Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2021-09-14 15:18:09 UTC
HMDB IDHMDB0001143
Secondary Accession Numbers
  • HMDB01143
Metabolite Identification
Common NameInositol 1,3,4-trisphosphate
DescriptionInositol 1,3,4-trisphosphate (CAS: 98102-63-7), also known as Ins(1,3,4)P3 or I3S, belongs to the class of organic compounds known as inositol phosphates. Inositol phosphates are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety. Within humans, inositol 1,3,4-trisphosphate participates in several enzymatic reactions. In particular, inositol 1,3,4-trisphosphate can be converted into 1D-myo-inositol 1,3,4,6-tetrakisphosphate through the action of the enzyme inositol-tetrakisphosphate 1-kinase. In addition, inositol 1,3,4-trisphosphate can be converted into inositol 1,3,4,5-tetraphosphate through its interaction with the enzyme inositol-tetrakisphosphate 1-kinase. In humans, inositol 1,3,4-trisphosphate is involved in inositol metabolism. Inositol 1,3,4-trisphosphate is a specific regulator of cellular signalling.
Structure
Data?1600457919
Synonyms
ValueSource
(1S,3S,4S)-1,3,4-TRIPHOSPHO-myo-inositolChEBI
D-Myo-inositol 1,3,4-trisphosphateChEBI
D-Myo-inositol 1,3,4-trisphosphoric acidGenerator
Inositol 1,3,4-trisphosphoric acidGenerator
1,3,4-ItpHMDB
1D-Myo-inositol 1,3,4-trisphosphateHMDB
I3SHMDB
Inositol 1,3,4-triphosphateHMDB
Myo-inositol 1,3,4-trisphosphateHMDB
Inositol 1,3,4-trisphosphate, (D)-isomerHMDB
D-myo-Inositol 1,3,4-tris(phosphate)HMDB
Inositol 1,3,4-trisphosphateHMDB
Ins(1,3,4)P3HMDB
Chemical FormulaC6H15O15P3
Average Molecular Weight420.0956
Monoisotopic Molecular Weight419.962379346
IUPAC Name{[(1S,2R,3R,4S,5S,6S)-2,3,5-trihydroxy-4,6-bis(phosphonooxy)cyclohexyl]oxy}phosphonic acid
Traditional Nameinositol 1,3,4-trisphosphate
CAS Registry Number93133-76-7
SMILES
O[C@@H]1[C@@H](O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](O)[C@H]1OP(O)(O)=O
InChI Identifier
InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2-,3+,4+,5+,6+/m1/s1
InChI KeyMMWCIQZXVOZEGG-MLQGYMEPSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as inositol phosphates. Inositol phosphates are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassAlcohols and polyols
Direct ParentInositol phosphates
Alternative Parents
Substituents
  • Inositol phosphate
  • Monoalkyl phosphate
  • Cyclohexanol
  • Alkyl phosphate
  • Phosphoric acid ester
  • Organic phosphoric acid derivative
  • Secondary alcohol
  • Polyol
  • Organic oxide
  • Hydrocarbon derivative
  • Aliphatic homomonocyclic compound
Molecular FrameworkAliphatic homomonocyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
Biological locationSource
Process
Role
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility14.8 g/LALOGPS
logP-0.86ALOGPS
logP-4.2ChemAxon
logS-1.4ALOGPS
pKa (Strongest Acidic)0.54ChemAxon
pKa (Strongest Basic)-3.7ChemAxon
Physiological Charge-6ChemAxon
Hydrogen Acceptor Count12ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area260.97 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity68.39 m³·mol⁻¹ChemAxon
Polarizability29.73 ųChemAxon
Number of Rings1ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+189.99231661259
DarkChem[M-H]-181.531661259
AllCCS[M+H]+183.15732859911
AllCCS[M-H]-168.56432859911
DeepCCS[M+H]+158.03730932474
DeepCCS[M-H]-155.6430932474
DeepCCS[M-2H]-188.52330932474
DeepCCS[M+Na]+164.430932474
AllCCS[M+H]+183.232859911
AllCCS[M+H-H2O]+180.832859911
AllCCS[M+NH4]+185.332859911
AllCCS[M+Na]+186.032859911
AllCCS[M-H]-168.632859911
AllCCS[M+Na-2H]-168.532859911
AllCCS[M+HCOO]-168.632859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Inositol 1,3,4-trisphosphateO[C@@H]1[C@@H](O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](O)[C@H]1OP(O)(O)=O3125.6Standard polar33892256
Inositol 1,3,4-trisphosphateO[C@@H]1[C@@H](O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](O)[C@H]1OP(O)(O)=O2687.1Standard non polar33892256
Inositol 1,3,4-trisphosphateO[C@@H]1[C@@H](O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](O)[C@H]1OP(O)(O)=O3536.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Inositol 1,3,4-trisphosphate,1TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O2878.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TMS,isomer #2C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2881.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2890.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TMS,isomer #4C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O2988.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TMS,isomer #5C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2987.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TMS,isomer #6C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O2985.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2852.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2918.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2917.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2919.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #13C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O)O[Si](C)(C)C2954.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #14C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3005.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #15C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H]1O3008.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #16C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O)O[Si](C)(C)C2958.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #17C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3009.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #18C[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O)O[Si](C)(C)C2955.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2846.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O2910.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2910.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2910.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2848.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2914.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2912.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2912.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2820.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2933.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2904.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2934.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2905.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2868.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2870.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2867.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #17C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2913.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #18C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2938.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #19C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2940.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #2C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2870.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #20C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2907.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #21C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2935.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #22C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2905.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2921.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2948.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2951.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2919.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2948.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2919.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #29C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3000.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2866.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #30C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3002.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #31C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3002.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #32C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3034.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #33C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3001.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #34C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3009.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #35C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3004.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2866.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2865.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2861.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2866.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O2904.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2932.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2859.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3018.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4506.6Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2872.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3077.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4368.9Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2902.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3045.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4383.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2904.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4383.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2870.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3075.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4371.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2902.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3045.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4384.0Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2871.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3076.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4369.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2922.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3097.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O4245.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2920.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3097.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4245.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2922.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3097.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O4245.1Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2956.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3064.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4264.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2858.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3018.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4506.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2918.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3097.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4244.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2921.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3097.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4244.9Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2919.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3098.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4244.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2872.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3077.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O4370.0Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2907.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3048.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O4386.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2905.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4387.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2876.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3077.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O4373.5Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2907.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4388.6Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2872.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3079.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4377.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2931.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3096.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O4250.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2859.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3019.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4507.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2930.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3094.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O4251.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2931.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3097.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O4252.2Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2965.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3061.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O4271.5Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2925.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3096.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O4255.1Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2928.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3097.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O4252.9Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2924.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3098.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O4254.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2929.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3091.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O4300.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2928.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3091.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4300.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2929.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3091.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O4303.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2965.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3058.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4321.1Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2874.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3065.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C4367.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2926.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3091.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4303.2Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2927.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3092.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4303.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2926.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3092.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4303.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2965.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3148.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4165.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3004.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3096.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4185.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C2958.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C3151.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C4165.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H]1O3009.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H]1O3097.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H]1O4185.0Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3004.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3097.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4185.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O)O[Si](C)(C)C2967.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O)O[Si](C)(C)C3152.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O)O[Si](C)(C)C4164.9Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2904.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3037.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C4382.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2903.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3038.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4382.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2872.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3065.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C4369.6Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2901.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3037.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4382.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2869.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3067.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4371.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2885.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3017.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4217.7Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2962.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3006.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4135.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2925.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3033.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4117.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2927.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3030.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4116.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2924.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3031.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4117.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2930.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3043.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4116.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2930.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3046.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4116.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2933.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3042.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4119.0Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2964.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3017.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4136.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2930.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3047.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4116.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2931.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3042.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4119.1Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2916.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2993.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4230.7Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2929.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3043.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4117.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O2949.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3093.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3996.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2979.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3058.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4018.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2948.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3093.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3996.5Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2978.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3058.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4018.0Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2978.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3058.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4017.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2948.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3094.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3996.0Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2931.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3047.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O4116.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2929.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3046.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4116.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2932.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3047.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O4118.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2916.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2994.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4231.5Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2964.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3021.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4138.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2928.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3046.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4121.9Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2934.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3047.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4120.3Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2932.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3047.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4123.1Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O2961.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3092.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O4001.3Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2990.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3053.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O4023.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2955.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3090.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O4003.7Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2990.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3054.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O4024.1Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2985.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3054.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O4025.9Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2954.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3089.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O4004.5Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2885.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3017.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4218.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O2933.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3087.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O4054.0Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2964.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3051.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4073.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2933.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3088.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4053.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2965.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3052.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4075.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2963.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3052.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4075.4Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2932.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3086.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4056.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O2996.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3096.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3956.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2992.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3096.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3956.5Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O2994.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3097.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O3956.2Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2916.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2994.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4231.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2885.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3019.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4219.6Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2927.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3031.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C4114.8Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2927.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3033.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4115.0Standard polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2930.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3030.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C4116.4Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2929.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3003.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3982.5Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2934.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3035.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3885.0Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2969.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3007.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3907.5Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2966.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3008.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3907.9Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2934.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3034.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3885.3Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2941.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3049.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3885.4Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2969.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3022.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3907.6Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2937.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3052.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3884.2Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2970.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3021.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3908.5Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2968.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3022.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3907.4Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2938.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3048.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3885.3Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2928.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3007.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3982.7Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C2979.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3053.4Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3809.1Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2977.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3054.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3808.8Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2977.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3054.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3808.5Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O2937.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3054.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3884.0Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2969.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3025.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3907.1Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2935.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3052.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3885.2Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2969.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3025.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3908.7Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2968.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3025.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3909.9Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2938.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3053.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3887.6Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O2991.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3048.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O3812.6Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2929.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3003.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3982.8Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2987.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3047.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #30C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3813.7Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O2987.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3047.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O3813.9Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2973.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3857.4Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2971.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3049.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3857.2Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2972.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3049.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3858.0Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #35C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2997.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #35C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3080.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #35C[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3760.0Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2962.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2987.8Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4006.6Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2927.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3008.7Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3983.8Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2928.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3007.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3983.1Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2926.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3009.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3983.9Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C2938.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3035.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C3884.7Standard polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2968.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3008.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,6TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3907.1Standard polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O3136.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3134.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3140.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3236.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3235.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3233.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3209.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3301.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3297.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3298.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C3370.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3428.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3428.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OP(=O)(O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O)O[Si](C)(C)C(C)(C)C3371.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3429.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OP(=O)(O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C3369.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3200.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O3296.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3295.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3296.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3204.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3295.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3288.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3291.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3392.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3460.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3418.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3460.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3420.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3406.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O3408.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3407.7Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3424.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3459.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3464.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3409.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O3421.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3462.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H]1O3423.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3415.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3448.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3452.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3412.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3448.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3415.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3507.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3407.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3508.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3510.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3554.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3508.8Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1O3517.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)OP(=O)(O)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O3514.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3408.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3408.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3404.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3406.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O3418.4Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3456.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3636.1Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3694.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O4663.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3615.9Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3709.5Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O4564.0Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3632.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3709.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O4561.1Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3631.2Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3712.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C4560.9Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3613.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3707.0Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O4566.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3630.6Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3709.9Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C4561.3Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3610.3Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3709.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4564.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3622.0Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3711.1Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O4458.7Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3625.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3710.6Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C4458.6Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3622.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O3711.3Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O4458.4Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3644.5Semi standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C3710.2Standard non polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C(C)(C)C4454.8Standard polar33892256
Inositol 1,3,4-trisphosphate,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OP(=O)(O)O3635.5Semi standard non polar33892256
Inositol 1,3,4-tr