Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (132)transporters (1) Show 133 proteins XML

enzymes (132)transporters (1) Show 133 proteins

Record Information

Version

5.0

Status

Detected and Quantified

Creation Date

2008-09-12 01:16:37 UTC

Update Date

2022-03-07 02:49:40 UTC

HMDB ID

HMDB0007225

Secondary Accession Numbers

HMDB07225

Metabolite Identification

Common Name

DG(18:1(9Z)/20:2(11Z,14Z)/0:0)

Description

DG(18:1(9Z)/20:2(11Z,14Z)/0:0) is a diglyceride, or a diacylglycerol (DAG). It is a glyceride consisting of two fatty acid chains covalently bonded to a glycerol molecule through ester linkages. Diacylglycerols can have many different combinations of fatty acids attached at both the C-1 and C-2 positions. DG(18:1(9Z)/20:2(11Z,14Z)/0:0), in particular, consists of one chain of oleic acid at the C-1 position and one chain of eicosadienoic acid at the C-2 position. The oleic acid moiety is derived from vegetable oils, especially olive and canola oil, while the eicosadienoic acid moiety is derived from fish oils and liver. Mono- and diacylglycerols are common food additives used to blend together certain ingredients, such as oil and water, which would not otherwise blend well. Dacylglycerols are often found in bakery products, beverages, ice cream, chewing gum, shortening, whipped toppings, margarine, and confections. Synthesis of diacylglycerol begins with glycerol-3-phosphate, which is derived primarily from dihydroxyacetone phosphate, a product of glycolysis (usually in the cytoplasm of liver or adipose tissue cells). Glycerol-3-phosphate is first acylated with acyl-coenzyme A (acyl-CoA) to form lysophosphatidic acid, which is then acylated with another molecule of acyl-CoA to yield phosphatidic acid. Phosphatidic acid is then de-phosphorylated to form diacylglycerol.Diacylglycerols are precursors to triacylglycerols (triglyceride), which are formed by the addition of a third fatty acid to the diacylglycerol under the catalysis of diglyceride acyltransferase. Since diacylglycerols are synthesized via phosphatidic acid, they will usually contain a saturated fatty acid at the C-1 position on the glycerol moiety and an unsaturated fatty acid at the C-2 position.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02231221112D          

 47 46  0  0  1  0            999 V2000
   19.4288   -3.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1433   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8578   -3.3547    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5723   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2867   -3.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3607   -4.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4828   -4.1350    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5682   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2827   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9972   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7116   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4261   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1406   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8551   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5696   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2841   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9985   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7130   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4275   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1420   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8565   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5709   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2854   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9999   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7143   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7143   -2.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0712   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7857   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5002   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2147   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9291   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6436   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3581   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0726   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7871   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5015   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2160   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9305   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6449   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3594   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0739   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7884   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5029   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2173   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9318   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6463   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6463   -5.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  3  6  1  6  0  0  0
  3  7  1  1  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
  1 25  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  2  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46  6  1  0  0  0  0
 46 47  2  0  0  0  0
M  END

HMDB0007225
     RDKit          3D
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)
120119  0  0  0  0  0  0  0  0999 V2000
   12.5245   -5.5588   -0.6352 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5336   -4.6325    0.5338 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807   -3.1748    0.1090 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6757   -2.8473   -0.7594 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6458   -1.3813   -1.1901 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6753   -0.4823   -0.0302 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7268    0.3749    0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5266    0.5204   -0.5775 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2801    0.2372    0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3719    1.1700    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4211    2.5312   -0.1761 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2741    2.8293   -1.1195 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.6241   -0.4334 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7251    3.4588    0.7797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3676    3.1959    1.3920 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2223    3.5166    0.4634 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9101    3.2222    1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    3.5332    0.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5536    2.8093   -0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4578    1.3291   -0.8032 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4581    0.5910   -1.0030 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2680    0.7079   -0.4673 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0608   -0.6641   -0.3394 C   0  0  1  0  0  0  0  0  0  0  0  0
   -0.1721   -1.1021    1.1153 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3727   -2.4661    1.1914 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9559   -1.2566   -1.2530 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2437   -0.7357   -1.1851 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6423    0.5390   -1.4707 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7538    1.3709   -1.8512 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0512    1.0521   -1.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0487    1.9886   -0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7056    1.3294    1.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5071    0.2007    1.5889 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9389    0.3876    1.9121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8848    0.7578    0.8435 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3121    0.9092    1.4238 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1886    1.2820    0.3267 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2205    0.6079   -0.0639 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6776   -0.6414    0.5341 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6792   -1.7508   -0.5385 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1817   -3.0170    0.0338 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.5988   -3.1137    0.4269 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6544   -3.1197   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0553   -2.0713   -1.4872 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6945   -0.8283   -1.0274 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0142    0.0826   -0.1009 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5318   -5.6360   -1.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8578   -5.1465   -1.4341 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2186   -6.5678   -0.3224 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7401   -4.8258    1.2827 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.4992   -4.7594    1.1068 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5287   -3.0073   -0.4488 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.5277   -2.5713    1.0381 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6149   -3.0571   -0.2152 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6398   -3.5186   -1.6384 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6818   -1.2495   -1.6703 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9640   -1.1740   -1.9930 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5763   -0.5585    0.6366 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8531    1.0112    1.1611 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5441    1.5357   -1.0024 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4747   -0.1506   -1.4622 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1299   -0.7751    0.6250 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4615    0.8907    0.9142 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2066    3.2023    0.7269 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3731    2.9149   -0.5407 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2860    2.1936   -2.0261 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3312    3.9175   -1.3926 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8754    1.5339   -0.1825 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1245    2.8417   -1.1667 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7652    4.5514    0.5721 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4526    3.2371    1.6159 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3260    2.1582    1.7647 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2964    3.8424    2.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2066    4.5738    0.1783 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2664    2.7997   -0.3843 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539    2.1423    1.4586 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8710    3.8036    2.1139 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8026    3.4063    1.0011 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7324    4.6481    0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4638    3.0144   -1.5440 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6710    3.1568   -1.4930 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0445   -1.1776   -0.6081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7648   -0.9004    1.7146 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9517   -0.5044    1.6146 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0327   -2.8758    2.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6391   -1.1753   -2.3333 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9355   -2.3676   -1.0714 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3181    1.6622   -2.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7512    0.2203   -1.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8372    2.7046   -0.1150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1133    2.6490   -0.4087 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8100    2.1550    1.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879    1.1238    1.1669 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0206   -0.1373    2.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3780   -0.7281    0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2920   -0.6012    2.3727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0317    1.1164    2.7818 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6494    1.6180    0.2290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9973   -0.1070    0.1188 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5005    0.0127    1.9835 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2420    1.7643    2.1400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9455    2.2201   -0.2121 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8052    0.9966   -0.9167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9376   -1.0333    1.2967 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6076   -0.5537    1.0746 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2379   -1.3209   -1.3796 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6184   -1.8381   -0.9066 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8450   -3.9155   -0.5698 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5647   -3.1743    0.9943 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7024   -4.1063    1.0013 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7954   -2.3769    1.2690 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6235   -3.3955    0.0277 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5912   -4.1374   -1.1726 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8617   -2.5569   -2.1840 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2911   -1.7979   -2.2715 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9095   -0.2211   -1.9770 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.7418   -1.0594   -0.6632 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0771    0.4668   -0.5127 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6936    0.9986    0.0048 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.9541   -0.3392    0.9242 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  2 50  1  0
  2 51  1  0
  3 52  1  0
  3 53  1  0
  4 54  1  0
  4 55  1  0
  5 56  1  0
  5 57  1  0
  6 58  1  0
  7 59  1  0
  8 60  1  0
  8 61  1  0
  9 62  1  0
 10 63  1  0
 11 64  1  0
 11 65  1  0
 12 66  1  0
 12 67  1  0
 13 68  1  0
 13 69  1  0
 14 70  1  0
 14 71  1  0
 15 72  1  0
 15 73  1  0
 16 74  1  0
 16 75  1  0
 17 76  1  0
 17 77  1  0
 18 78  1  0
 18 79  1  0
 19 80  1  0
 19 81  1  0
 23 82  1  6
 24 83  1  0
 24 84  1  0
 25 85  1  0
 26 86  1  0
 26 87  1  0
 30 88  1  0
 30 89  1  0
 31 90  1  0
 31 91  1  0
 32 92  1  0
 32 93  1  0
 33 94  1  0
 33 95  1  0
 34 96  1  0
 34 97  1  0
 35 98  1  0
 35 99  1  0
 36100  1  0
 36101  1  0
 37102  1  0
 38103  1  0
 39104  1  0
 39105  1  0
 40106  1  0
 40107  1  0
 41108  1  0
 41109  1  0
 42110  1  0
 42111  1  0
 43112  1  0
 43113  1  0
 44114  1  0
 44115  1  0
 45116  1  0
 45117  1  0
 46118  1  0
 46119  1  0
 46120  1  0
M  END


  Mrv0541 02231221112D          

 47 46  0  0  1  0            999 V2000
   19.4288   -3.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1433   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8578   -3.3547    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5723   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2867   -3.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3607   -4.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4828   -4.1350    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5682   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2827   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9972   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7116   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4261   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1406   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8551   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5696   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2841   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9985   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7130   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4275   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1420   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8565   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5709   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2854   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9999   -3.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7143   -2.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7143   -2.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0712   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7857   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5002   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2147   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9291   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6436   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3581   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0726   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7871   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5015   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2160   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9305   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6449   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3594   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0739   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7884   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5029   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2173   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9318   -4.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6463   -4.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6463   -5.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  3  6  1  6  0  0  0
  3  7  1  1  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
  1 25  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  2  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46  6  1  0  0  0  0
 46 47  2  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0007225

> <DATABASE_NAME>
hmdb

> <SMILES>
[H][C@](CO)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCCCC\C=C/C\C=C/CCCCC

> <INCHI_IDENTIFIER>
InChI=1S/C41H74O5/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-41(44)46-39(37-42)38-45-40(43)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h11,13,17-19,21,39,42H,3-10,12,14-16,20,22-38H2,1-2H3/b13-11-,19-17-,21-18-/t39-/m0/s1

> <INCHI_KEY>
ADXAWIIUCSQOAS-SMJOZILHSA-N

> <FORMULA>
C41H74O5

> <MOLECULAR_WEIGHT>
647.0233

> <EXACT_MASS>
646.553625478

> <JCHEM_ACCEPTOR_COUNT>
3

> <JCHEM_AVERAGE_POLARIZABILITY>
83.9054652959293

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
1

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(2S)-1-hydroxy-3-[(9Z)-octadec-9-enoyloxy]propan-2-yl (11Z,14Z)-icosa-11,14-dienoate

> <ALOGPS_LOGP>
10.33

> <JCHEM_LOGP>
13.584740801999997

> <ALOGPS_LOGS>
-7.81

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA_STRONGEST_ACIDIC>
14.577784010572557

> <JCHEM_PKA_STRONGEST_BASIC>
-2.983477273775563

> <JCHEM_POLAR_SURFACE_AREA>
72.83

> <JCHEM_REFRACTIVITY>
198.6547

> <JCHEM_ROTATABLE_BOND_COUNT>
37

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.01e-05 g/l

> <JCHEM_TRADITIONAL_IUPAC>
diacylglycerol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0007225
     RDKit          3D
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)
120119  0  0  0  0  0  0  0  0999 V2000
   12.5245   -5.5588   -0.6352 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5336   -4.6325    0.5338 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807   -3.1748    0.1090 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6757   -2.8473   -0.7594 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6458   -1.3813   -1.1901 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6753   -0.4823   -0.0302 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7268    0.3749    0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5266    0.5204   -0.5775 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2801    0.2372    0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3719    1.1700    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4211    2.5312   -0.1761 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2741    2.8293   -1.1195 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.6241   -0.4334 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7251    3.4588    0.7797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3676    3.1959    1.3920 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2223    3.5166    0.4634 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9101    3.2222    1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    3.5332    0.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5536    2.8093   -0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4578    1.3291   -0.8032 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4581    0.5910   -1.0030 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2680    0.7079   -0.4673 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0608   -0.6641   -0.3394 C   0  0  1  0  0  0  0  0  0  0  0  0
   -0.1721   -1.1021    1.1153 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3727   -2.4661    1.1914 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9559   -1.2566   -1.2530 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2437   -0.7357   -1.1851 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6423    0.5390   -1.4707 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7538    1.3709   -1.8512 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0512    1.0521   -1.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0487    1.9886   -0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7056    1.3294    1.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5071    0.2007    1.5889 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9389    0.3876    1.9121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8848    0.7578    0.8435 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3121    0.9092    1.4238 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1886    1.2820    0.3267 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2205    0.6079   -0.0639 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6776   -0.6414    0.5341 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6792   -1.7508   -0.5385 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1817   -3.0170    0.0338 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.5988   -3.1137    0.4269 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6544   -3.1197   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0553   -2.0713   -1.4872 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6945   -0.8283   -1.0274 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0142    0.0826   -0.1009 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5318   -5.6360   -1.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8578   -5.1465   -1.4341 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2186   -6.5678   -0.3224 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7401   -4.8258    1.2827 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.4992   -4.7594    1.1068 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5287   -3.0073   -0.4488 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.5277   -2.5713    1.0381 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6149   -3.0571   -0.2152 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6398   -3.5186   -1.6384 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6818   -1.2495   -1.6703 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9640   -1.1740   -1.9930 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5763   -0.5585    0.6366 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8531    1.0112    1.1611 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5441    1.5357   -1.0024 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4747   -0.1506   -1.4622 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1299   -0.7751    0.6250 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4615    0.8907    0.9142 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2066    3.2023    0.7269 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3731    2.9149   -0.5407 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2860    2.1936   -2.0261 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3312    3.9175   -1.3926 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8754    1.5339   -0.1825 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1245    2.8417   -1.1667 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7652    4.5514    0.5721 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4526    3.2371    1.6159 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3260    2.1582    1.7647 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2964    3.8424    2.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2066    4.5738    0.1783 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2664    2.7997   -0.3843 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539    2.1423    1.4586 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8710    3.8036    2.1139 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8026    3.4063    1.0011 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7324    4.6481    0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4638    3.0144   -1.5440 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6710    3.1568   -1.4930 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0445   -1.1776   -0.6081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7648   -0.9004    1.7146 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9517   -0.5044    1.6146 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0327   -2.8758    2.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6391   -1.1753   -2.3333 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9355   -2.3676   -1.0714 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3181    1.6622   -2.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7512    0.2203   -1.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8372    2.7046   -0.1150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1133    2.6490   -0.4087 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8100    2.1550    1.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879    1.1238    1.1669 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0206   -0.1373    2.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3780   -0.7281    0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2920   -0.6012    2.3727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0317    1.1164    2.7818 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6494    1.6180    0.2290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9973   -0.1070    0.1188 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5005    0.0127    1.9835 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2420    1.7643    2.1400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9455    2.2201   -0.2121 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8052    0.9966   -0.9167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9376   -1.0333    1.2967 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6076   -0.5537    1.0746 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2379   -1.3209   -1.3796 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6184   -1.8381   -0.9066 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8450   -3.9155   -0.5698 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5647   -3.1743    0.9943 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7024   -4.1063    1.0013 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7954   -2.3769    1.2690 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6235   -3.3955    0.0277 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5912   -4.1374   -1.1726 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8617   -2.5569   -2.1840 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2911   -1.7979   -2.2715 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9095   -0.2211   -1.9770 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.7418   -1.0594   -0.6632 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0771    0.4668   -0.5127 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6936    0.9986    0.0048 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.9541   -0.3392    0.9242 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  2 50  1  0
  2 51  1  0
  3 52  1  0
  3 53  1  0
  4 54  1  0
  4 55  1  0
  5 56  1  0
  5 57  1  0
  6 58  1  0
  7 59  1  0
  8 60  1  0
  8 61  1  0
  9 62  1  0
 10 63  1  0
 11 64  1  0
 11 65  1  0
 12 66  1  0
 12 67  1  0
 13 68  1  0
 13 69  1  0
 14 70  1  0
 14 71  1  0
 15 72  1  0
 15 73  1  0
 16 74  1  0
 16 75  1  0
 17 76  1  0
 17 77  1  0
 18 78  1  0
 18 79  1  0
 19 80  1  0
 19 81  1  0
 23 82  1  6
 24 83  1  0
 24 84  1  0
 25 85  1  0
 26 86  1  0
 26 87  1  0
 30 88  1  0
 30 89  1  0
 31 90  1  0
 31 91  1  0
 32 92  1  0
 32 93  1  0
 33 94  1  0
 33 95  1  0
 34 96  1  0
 34 97  1  0
 35 98  1  0
 35 99  1  0
 36100  1  0
 36101  1  0
 37102  1  0
 38103  1  0
 39104  1  0
 39105  1  0
 40106  1  0
 40107  1  0
 41108  1  0
 41109  1  0
 42110  1  0
 42111  1  0
 43112  1  0
 43113  1  0
 44114  1  0
 44115  1  0
 45116  1  0
 45117  1  0
 46118  1  0
 46119  1  0
 46120  1  0
M  END

HEADER    PROTEIN                                 23-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   23-FEB-12         0                                  
HETATM    1  O   UNK     0      36.267  -6.262   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0      37.601  -5.492   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      38.935  -6.262   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      40.268  -5.492   0.000  0.00  0.00           C+0
HETATM    5  O   UNK     0      41.602  -6.262   0.000  0.00  0.00           O+0
HETATM    6  O   UNK     0      38.007  -7.691   0.000  0.00  0.00           O+0
HETATM    7  H   UNK     0      40.101  -7.719   0.000  0.00  0.00           H+0
HETATM    8  C   UNK     0      12.261  -5.492   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      13.594  -6.262   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      14.928  -5.492   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      16.262  -6.262   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      17.595  -5.492   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      18.929  -6.262   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      20.263  -5.492   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      21.597  -6.262   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      22.930  -5.492   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      24.264  -5.492   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      25.598  -6.262   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      26.931  -5.492   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      28.265  -6.262   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      29.599  -5.492   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      30.932  -6.262   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      32.266  -5.492   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      33.600  -6.262   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      34.933  -5.492   0.000  0.00  0.00           C+0
HETATM   26  O   UNK     0      34.933  -3.952   0.000  0.00  0.00           O+0
HETATM   27  C   UNK     0      11.333  -7.691   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      12.667  -8.461   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      14.000  -7.691   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      15.334  -8.461   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      16.668  -7.691   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      18.001  -8.461   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      19.335  -8.461   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      20.669  -7.691   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      22.003  -8.461   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      23.336  -8.461   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      24.670  -7.691   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      26.004  -8.461   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0      27.337  -7.691   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0      28.671  -8.461   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0      30.005  -7.691   0.000  0.00  0.00           C+0
HETATM   42  C   UNK     0      31.338  -8.461   0.000  0.00  0.00           C+0
HETATM   43  C   UNK     0      32.672  -7.691   0.000  0.00  0.00           C+0
HETATM   44  C   UNK     0      34.006  -8.461   0.000  0.00  0.00           C+0
HETATM   45  C   UNK     0      35.339  -7.691   0.000  0.00  0.00           C+0
HETATM   46  C   UNK     0      36.673  -8.461   0.000  0.00  0.00           C+0
HETATM   47  O   UNK     0      36.673 -10.001   0.000  0.00  0.00           O+0
CONECT    1    2   25                                                       
CONECT    2    1    3                                                       
CONECT    3    2    4    6    7                                             
CONECT    4    3    5                                                       
CONECT    5    4                                                            
CONECT    6    3   46                                                       
CONECT    7    3                                                            
CONECT    8    9                                                            
CONECT    9    8   10                                                       
CONECT   10    9   11                                                       
CONECT   11   10   12                                                       
CONECT   12   11   13                                                       
CONECT   13   12   14                                                       
CONECT   14   13   15                                                       
CONECT   15   14   16                                                       
CONECT   16   15   17                                                       
CONECT   17   16   18                                                       
CONECT   18   17   19                                                       
CONECT   19   18   20                                                       
CONECT   20   19   21                                                       
CONECT   21   20   22                                                       
CONECT   22   21   23                                                       
CONECT   23   22   24                                                       
CONECT   24   23   25                                                       
CONECT   25   24   26    1                                                  
CONECT   26   25                                                            
CONECT   27   28                                                            
CONECT   28   27   29                                                       
CONECT   29   28   30                                                       
CONECT   30   29   31                                                       
CONECT   31   30   32                                                       
CONECT   32   31   33                                                       
CONECT   33   32   34                                                       
CONECT   34   33   35                                                       
CONECT   35   34   36                                                       
CONECT   36   35   37                                                       
CONECT   37   36   38                                                       
CONECT   38   37   39                                                       
CONECT   39   38   40                                                       
CONECT   40   39   41                                                       
CONECT   41   40   42                                                       
CONECT   42   41   43                                                       
CONECT   43   42   44                                                       
CONECT   44   43   45                                                       
CONECT   45   44   46                                                       
CONECT   46   45    6   47                                                  
CONECT   47   46                                                            
MASTER        0    0    0    0    0    0    0    0   47    0   92    0
END

COMPND    HMDB0007225
HETATM    1  C1  UNL     1      12.524  -5.559  -0.635  1.00  0.00           C  
HETATM    2  C2  UNL     1      12.534  -4.633   0.534  1.00  0.00           C  
HETATM    3  C3  UNL     1      12.481  -3.175   0.109  1.00  0.00           C  
HETATM    4  C4  UNL     1      13.676  -2.847  -0.759  1.00  0.00           C  
HETATM    5  C5  UNL     1      13.646  -1.381  -1.190  1.00  0.00           C  
HETATM    6  C6  UNL     1      13.675  -0.482  -0.030  1.00  0.00           C  
HETATM    7  C7  UNL     1      12.727   0.375   0.251  1.00  0.00           C  
HETATM    8  C8  UNL     1      11.527   0.520  -0.577  1.00  0.00           C  
HETATM    9  C9  UNL     1      10.280   0.237   0.184  1.00  0.00           C  
HETATM   10  C10 UNL     1       9.372   1.170   0.333  1.00  0.00           C  
HETATM   11  C11 UNL     1       9.421   2.531  -0.176  1.00  0.00           C  
HETATM   12  C12 UNL     1       8.274   2.829  -1.120  1.00  0.00           C  
HETATM   13  C13 UNL     1       6.955   2.624  -0.433  1.00  0.00           C  
HETATM   14  C14 UNL     1       6.725   3.459   0.780  1.00  0.00           C  
HETATM   15  C15 UNL     1       5.368   3.196   1.392  1.00  0.00           C  
HETATM   16  C16 UNL     1       4.222   3.517   0.463  1.00  0.00           C  
HETATM   17  C17 UNL     1       2.910   3.222   1.171  1.00  0.00           C  
HETATM   18  C18 UNL     1       1.707   3.533   0.359  1.00  0.00           C  
HETATM   19  C19 UNL     1       1.554   2.809  -0.925  1.00  0.00           C  
HETATM   20  C20 UNL     1       1.458   1.329  -0.803  1.00  0.00           C  
HETATM   21  O1  UNL     1       2.458   0.591  -1.003  1.00  0.00           O  
HETATM   22  O2  UNL     1       0.268   0.708  -0.467  1.00  0.00           O  
HETATM   23  C21 UNL     1       0.061  -0.664  -0.339  1.00  0.00           C  
HETATM   24  C22 UNL     1      -0.172  -1.102   1.115  1.00  0.00           C  
HETATM   25  O3  UNL     1      -0.373  -2.466   1.191  1.00  0.00           O  
HETATM   26  C23 UNL     1      -0.956  -1.257  -1.253  1.00  0.00           C  
HETATM   27  O4  UNL     1      -2.244  -0.736  -1.185  1.00  0.00           O  
HETATM   28  C24 UNL     1      -2.642   0.539  -1.471  1.00  0.00           C  
HETATM   29  O5  UNL     1      -1.754   1.371  -1.851  1.00  0.00           O  
HETATM   30  C25 UNL     1      -4.051   1.052  -1.375  1.00  0.00           C  
HETATM   31  C26 UNL     1      -4.049   1.989  -0.184  1.00  0.00           C  
HETATM   32  C27 UNL     1      -3.706   1.329   1.096  1.00  0.00           C  
HETATM   33  C28 UNL     1      -4.507   0.201   1.589  1.00  0.00           C  
HETATM   34  C29 UNL     1      -5.939   0.388   1.912  1.00  0.00           C  
HETATM   35  C30 UNL     1      -6.885   0.758   0.844  1.00  0.00           C  
HETATM   36  C31 UNL     1      -8.312   0.909   1.424  1.00  0.00           C  
HETATM   37  C32 UNL     1      -9.189   1.282   0.327  1.00  0.00           C  
HETATM   38  C33 UNL     1     -10.221   0.608  -0.064  1.00  0.00           C  
HETATM   39  C34 UNL     1     -10.678  -0.641   0.534  1.00  0.00           C  
HETATM   40  C35 UNL     1     -10.679  -1.751  -0.539  1.00  0.00           C  
HETATM   41  C36 UNL     1     -11.182  -3.017   0.034  1.00  0.00           C  
HETATM   42  C37 UNL     1     -12.599  -3.114   0.427  1.00  0.00           C  
HETATM   43  C38 UNL     1     -13.654  -3.120  -0.578  1.00  0.00           C  
HETATM   44  C39 UNL     1     -14.055  -2.071  -1.487  1.00  0.00           C  
HETATM   45  C40 UNL     1     -14.694  -0.828  -1.027  1.00  0.00           C  
HETATM   46  C41 UNL     1     -14.014   0.083  -0.101  1.00  0.00           C  
HETATM   47  H1  UNL     1      13.532  -5.636  -1.088  1.00  0.00           H  
HETATM   48  H2  UNL     1      11.858  -5.146  -1.434  1.00  0.00           H  
HETATM   49  H3  UNL     1      12.219  -6.568  -0.322  1.00  0.00           H  
HETATM   50  H4  UNL     1      11.740  -4.826   1.283  1.00  0.00           H  
HETATM   51  H5  UNL     1      13.499  -4.759   1.107  1.00  0.00           H  
HETATM   52  H6  UNL     1      11.529  -3.007  -0.449  1.00  0.00           H  
HETATM   53  H7  UNL     1      12.528  -2.571   1.038  1.00  0.00           H  
HETATM   54  H8  UNL     1      14.615  -3.057  -0.215  1.00  0.00           H  
HETATM   55  H9  UNL     1      13.640  -3.519  -1.638  1.00  0.00           H  
HETATM   56  H10 UNL     1      14.682  -1.250  -1.670  1.00  0.00           H  
HETATM   57  H11 UNL     1      12.964  -1.174  -1.993  1.00  0.00           H  
HETATM   58  H12 UNL     1      14.576  -0.559   0.637  1.00  0.00           H  
HETATM   59  H13 UNL     1      12.853   1.011   1.161  1.00  0.00           H  
HETATM   60  H14 UNL     1      11.544   1.536  -1.002  1.00  0.00           H  
HETATM   61  H15 UNL     1      11.475  -0.151  -1.462  1.00  0.00           H  
HETATM   62  H16 UNL     1      10.130  -0.775   0.625  1.00  0.00           H  
HETATM   63  H17 UNL     1       8.462   0.891   0.914  1.00  0.00           H  
HETATM   64  H18 UNL     1       9.207   3.202   0.727  1.00  0.00           H  
HETATM   65  H19 UNL     1      10.373   2.915  -0.541  1.00  0.00           H  
HETATM   66  H20 UNL     1       8.286   2.194  -2.026  1.00  0.00           H  
HETATM   67  H21 UNL     1       8.331   3.917  -1.393  1.00  0.00           H  
HETATM   68  H22 UNL     1       6.875   1.534  -0.182  1.00  0.00           H  
HETATM   69  H23 UNL     1       6.125   2.842  -1.167  1.00  0.00           H  
HETATM   70  H24 UNL     1       6.765   4.551   0.572  1.00  0.00           H  
HETATM   71  H25 UNL     1       7.453   3.237   1.616  1.00  0.00           H  
HETATM   72  H26 UNL     1       5.326   2.158   1.765  1.00  0.00           H  
HETATM   73  H27 UNL     1       5.296   3.842   2.309  1.00  0.00           H  
HETATM   74  H28 UNL     1       4.207   4.574   0.178  1.00  0.00           H  
HETATM   75  H29 UNL     1       4.266   2.800  -0.384  1.00  0.00           H  
HETATM   76  H30 UNL     1       2.854   2.142   1.459  1.00  0.00           H  
HETATM   77  H31 UNL     1       2.871   3.804   2.114  1.00  0.00           H  
HETATM   78  H32 UNL     1       0.803   3.406   1.001  1.00  0.00           H  
HETATM   79  H33 UNL     1       1.732   4.648   0.170  1.00  0.00           H  
HETATM   80  H34 UNL     1       2.464   3.014  -1.544  1.00  0.00           H  
HETATM   81  H35 UNL     1       0.671   3.157  -1.493  1.00  0.00           H  
HETATM   82  H36 UNL     1       1.044  -1.178  -0.608  1.00  0.00           H  
HETATM   83  H37 UNL     1       0.765  -0.900   1.715  1.00  0.00           H  
HETATM   84  H38 UNL     1      -0.952  -0.504   1.615  1.00  0.00           H  
HETATM   85  H39 UNL     1       0.033  -2.876   2.000  1.00  0.00           H  
HETATM   86  H40 UNL     1      -0.639  -1.175  -2.333  1.00  0.00           H  
HETATM   87  H41 UNL     1      -0.936  -2.368  -1.071  1.00  0.00           H  
HETATM   88  H42 UNL     1      -4.318   1.662  -2.261  1.00  0.00           H  
HETATM   89  H43 UNL     1      -4.751   0.220  -1.293  1.00  0.00           H  
HETATM   90  H44 UNL     1      -4.837   2.705  -0.115  1.00  0.00           H  
HETATM   91  H45 UNL     1      -3.113   2.649  -0.409  1.00  0.00           H  
HETATM   92  H46 UNL     1      -3.810   2.155   1.889  1.00  0.00           H  
HETATM   93  H47 UNL     1      -2.588   1.124   1.167  1.00  0.00           H  
HETATM   94  H48 UNL     1      -4.021  -0.137   2.574  1.00  0.00           H  
HETATM   95  H49 UNL     1      -4.378  -0.728   0.946  1.00  0.00           H  
HETATM   96  H50 UNL     1      -6.292  -0.601   2.373  1.00  0.00           H  
HETATM   97  H51 UNL     1      -6.032   1.116   2.782  1.00  0.00           H  
HETATM   98  H52 UNL     1      -6.649   1.618   0.229  1.00  0.00           H  
HETATM   99  H53 UNL     1      -6.997  -0.107   0.119  1.00  0.00           H  
HETATM  100  H54 UNL     1      -8.500   0.013   1.983  1.00  0.00           H  
HETATM  101  H55 UNL     1      -8.242   1.764   2.140  1.00  0.00           H  
HETATM  102  H56 UNL     1      -8.945   2.220  -0.212  1.00  0.00           H  
HETATM  103  H57 UNL     1     -10.805   0.997  -0.917  1.00  0.00           H  
HETATM  104  H58 UNL     1      -9.938  -1.033   1.297  1.00  0.00           H  
HETATM  105  H59 UNL     1     -11.608  -0.554   1.075  1.00  0.00           H  
HETATM  106  H60 UNL     1     -11.238  -1.321  -1.380  1.00  0.00           H  
HETATM  107  H61 UNL     1      -9.618  -1.838  -0.907  1.00  0.00           H  
HETATM  108  H62 UNL     1     -10.845  -3.916  -0.570  1.00  0.00           H  
HETATM  109  H63 UNL     1     -10.565  -3.174   0.994  1.00  0.00           H  
HETATM  110  H64 UNL     1     -12.702  -4.106   1.001  1.00  0.00           H  
HETATM  111  H65 UNL     1     -12.795  -2.377   1.269  1.00  0.00           H  
HETATM  112  H66 UNL     1     -14.623  -3.396   0.028  1.00  0.00           H  
HETATM  113  H67 UNL     1     -13.591  -4.137  -1.173  1.00  0.00           H  
HETATM  114  H68 UNL     1     -14.862  -2.557  -2.184  1.00  0.00           H  
HETATM  115  H69 UNL     1     -13.291  -1.798  -2.271  1.00  0.00           H  
HETATM  116  H70 UNL     1     -14.909  -0.221  -1.977  1.00  0.00           H  
HETATM  117  H71 UNL     1     -15.742  -1.059  -0.663  1.00  0.00           H  
HETATM  118  H72 UNL     1     -13.077   0.467  -0.513  1.00  0.00           H  
HETATM  119  H73 UNL     1     -14.694   0.999   0.005  1.00  0.00           H  
HETATM  120  H74 UNL     1     -13.954  -0.339   0.924  1.00  0.00           H  
CONECT    1    2   47   48   49
CONECT    2    3   50   51
CONECT    3    4   52   53
CONECT    4    5   54   55
CONECT    5    6   56   57
CONECT    6    7    7   58
CONECT    7    8   59
CONECT    8    9   60   61
CONECT    9   10   10   62
CONECT   10   11   63
CONECT   11   12   64   65
CONECT   12   13   66   67
CONECT   13   14   68   69
CONECT   14   15   70   71
CONECT   15   16   72   73
CONECT   16   17   74   75
CONECT   17   18   76   77
CONECT   18   19   78   79
CONECT   19   20   80   81
CONECT   20   21   21   22
CONECT   22   23
CONECT   23   24   26   82
CONECT   24   25   83   84
CONECT   25   85
CONECT   26   27   86   87
CONECT   27   28
CONECT   28   29   29   30
CONECT   30   31   88   89
CONECT   31   32   90   91
CONECT   32   33   92   93
CONECT   33   34   94   95
CONECT   34   35   96   97
CONECT   35   36   98   99
CONECT   36   37  100  101
CONECT   37   38   38  102
CONECT   38   39  103
CONECT   39   40  104  105
CONECT   40   41  106  107
CONECT   41   42  108  109
CONECT   42   43  110  111
CONECT   43   44  112  113
CONECT   44   45  114  115
CONECT   45   46  116  117
CONECT   46  118  119  120
END

HMDB0007225
     RDKit          3D
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)
120119  0  0  0  0  0  0  0  0999 V2000
   12.5245   -5.5588   -0.6352 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5336   -4.6325    0.5338 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807   -3.1748    0.1090 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6757   -2.8473   -0.7594 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6458   -1.3813   -1.1901 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6753   -0.4823   -0.0302 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7268    0.3749    0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5266    0.5204   -0.5775 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2801    0.2372    0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3719    1.1700    0.3330 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4211    2.5312   -0.1761 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2741    2.8293   -1.1195 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9547    2.6241   -0.4334 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7251    3.4588    0.7797 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3676    3.1959    1.3920 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2223    3.5166    0.4634 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9101    3.2222    1.1707 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7074    3.5332    0.3592 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5536    2.8093   -0.9251 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4578    1.3291   -0.8032 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4581    0.5910   -1.0030 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2680    0.7079   -0.4673 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0608   -0.6641   -0.3394 C   0  0  1  0  0  0  0  0  0  0  0  0
   -0.1721   -1.1021    1.1153 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3727   -2.4661    1.1914 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9559   -1.2566   -1.2530 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2437   -0.7357   -1.1851 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6423    0.5390   -1.4707 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7538    1.3709   -1.8512 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0512    1.0521   -1.3749 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0487    1.9886   -0.1843 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7056    1.3294    1.0955 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5071    0.2007    1.5889 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9389    0.3876    1.9121 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8848    0.7578    0.8435 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3121    0.9092    1.4238 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1886    1.2820    0.3267 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2205    0.6079   -0.0639 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6776   -0.6414    0.5341 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6792   -1.7508   -0.5385 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1817   -3.0170    0.0338 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.5988   -3.1137    0.4269 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6544   -3.1197   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0553   -2.0713   -1.4872 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6945   -0.8283   -1.0274 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0142    0.0826   -0.1009 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5318   -5.6360   -1.0882 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8578   -5.1465   -1.4341 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2186   -6.5678   -0.3224 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7401   -4.8258    1.2827 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.4992   -4.7594    1.1068 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5287   -3.0073   -0.4488 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.5277   -2.5713    1.0381 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6149   -3.0571   -0.2152 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.6398   -3.5186   -1.6384 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6818   -1.2495   -1.6703 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9640   -1.1740   -1.9930 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5763   -0.5585    0.6366 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8531    1.0112    1.1611 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5441    1.5357   -1.0024 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4747   -0.1506   -1.4622 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1299   -0.7751    0.6250 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4615    0.8907    0.9142 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2066    3.2023    0.7269 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3731    2.9149   -0.5407 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2860    2.1936   -2.0261 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3312    3.9175   -1.3926 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8754    1.5339   -0.1825 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1245    2.8417   -1.1667 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7652    4.5514    0.5721 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4526    3.2371    1.6159 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3260    2.1582    1.7647 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2964    3.8424    2.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2066    4.5738    0.1783 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2664    2.7997   -0.3843 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8539    2.1423    1.4586 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8710    3.8036    2.1139 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8026    3.4063    1.0011 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7324    4.6481    0.1699 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4638    3.0144   -1.5440 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6710    3.1568   -1.4930 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0445   -1.1776   -0.6081 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7648   -0.9004    1.7146 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9517   -0.5044    1.6146 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0327   -2.8758    2.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6391   -1.1753   -2.3333 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9355   -2.3676   -1.0714 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3181    1.6622   -2.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7512    0.2203   -1.2926 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8372    2.7046   -0.1150 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1133    2.6490   -0.4087 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8100    2.1550    1.8888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879    1.1238    1.1669 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0206   -0.1373    2.5739 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3780   -0.7281    0.9462 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2920   -0.6012    2.3727 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0317    1.1164    2.7818 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6494    1.6180    0.2290 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9973   -0.1070    0.1188 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5005    0.0127    1.9835 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2420    1.7643    2.1400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9455    2.2201   -0.2121 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8052    0.9966   -0.9167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9376   -1.0333    1.2967 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6076   -0.5537    1.0746 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2379   -1.3209   -1.3796 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6184   -1.8381   -0.9066 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8450   -3.9155   -0.5698 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5647   -3.1743    0.9943 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7024   -4.1063    1.0013 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7954   -2.3769    1.2690 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6235   -3.3955    0.0277 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5912   -4.1374   -1.1726 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8617   -2.5569   -2.1840 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2911   -1.7979   -2.2715 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9095   -0.2211   -1.9770 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.7418   -1.0594   -0.6632 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0771    0.4668   -0.5127 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6936    0.9986    0.0048 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.9541   -0.3392    0.9242 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
  1 47  1  0
  1 48  1  0
  1 49  1  0
  2 50  1  0
  2 51  1  0
  3 52  1  0
  3 53  1  0
  4 54  1  0
  4 55  1  0
  5 56  1  0
  5 57  1  0
  6 58  1  0
  7 59  1  0
  8 60  1  0
  8 61  1  0
  9 62  1  0
 10 63  1  0
 11 64  1  0
 11 65  1  0
 12 66  1  0
 12 67  1  0
 13 68  1  0
 13 69  1  0
 14 70  1  0
 14 71  1  0
 15 72  1  0
 15 73  1  0
 16 74  1  0
 16 75  1  0
 17 76  1  0
 17 77  1  0
 18 78  1  0
 18 79  1  0
 19 80  1  0
 19 81  1  0
 23 82  1  6
 24 83  1  0
 24 84  1  0
 25 85  1  0
 26 86  1  0
 26 87  1  0
 30 88  1  0
 30 89  1  0
 31 90  1  0
 31 91  1  0
 32 92  1  0
 32 93  1  0
 33 94  1  0
 33 95  1  0
 34 96  1  0
 34 97  1  0
 35 98  1  0
 35 99  1  0
 36100  1  0
 36101  1  0
 37102  1  0
 38103  1  0
 39104  1  0
 39105  1  0
 40106  1  0
 40107  1  0
 41108  1  0
 41109  1  0
 42110  1  0
 42111  1  0
 43112  1  0
 43113  1  0
 44114  1  0
 44115  1  0
 45116  1  0
 45117  1  0
 46118  1  0
 46119  1  0
 46120  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Diglyceride	HMDB
DG(38:3)	HMDB
Diacylglycerol(38:3)	HMDB
DAG(18:1/20:2)	HMDB
DG(18:1/20:2)	HMDB
Diacylglycerol(18:1/20:2)	HMDB
Diacylglycerol	HMDB
1-Oleoyl-2-eicosadienoyl-sn-glycerol	HMDB
1-(9Z-Octadecenoyl)-2-(11Z,14Z-eicosadienoyl)-sn-glycerol	HMDB
DAG(38:3)	HMDB
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)	Lipid Annotator

Chemical Formula

C₄₁H₇₄O₅

Average Molecular Weight

647.0233

Monoisotopic Molecular Weight

646.553625478

IUPAC Name

(2S)-1-hydroxy-3-[(9Z)-octadec-9-enoyloxy]propan-2-yl (11Z,14Z)-icosa-11,14-dienoate

Traditional Name

diacylglycerol

CAS Registry Number

Not Available

SMILES

[H][C@](CO)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCCCC\C=C/C\C=C/CCCCC

InChI Identifier

InChI=1S/C41H74O5/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-41(44)46-39(37-42)38-45-40(43)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h11,13,17-19,21,39,42H,3-10,12,14-16,20,22-38H2,1-2H3/b13-11-,19-17-,21-18-/t39-/m0/s1

InChI Key

ADXAWIIUCSQOAS-SMJOZILHSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as 1,2-diacylglycerols. These are diacylglycerols containing a glycerol acylated at positions 1 and 2.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Glycerolipids

Sub Class

Diradylglycerols

Direct Parent

1,2-diacylglycerols

Alternative Parents

Substituents

1,2-acyl-sn-glycerol
Fatty acid ester
Fatty acyl
Dicarboxylic acid or derivatives
Carboxylic acid ester
Carboxylic acid derivative
Organic oxygen compound
Organic oxide
Hydrocarbon derivative
Primary alcohol
Organooxygen compound
Carbonyl group
Alcohol
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Diacylglycerols (LMGL02010100 )

Ontology

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.0e-05 g/L	ALOGPS
logP	10.33	ALOGPS
logP	13.58	ChemAxon
logS	-7.8	ALOGPS
pKa (Strongest Acidic)	14.58	ChemAxon
pKa (Strongest Basic)	-3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	3	ChemAxon
Hydrogen Donor Count	1	ChemAxon
Polar Surface Area	72.83 Å²	ChemAxon
Rotatable Bond Count	37	ChemAxon
Refractivity	198.65 m³·mol⁻¹	ChemAxon
Polarizability	83.91 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	265.542	31661259
DarkChem	[M-H]-	250.997	31661259
DeepCCS	[M+H]+	266.92	30932474
DeepCCS	[M-H]-	264.562	30932474
DeepCCS	[M-2H]-	297.448	30932474
DeepCCS	[M+Na]+	273.014	30932474
AllCCS	[M+H]+	268.6	32859911
AllCCS	[M+H-H2O]+	268.2	32859911
AllCCS	[M+NH4]+	268.9	32859911
AllCCS	[M+Na]+	269.0	32859911
AllCCS	[M-H]-	254.9	32859911
AllCCS	[M+Na-2H]-	261.2	32859911
AllCCS	[M+HCOO]-	268.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)	[H][C@](CO)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCCCC\C=C/C\C=C/CCCCC	4278.1	Standard polar	33892256
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)	[H][C@](CO)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCCCC\C=C/C\C=C/CCCCC	4163.5	Standard non polar	33892256
DG(18:1(9Z)/20:2(11Z,14Z)/0:0)	[H][C@](CO)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCCCC\C=C/C\C=C/CCCCC	4628.4	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
DG(18:1(9Z)/20:2(11Z,14Z)/0:0),1TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)CO[Si](C)(C)C	4608.3	Semi standard non polar	33892256
DG(18:1(9Z)/20:2(11Z,14Z)/0:0),1TBDMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)CO[Si](C)(C)C(C)(C)C	4862.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) GC-MS (TBDMS_1_1) - 70eV, Positive	Not Available	2021-10-17	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) GC-MS ("DG(18:1(9Z)/20:2(11Z,14Z)/0:0),1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-11-02	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 10V, Positive-QTOF	splash10-03di-0000009000-2259905083239ea1ecd7	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 20V, Positive-QTOF	splash10-0179-0009004000-debcc52d8bfb42e0b4f8	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 40V, Positive-QTOF	splash10-02tr-0009004000-b0a1506fd14d7f31b864	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 10V, Positive-QTOF	splash10-014i-0000009000-d37410aaac9880d0864d	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 20V, Positive-QTOF	splash10-014i-0000009000-d37410aaac9880d0864d	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 40V, Positive-QTOF	splash10-03e0-0009000000-153c2e36ac0bb46e3d78	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 10V, Positive-QTOF	splash10-0007-3194027000-e689d943f3759cb3bc88	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 20V, Positive-QTOF	splash10-0006-3393000000-98f05662ea842e96c189	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 40V, Positive-QTOF	splash10-00kf-7595000000-0e4561e04a748d892c9c	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 10V, Negative-QTOF	splash10-052b-2059008000-721cc8dedd4241cb30f6	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 20V, Negative-QTOF	splash10-06z9-5095001000-7c72f1df1d98098144e2	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 40V, Negative-QTOF	splash10-0a59-4193000000-0c1eb6da1eb32cbd0588	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 10V, Positive-QTOF	splash10-03di-0000009000-63265ec42c7a24551d59	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 20V, Positive-QTOF	splash10-0179-0009004000-b74dd3fff99d03171760	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - DG(18:1(9Z)/20:2(11Z,14Z)/0:0) 40V, Positive-QTOF	splash10-02tr-0009004000-25ac88be1660577b9c81	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular
Membrane

Biospecimen Locations

Blood

Tissue Locations

All Tissues

Pathways

Name	SMPDB/PathBank	KEGG
Phosphatidylcholine Biosynthesis PC(18:1(9Z)/20:2(11Z,14Z))		Not Available
Phosphatidylethanolamine Biosynthesis PE(18:1(9Z)/20:2(11Z,14Z))		Not Available
De Novo Triacylglycerol Biosynthesis TG(18:1(9Z)/20:2(11Z,14Z)/18:1(9Z))		Not Available
De Novo Triacylglycerol Biosynthesis TG(18:1(9Z)/20:2(11Z,14Z)/18:2(9Z,12Z))		Not Available
De Novo Triacylglycerol Biosynthesis TG(18:1(9Z)/20:2(11Z,14Z)/18:3(6Z,9Z,12Z))		Not Available

Normal Concentrations

Biospecimen	Status	Value	Age	Sex	Condition	Reference	Details
Blood	Detected and Quantified	0.28 +/- 0.02 uM	Adult (>18 years old)	Both	Normal	20671299	details

Abnormal Concentrations

Not Available

Predicted Concentrations

Biospecimen	Value	Original age	Original sex	Original condition	Comments
Blood	0.016 +/- 0.014 uM	Adult (>18 years old)	Both	Normal (Most Probable)	Calculated using MetaboAnalyst
Blood	0.100 +/- 0.100 uM	Adult (>18 years old)	Both	Normal (Upper Limit)	Calculated using MetaboAnalyst

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB024418

KNApSAcK ID

Not Available

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

9543766

PDB ID

Not Available

ChEBI ID

89222

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Not Available

Only showing the first 10 proteins. There are 133 proteins in total.

Show all enzymes and transporters

Enzymes

Enzyme Details

1. Diacylglycerol kinase theta

General function:: Involved in diacylglycerol kinase activity
Specific function:: Phosphorylates diacylglycerol (DAG) to generate phosphatidic acid (PA). May regulate the activity of protein kinase C by controlling the balance between these two signaling lipids. Activated in the nucleus in response to alpha-thrombin and nerve growth factor. May be involved in cAMP- induced activation of NR5A1 and subsequent steroidogenic gene transcription by delivering PA as ligand for NR5A1. Acts synergistically with NR5A1 on CYP17 transcriptional activity
Gene Name:: DGKQ
Uniprot ID:: P52824
Molecular weight:: 101154.0

Enzyme Details

2. Pancreatic triacylglycerol lipase

General function:: Involved in catalytic activity
Specific function:: Not Available
Gene Name:: PNLIP
Uniprot ID:: P16233
Molecular weight:: 51156.48

Enzyme Details

3. 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1

General function:: Involved in calcium ion binding
Specific function:: The production of the second messenger molecules diacylglycerol (DAG) and inositol 1,4,5-trisphosphate (IP3) is mediated by activated phosphatidylinositol-specific phospholipase C enzymes.
Gene Name:: PLCB1
Uniprot ID:: Q9NQ66
Molecular weight:: 138565.805

Enzyme Details

4. 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4

General function:: Involved in calcium ion binding
Specific function:: The production of the second messenger molecules diacylglycerol (DAG) and inositol 1,4,5-trisphosphate (IP3) is mediated by activated phosphatidylinositol-specific phospholipase C enzymes. This form has a role in retina signal transduction.
Gene Name:: PLCB4
Uniprot ID:: Q15147
Molecular weight:: 136105.065

Enzyme Details

5. 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-2

General function:: Involved in calcium ion binding
Specific function:: The production of the second messenger molecules diacylglycerol (DAG) and inositol 1,4,5-trisphosphate (IP3) is mediated by activated phosphatidylinositol-specific phospholipase C enzymes.
Gene Name:: PLCB2
Uniprot ID:: Q00722
Molecular weight:: 134023.21

Enzyme Details

6. Diacylglycerol kinase gamma

General function:: Involved in diacylglycerol kinase activity
Specific function:: Reverses the normal flow of glycerolipid biosynthesis by phosphorylating diacylglycerol back to phosphatidic acid
Gene Name:: DGKG
Uniprot ID:: P49619
Molecular weight:: 89095.3

Enzyme Details

7. Hepatic triacylglycerol lipase

General function:: Involved in catalytic activity
Specific function:: Hepatic lipase has the capacity to catalyze hydrolysis of phospholipids, mono-, di-, and triglycerides, and acyl-CoA thioesters. It is an important enzyme in HDL metabolism. Hepatic lipase binds heparin.
Gene Name:: LIPC
Uniprot ID:: P11150
Molecular weight:: 55914.1

Enzyme Details

8. Lysosomal acid lipase/cholesteryl ester hydrolase

General function:: Involved in lipid metabolic process
Specific function:: Crucial for the intracellular hydrolysis of cholesteryl esters and triglycerides that have been internalized via receptor-mediated endocytosis of lipoprotein particles. Important in mediating the effect of LDL (low density lipoprotein) uptake on suppression of hydroxymethylglutaryl-CoA reductase and activation of endogenous cellular cholesteryl ester formation.
Gene Name:: LIPA
Uniprot ID:: P38571
Molecular weight:: 45418.71

Enzyme Details

9. 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-3

General function:: Involved in calcium ion binding
Specific function:: The production of the second messenger molecules diacylglycerol (DAG) and inositol 1,4,5-trisphosphate (IP3) is mediated by activated phosphatidylinositol-specific phospholipase C enzymes.
Gene Name:: PLCB3
Uniprot ID:: Q01970
Molecular weight:: 138797.725

Enzyme Details

10. Inactive pancreatic lipase-related protein 1

General function:: Involved in catalytic activity
Specific function:: May function as inhibitor of dietary triglyceride digestion. Lacks detectable lipase activity towards triglycerides, diglycerides, phosphatidylcholine, galactolipids or cholesterol esters (in vitro) (By similarity).
Gene Name:: PNLIPRP1
Uniprot ID:: P54315
Molecular weight:: Not Available

Transporters

Enzyme Details

1. Long-chain fatty acid transport protein 1

General function:: Lipid transport and metabolism
Specific function:: Involved in translocation of long-chain fatty acids (LFCA) across the plasma membrane. The LFCA import appears to be hormone-regulated in a tissue-specific manner. In adipocytes, but not myocytes, insulin induces a rapid translocation of FATP1 from intracellular compartments to the plasma membrane, paralleled by increased LFCA uptake. May act directly as a bona fide transporter, or alternatively, in a cytoplasmic or membrane- associated multimeric protein complex to trap and draw fatty acids towards accumulation. Plays a pivotal role in regulating available LFCA substrates from exogenous sources in tissues undergoing high levels of beta-oxidation or triglyceride synthesis. May be involved in regulation of cholesterol metabolism. Has acyl-CoA ligase activity for long-chain and very-long-chain fatty acids
Gene Name:: SLC27A1
Uniprot ID:: Q6PCB7
Molecular weight:: 71107.5

Only showing the first 10 proteins. There are 133 proteins in total.

Show all enzymes and transporters

Showing metabocard for DG(18:1(9Z)/20:2(11Z,14Z)/0:0) (HMDB0007225)

MOL for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

3D MOL for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

3D SDF for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

3D-SDF for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

PDB for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

3D PDB for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

SMILES for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

INCHI for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

Structure for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

3D Structure for HMDB0007225 (DG(18:1(9Z)/20:2(11Z,14Z)/0:0))

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

Enzymes

Transporters