Hmdb loader
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2009-02-03 12:29:32 UTC
Update Date2021-09-14 15:18:09 UTC
HMDB IDHMDB0011668
Secondary Accession Numbers
  • HMDB11668
Metabolite Identification
Common Name6-(alpha-D-Glucosaminyl)-1D-myo-inositol
Description6-(alpha-D-Glucosaminyl)-1D-myo-inositol, also known as glucosaminyl-(a-6)-D-myo-inositol, belongs to the class of organic compounds known as aminocyclitol glycosides. These are organic compounds containing an amicocyclitol moiety glycosidically linked to a carbohydrate moiety. There are two major classes of aminoglycosides containing a 2-streptamine core. They are called 4,5- and 4,6-disubstituted 2-deoxystreptamines. 6-(alpha-D-Glucosaminyl)-1D-myo-inositol has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make 6-(alpha-D-glucosaminyl)-1D-myo-inositol a potential biomarker for the consumption of these foods. 6-(alpha-D-Glucosaminyl)-1D-myo-inositol is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review very few articles have been published on 6-(alpha-D-Glucosaminyl)-1D-myo-inositol.
Structure
Data?1582752936
Synonyms
ValueSource
GLUCOSAMINYL-(ALPHA-6)-D-myo-inositolChEBI
GLUCOSAMINYL-(a-6)-D-myo-inositolGenerator
GLUCOSAMINYL-(α-6)-D-myo-inositolGenerator
6-(a-D-Glucosaminyl)-1D-myo-inositolGenerator
6-(Α-D-glucosaminyl)-1D-myo-inositolGenerator
(1R,2R,3R,4R,5R,6S)-2,3,4,5,6-Pentahydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranosideHMDB
(1R,2R,3R,4R,5R,6S)-2,3,4,5,6-Pentahydroxycyclohexyl 2-amino-2-deoxy-alpha-delta-glucopyranosideHMDB
6-O-(2-amino-2-Deoxy-alpha-D-glucopyranosyl)-1D-myo-inositolHMDB
6-O-(2-amino-2-Deoxy-alpha-delta-glucopyranosyl)-1D-myo-inositolHMDB
Glucosaminyl-(alpha-6)-delta-myo-inositolHMDB
MYGHMDB
Chemical FormulaC12H23NO10
Average Molecular Weight341.3117
Monoisotopic Molecular Weight341.132195961
IUPAC Name(1R,2R,3R,4R,5S,6R)-6-{[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4,5-pentol
Traditional Name(1R,2R,3R,4R,5S,6R)-6-{[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4,5-pentol
CAS Registry NumberNot Available
SMILES
N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O
InChI Identifier
InChI=1S/C12H23NO10/c13-3-5(16)4(15)2(1-14)22-12(3)23-11-9(20)7(18)6(17)8(19)10(11)21/h2-12,14-21H,1,13H2/t2-,3-,4-,5-,6-,7-,8-,9+,10-,11-,12-/m1/s1
InChI KeyHEPUIGACZYVUCD-YZRQSVRMSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as aminocyclitol glycosides. These are organic compounds containing an amicocyclitol moiety glycosidically linked to a carbohydrate moiety. There are two major classes of aminoglycosides containing a 2-streptamine core. They are called 4,5- and 4,6-disubstituted 2-deoxystreptamines.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentAminocyclitol glycosides
Alternative Parents
Substituents
  • Amino cyclitol glycoside
  • Glycosyl compound
  • O-glycosyl compound
  • Cyclohexanol
  • Cyclitol or derivatives
  • Monosaccharide
  • Oxane
  • Cyclic alcohol
  • Secondary alcohol
  • 1,2-aminoalcohol
  • Organoheterocyclic compound
  • Polyol
  • Oxacycle
  • Acetal
  • Primary alcohol
  • Hydrocarbon derivative
  • Organopnictogen compound
  • Primary aliphatic amine
  • Organonitrogen compound
  • Organic nitrogen compound
  • Amine
  • Primary amine
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
ProcessNot Available
Role
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility387 g/LALOGPS
logP-2.8ALOGPS
logP-5.7ChemAxon
logS0.05ALOGPS
pKa (Strongest Acidic)12.25ChemAxon
pKa (Strongest Basic)8.13ChemAxon
Physiological Charge1ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area206.32 ŲChemAxon
Rotatable Bond Count3ChemAxon
Refractivity69.85 m³·mol⁻¹ChemAxon
Polarizability31.59 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+175.36131661259
DarkChem[M-H]-173.34731661259
DeepCCS[M+H]+177.57530932474
DeepCCS[M-H]-175.67130932474
DeepCCS[M-2H]-209.12330932474
DeepCCS[M+Na]+183.31630932474
AllCCS[M+H]+178.832859911
AllCCS[M+H-H2O]+175.932859911
AllCCS[M+NH4]+181.532859911
AllCCS[M+Na]+182.332859911
AllCCS[M-H]-174.432859911
AllCCS[M+Na-2H]-173.732859911
AllCCS[M+HCOO]-173.132859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
6-(alpha-D-Glucosaminyl)-1D-myo-inositolN[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O3682.2Standard polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositolN[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O3692.5Standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositolN[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]1O3225.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@H]1O2887.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O2886.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2877.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2888.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O2894.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O2896.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #7C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O2894.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O2888.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TMS,isomer #9C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2955.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #1C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2864.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2868.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@H]1O2877.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O2886.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O2877.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2868.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #15C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2919.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2879.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2883.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2889.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2883.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O2873.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2879.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #21C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2931.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #22C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N2873.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2875.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O2884.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O[Si](C)(C)C2884.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #26C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2919.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C2890.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2882.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #29C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O2875.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O2880.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #30C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2919.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #31C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2884.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2890.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #33C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2925.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2884.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #35C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2919.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #36C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2919.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #37C[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C3052.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O2873.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O2864.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2879.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C2878.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #8C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2929.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2882.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2808.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O2785.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2788.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O2784.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #13C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2867.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2782.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O2782.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2781.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2790.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #18C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2873.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #19C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2775.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2787.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2788.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O2784.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #22C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2867.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2808.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #24C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O2787.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #25C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2866.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2860.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #27C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2891.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #28C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2888.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C3043.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N2775.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2798.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2801.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2798.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #35C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2914.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2772.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O2776.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O2776.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2773.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2785.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #40C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2884.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2776.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #42C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2798.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #43C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C2780.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #44C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2887.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #45C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2780.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #46C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2776.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #47C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2900.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #48C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2773.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #49C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2887.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O2781.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #50C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2884.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3031.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2819.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2797.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2794.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2819.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #56C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2897.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2794.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2808.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2797.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O[Si](C)(C)C2775.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #60C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2897.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2797.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2797.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #63C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2888.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2819.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #65C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2897.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #66C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2897.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3048.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #68C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2782.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #69C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N2810.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #7C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2866.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #70C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2782.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #71C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2888.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #72C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2791.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #73C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2801.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #74C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2886.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #75C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2793.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #76C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2893.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #77C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2887.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #78C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3028.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #79C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2802.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C2790.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2791.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #81C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2899.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #82C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2801.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #83C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2895.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #84C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2886.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3036.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #86C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2793.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #87C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2893.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #88C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2899.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #89C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H]1O3043.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2813.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #90C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2887.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #91C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3036.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TMS,isomer #92C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3028.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2725.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O[Si](C)(C)C2749.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #100C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #101C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2990.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #102C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2795.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #103C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2971.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #104C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2969.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2720.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2745.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2737.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #108C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2787.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2751.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #11C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2785.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2754.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #111C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2796.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2720.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #113C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2792.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #114C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2785.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2987.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2751.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2745.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #118C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2792.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2742.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2734.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #120C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2834.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #121C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2797.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2983.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2737.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #124C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2797.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #125C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2796.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2997.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #127C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2787.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2983.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2987.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N2780.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #130C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2752.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #131C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2736.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #132C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2794.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #133C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N2752.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #134C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2832.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #135C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2794.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #136C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2973.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #137C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2762.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #138C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2825.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #139C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2825.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2734.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2989.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #141C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2805.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #142C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2999.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #143C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C2984.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #144C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2762.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #145C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2822.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #146C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2825.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #147C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2990.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #148C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2825.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #149C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2981.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #15C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2792.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #150C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2989.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #151C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2805.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #152C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2999.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #153C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2990.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #154C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2984.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #16C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2783.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2778.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #18C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2805.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2750.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2737.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #20C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2810.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #21C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2794.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2974.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2776.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #24C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2783.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2741.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C2772.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #27C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2809.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #28C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2778.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2777.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2735.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2811.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #31C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2842.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2735.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H]1O2764.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #34C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2805.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2753.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #36C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2789.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #37C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2798.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2974.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2741.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2718.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2737.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2749.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #42C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2780.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2770.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #44C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2772.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #45C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2792.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #46C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2750.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #47C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2810.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #48C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2809.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #49C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H]1O2989.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2725.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2749.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #52C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2794.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2753.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #54C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2789.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #55C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2798.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #56C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O2974.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #58C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2779.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #59C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2785.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #6C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2779.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #60C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O2974.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #61C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2799.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2968.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C2982.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2734.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2735.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2732.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2726.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #68C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2797.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2732.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N2744.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2764.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2734.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #72C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2806.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2734.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2735.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #75C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2795.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2734.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #77C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2806.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #78C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2797.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2985.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2764.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2726.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #81C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2769.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #82C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2726.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #83C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2791.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #84C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2762.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2771.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #86C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2807.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #87C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2746.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #88C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #89C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2795.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O2770.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #90C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2969.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #91C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2771.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #92C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2762.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #93C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2807.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #94C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2760.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #95C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2839.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #96C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #97C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2971.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #98C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2746.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TMS,isomer #99C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2734.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2734.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #100C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2809.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #101C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2797.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2882.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2764.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2758.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #105C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2809.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2757.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #107C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2842.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #108C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2888.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2750.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2744.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #111C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2813.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #112C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2811.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2895.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #114C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2801.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2888.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2882.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #117C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2753.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #118C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O2762.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #119C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2807.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #12C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2794.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #120C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N2762.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #121C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2837.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #122C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2807.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #123C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2873.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #124C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2772.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #125C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2834.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #126C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2841.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #127C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2896.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #128C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2822.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #129C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2902.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2740.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #130C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2892.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #131C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2772.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #132C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2841.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #133C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2834.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #134C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2896.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #135C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2834.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #136C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2906.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #137C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2900.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #138C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2822.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #139C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2900.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #14C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2780.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2902.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #141C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2892.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2730.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2740.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #144C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2782.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2749.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #146C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2804.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #147C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2795.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2888.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2740.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #15C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2781.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #150C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2813.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #151C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2808.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2905.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #153C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2782.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2899.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2877.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O2749.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #157C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2813.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #158C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2804.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2899.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2884.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #160C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2808.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2910.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2898.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #163C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2795.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2898.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2905.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2888.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #167C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2765.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #168C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2821.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #169C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2812.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #17C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2766.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #170C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2887.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #171C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2821.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #172C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2895.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #173C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2887.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #174C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2834.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #175C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2900.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #176C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2904.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #177C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2909.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #178C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O2834.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #179C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2910.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #18C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N2797.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #180C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2900.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #181C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2904.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #182C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2909.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2766.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2773.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #20C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2790.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2805.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2793.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #23C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2806.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2779.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #25C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2811.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #26C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2792.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O2898.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2777.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2771.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2745.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #30C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2807.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N2777.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #32C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #33C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2807.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2885.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2784.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #36C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2829.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #37C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2825.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2902.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #39C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2821.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2752.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #40C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2910.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C2905.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #42C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2784.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2773.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #44C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2794.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #45C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2831.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2781.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #47C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O2805.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #48C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2829.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #5C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2785.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #50C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2803.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #51C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2816.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #52C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2909.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2773.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2793.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #55C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2825.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2788.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #57C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2830.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #58C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2837.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #59C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2912.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2781.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2750.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #61C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2794.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #62C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2806.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2902.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #64C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2797.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2893.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #66C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2909.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2745.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #69C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2803.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2775.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #71C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2797.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #72C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2789.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2901.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #74C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2779.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #75C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2811.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #76C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2816.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #77C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H]1O2918.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #78C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2821.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #79C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2910.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #80C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2909.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2752.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #82C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2785.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #83C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2792.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #84C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2905.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #85C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2797.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2893.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #87C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O2909.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #88C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2781.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2884.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #9C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2797.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #90C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O2898.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2908.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2730.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2758.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2744.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #95C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2801.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2764.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2758.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #98C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2811.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,5TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2730.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2746.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #10C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2818.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #100C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2843.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #101C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2834.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2912.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #103C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2818.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2909.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2891.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2763.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #107C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2843.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #108C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2836.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2909.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2928.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #110C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2841.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2923.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2917.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #113C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2838.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2917.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2912.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2910.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #117C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2778.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #118C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2837.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #119C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2844.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2752.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #120C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2917.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #121C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2844.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #122C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2911.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #123C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2917.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #124C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2861.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #125C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2932.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #126C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2932.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #127C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2939.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #128C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2861.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2932.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2766.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #130C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2932.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #131C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2941.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #132C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2939.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O2761.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #134C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2823.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #135C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2826.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2915.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #137C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2843.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2923.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2931.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #14C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2829.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #140C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2826.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2922.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2903.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2915.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #144C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2843.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2922.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2923.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2931.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2931.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #149C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O2862.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2760.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #150C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2935.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #151C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2933.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #152C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2935.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #153C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2958.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #154C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2958.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #16C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2820.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #17C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2817.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2926.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2752.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #20C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2808.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #21C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2815.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2921.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #23C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2806.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2903.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2922.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2775.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #27C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2767.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #28C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2815.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N2775.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2754.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #30C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2830.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #31C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2815.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #32C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2925.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2784.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #34C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2837.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #35C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2837.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2941.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #37C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2835.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2945.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C2943.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #4C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2808.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #40C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2780.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #41C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2837.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #42C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2831.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2935.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #44C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2837.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2931.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #46C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2935.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #47C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2856.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #48C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2952.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #49C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2949.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2757.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #50C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2953.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2757.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #52C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2784.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #53C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2856.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2762.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #55C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2834.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #56C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2844.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #57C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2961.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2766.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #59C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2829.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #60C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2837.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #61C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2952.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #62C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2826.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2936.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #64C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2955.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2758.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #66C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #67C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2837.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #68C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2949.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #69C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2839.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #7C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2936.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #71C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2958.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #72C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2815.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2921.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2941.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2930.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2765.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #77C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #78C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2826.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2936.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2765.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #80C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2817.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2926.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2947.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #83C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2835.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2945.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #85C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2955.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #86C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2953.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #87C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2818.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2928.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #89C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2943.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #9C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2826.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2930.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2922.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2749.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2754.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #94C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2818.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2763.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #96C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2836.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #97C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2838.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2910.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,6TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2754.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O2770.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #10C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2831.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2966.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #12C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2836.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2968.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2960.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2780.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #16C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2827.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #17C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2834.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2971.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #19C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2827.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2775.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2952.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2957.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #22C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2820.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2954.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2956.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2944.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2790.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #27C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2838.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #28C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2829.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O2977.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #3C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2821.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #30C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2838.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2974.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2977.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #33C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2852.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2994.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2990.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2991.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #37C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C2857.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2982.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2984.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2780.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2982.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #41C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3002.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2783.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #43C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2839.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #44C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2852.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #45C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3002.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #46C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2842.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2981.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #48C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3003.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #49C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2834.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #5C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2827.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2971.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2994.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2972.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #53C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2831.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2966.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2990.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2967.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2956.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #58C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2836.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2968.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #6C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2820.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2972.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2957.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #62C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2991.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2960.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C2776.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #65C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2849.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #66C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2855.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2946.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #68C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2866.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2958.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2954.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2962.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #71C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2855.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2960.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2943.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2946.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #75C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2866.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2960.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2958.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2969.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2962.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2783.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #80C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O2863.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #81C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C2973.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #82C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O2974.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #83C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C2973.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #84C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2994.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #85C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2994.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #86C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O2849.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2962.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2962.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2981.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #9C[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2839.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2962.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O2981.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,7TMS,isomer #92C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2985.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3121.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O3117.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3130.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3123.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O3133.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O3146.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O3133.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3123.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3200.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3340.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3337.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@H]1O3346.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O3364.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3346.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3337.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3373.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3331.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3337.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3349.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3337.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O3358.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3331.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3365.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3344.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3365.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3366.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O[Si](C)(C)C(C)(C)C3354.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3371.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3366.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3362.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H]1O3365.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O3378.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3390.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3366.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3366.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3415.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3354.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3390.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3371.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #37CC(C)(C)[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C3505.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O3358.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3340.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3335.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C3335.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3371.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3334.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3500.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O3520.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3508.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O3496.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3526.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3523.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O3509.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3521.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3516.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3537.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3499.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3491.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3508.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O3496.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3526.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3500.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3491.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3512.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3512.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3502.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3497.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3663.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N3490.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3501.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3497.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3513.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3497.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3501.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3511.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3477.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3510.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3509.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3492.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3520.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3518.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3510.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3521.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3505.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3528.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3505.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3509.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3545.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3492.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3528.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3521.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3518.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3661.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3497.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3503.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3506.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3483.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3507.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3506.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3518.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3505.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O[Si](C)(C)C(C)(C)C3499.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3520.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3505.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3503.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3535.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3497.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3520.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3507.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3668.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3500.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3513.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3512.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3500.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3515.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3516.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3511.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3543.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3515.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3541.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3525.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #78CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3668.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3510.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3516.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3516.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #81CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3543.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #82CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3511.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #83CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3561.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #84CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3543.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #85CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3680.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #86CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3515.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #87CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3541.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #88CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3543.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O3703.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3535.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #90CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3525.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3680.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,3TBDMS,isomer #92CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3668.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3633.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O[Si](C)(C)C(C)(C)C3625.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3689.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3821.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3667.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3808.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3803.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3620.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #106CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3637.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #107CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3633.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #108CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3654.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #109CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3637.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3643.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #110CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3639.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #111CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3673.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #112CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3620.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #113CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3676.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #114CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3645.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #115CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3813.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #116CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3637.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #117CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3637.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #118CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3676.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #119CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3638.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O3651.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #120CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3693.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #121CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3674.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #122CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3819.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #123CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3633.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #124CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3674.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #125CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3673.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #126CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3835.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #127CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3654.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #128CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3819.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #129CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3814.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N3677.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #130CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3647.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #131CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3640.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #132CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3673.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #133CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3647.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #134CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3695.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #135CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3673.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #136CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3813.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #137CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3651.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #138CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3688.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #139CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3689.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3651.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #140CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3823.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #141CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3682.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #142CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3822.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #143CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3816.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #144CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3651.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #145CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3694.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #146CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3688.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #147CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3823.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #148CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3689.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #149CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3822.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3655.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #150CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3823.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #151CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3682.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #152CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3822.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #153CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3823.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #154CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3816.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3675.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3675.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3687.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3662.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3657.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3687.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3659.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3804.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3671.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3675.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3658.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3655.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3685.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3675.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3671.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3660.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3679.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3708.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3660.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H]1O3658.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3687.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3643.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3668.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3661.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3811.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3658.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3621.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3657.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3652.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3680.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3657.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3655.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3671.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3662.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3687.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3685.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O3827.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3631.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3633.7Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3625.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3659.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3643.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3668.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3661.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3811.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3631.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3654.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3643.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3654.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O3804.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3661.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3814.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3812.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3621.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3640.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3644.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3609.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3660.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3644.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N3616.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3653.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #71CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3642.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #72CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3673.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #73CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3642.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #74CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3640.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #75CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3684.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #76CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3621.9Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #77CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3673.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #78CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3660.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #79CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3818.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3658.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3636.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3664.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #82CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3636.8Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #83CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3661.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #84CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3662.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #85CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3662.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #86CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3692.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #87CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3649.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #88CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3689.2Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #89CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3667.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3657.1Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@H](O)[C@H]1O3803.6Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #91CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3662.4Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #92CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3662.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #93CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3692.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #94CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3660.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #95CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3713.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #96CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3690.0Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #97CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O3808.3Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #98CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O3649.5Semi standard non polar33892256
6-(alpha-D-Glucosaminyl)-1D-myo-inositol,4TBDMS,isomer #99CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3690.0Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (Non-derivatized) - 70eV, Positivesplash10-0759-9365000000-8c6da9786f7f394906d02017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (4 TMS) - 70eV, Positivesplash10-03di-5404529000-a7a0a8bfeeba1060122c2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_4_132) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_4_135) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_30) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_33) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_144) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_153) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_168) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_169) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_5_171) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_4) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_20) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_41) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_42) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_44) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_120) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_134) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_135) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_136) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_140) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_143) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_6_149) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_7_3) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol GC-MS (TMS_7_5) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 10V, Positive-QTOFsplash10-0006-0309000000-3a69d8ec584e589a6d2a2017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 20V, Positive-QTOFsplash10-001i-1901000000-3d79d209918a36ad01472017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 40V, Positive-QTOFsplash10-03dm-5910000000-131ca13e015e37f1a4ff2017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 10V, Negative-QTOFsplash10-002f-6649000000-6df5fc75e9d942a90cb42017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 20V, Negative-QTOFsplash10-00b9-2911000000-f6e53b2f142c055970b42017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 40V, Negative-QTOFsplash10-056r-9800000000-e50853f70e5fa2f9f15c2017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 10V, Positive-QTOFsplash10-0006-0109000000-ea686b35e0f20640ff4c2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 20V, Positive-QTOFsplash10-000x-1901000000-f829886291326655e1f92021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 40V, Positive-QTOFsplash10-0ly6-8960000000-19b9d5066b7a677102cc2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 10V, Negative-QTOFsplash10-0006-0219000000-2d44bbf6915cfa0819b42021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 20V, Negative-QTOFsplash10-052u-4394000000-846ad64e1864fa9e9bb12021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 6-(alpha-D-Glucosaminyl)-1D-myo-inositol 40V, Negative-QTOFsplash10-0a4i-9140000000-3487891579f17cb3f9a92021-09-22Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-29Wishart Lab