| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 14.5731 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.91 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1987.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 553.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 188.3 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 346.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 112.6 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 547.2 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 649.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 314.5 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1054.9 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 401.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1301.0 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 379.2 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 341.8 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 540.6 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 511.8 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 72.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #1 | CC(=O)C(S[Si](C)(C)C)C(C)C | 1137.8 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #1 | CC(=O)C(S[Si](C)(C)C)C(C)C | 1141.2 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #1 | CC(=O)C(S[Si](C)(C)C)C(C)C | 1229.8 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #2 | CC(O[Si](C)(C)C)=C(S)C(C)C | 1249.5 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #2 | CC(O[Si](C)(C)C)=C(S)C(C)C | 1158.1 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #2 | CC(O[Si](C)(C)C)=C(S)C(C)C | 1365.6 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #3 | C=C(O[Si](C)(C)C)C(S)C(C)C | 1119.3 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #3 | C=C(O[Si](C)(C)C)C(S)C(C)C | 1132.4 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TMS,isomer #3 | C=C(O[Si](C)(C)C)C(S)C(C)C | 1373.9 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C(S[Si](C)(C)C)C(C)C | 1295.8 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C(S[Si](C)(C)C)C(C)C | 1300.6 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C(S[Si](C)(C)C)C(C)C | 1272.8 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)C(S[Si](C)(C)C)C(C)C | 1267.0 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)C(S[Si](C)(C)C)C(C)C | 1303.8 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)C(S[Si](C)(C)C)C(C)C | 1257.8 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #1 | CC(=O)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1373.3 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #1 | CC(=O)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1392.9 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #1 | CC(=O)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1391.4 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #2 | CC(O[Si](C)(C)C(C)(C)C)=C(S)C(C)C | 1464.0 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #2 | CC(O[Si](C)(C)C(C)(C)C)=C(S)C(C)C | 1385.4 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #2 | CC(O[Si](C)(C)C(C)(C)C)=C(S)C(C)C | 1570.9 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)C(S)C(C)C | 1343.7 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)C(S)C(C)C | 1342.0 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,1TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)C(S)C(C)C | 1567.2 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C(S[Si](C)(C)C(C)(C)C)C(C)C | 1767.9 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C(S[Si](C)(C)C(C)(C)C)C(C)C | 1704.1 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C(S[Si](C)(C)C(C)(C)C)C(C)C | 1589.4 | Standard polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1699.7 | Semi standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1730.9 | Standard non polar | 33892256 |
| 3-mercapto-4-methyl-2-pentanone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)C(S[Si](C)(C)C(C)(C)C)C(C)C | 1579.3 | Standard polar | 33892256 |