Hmdb loader
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2021-09-14 15:18:17 UTC
HMDB IDHMDB0001498
Secondary Accession Numbers
  • HMDB01498
Metabolite Identification
Common Namemyo-Inositol 1,4,5-trisphosphate
Descriptionmyo-Inositol 1,4,5-trisphosphate (CAS: 20298-95-7), also known as Ins(1,4,5)P3 or InsP3, is an intracellular messenger formed by the action of phospholipase C on phosphatidylinositol 4,5-bisphosphate, which is one of the phospholipids that make up the cell membrane (PMID: 22453946 ). It is released into the cytoplasm where it releases calcium ions from internal stores within the cell's endoplasmic reticulum. These calcium ions stimulate the activity of B kinase or calmodulin (PMID: 15189149 ). Its transient accumulation is due both to the enhanced metabolism via the Ca2+-calmodulin-sensitive Ins(1,4,5)P3 kinase, as well as a down-regulation of phosphatidylinositol 4,5-bisphosphate hydrolysis (PMID: 3041962 ). It is a major regulator of apoptotic signalling driving calcium (Ca2+) transients from the endoplasmic reticulum to mitochondria, thereby establishing a functional and physical link between these organelles. It also regulates autophagy through the interaction with Beclin 1 complex, and in particular, its inhibition/depletion strongly induces macroautophagy (PMID: 19325567 ). In addition, recent evidence suggests that the penetrating sperm delivers into mammalian eggs a novel isoform of phospholipase C (PLC), which promotes the formation of inositol 1,4,5-trisphosphate (PMID: 15362223 ).
Structure
Data?1589558375
Synonyms
ValueSource
1,4,5-Insp3ChEBI
D-Myo-inositol 1,4,5-trisphosphateChEBI
D-MYO-inositol-1,4,5-triphosphATEChEBI
Ins(1,4,5)P3ChEBI
InsP3ChEBI
IP3ChEBI
1D-Myo-inositol 1,4,5-trisphosphateKegg
D-Myo-inositol 1,4,5-trisphosphoric acidGenerator
D-MYO-inositol-1,4,5-triphosphoric acidGenerator
1D-Myo-inositol 1,4,5-trisphosphoric acidGenerator
Inositol 1,4,5-trisphosphoric acidGenerator
Myo-inositol 1,4,5-trisphosphateHMDB
1,4,5-IP3HMDB
Inositol 1,4,5-triphosphateHMDB
Myoinositol 1,4,5-triphosphateHMDB
D-myo-Inositol 1,4,5-triphosphateHMDB
IP 3HMDB
Inositol 1,4,5-trisphosphateHMDB
Inositol triphosphateHMDB
Inositol trisphosphateHMDB
TriphosphoinositolHMDB
myo-Inositol 1,4,5-triphosphateHMDB
myo-Inositol triphosphateHMDB
myo-Inositol trisphosphateHMDB
Chemical FormulaC6H15O15P3
Average Molecular Weight420.0956
Monoisotopic Molecular Weight419.962379346
IUPAC Name{[(1R,2S,3R,4R,5S,6R)-2,3,5-trihydroxy-4,6-bis(phosphonooxy)cyclohexyl]oxy}phosphonic acid
Traditional NameInsP3
CAS Registry Number85166-31-0
SMILES
O[C@@H]1[C@H](O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](O)[C@@H]1OP(O)(O)=O
InChI Identifier
InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2+,3+,4-,5-,6-/m1/s1
InChI KeyMMWCIQZXVOZEGG-XJTPDSDZSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as inositol phosphates. Inositol phosphates are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassAlcohols and polyols
Direct ParentInositol phosphates
Alternative Parents
Substituents
  • Inositol phosphate
  • Monoalkyl phosphate
  • Cyclohexanol
  • Alkyl phosphate
  • Phosphoric acid ester
  • Organic phosphoric acid derivative
  • Secondary alcohol
  • Polyol
  • Organic oxide
  • Hydrocarbon derivative
  • Aliphatic homomonocyclic compound
Molecular FrameworkAliphatic homomonocyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
Biological locationSource
Process
Naturally occurring process
Role
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility14.8 g/LALOGPS
logP-0.86ALOGPS
logP-4.2ChemAxon
logS-1.4ALOGPS
pKa (Strongest Acidic)0.54ChemAxon
pKa (Strongest Basic)-3.7ChemAxon
Physiological Charge-6ChemAxon
Hydrogen Acceptor Count12ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area260.97 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity68.39 m³·mol⁻¹ChemAxon
Polarizability29.61 ųChemAxon
Number of Rings1ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+189.99231661259
DarkChem[M-H]-182.80331661259
AllCCS[M+H]+183.15732859911
AllCCS[M-H]-168.56432859911
DeepCCS[M+H]+158.03530932474
DeepCCS[M-H]-155.63830932474
DeepCCS[M-2H]-188.52130932474
DeepCCS[M+Na]+164.19230932474
AllCCS[M+H]+183.232859911
AllCCS[M+H-H2O]+180.832859911
AllCCS[M+NH4]+185.332859911
AllCCS[M+Na]+186.032859911
AllCCS[M-H]-168.632859911
AllCCS[M+Na-2H]-168.532859911
AllCCS[M+HCOO]-168.632859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
myo-Inositol 1,4,5-trisphosphateO[C@@H]1[C@H](O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](O)[C@@H]1OP(O)(O)=O3125.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphateO[C@@H]1[C@H](O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](O)[C@@H]1OP(O)(O)=O2687.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphateO[C@@H]1[C@H](O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](O)[C@@H]1OP(O)(O)=O3536.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O2878.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2881.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2890.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #4C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O)O2988.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #5C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@H]1OP(=O)(O)O2987.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,1TMS,isomer #6C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O2985.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #1C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2846.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2919.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2917.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2918.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #13C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O)O)O[Si](C)(C)C2954.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #14C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1O3008.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #15C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3005.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #16C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@H]1OP(=O)(O)O)O[Si](C)(C)C2958.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #17C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O3009.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #18C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O)O[Si](C)(C)C2955.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2852.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #3C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O2910.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2910.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2910.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2848.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #7C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2912.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2912.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,2TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2914.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2820.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2933.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #11C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2904.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2932.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2904.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2867.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2868.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2870.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2905.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2935.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2940.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C2866.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2907.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2938.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2913.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #23C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2919.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #24C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2948.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #25C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2951.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #26C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2919.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #27C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2948.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #28C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2921.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #29C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O3002.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2861.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #30C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3000.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #31C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O)O3001.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #32C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1O3034.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #33C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3002.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #34C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O3009.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #35C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]1OP(=O)(O)O3004.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2865.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2866.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2866.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #7C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2870.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #8C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O2905.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,3TMS,isomer #9C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2934.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2859.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O3019.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O4507.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2869.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O3067.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #10C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O4371.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2901.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3037.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #11C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4382.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2903.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3038.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #12C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4382.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2872.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3065.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #13C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4369.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2904.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3037.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4382.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2874.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3065.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4367.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2919.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O3098.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O4244.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2918.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O3097.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O4244.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2921.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O3097.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O4244.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2956.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O3064.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O4264.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2859.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3018.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4506.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2920.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3097.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O4245.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2922.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O3097.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O4245.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2922.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3097.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O4245.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2872.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O3079.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O4377.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2905.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3048.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4387.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2907.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4388.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2872.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3077.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4370.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2907.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4386.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2876.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3077.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4373.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2924.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3098.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4254.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2858.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3018.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4506.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2925.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3096.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4255.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2928.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3097.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4252.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2965.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3061.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4271.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2930.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3094.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4251.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2931.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3097.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4252.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2931.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3096.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4250.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2926.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3092.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4303.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2926.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3091.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4303.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2927.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3092.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4303.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2965.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3058.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4321.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2904.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3048.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #4C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4383.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2928.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3091.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4300.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2929.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3091.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4303.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2929.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3091.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4300.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O)O[Si](C)(C)C2958.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O)O[Si](C)(C)C3151.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #43C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O)O[Si](C)(C)C4165.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O3004.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O3096.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #44C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O4185.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C2965.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3148.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #45C[Si](C)(C)OP(=O)(O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4165.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3004.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C3097.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O)O[Si](C)(C)C4185.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1O3009.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1O3097.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H]1O4185.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O)O[Si](C)(C)C2967.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O)O[Si](C)(C)C3152.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #48C[Si](C)(C)OP(=O)(O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@H]1O)O[Si](C)(C)C4164.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C2902.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C3045.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C4384.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2871.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3076.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4369.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2870.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3075.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4371.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2902.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3045.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4383.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2872.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3077.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,4TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4368.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O2885.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O3019.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O4219.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C2931.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C3042.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C4119.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2929.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3043.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4117.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2933.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3042.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4119.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2930.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3043.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #13C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4116.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2924.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3031.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4117.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2925.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3033.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #15C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4117.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2927.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3030.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #16C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4116.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2962.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3006.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #17C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4135.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2927.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3033.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #18C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4115.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2930.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3030.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #19C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4116.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2916.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2994.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #2C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4231.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2927.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3031.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #20C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4114.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O2948.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O3094.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #21C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@H]1O3996.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2978.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O3058.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #22C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O4017.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2948.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3093.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #23C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3996.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O2978.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O3058.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #24C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H]1O4018.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2979.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3058.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #25C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O4018.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O2949.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3093.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #26C[Si](C)(C)O[C@H]1[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O3996.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2928.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3046.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #27C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4121.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C2932.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C3047.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #28C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O[Si](C)(C)C4123.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2929.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3046.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #29C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4116.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C2916.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C2994.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O)O[Si](C)(C)C4231.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2964.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3021.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #30C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4138.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2934.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3047.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #31C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4120.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2931.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3047.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #32C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4116.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2932.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3047.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4118.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2954.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3089.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4004.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2985.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3054.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #35C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4025.9Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2955.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3090.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4003.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2990.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3054.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #37C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4024.1Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2990.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3053.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4023.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2961.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3092.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #39C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4001.3Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2885.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3017.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4217.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2932.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3086.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4056.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2963.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3052.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4075.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2933.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3088.6Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4053.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2965.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3052.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4075.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2964.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3051.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4073.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2933.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3087.4Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4054.0Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2992.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3096.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #46C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3956.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O2996.6Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O3096.5Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #47C[Si](C)(C)OP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]1O3956.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2994.9Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3097.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #48C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3956.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2916.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2993.0Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4230.7Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2885.5Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3017.2Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O4218.2Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2930.2Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3047.1Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4116.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2964.0Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3017.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C4136.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2930.3Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3046.9Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,5TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4116.4Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O2927.1Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3008.7Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #1C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O3983.8Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C2970.8Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3021.8Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1OP(=O)(O)O[Si](C)(C)C3908.5Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2969.4Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3022.3Standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](OP(=O)(O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)O[Si](C)(C)C)[C@@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3907.6Standard polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@H]1OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C2938.7Semi standard non polar33892256
myo-Inositol 1,4,5-trisphosphate,6TMS,isomer #12