 119 H47 UNL 1 -7.240 3.718 1.009 1.00 0.00 H HETATM 120 H48 UNL 1 -6.021 5.357 -0.047 1.00 0.00 H HETATM 121 H49 UNL 1 -4.353 2.986 -1.410 1.00 0.00 H HETATM 122 H50 UNL 1 -3.140 4.686 -2.380 1.00 0.00 H HETATM 123 H51 UNL 1 -5.018 6.791 -0.844 1.00 0.00 H HETATM 124 H52 UNL 1 -2.700 6.926 -2.725 1.00 0.00 H HETATM 125 H53 UNL 1 -4.486 9.116 -1.279 1.00 0.00 H HETATM 126 H54 UNL 1 -2.129 9.271 -3.173 1.00 0.00 H HETATM 127 H55 UNL 1 -4.040 11.357 -1.870 1.00 0.00 H HETATM 128 H56 UNL 1 -2.921 12.647 -3.533 1.00 0.00 H HETATM 129 H57 UNL 1 -2.013 12.733 -1.466 1.00 0.00 H HETATM 130 H58 UNL 1 -2.059 11.266 -0.497 1.00 0.00 H HETATM 131 H59 UNL 1 -0.425 11.750 -3.136 1.00 0.00 H HETATM 132 H60 UNL 1 1.264 10.473 -2.107 1.00 0.00 H HETATM 133 H61 UNL 1 0.514 8.916 -0.407 1.00 0.00 H HETATM 134 H62 UNL 1 -0.771 9.962 0.213 1.00 0.00 H HETATM 135 H63 UNL 1 0.990 11.477 1.163 1.00 0.00 H HETATM 136 H64 UNL 1 1.534 9.745 1.406 1.00 0.00 H HETATM 137 H65 UNL 1 2.213 10.670 0.052 1.00 0.00 H HETATM 138 H66 UNL 1 -2.650 -3.407 1.503 1.00 0.00 H HETATM 139 H67 UNL 1 -0.885 -3.839 1.365 1.00 0.00 H HETATM 140 H68 UNL 1 -0.316 -5.865 4.882 1.00 0.00 H HETATM 141 H69 UNL 1 -2.784 -2.411 3.646 1.00 0.00 H HETATM 142 H70 UNL 1 -1.146 -1.290 5.904 1.00 0.00 H HETATM 143 H71 UNL 1 -3.780 -2.397 6.245 1.00 0.00 H HETATM 144 H72 UNL 1 -3.830 -0.345 5.797 1.00 0.00 H HETATM 145 H73 UNL 1 -2.906 1.527 5.884 1.00 0.00 H HETATM 146 H74 UNL 1 -4.054 -0.860 3.539 1.00 0.00 H HETATM 147 H75 UNL 1 -4.605 1.148 4.384 1.00 0.00 H HETATM 148 H76 UNL 1 -2.465 -0.600 1.869 1.00 0.00 H HETATM 149 H77 UNL 1 -1.672 2.937 -0.606 1.00 0.00 H HETATM 150 H78 UNL 1 -2.436 0.219 -0.873 1.00 0.00 H HETATM 151 H79 UNL 1 -0.487 -1.581 2.526 1.00 0.00 H HETATM 152 H80 UNL 1 0.074 0.395 3.969 1.00 0.00 H CONECT 1 2 73 74 75 CONECT 2 3 76 77 CONECT 3 4 4 78 CONECT 4 5 79 CONECT 5 6 80 81 CONECT 6 7 7 82 CONECT 7 8 83 CONECT 8 9 84 85 CONECT 9 10 10 86 CONECT 10 11 87 CONECT 11 12 88 89 CONECT 12 13 13 90 CONECT 13 14 91 CONECT 14 15 92 93 CONECT 15 16 16 94 CONECT 16 17 95 CONECT 17 18 96 97 CONECT 18 19 98 99 CONECT 19 20 100 101 CONECT 20 21 102 103 CONECT 21 22 104 105 CONECT 22 23 23 24 CONECT 24 25 CONECT 25 26 52 106 CONECT 26 27 107 108 CONECT 27 28 CONECT 28 29 29 30 CONECT 30 31 109 110 CONECT 31 32 111 112 CONECT 32 33 113 114 CONECT 33 34 35 115 CONECT 34 116 CONECT 35 36 37 117 CONECT 36 118 CONECT 37 38 38 119 CONECT 38 39 120 CONECT 39 40 40 121 CONECT 40 41 122 CONECT 41 42 42 123 CONECT 42 43 124 CONECT 43 44 44 125 CONECT 44 45 126 CONECT 45 46 47 127 CONECT 46 128 CONECT 47 48 129 130 CONECT 48 49 49 131 CONECT 49 50 132 CONECT 50 51 133 134 CONECT 51 135 136 137 CONECT 52 53 138 139 CONECT 53 54 CONECT 54 55 55 56 57 CONECT 56 140 CONECT 57 58 CONECT 58 59 71 141 CONECT 59 60 61 142 CONECT 60 143 CONECT 61 62 63 144 CONECT 62 145 CONECT 63 64 65 146 CONECT 64 147 CONECT 65 66 71 148 CONECT 66 67 CONECT 67 68 68 69 70 CONECT 69 149 CONECT 70 150 CONECT 71 72 151 CONECT 72 152 END SMILES for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))[H][C@@](COC(=O)CCC[C@H](O)[C@@H](O)\C=C/C=C\C=C\C=C\[C@H](O)C\C=C/CC)(COP(O)(=O)O[C@H]1C(O)C(O)C(O)[C@@H](OP(O)(O)=O)C1O)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC INCHI for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))InChI=1S/C51H80O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-30-36-45(56)68-41(39-67-72(64,65)70-51-48(59)46(57)47(58)50(49(51)60)69-71(61,62)63)38-66-44(55)37-31-35-43(54)42(53)34-29-25-23-22-24-28-33-40(52)32-27-6-4-2/h5-7,9-10,12-13,15-16,18-19,22-25,27-29,33-34,40-43,46-54,57-60H,3-4,8,11,14,17,20-21,26,30-32,35-39H2,1-2H3,(H,64,65)(H2,61,62,63)/b7-5-,10-9-,13-12-,16-15-,19-18-,24-22+,25-23-,27-6-,33-28+,34-29-/t40-,41-,42+,43+,46?,47?,48?,49?,50-,51+/m1/s1 Structure for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z)))3D Structure for HMDB0280770 (PIP(20:5(7Z,9Z,11E,13E,17Z)-3OH(5,6,15)/22:5(7Z,10Z,13Z,16Z,19Z))) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C51H80O19P2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1059.13 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1058.476904352 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | {[(1R,3S)-3-({[(2R)-2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]-3-{[(5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoyl]oxy}propoxy](hydroxy)phosphoryl}oxy)-2,4,5,6-tetrahydroxycyclohexyl]oxy}phosphonic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | [(1R,3S)-3-{[(2R)-2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]-3-{[(5S,6S,7Z,9Z,11E,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoyl]oxy}propoxy(hydroxy)phosphoryl]oxy}-2,4,5,6-tetrahydroxycyclohexyl]oxyphosphonic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H][C@@](COC(=O)CCC[C@H](O)[C@@H](O)\C=C/C=C\C=C\C=C\[C@H](O)C\C=C/CC)(COP(O)(=O)O[C@H]1C(O)C(O)C(O)[C@@H](OP(O)(O)=O)C1O)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C51H80O19P2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-30-36-45(56)68-41(39-67-72(64,65)70-51-48(59)46(57)47(58)50(49(51)60)69-71(61,62)63)38-66-44(55)37-31-35-43(54)42(53)34-29-25-23-22-24-28-33-40(52)32-27-6-4-2/h5-7,9-10,12-13,15-16,18-19,22-25,27-29,33-34,40-43,46-54,57-60H,3-4,8,11,14,17,20-21,26,30-32,35-39H2,1-2H3,(H,64,65)(H2,61,62,63)/b7-5-,10-9-,13-12-,16-15-,19-18-,24-22+,25-23-,27-6-,33-28+,34-29-/t40-,41-,42+,43+,46?,47?,48?,49?,50-,51+/m1/s1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | CNIKIMNSVXYEHG-LGOADCTCSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Health effect
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Naturally occurring process
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |