Showing metabocard for Cer(t18:0/PGF2alpha) (HMDB0290164)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Predicted | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-16 01:48:42 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-11-30 20:07:02 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0290164 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Cer(t18:0/PGF2alpha) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Cer(t18:0/PGF2alpha) is an oxidized ceramide (Cer). As all ceramides, oxidized ceramides are members of the class of compounds known as sphingolipids (SPs), or glycosylceramides. SPs are lipids containing a backbone of sphingoid bases (e.g. sphingosine or sphinganine) that are often covalently bound to a fatty acid derivative through N-acylation. SPs are found in cell membranes, particularly in peripheral nerve cells and the cells found in the central nervous system (including the brain and spinal cord). Sphingolipids are extremely versatile molecules that have functions controlling fundamental cellular processes such as cell division, differentiation, and cell death. Impairments associated with sphingolipid metabolism are associated with many common human diseases such as diabetes, various cancers, microbial infections, diseases of the cardiovascular and respiratory systems, Alzheimer’s disease and other neurological syndromes. The biosynthesis and catabolism of sphingolipids involves a large number of intermediate metabolites where many different enzymes are involved. Simple sphingolipids, which include the sphingoid bases and ceramides, make up the early products of the sphingolipid synthetic pathways, while complex sphingolipids may be formed by the addition of head groups to the ceramide template (Wikipedia). In humans, ceramides are phosphorylated to ceramide phosphates (CerPs) through the action of a specific ceramide kinase (CerK). Ceramide phosphates are important metabolites of ceramides as they act as a mediators of the inflammatory response. Ceramides are also one of the hydrolysis byproducts of sphingomyelins (SMs) through the action of the enzyme sphingomyelin phosphodiesterase, which has been identified in the subcellular fractions of human epidermis (PMID: 25935) and many other tissues. Ceramides can also be synthesized from serine and palmitate in a de novo pathway and are regarded as important cellular signals for inducing apoptosis (PMID: 14998372). Ceramides are key in the biosynthesis of glycosphingolipids and gangliosides. In terms of its appearance and structure, Cer(d18:1/22:1(13Z)) is a colorless solid that consists of an unsaturated 18-carbon sphingoid base with an attached unsaturated 13Z-docosenoyl fatty acid side chain. In most mammalian SPs, the 18-carbon sphingoid bases are predominant (PMID: 9759481). | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0290164 (Cer(t18:0/PGF2alpha))Mrv1652309162103492D 46 46 0 0 1 0 999 V2000 -3.0300 -4.8599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7445 -5.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7445 -6.0974 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4589 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4589 -7.3349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1734 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1734 -5.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8879 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6023 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3168 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0313 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7458 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4602 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1747 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8892 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6036 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3181 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0326 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.7471 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4615 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.1760 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0300 -6.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3155 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3155 -5.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6010 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8866 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1721 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5424 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2568 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9713 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9713 -5.2724 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3039 -4.7875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5192 -5.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5588 -4.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3838 -4.0029 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8687 -3.3354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6387 -4.7875 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4234 -5.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5949 -5.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3795 -6.1043 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5510 -6.9113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9926 -5.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7772 -5.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3903 -5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1750 -5.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7880 -4.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 6 1 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 3 22 1 6 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 2 0 0 0 0 29 30 1 0 0 0 0 31 30 1 1 0 0 0 31 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 1 0 0 0 35 37 1 0 0 0 0 31 37 1 0 0 0 0 37 38 1 6 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 1 6 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 M END 3D MOL for HMDB0290164 (Cer(t18:0/PGF2alpha))HMDB0290164 RDKit 3D Cer(t18:0/PGF2alpha) 117117 0 0 0 0 0 0 0 0999 V2000 12.2310 -1.8105 -1.9247 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1377 -1.0116 -0.9884 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5803 -1.8025 0.1735 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6153 -2.3515 1.1337 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8091 -1.4281 1.9333 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8482 -0.4958 1.3093 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7346 -1.1345 0.5171 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8800 -0.0414 -0.0776 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2722 0.7759 1.0187 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3862 1.9056 0.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2694 1.4288 -0.3698 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3365 0.4533 0.2484 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6913 1.0202 1.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7555 0.0938 2.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5688 -0.4167 1.4022 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9784 -1.3115 2.4256 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5077 0.5476 1.0398 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1388 1.4005 2.0453 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5058 1.0460 -0.3422 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2729 2.3375 -0.5924 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8963 3.3695 0.2300 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0713 1.3965 -0.6448 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.5112 1.0611 -1.8833 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1915 0.4575 -2.7324 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9083 1.4049 -2.1997 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2292 1.1309 -3.6601 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6318 1.5022 -4.0013 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6771 0.7739 -3.2710 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5180 1.4750 -2.4913 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6017 0.8096 -1.7235 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3974 1.0357 -0.2712 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3752 2.4979 0.1572 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4681 3.1955 -0.3058 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5450 2.3733 1.6832 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2054 0.9941 1.8991 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2772 1.1142 2.7534 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6350 0.6104 0.5340 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0935 -0.7314 0.2851 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2031 -1.7275 1.1551 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7026 -3.0754 0.7361 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8249 -3.8596 1.8760 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1375 -2.9271 0.1683 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9905 -2.3651 1.2621 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4161 -2.1599 0.9385 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7733 -1.2201 -0.1530 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2866 -1.5426 -1.5191 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7255 -2.0516 -2.8740 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9489 -2.7430 -1.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3417 -1.2037 -2.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7497 -0.0201 -0.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0812 -0.7959 -1.6086 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3504 -1.1991 0.7363 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2161 -2.6591 -0.2498 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9352 -3.1354 0.6322 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2445 -2.9516 1.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5225 -0.7954 2.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2609 -2.0155 2.7582 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2242 0.3898 0.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2804 -0.0460 2.2220 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0751 -1.6984 1.2623 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0457 -1.8962 -0.2057 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1179 -0.4371 -0.7808 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6074 0.6222 -0.6382 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6724 0.1306 1.6699 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0403 1.3104 1.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0666 2.5687 1.3220 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0595 2.5460 -0.1345 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7033 2.3277 -0.6938 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7383 0.9683 -1.2819 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5359 0.2211 -0.5024 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8126 -0.5390 0.4479 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5640 1.1391 2.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3748 2.0397 1.3057 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3457 -0.8183 2.4482 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4770 0.5534 3.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8865 -1.1171 0.6238 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0117 -1.3447 2.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5307 -0.1872 1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3723 0.9836 2.9028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7981 0.3513 -1.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3275 2.2536 -0.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8709 2.6583 -1.6301 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5864 4.1915 -0.2331 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4511 1.8841 0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0399 2.4904 -2.0278 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6465 0.9047 -1.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5507 1.6953 -4.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0828 0.0508 -3.9138 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7058 2.6201 -3.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7646 1.4144 -5.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8205 -0.3022 -3.3180 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3741 2.5693 -2.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5135 -0.2853 -1.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6068 1.1060 -2.0844 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4807 0.5677 0.0884 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4303 2.9672 -0.1080 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1791 3.3504 0.3302 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5623 2.4315 2.1405 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1840 3.1821 2.0839 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4053 0.3533 2.3222 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1861 0.5193 3.5307 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4277 1.3398 0.2171 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3968 -0.9761 -0.7535 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9094 -1.5031 2.1753 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0661 -3.5862 0.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0071 -3.2938 2.6691 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0006 -2.2682 -0.7071 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4930 -3.9283 -0.0693 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9587 -3.1417 2.0921 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5154 -1.4682 1.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9899 -1.8031 1.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8840 -3.1643 0.7453 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9097 -1.1774 -0.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5172 -0.1473 0.1220 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1150 -2.6108 -1.6467 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1307 -1.3093 -2.2486 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4660 -0.8805 -1.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 37 31 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 0 2 51 1 0 3 52 1 0 3 53 1 0 4 54 1 0 4 55 1 0 5 56 1 0 5 57 1 0 6 58 1 0 6 59 1 0 7 60 1 0 7 61 1 0 8 62 1 0 8 63 1 0 9 64 1 0 9 65 1 0 10 66 1 0 10 67 1 0 11 68 1 0 11 69 1 0 12 70 1 0 12 71 1 0 13 72 1 0 13 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 16 77 1 0 17 78 1 0 18 79 1 0 19 80 1 6 20 81 1 0 20 82 1 0 21 83 1 0 22 84 1 0 25 85 1 0 25 86 1 0 26 87 1 0 26 88 1 0 27 89 1 0 27 90 1 0 28 91 1 0 29 92 1 0 30 93 1 0 30 94 1 0 31 95 1 1 32 96 1 1 33 97 1 0 34 98 1 0 34 99 1 0 35100 1 1 36101 1 0 37102 1 6 38103 1 0 39104 1 0 40105 1 6 41106 1 0 42107 1 0 42108 1 0 43109 1 0 43110 1 0 44111 1 0 44112 1 0 45113 1 0 45114 1 0 46115 1 0 46116 1 0 46117 1 0 M END 3D SDF for HMDB0290164 (Cer(t18:0/PGF2alpha))Mrv1652309162103492D 46 46 0 0 1 0 999 V2000 -3.0300 -4.8599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7445 -5.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7445 -6.0974 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4589 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4589 -7.3349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1734 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1734 -5.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8879 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6023 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3168 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0313 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7458 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4602 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1747 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8892 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6036 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3181 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0326 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.7471 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4615 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.1760 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0300 -6.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3155 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3155 -5.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6010 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8866 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1721 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5424 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2568 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9713 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9713 -5.2724 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3039 -4.7875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5192 -5.0424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5588 -4.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3838 -4.0029 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8687 -3.3354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6387 -4.7875 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4234 -5.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5949 -5.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3795 -6.1043 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5510 -6.9113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9926 -5.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7772 -5.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3903 -5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1750 -5.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7880 -4.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 6 1 0 0 0 0 6 7 1 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 3 22 1 6 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 2 0 0 0 0 29 30 1 0 0 0 0 31 30 1 1 0 0 0 31 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 1 0 0 0 35 37 1 0 0 0 0 31 37 1 0 0 0 0 37 38 1 6 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 1 6 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 M END > <DATABASE_ID> HMDB0290164 > <DATABASE_NAME> hmdb > <SMILES> CCCCCCCCCCCCCCC(O)C(O)[C@H](CO)NC(=O)CCC\C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)CCCCC > <INCHI_IDENTIFIER> InChI=1S/C38H71NO7/c1-3-5-7-8-9-10-11-12-13-14-15-20-24-34(42)38(46)33(29-40)39-37(45)25-21-17-16-19-23-31-32(36(44)28-35(31)43)27-26-30(41)22-18-6-4-2/h16,19,26-27,30-36,38,40-44,46H,3-15,17-18,20-25,28-29H2,1-2H3,(H,39,45)/b19-16+,27-26+/t30-,31+,32+,33-,34?,35-,36+,38?/m0/s1 > <INCHI_KEY> HETQVXXRQGXRHI-ZVMBDRQCSA-N > <FORMULA> C38H71NO7 > <MOLECULAR_WEIGHT> 653.986 > <EXACT_MASS> 653.52305363 > <JCHEM_ACCEPTOR_COUNT> 7 > <JCHEM_ATOM_COUNT> 117 > <JCHEM_AVERAGE_POLARIZABILITY> 80.66998287188817 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 7 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (5E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]-N-[(2S)-1,3,4-trihydroxyoctadecan-2-yl]hept-5-enamide > <ALOGPS_LOGP> 5.75 > <JCHEM_LOGP> 6.350937373000001 > <ALOGPS_LOGS> -5.40 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 1 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 13.679510491691154 > <JCHEM_PKA_STRONGEST_ACIDIC> 13.132388691947572 > <JCHEM_PKA_STRONGEST_BASIC> -0.9479936541745094 > <JCHEM_POLAR_SURFACE_AREA> 150.48 > <JCHEM_REFRACTIVITY> 189.5617 > <JCHEM_ROTATABLE_BOND_COUNT> 29 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 2.58e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> (5E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]-N-[(2S)-1,3,4-trihydroxyoctadecan-2-yl]hept-5-enamide > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0290164 (Cer(t18:0/PGF2alpha))HMDB0290164 RDKit 3D Cer(t18:0/PGF2alpha) 117117 0 0 0 0 0 0 0 0999 V2000 12.2310 -1.8105 -1.9247 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1377 -1.0116 -0.9884 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5803 -1.8025 0.1735 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6153 -2.3515 1.1337 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8091 -1.4281 1.9333 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8482 -0.4958 1.3093 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7346 -1.1345 0.5171 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8800 -0.0414 -0.0776 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2722 0.7759 1.0187 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3862 1.9056 0.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2694 1.4288 -0.3698 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3365 0.4533 0.2484 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6913 1.0202 1.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7555 0.0938 2.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5688 -0.4167 1.4022 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9784 -1.3115 2.4256 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5077 0.5476 1.0398 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1388 1.4005 2.0453 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5058 1.0460 -0.3422 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2729 2.3375 -0.5924 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8963 3.3695 0.2300 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0713 1.3965 -0.6448 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.5112 1.0611 -1.8833 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1915 0.4575 -2.7324 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9083 1.4049 -2.1997 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2292 1.1309 -3.6601 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6318 1.5022 -4.0013 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6771 0.7739 -3.2710 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5180 1.4750 -2.4913 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6017 0.8096 -1.7235 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3974 1.0357 -0.2712 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3752 2.4979 0.1572 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4681 3.1955 -0.3058 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5450 2.3733 1.6832 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2054 0.9941 1.8991 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2772 1.1142 2.7534 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6350 0.6104 0.5340 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0935 -0.7314 0.2851 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2031 -1.7275 1.1551 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7026 -3.0754 0.7361 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8249 -3.8596 1.8760 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1375 -2.9271 0.1683 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9905 -2.3651 1.2621 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4161 -2.1599 0.9385 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7733 -1.2201 -0.1530 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2866 -1.5426 -1.5191 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7255 -2.0516 -2.8740 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9489 -2.7430 -1.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3417 -1.2037 -2.1163 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7497 -0.0201 -0.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0812 -0.7959 -1.6086 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3504 -1.1991 0.7363 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2161 -2.6591 -0.2498 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9352 -3.1354 0.6322 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2445 -2.9516 1.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5225 -0.7954 2.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2609 -2.0155 2.7582 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2242 0.3898 0.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2804 -0.0460 2.2220 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0751 -1.6984 1.2623 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0457 -1.8962 -0.2057 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1179 -0.4371 -0.7808 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6074 0.6222 -0.6382 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6724 0.1306 1.6699 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0403 1.3104 1.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0666 2.5687 1.3220 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0595 2.5460 -0.1345 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7033 2.3277 -0.6938 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7383 0.9683 -1.2819 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5359 0.2211 -0.5024 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8126 -0.5390 0.4479 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5640 1.1391 2.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3748 2.0397 1.3057 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3457 -0.8183 2.4482 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4770 0.5534 3.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8865 -1.1171 0.6238 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0117 -1.3447 2.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5307 -0.1872 1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3723 0.9836 2.9028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7981 0.3513 -1.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3275 2.2536 -0.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8709 2.6583 -1.6301 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5864 4.1915 -0.2331 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4511 1.8841 0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0399 2.4904 -2.0278 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6465 0.9047 -1.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5507 1.6953 -4.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0828 0.0508 -3.9138 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7058 2.6201 -3.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7646 1.4144 -5.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8205 -0.3022 -3.3180 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3741 2.5693 -2.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5135 -0.2853 -1.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6068 1.1060 -2.0844 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4807 0.5677 0.0884 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4303 2.9672 -0.1080 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1791 3.3504 0.3302 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5623 2.4315 2.1405 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1840 3.1821 2.0839 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4053 0.3533 2.3222 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1861 0.5193 3.5307 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4277 1.3398 0.2171 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3968 -0.9761 -0.7535 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9094 -1.5031 2.1753 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0661 -3.5862 0.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0071 -3.2938 2.6691 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0006 -2.2682 -0.7071 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4930 -3.9283 -0.0693 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9587 -3.1417 2.0921 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5154 -1.4682 1.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9899 -1.8031 1.8557 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8840 -3.1643 0.7453 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9097 -1.1774 -0.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5172 -0.1473 0.1220 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1150 -2.6108 -1.6467 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1307 -1.3093 -2.2486 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4660 -0.8805 -1.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 37 31 1 0 1 47 1 0 1 48 1 0 1 49 1 0 2 50 1 0 2 51 1 0 3 52 1 0 3 53 1 0 4 54 1 0 4 55 1 0 5 56 1 0 5 57 1 0 6 58 1 0 6 59 1 0 7 60 1 0 7 61 1 0 8 62 1 0 8 63 1 0 9 64 1 0 9 65 1 0 10 66 1 0 10 67 1 0 11 68 1 0 11 69 1 0 12 70 1 0 12 71 1 0 13 72 1 0 13 73 1 0 14 74 1 0 14 75 1 0 15 76 1 0 16 77 1 0 17 78 1 0 18 79 1 0 19 80 1 6 20 81 1 0 20 82 1 0 21 83 1 0 22 84 1 0 25 85 1 0 25 86 1 0 26 87 1 0 26 88 1 0 27 89 1 0 27 90 1 0 28 91 1 0 29 92 1 0 30 93 1 0 30 94 1 0 31 95 1 1 32 96 1 1 33 97 1 0 34 98 1 0 34 99 1 0 35100 1 1 36101 1 0 37102 1 6 38103 1 0 39104 1 0 40105 1 6 41106 1 0 42107 1 0 42108 1 0 43109 1 0 43110 1 0 44111 1 0 44112 1 0 45113 1 0 45114 1 0 46115 1 0 46116 1 0 46117 1 0 M END PDB for HMDB0290164 (Cer(t18:0/PGF2alpha))HEADER PROTEIN 16-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 16-SEP-21 0 HETATM 1 O UNK 0 -5.656 -9.072 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 -6.990 -9.842 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -6.990 -11.382 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -8.323 -12.152 0.000 0.00 0.00 C+0 HETATM 5 O UNK 0 -8.323 -13.692 0.000 0.00 0.00 O+0 HETATM 6 C UNK 0 -9.657 -11.382 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 -9.657 -9.842 0.000 0.00 0.00 O+0 HETATM 8 C UNK 0 -10.991 -12.152 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -12.324 -11.382 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -13.658 -12.152 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -14.992 -11.382 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -16.325 -12.152 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -17.659 -11.382 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -18.993 -12.152 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -20.326 -11.382 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 -21.660 -12.152 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -22.994 -11.382 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -24.327 -12.152 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -25.661 -11.382 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -26.995 -12.152 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -28.329 -11.382 0.000 0.00 0.00 C+0 HETATM 22 N UNK 0 -5.656 -12.152 0.000 0.00 0.00 N+0 HETATM 23 C UNK 0 -4.322 -11.382 0.000 0.00 0.00 C+0 HETATM 24 O UNK 0 -4.322 -9.842 0.000 0.00 0.00 O+0 HETATM 25 C UNK 0 -2.989 -12.152 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -1.655 -11.382 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -0.321 -12.152 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 1.012 -11.382 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 2.346 -12.152 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 3.680 -11.382 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 3.680 -9.842 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 2.434 -8.937 0.000 0.00 0.00 C+0 HETATM 33 O UNK 0 0.969 -9.413 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 2.910 -7.472 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 4.450 -7.472 0.000 0.00 0.00 C+0 HETATM 36 O UNK 0 5.355 -6.226 0.000 0.00 0.00 O+0 HETATM 37 C UNK 0 4.926 -8.937 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 6.390 -9.413 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 6.710 -10.919 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 8.175 -11.395 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 8.495 -12.901 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 9.320 -10.364 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 10.784 -10.840 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 11.929 -9.810 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 13.393 -10.286 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 14.538 -9.255 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 22 CONECT 4 3 5 6 CONECT 5 4 CONECT 6 4 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 CONECT 16 15 17 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 20 CONECT 20 19 21 CONECT 21 20 CONECT 22 3 23 CONECT 23 22 24 25 CONECT 24 23 CONECT 25 23 26 CONECT 26 25 27 CONECT 27 26 28 CONECT 28 27 29 CONECT 29 28 30 CONECT 30 29 31 CONECT 31 30 32 37 CONECT 32 31 33 34 CONECT 33 32 CONECT 34 32 35 CONECT 35 34 36 37 CONECT 36 35 CONECT 37 35 31 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 41 42 CONECT 41 40 CONECT 42 40 43 CONECT 43 42 44 CONECT 44 43 45 CONECT 45 44 46 CONECT 46 45 MASTER 0 0 0 0 0 0 0 0 46 0 92 0 END 3D PDB for HMDB0290164 (Cer(t18:0/PGF2alpha))COMPND HMDB0290164 HETATM 1 C1 UNL 1 12.231 -1.810 -1.925 1.00 0.00 C HETATM 2 C2 UNL 1 13.138 -1.012 -0.988 1.00 0.00 C HETATM 3 C3 UNL 1 13.580 -1.802 0.174 1.00 0.00 C HETATM 4 C4 UNL 1 12.615 -2.352 1.134 1.00 0.00 C HETATM 5 C5 UNL 1 11.809 -1.428 1.933 1.00 0.00 C HETATM 6 C6 UNL 1 10.848 -0.496 1.309 1.00 0.00 C HETATM 7 C7 UNL 1 9.735 -1.135 0.517 1.00 0.00 C HETATM 8 C8 UNL 1 8.880 -0.041 -0.078 1.00 0.00 C HETATM 9 C9 UNL 1 8.272 0.776 1.019 1.00 0.00 C HETATM 10 C10 UNL 1 7.386 1.906 0.495 1.00 0.00 C HETATM 11 C11 UNL 1 6.269 1.429 -0.370 1.00 0.00 C HETATM 12 C12 UNL 1 5.336 0.453 0.248 1.00 0.00 C HETATM 13 C13 UNL 1 4.691 1.020 1.481 1.00 0.00 C HETATM 14 C14 UNL 1 3.755 0.094 2.145 1.00 0.00 C HETATM 15 C15 UNL 1 2.569 -0.417 1.402 1.00 0.00 C HETATM 16 O1 UNL 1 1.978 -1.311 2.426 1.00 0.00 O HETATM 17 C16 UNL 1 1.508 0.548 1.040 1.00 0.00 C HETATM 18 O2 UNL 1 1.139 1.400 2.045 1.00 0.00 O HETATM 19 C17 UNL 1 1.506 1.046 -0.342 1.00 0.00 C HETATM 20 C18 UNL 1 2.273 2.338 -0.592 1.00 0.00 C HETATM 21 O3 UNL 1 1.896 3.370 0.230 1.00 0.00 O HETATM 22 N1 UNL 1 0.071 1.396 -0.645 1.00 0.00 N HETATM 23 C19 UNL 1 -0.511 1.061 -1.883 1.00 0.00 C HETATM 24 O4 UNL 1 0.192 0.458 -2.732 1.00 0.00 O HETATM 25 C20 UNL 1 -1.908 1.405 -2.200 1.00 0.00 C HETATM 26 C21 UNL 1 -2.229 1.131 -3.660 1.00 0.00 C HETATM 27 C22 UNL 1 -3.632 1.502 -4.001 1.00 0.00 C HETATM 28 C23 UNL 1 -4.677 0.774 -3.271 1.00 0.00 C HETATM 29 C24 UNL 1 -5.518 1.475 -2.491 1.00 0.00 C HETATM 30 C25 UNL 1 -6.602 0.810 -1.724 1.00 0.00 C HETATM 31 C26 UNL 1 -6.397 1.036 -0.271 1.00 0.00 C HETATM 32 C27 UNL 1 -6.375 2.498 0.157 1.00 0.00 C HETATM 33 O5 UNL 1 -7.468 3.195 -0.306 1.00 0.00 O HETATM 34 C28 UNL 1 -6.545 2.373 1.683 1.00 0.00 C HETATM 35 C29 UNL 1 -7.205 0.994 1.899 1.00 0.00 C HETATM 36 O6 UNL 1 -8.277 1.114 2.753 1.00 0.00 O HETATM 37 C30 UNL 1 -7.635 0.610 0.534 1.00 0.00 C HETATM 38 C31 UNL 1 -8.094 -0.731 0.285 1.00 0.00 C HETATM 39 C32 UNL 1 -8.203 -1.728 1.155 1.00 0.00 C HETATM 40 C33 UNL 1 -8.703 -3.075 0.736 1.00 0.00 C HETATM 41 O7 UNL 1 -8.825 -3.860 1.876 1.00 0.00 O HETATM 42 C34 UNL 1 -10.137 -2.927 0.168 1.00 0.00 C HETATM 43 C35 UNL 1 -10.990 -2.365 1.262 1.00 0.00 C HETATM 44 C36 UNL 1 -12.416 -2.160 0.939 1.00 0.00 C HETATM 45 C37 UNL 1 -12.773 -1.220 -0.153 1.00 0.00 C HETATM 46 C38 UNL 1 -12.287 -1.543 -1.519 1.00 0.00 C HETATM 47 H1 UNL 1 12.725 -2.052 -2.874 1.00 0.00 H HETATM 48 H2 UNL 1 11.949 -2.743 -1.385 1.00 0.00 H HETATM 49 H3 UNL 1 11.342 -1.204 -2.116 1.00 0.00 H HETATM 50 H4 UNL 1 12.750 -0.020 -0.774 1.00 0.00 H HETATM 51 H5 UNL 1 14.081 -0.796 -1.609 1.00 0.00 H HETATM 52 H6 UNL 1 14.350 -1.199 0.736 1.00 0.00 H HETATM 53 H7 UNL 1 14.216 -2.659 -0.250 1.00 0.00 H HETATM 54 H8 UNL 1 11.935 -3.135 0.632 1.00 0.00 H HETATM 55 H9 UNL 1 13.244 -2.952 1.891 1.00 0.00 H HETATM 56 H10 UNL 1 12.523 -0.795 2.539 1.00 0.00 H HETATM 57 H11 UNL 1 11.261 -2.016 2.758 1.00 0.00 H HETATM 58 H12 UNL 1 11.224 0.390 0.814 1.00 0.00 H HETATM 59 H13 UNL 1 10.280 -0.046 2.222 1.00 0.00 H HETATM 60 H14 UNL 1 9.075 -1.698 1.262 1.00 0.00 H HETATM 61 H15 UNL 1 10.046 -1.896 -0.206 1.00 0.00 H HETATM 62 H16 UNL 1 8.118 -0.437 -0.781 1.00 0.00 H HETATM 63 H17 UNL 1 9.607 0.622 -0.638 1.00 0.00 H HETATM 64 H18 UNL 1 7.672 0.131 1.670 1.00 0.00 H HETATM 65 H19 UNL 1 9.040 1.310 1.633 1.00 0.00 H HETATM 66 H20 UNL 1 7.067 2.569 1.322 1.00 0.00 H HETATM 67 H21 UNL 1 8.059 2.546 -0.134 1.00 0.00 H HETATM 68 H22 UNL 1 5.703 2.328 -0.694 1.00 0.00 H HETATM 69 H23 UNL 1 6.738 0.968 -1.282 1.00 0.00 H HETATM 70 H24 UNL 1 4.536 0.221 -0.502 1.00 0.00 H HETATM 71 H25 UNL 1 5.813 -0.539 0.448 1.00 0.00 H HETATM 72 H26 UNL 1 5.564 1.139 2.231 1.00 0.00 H HETATM 73 H27 UNL 1 4.375 2.040 1.306 1.00 0.00 H HETATM 74 H28 UNL 1 4.346 -0.818 2.448 1.00 0.00 H HETATM 75 H29 UNL 1 3.477 0.553 3.131 1.00 0.00 H HETATM 76 H30 UNL 1 2.886 -1.117 0.624 1.00 0.00 H HETATM 77 H31 UNL 1 1.012 -1.345 2.239 1.00 0.00 H HETATM 78 H32 UNL 1 0.531 -0.187 1.061 1.00 0.00 H HETATM 79 H33 UNL 1 1.372 0.984 2.903 1.00 0.00 H HETATM 80 H34 UNL 1 1.798 0.351 -1.131 1.00 0.00 H HETATM 81 H35 UNL 1 3.327 2.254 -0.720 1.00 0.00 H HETATM 82 H36 UNL 1 1.871 2.658 -1.630 1.00 0.00 H HETATM 83 H37 UNL 1 1.586 4.192 -0.233 1.00 0.00 H HETATM 84 H38 UNL 1 -0.451 1.884 0.082 1.00 0.00 H HETATM 85 H39 UNL 1 -2.040 2.490 -2.028 1.00 0.00 H HETATM 86 H40 UNL 1 -2.646 0.905 -1.533 1.00 0.00 H HETATM 87 H41 UNL 1 -1.551 1.695 -4.326 1.00 0.00 H HETATM 88 H42 UNL 1 -2.083 0.051 -3.914 1.00 0.00 H HETATM 89 H43 UNL 1 -3.706 2.620 -3.823 1.00 0.00 H HETATM 90 H44 UNL 1 -3.765 1.414 -5.118 1.00 0.00 H HETATM 91 H45 UNL 1 -4.821 -0.302 -3.318 1.00 0.00 H HETATM 92 H46 UNL 1 -5.374 2.569 -2.440 1.00 0.00 H HETATM 93 H47 UNL 1 -6.514 -0.285 -1.908 1.00 0.00 H HETATM 94 H48 UNL 1 -7.607 1.106 -2.084 1.00 0.00 H HETATM 95 H49 UNL 1 -5.481 0.568 0.088 1.00 0.00 H HETATM 96 H50 UNL 1 -5.430 2.967 -0.108 1.00 0.00 H HETATM 97 H51 UNL 1 -8.179 3.350 0.330 1.00 0.00 H HETATM 98 H52 UNL 1 -5.562 2.432 2.140 1.00 0.00 H HETATM 99 H53 UNL 1 -7.184 3.182 2.084 1.00 0.00 H HETATM 100 H54 UNL 1 -6.405 0.353 2.322 1.00 0.00 H HETATM 101 H55 UNL 1 -8.186 0.519 3.531 1.00 0.00 H HETATM 102 H56 UNL 1 -8.428 1.340 0.217 1.00 0.00 H HETATM 103 H57 UNL 1 -8.397 -0.976 -0.753 1.00 0.00 H HETATM 104 H58 UNL 1 -7.909 -1.503 2.175 1.00 0.00 H HETATM 105 H59 UNL 1 -8.066 -3.586 0.020 1.00 0.00 H HETATM 106 H60 UNL 1 -9.007 -3.294 2.669 1.00 0.00 H HETATM 107 H61 UNL 1 -10.001 -2.268 -0.707 1.00 0.00 H HETATM 108 H62 UNL 1 -10.493 -3.928 -0.069 1.00 0.00 H HETATM 109 H63 UNL 1 -10.959 -3.142 2.092 1.00 0.00 H HETATM 110 H64 UNL 1 -10.515 -1.468 1.740 1.00 0.00 H HETATM 111 H65 UNL 1 -12.990 -1.803 1.856 1.00 0.00 H HETATM 112 H66 UNL 1 -12.884 -3.164 0.745 1.00 0.00 H HETATM 113 H67 UNL 1 -13.910 -1.177 -0.193 1.00 0.00 H HETATM 114 H68 UNL 1 -12.517 -0.147 0.122 1.00 0.00 H HETATM 115 H69 UNL 1 -12.115 -2.611 -1.647 1.00 0.00 H HETATM 116 H70 UNL 1 -13.131 -1.309 -2.249 1.00 0.00 H HETATM 117 H71 UNL 1 -11.466 -0.881 -1.874 1.00 0.00 H CONECT 1 2 47 48 49 CONECT 2 3 50 51 CONECT 3 4 52 53 CONECT 4 5 54 55 CONECT 5 6 56 57 CONECT 6 7 58 59 CONECT 7 8 60 61 CONECT 8 9 62 63 CONECT 9 10 64 65 CONECT 10 11 66 67 CONECT 11 12 68 69 CONECT 12 13 70 71 CONECT 13 14 72 73 CONECT 14 15 74 75 CONECT 15 16 17 76 CONECT 16 77 CONECT 17 18 19 78 CONECT 18 79 CONECT 19 20 22 80 CONECT 20 21 81 82 CONECT 21 83 CONECT 22 23 84 CONECT 23 24 24 25 CONECT 25 26 85 86 CONECT 26 27 87 88 CONECT 27 28 89 90 CONECT 28 29 29 91 CONECT 29 30 92 CONECT 30 31 93 94 CONECT 31 32 37 95 CONECT 32 33 34 96 CONECT 33 97 CONECT 34 35 98 99 CONECT 35 36 37 100 CONECT 36 101 CONECT 37 38 102 CONECT 38 39 39 103 CONECT 39 40 104 CONECT 40 41 42 105 CONECT 41 106 CONECT 42 43 107 108 CONECT 43 44 109 110 CONECT 44 45 111 112 CONECT 45 46 113 114 CONECT 46 115 116 117 END SMILES for HMDB0290164 (Cer(t18:0/PGF2alpha))CCCCCCCCCCCCCCC(O)C(O)[C@H](CO)NC(=O)CCC\C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)CCCCC INCHI for HMDB0290164 (Cer(t18:0/PGF2alpha))InChI=1S/C38H71NO7/c1-3-5-7-8-9-10-11-12-13-14-15-20-24-34(42)38(46)33(29-40)39-37(45)25-21-17-16-19-23-31-32(36(44)28-35(31)43)27-26-30(41)22-18-6-4-2/h16,19,26-27,30-36,38,40-44,46H,3-15,17-18,20-25,28-29H2,1-2H3,(H,39,45)/b19-16+,27-26+/t30-,31+,32+,33-,34?,35-,36+,38?/m0/s1 3D Structure for HMDB0290164 (Cer(t18:0/PGF2alpha)) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C38H71NO7 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 653.986 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 653.52305363 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (5E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]-N-[(2S)-1,3,4-trihydroxyoctadecan-2-yl]hept-5-enamide | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (5E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]-N-[(2S)-1,3,4-trihydroxyoctadecan-2-yl]hept-5-enamide | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCCCCCCCCCCC(O)C(O)[C@H](CO)NC(=O)CCC\C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)CCCCC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C38H71NO7/c1-3-5-7-8-9-10-11-12-13-14-15-20-24-34(42)38(46)33(29-40)39-37(45)25-21-17-16-19-23-31-32(36(44)28-35(31)43)27-26-30(41)22-18-6-4-2/h16,19,26-27,30-36,38,40-44,46H,3-15,17-18,20-25,28-29H2,1-2H3,(H,39,45)/b19-16+,27-26+/t30-,31+,32+,33-,34?,35-,36+,38?/m0/s1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | HETQVXXRQGXRHI-ZVMBDRQCSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Health effect
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |